Merge m-i to m-c, a=merge
authorPhil Ringnalda <philringnalda@gmail.com>
Sun, 08 Feb 2015 17:40:44 -0800
changeset 228058 3436787a82d0e1f7c4b43d8ec7b9b0be2f00bd04
parent 228053 50ea2cac6d648cf852c322dd7d050467c7bf8dd5 (current diff)
parent 228057 bc48a81f3f7b70d5a893db0de5dddcc5247099e1 (diff)
child 228060 27cc693dca336823168ad58e9352c72b7cfb3ab9
child 228121 126a1ec5c7c53ab6145c1bf9371ad3fabc105d8c
child 228272 cdad12abafc4b589bfde4912f50862342a7112e2
push id28256
push userphilringnalda@gmail.com
push dateMon, 09 Feb 2015 01:41:15 +0000
treeherdermozilla-central@3436787a82d0 [default view] [failures only]
perfherder[talos] [build metrics] [platform microbench] (compared to previous push)
reviewersmerge
milestone38.0a1
first release with
nightly linux32
3436787a82d0 / 38.0a1 / 20150209030204 / files
nightly linux64
3436787a82d0 / 38.0a1 / 20150209030204 / files
nightly mac
3436787a82d0 / 38.0a1 / 20150209030204 / files
nightly win32
3436787a82d0 / 38.0a1 / 20150209030204 / files
nightly win64
3436787a82d0 / 38.0a1 / 20150209030204 / files
last release without
nightly linux32
nightly linux64
nightly mac
nightly win32
nightly win64
releases
nightly linux32
nightly linux64
nightly mac
nightly win32
nightly win64
Merge m-i to m-c, a=merge
--- a/browser/extensions/shumway/content/ShumwayBootstrapUtils.jsm
+++ b/browser/extensions/shumway/content/ShumwayBootstrapUtils.jsm
@@ -48,17 +48,18 @@ function getStringPref(pref, def) {
   try {
     return Services.prefs.getComplexValue(pref, Ci.nsISupportsString).data;
   } catch (ex) {
     return def;
   }
 }
 
 function log(str) {
-  dump(str + '\n');
+  var msg = 'ShumwayBootstrapUtils.jsm: ' + str;
+  Services.console.logStringMessage(msg);
 }
 
 // Register/unregister a constructor as a factory.
 function Factory() {}
 Factory.prototype = {
   register: function register(targetConstructor) {
     var proto = targetConstructor.prototype;
     this._classID = proto.classID;
@@ -75,25 +76,46 @@ Factory.prototype = {
     var registrar = Cm.QueryInterface(Ci.nsIComponentRegistrar);
     registrar.unregisterFactory(this._classID, this._factory);
   }
 };
 
 let converterFactory = new Factory();
 let overlayConverterFactory = new Factory();
 
+function allowedPlatformForMedia() {
+  var oscpu = Cc["@mozilla.org/network/protocol;1?name=http"]
+                .getService(Ci.nsIHttpProtocolHandler).oscpu;
+  if (oscpu.indexOf('Windows NT') === 0) {
+    return oscpu.indexOf('Windows NT 5') < 0; // excluding Windows XP
+  }
+  if (oscpu.indexOf('Intel Mac OS X') === 0) {
+    return true;
+  }
+  // Other platforms are not supported yet.
+  return false;
+}
+
 var ShumwayBootstrapUtils = {
   register: function () {
     // Register the components.
     converterFactory.register(ShumwayStreamConverter);
     overlayConverterFactory.register(ShumwayStreamOverlayConverter);
 
     if (registerOverlayPreview) {
       var ignoreCTP = getBoolPref(PREF_IGNORE_CTP, true);
-      var whitelist = getStringPref(PREF_WHITELIST); 
+      var whitelist = getStringPref(PREF_WHITELIST);
+      // Some platforms cannot support video playback, and our whitelist targets
+      // only video players atm. We need to disable Shumway for those platforms.
+      if (whitelist && !Services.prefs.prefHasUserValue(PREF_WHITELIST) &&
+          !allowedPlatformForMedia()) {
+        log('Default SWF whitelist is used on an unsupported platform -- ' +
+            'using demo whitelist.');
+        whitelist = 'http://www.areweflashyet.com/*.swf';
+      }
       Ph.registerPlayPreviewMimeType(SWF_CONTENT_TYPE, ignoreCTP,
                                      undefined, whitelist);
     }
   },
 
   unregister: function () {
     // Remove the contract/component.
     converterFactory.unregister();
--- a/browser/extensions/shumway/content/ShumwayStreamConverter.jsm
+++ b/browser/extensions/shumway/content/ShumwayStreamConverter.jsm
@@ -215,38 +215,50 @@ function isShumwayEnabledFor(actions) {
   }
 
   return true;
 }
 
 function getVersionInfo() {
   var deferred = Promise.defer();
   var versionInfo = {
-    version: 'unknown',
+    geckoVersion: 'unknown',
     geckoBuildID: 'unknown',
     shumwayVersion: 'unknown'
   };
   try {
     var appInfo = Components.classes["@mozilla.org/xre/app-info;1"]
         .getService(Components.interfaces.nsIXULAppInfo);
     versionInfo.geckoVersion = appInfo.version;
     versionInfo.geckoBuildID = appInfo.appBuildID;
   } catch (e) {
-    log('Error encountered while getting platform version info:', e);
+    log('Error encountered while getting platform version info: ' + e);
   }
-  try {
-    var addonId = "shumway@research.mozilla.org";
-    AddonManager.getAddonByID(addonId, function(addon) {
-      versionInfo.shumwayVersion = addon ? addon.version : 'n/a';
-      deferred.resolve(versionInfo);
-    });
-  } catch (e) {
-    log('Error encountered while getting Shumway version info:', e);
+  var xhr = Components.classes["@mozilla.org/xmlextras/xmlhttprequest;1"]
+    .createInstance(Ci.nsIXMLHttpRequest);
+  xhr.open('GET', 'resource://shumway/version.txt', true);
+  xhr.overrideMimeType('text/plain');
+  xhr.onload = function () {
+    try {
+      // Trying to merge version.txt lines into something like:
+      //   "version (sha) details"
+      var lines = xhr.responseText.split(/\n/g);
+      lines[1] = '(' + lines[1] + ')';
+      versionInfo.shumwayVersion = lines.join(' ');
+    } catch (e) {
+      log('Error while parsing version info: ' + e);
+    }
     deferred.resolve(versionInfo);
-  }
+  };
+  xhr.onerror = function () {
+    log('Error while reading version info: ' + xhr.error);
+    deferred.resolve(versionInfo);
+  };
+  xhr.send();
+
   return deferred.promise;
 }
 
 function fallbackToNativePlugin(window, userAction, activateCTP) {
   var obj = window.frameElement;
   var doc = obj.ownerDocument;
   var e = doc.createEvent("CustomEvent");
   e.initCustomEvent("MozPlayPlugin", true, true, activateCTP);
@@ -749,16 +761,17 @@ function activateShumwayScripts(window, 
       window.document.readyState === "complete") {
     initScripts();
   } else {
     window.document.addEventListener('DOMContentLoaded', initScripts);
   }
 }
 
 function initExternalCom(wrappedWindow, wrappedObject, targetWindow) {
+  var traceExternalInterface = getBoolPref('shumway.externalInterface.trace', false);
   if (!wrappedWindow.__flash__initialized) {
     wrappedWindow.__flash__initialized = true;
     wrappedWindow.__flash__toXML = function __flash__toXML(obj) {
       switch (typeof obj) {
       case 'boolean':
         return obj ? '<true/>' : '<false/>';
       case 'number':
         return '<number>' + obj + '</number>';
@@ -781,39 +794,42 @@ function initExternalCom(wrappedWindow, 
         return xml + '</object>';
       case 'string':
         return '<string>' + obj.replace(/&/g, '&amp;').replace(/</g, '&lt;').replace(/>/g, '&gt;') + '</string>';
       case 'undefined':
         return '<undefined/>';
       }
     };
     wrappedWindow.__flash__eval = function (expr) {
-      this.console.log('__flash__eval: ' + expr);
+      traceExternalInterface && this.console.log('__flash__eval: ' + expr);
       // allowScriptAccess protects page from unwanted swf scripts,
       // we can execute script in the page context without restrictions.
-      return this.eval(expr);
+      var result = this.eval(expr);
+      traceExternalInterface && this.console.log('__flash__eval (result): ' + result);
+      return result;
     }.bind(wrappedWindow);
     wrappedWindow.__flash__call = function (expr) {
-      this.console.log('__flash__call (ignored): ' + expr);
+      traceExternalInterface && this.console.log('__flash__call (ignored): ' + expr);
     };
   }
   wrappedObject.__flash__registerCallback = function (functionName) {
-    wrappedWindow.console.log('__flash__registerCallback: ' + functionName);
+    traceExternalInterface && wrappedWindow.console.log('__flash__registerCallback: ' + functionName);
     Components.utils.exportFunction(function () {
       var args = Array.prototype.slice.call(arguments, 0);
-      wrappedWindow.console.log('__flash__callIn: ' + functionName);
+      traceExternalInterface && wrappedWindow.console.log('__flash__callIn: ' + functionName);
       var result;
       if (targetWindow.wrappedJSObject.onExternalCallback) {
         result = targetWindow.wrappedJSObject.onExternalCallback({functionName: functionName, args: args});
+        traceExternalInterface && wrappedWindow.console.log('__flash__callIn (result): ' + result);
       }
       return wrappedWindow.eval(result);
     }, this, { defineAs: functionName });
   };
   wrappedObject.__flash__unregisterCallback = function (functionName) {
-    wrappedWindow.console.log('__flash__unregisterCallback: ' + functionName);
+    traceExternalInterface && wrappedWindow.console.log('__flash__unregisterCallback: ' + functionName);
     delete this[functionName];
   };
 }
 
 function ShumwayStreamConverterBase() {
 }
 
 ShumwayStreamConverterBase.prototype = {
@@ -904,17 +920,21 @@ ShumwayStreamConverterBase.prototype = {
         }
       }
     }
 
     if (!url) { // at this point url shall be known -- asserting
       throw new Error('Movie url is not specified');
     }
 
-    baseUrl = objectParams.base || pageUrl;
+    if (objectParams.base) {
+        baseUrl = Services.io.newURI(objectParams.base, null, pageUrl).spec;
+    } else {
+        baseUrl = pageUrl;
+    }
 
     var movieParams = {};
     if (objectParams.flashvars) {
       movieParams = parseQueryString(objectParams.flashvars);
     }
     var queryStringMatch = /\?([^#]+)/.exec(url);
     if (queryStringMatch) {
       var queryStringParams = parseQueryString(queryStringMatch[1]);
--- a/browser/extensions/shumway/content/ShumwayUtils.jsm
+++ b/browser/extensions/shumway/content/ShumwayUtils.jsm
@@ -12,16 +12,17 @@
  * See the License for the specific language governing permissions and
  * limitations under the License.
  */
 
 var EXPORTED_SYMBOLS = ["ShumwayUtils"];
 
 const PREF_PREFIX = 'shumway.';
 const PREF_DISABLED = PREF_PREFIX + 'disabled';
+const PREF_WHITELIST = PREF_PREFIX + 'swf.whitelist';
 
 let Cc = Components.classes;
 let Ci = Components.interfaces;
 let Cm = Components.manager;
 let Cu = Components.utils;
 
 Cu.import('resource://gre/modules/XPCOMUtils.jsm');
 Cu.import('resource://gre/modules/Services.jsm');
@@ -38,29 +39,43 @@ function log(str) {
   dump(str + '\n');
 }
 
 let ShumwayUtils = {
   QueryInterface: XPCOMUtils.generateQI([Ci.nsIObserver]),
   _registered: false,
 
   init: function init() {
+    this.migratePreferences();
     if (this.enabled)
       this._ensureRegistered();
     else
       this._ensureUnregistered();
 
     Cc["@mozilla.org/parentprocessmessagemanager;1"]
       .getService(Ci.nsIMessageBroadcaster)
       .addMessageListener('Shumway:Chrome:isEnabled', this);
 
     // Listen for when shumway is completely disabled.
     Services.prefs.addObserver(PREF_DISABLED, this, false);
   },
 
+  migratePreferences: function migratePreferences() {
+    // At one point we had shumway.disabled set to true by default,
+    // and we are trying to replace it with shumway.swf.whitelist:
+    // checking if the user already changed it before to reset
+    // the whitelist to '*'.
+    if (Services.prefs.prefHasUserValue(PREF_DISABLED) &&
+        !Services.prefs.prefHasUserValue(PREF_WHITELIST) &&
+        !getBoolPref(PREF_DISABLED, false)) {
+      // The user is already using Shumway -- enabling all web sites.
+      Services.prefs.setCharPref(PREF_WHITELIST, '*');
+    }
+  },
+
   // nsIObserver
   observe: function observe(aSubject, aTopic, aData) {
     if (this.enabled)
       this._ensureRegistered();
     else
       this._ensureUnregistered();
   },
 
index a4c393b8488ccb31bf179c57070026d215f7bc20..eb3040f1a2448ce1dd1dd47ca0537201433e131e
GIT binary patch
literal 187935
zc%0<DYi}e+mM9jHugJ`L7s=wgo3DPdq^7zxlBT86sG2NxSBp(@$fDG(nP%N0nblRR
zVimWl*i!Fev4a5yxWF}FFYH~w#<igf!xu2T{<Ma_`kO!bL$?I)7`AbJ{R{5b`$_F{
zPUN$y$nKVQW@q4*m=zfj85tRI;=JOV6KVD~gMXR%TC>`%zg;~%bh_QfL8IB|J-b~9
z-!XBg-EKP7miDyWI7-O+M~&`Dv-&KtCV#gM{>(Y-X{U`=&!`^u8c!Xo>$HxFPn}jT
zeR^_K?K#_>_KDN!HJt9qkXI%muQX(PMyrZVsfW#OHd4L{4Rj5i=aihDi%oE53q=)*
zCR9TxLMWzCETPy!iwh-TFs3lZl{rmOHH|A*xotB=nWJp@<4K-MbJL3HOk+&dvnn?-
znj$i~%5`q8amJa-I9E0G`O00!G|n~Mc)s$y#NbX>pk(Cvio+gTHERVg57}(pgrc+@
z;tMxkImD&olcsYFV+G&aZn0#m-Se}Yqu3LtSAnN@U>0bIy^PK3v19D^I*rzoxSRD^
zwR!4zH@ncDGwR-~IkoC(vsXC8S6Eo;G;z*wQe%zoM)d&hkM2D4X4{s%e&V!`tsSUX
zZ9Qo^DQIl9-e?|`)(V|Y^_foB7__$0KBUg4y?0aVkl}S^y?uDvoxq!}S5#;n*4v#@
z>&W@KuYf>^3bbzT^gwqyomM-GU(t?y$1qTuK4)k>z#`B|<)#62rU-O&f*Syrq)^jB
z$qHpcD3b_MiV?t*0+ka&$p~dcD5F9d6G}`dIiZXTZAK`w86Tz;1um+832rsK=mu01
zkN`NO1pX=-*791AKszyM>5QjMfHP)cmJN@@03PF<X$j8sBxgp7Gm+-Z%y4F9VJ(bs
z78~U(KE_!h$60cmvlO(I<`WucnGhuN2qeSXH9hfs<uT7|>zrR(V)tM<1epeA<`u})
zf=tuT)PqdRf7}Q%ZNH|#%ot_HFcaQwVpg285}0)bs#yy6@-mn=2YGhz=!pAhET}f>
zRf}VueC?Rumjo>TzSkzPp3KU*S*ajv+|5b{OMJ36xq=s5;uFCVPcFZ5i3jM9X{})0
z#*UosVW)9|z-e}2HS`Wodq%g>1c>!kVyxEg96GxVgk(Ssh0|V}Rx3O{4F1Q@c&`il
zI>A07&6tZc5%{BcQ$@U~MnTcCEsb%5;~f=gc+p{wnZS#Q7sRvN(xM2nAI$vGv}^VX
zUT`$6U^E4D2WN5EsFrq}YUi+CJ!m>*=j)!`rCUr68;n$6buGtDH3yhpa77Xf_zaGH
zWb{jE6+TPhxKQy1zJt>Us4BmUD}r;y#{SPeWOX&@w#ih$%~yx_nI;cA;N!*7VQ6r4
z7z!NrU8BRAlpkj>-TgS2SXJo$_eH)@gKtz_v_xO0aV_$lTI4&m;5#SAT^7LUe%WiE
z++J-qP7d1D&JjyQ3M{`sQVF6o?#%X4IMH=_Yt>%WgLoHIlWz9CYU`-!bj<bB7Ja99
zBJ(rtPUA_VRc&r}oEne_=g6v8yX)=FakU3@sO5C3O}`VOM)_U+5Z=(S=!%Vmn2e-f
znHUUQDQZrEm69P)(UHASg-}hQ!WxMQH6hfDP_sfE5$dQ=EnGM%QjnO(bI>m`8>%t~
zfTYX;zzIV!c`ODgQ>GN5X^=>9ZfGw37~{Ed&IK$vMcA<50OxCf^L4=a2H<=FINt=E
zZ^60*eudkd6Q3eN%T9?bJ44YVn$!V3>k`9?ATRFanTRE2UJ~=>2ooz_UfQc?2g_L0
z#0p+;8S?;6Qj2H6Nx4&Pbz#09w2z$Z)=ueeX|u3V+1@Fx7k74wYiw{@6Mn6&&5cKK
zuY9Z3e3n|>*xD=xPbUwX?Uv&|Y0F}K%%T!}#s$JCxQ-3&UkGWcxj29Vph(4I7c3<I
z00c@B5F-5V{c!^)jw7pRa2;4qL(vVc8mew`&Cqn1Ed{0;v7`diHT`^LA82l!?<;wu
zuI#IMv##!Id7D<<nb<Qt>_#x`vlq@7cDXLP@%4?u?mZf?(!=Nw7<6~rE|hlMa;@6v
z+)mTj7B^RmZf+8DX@s5Dp>un5x42U(Y?QtzluKKiZk;UF={lW8wb}R!;=OLi%EgD}
z%KFyMgF=~^Sl$Ed6}wk{u;J!XX1#aZOz)Id?^Qze1--IYv-fs3!da)CW_rD}QLJo~
zcD=d@ET{nqoohC_y~LeT`9WdZEwi!gpwT<7o=nhl+dEqiO1qKg$Nc9{I_={|SGMB<
zO}c+P1D0|eAS9;(jHDtkf{22+N<<WZC2~TY5bBiBriD5K&=P0<A5SEa-vg!w04Gj>
z6DPol6X3*c;2iaMf*XbrPjO+0c!ryX86V-6VFABq8+Lr0$BbBf5<x8CgIMuw5Zl-D
ziMqaT<WqHHU*t1&v2W%_>gK+cAFEsYc7D8W@5l0!_1Jm9n5-pN@PfdYaDfp~nKdIJ
z3>IU%)4g44Jq36;+WmaJh#4NCN5UBoS4{O))ae@GV00L0qfhK3zJ%CqllmsHu&SAw
zq<ad{a^y`k-Q`VGRX0rdpcmhk6!(*~N%|zcrmsBKY8qYOyJmf2Pak$M@?juq9e%m>
z)alfk?XS-Nw(MZtKmN}n9<|&!cG{=CSAE_<-9N6+Qx$00nvdu)ZcA}ecKtJ_(}kNv
zVHNS&?&?lyyL^*HZf}ts9@T}63~3`mJ`DNI0c$3|IZQY}^q`Lg@_>vdtbgb&e7NSX
z<P@&tB?VXVl3G{JTaz>daKSYh;@>jkeV_i>gLfXZpEewCN{LbPnJw+G+HA(EM@Osh
zdjOCd{c6j9JgN(FzdS`MAS|i&4(m?G0~O5ehFLGanUHSBoZz{HuiNp(6y&pPB)xiE
zcjc2gj?5N(yDC{Osnd~USV6W{=W=|xL3|R_095Mgb6~{ui!@?p&0LXcoDgxHjgZ&T
z(dg*iAzH$sgJR2EVlUk>t%B4RRivFXzIK|st?J1Mlv~~7cDq-Hlzk99E1UUI0~?cV
z_@hb;Z7$8?9!o3vS<7W<Q3aAfdZni<Dd}+l!K-Q<=#W&Kp$0>;vl<RI$Aru1@(j<8
zaML0|QHQmxt4uXOQZzuK5()snin1a%U9DPp7R+E4NGy!iVk=>d+H9axgSmXk1y20G
zfBEv|e<<9U7&aw1fFzOmqmD~<s8;LD$)kzVx7)#52ezOGOFJ&>tkYd`wcTuYB-aQ$
zfj2=Vx1CP)E0jKs2UUQCuRXb6Hh0=<G`rTFXFW$M(khk0?yXAY?WfM6@fkD%xRVNu
z&C}xpr=x$>IO^4ny3=@4@5Orf#*->AVLh#bScVu}6NIB}1TEW3+`4IYy}YiU7X!d+
zK6Ag|F!BZBuzif}#tz#j&sOWzRtuiQG(FlCI8g1bqaDGgrSS53qgVgMX%z)i6Go_s
zBWnS5Yac=T&8!r~dX9V<7G_b8i0{19K5ZR!slM0U?pW}ua@!vpESEzf>WyC6>Gt$v
zr}M<oTWw&`?2~HK>Ghlk)sxtX(`hzZo0u&Z8LX0SyZO{Hx`&;1vuSyQ(8ZK&)9Teb
zPPg7}9%;??;g`l~3xBLSFn;YPo$9dxoGyw3!NN)fU_y(_B9vw1Oke^>a$^&SwSO9*
zE?8%p)U5#Cq7|m3gqB7DQppNqR0vWdDic<kljd<sDAPhgt)fsa2<4(s=7cgYlm($I
z3S~(smxOXzC|87XRVdela$P9PLdgr|Eup+Elp8`>5z0G4xha%eLU~sxKM~4%LU~^(
z9|#3Hc3UVP3gsiA{7fhxUy}+QPK#ZM0sBe9EB@hX2f3B$fL}q<^scJG5!t#wnxSjL
zgfc_303p~=S;s6D$_z}v@+T}3j{_DlFf$gn5`aps>T&m<Z3{Oup<FeB+;|*X4PFH@
zE4&DVTooP$;h85jdT$cmn}VdS5GsSuh{w4qWG}EED1y;LngYL?itmHMH2i}+?|qh$
z$pFQLae!Q^g{Tke;mfb8iu})@fuNVdHKoj%DpX0x_K{>8@-tDOzsjK_Dfz1=H9JWu
z!k0hipA@)mTPDx)%Oij=M*-uG!A#^7rjG-+033su1fg>ZMEz;b>>18tvz)~*aF)2p
zSrX`8YM!(70%w^;&az9Kja=ev^fG5-S2)XE<!t;KXA{>sn_T8>D$m*UTb#|j&Drb?
z&MvHQcJUp~=5BH}e~Yt)cR5@931>_1adzo_&Mtqz*%d(8SGn#ZY)`##b+{f+_mQ-s
znIOnqJPS9wctu5tU%$IkEN*IdHuj2oVPpGVVF-Jb8F)0pT$#RX9_17idq6gi1+qD@
zSUSK1$mReOAe(FIplrUxiQQ6Aa9Yw(a9T2dkZhj1JZv<Ih+2Rq5JKENsUAA1)vb-K
zo!#vMh}?y}@)jfZAsxzn7yr}Wy$%0Gvu{>zLiWwuH~X_!D0`((_aQqnaaKousQM%J
z&!+xZ?Bj0lG@aHFX>vAExZhw#3+48vzEOBo+|i+m(=i|HZInyf8;{K6(`K)6f*PV#
zgh(V9j?)qwrMvga#ZA#fy6d!zwZhJ)P<mADeCf2*!rGb&{IR*acc;7qQi9n%JpkH#
z*t6G4>#pX+K5EoleTh-p{H(ZBHX1Du0efN#ZlEus4R^>--z)5_(fh1=wR1#olxsq-
zHc#qRy|`1@E$To|yUx(Lw1O`VPu?6%UbcVoa5F3A?PrY<{h1`PGm8XAMQYPGwdstU
z+9XVEil#P2Q=6ixO_72k6-Na{Dv1gT+*viuR2CH!sZmr=q;jaBNKNp#5l>C=gpo+i
z@T8GUT|lr%`(W|;xhjh|sVtJDvPhH4B1<ZZQBqmtNM$imkL}0vQ}y_MB0p14>?iXV
z>dEs!DpSj>-~~Y{9e`A#52RMBC*9rNv!<i(Z0&6V_Ua%Lqit?&7PS^|V8-q*_6j>i
zqx<Klz(ft7B)^TwB-x1X`;|vZyl)P4L(TzE859g*4m6qr&BPJZ{Sh1+HiGAUzfm(*
z@Dj%3`2Dke-;d~FwcY8+T?esNTra=^V&X_{%_>`)O1q_Qt*@)?T5ag}r~2CXQy7J%
zb4OwK^yH-7>BaUoclWlpw|2@v)?%lvuFQ6hY<H9@Tbq_UPFt;*pSiwnd%0%}S#J0X
z{{%*^FdZGah&ap6Gbqt_d(|gSSS^u@l&`j1y=nu53xDHC%1Q2^3>EgIKxO&Dj=j;Y
z9yy&-tJZ##-Bc+Rno@eWwbn1~X&n&f^)7Z_Zuh!!+Htk}rFhza_L>g=nm^-z0W=0g
zmxuD_k^K3>IBuVIA(MU{nVq&YU$DHyLqGM%PkrGMh_H;9IIJGlokCZ3F5Nz<{`skM
zr+WD16T(@x6o_zage%!v2Ojybdj1emr+#|3(>Su5{%DO?hmTC+Nwa-WZI;_;64FdG
z@mg-*rA!p!q{xSRc=+CgE6m9mi@SF;xT#1(Fvd;!>opcpdGzZ;!nQ+Em_cF9l$sC_
z)iSw{P*g*qNXlu3RLlh`5sjoZ4d`TA=vkqS2yN6F<D|$RCtdy|s`FJ;=L>aKs279^
z#B&bmr@A22MWHSU^^#C83-yXnuL|{=P_GMhS*UrTz9rPRg?dA%D?)uos5garOQ`P(
z^(R7oPpIz;^#h^)RH(Ow`k^p>R`B#)zG&tvV)U>w21O4IE=*uT{D1`eArJK>{9c%t
zfD1$65G6!rW5N#iKZc1|xK14Y5_p4`WYW7>+`AYghYDekO&3p5m6WTC`k4Rx6VBha
z1W)siGay@KLAC-JOB+#{4sw<Oa+VlVnF+F%l~b8LuCUm+%Hk6WOH8ONIjOMJq{`A$
z3d>BXEIX~Rk!h8U&M0hbMrFBKg^gcO*u+JJO<q*l)SSYm=TtT`udvy9m0eg+*hOHU
z<`xw;zo@c>C50_6sch+z!Y*A>+2zX$yK-4&SFb4S+7*>uzpAk1t18Q1Q`lSARQC3D
zh26NWvXy0py|b*cn|X!Z%B$?%w-ol1w-xr@+bVk>WVjDNhWjbVaJNB*`w(Qfk3fd|
z8OU%SgADg`K-QnQTf<67Z~jT3CnuHX`?dG!LV9v<3s+??;hz9WZ|NNT?W17QwYeA<
z_x0jrn$QA1r{3<pwh5t&>m`y7;ctm<W3AI;GCu=c8t;YLkM*htUO|G8rgvwe<{Hzs
zmnigN9p@O>ZMsW@(uH2aw{Jtki$phkXM1IZUeZh6d4@K4XksV3-`#_n9qQ{GApBCx
z!;wvApn`cQhpwCKepNm3`djG5!?(#$_u%#n@|P*K0C!8n%O9qG_nY$3qmt85mo>q2
zOY9=*u~bj0mU=9O^jHe%u>dnFq{j;E;#_Uka8;HzCp1!JiN*1=F`Ad)I_jQ)!*P?G
zQXDfinMoJKHmHN*DqX0U)HIszrLW=!0qraCOZ@T`K0RX@jE`D?9mvQ6utN;6LmaRJ
zFij!>@@|qdE5(_e<}8-sES}{oF~V7Ll(W<rXXzYgnQ;)Ufb$xe<ZN_`voTn8IX>;L
zI-n@D>T<B^j7zlYW^1!6k1y0NtjJB8nc56pNY6c6pAK=IGtsq2R+MWEmj_hKTiZ;<
zo%=gm<?_}8<DlK^wU5K1$Pi948ExcGfP+l+Y53PWu<FPLF1!s%jFw)*vObM|Q2%_M
zVZiJ-6+9W*ml8QkszO5hQmQF5Tok&$i5WmN-p6?&iQ}fzh6);cx*JmZ0Cv^_>`Y3I
z(4YjPLSxL{&P502Zl`)uZya_RAzEpV?XtvYAXax<LOrP-shuYWXKsb~9JW-SnBJR)
zY*`2#-L0b|f<V{Y>cDx@XyIl+hEnkKQ3J*vb5fM!Z>TggO~6B51(K01%%PNtyA8xP
zQUW<iyc><&t+vs!>}wk{R~sGZKn#<`X0vh9bqvI(<+g!smfPa+w1c<t!_$Mt;i|k5
zzyV`VOx%cA@3fCoSXuTk=*D)nSEp{2I}MU7x@o-g28K591^_DI6%#lKxy^}eC;-&_
zkd01_P^?Cr=PS|bt9A$`!njr;T|cZm697-w4GmB&s=;j@gA$Dk!!$`{AB)-c&^jg}
zQ&Xc%=sH(zJH=6luEOI|=T0hjN||m7(<&+A=e$aQDg5i;gT&Nw3yUIMQi0_|rTPf0
zA)Au4y)X*6#dg=+GS9!ot+^QB_^}wQu{f+5!08&`bRBTI0XSU%PB#IkTY%GT!09o-
z>2bj63Bc(|H01%Do(7zrnFbs`12}#baQp?p@fSJE!TKHN)_`VwJiupjwYe3%^jWyZ
zrUsTRL3{bxiDPV(Hj9NFMgUsv7(0cvQenfu8r9}dd>)TH-merl0&G4^9UiebAXJX~
zECUt?0TTZK76<9M;aDnI^Jnj$527j$6D3MsJJ>>SM^A+|(U0Z6YsWcpsy##Qvu6jp
z5ONJrb2{#l!wQMJ_9>dMOm0~mal95ozY=$0rd(5KSPrUU(k>DLr!-x$V=*0B6wP2{
zn+cgFj=Cj>A6{S&m`dxzN0zq3;esP;hir~#hmUMgA~4oBMp4E)GGeK|M?-L=xr3ow
zDz|h_)K2tShpSo)$d=M)r}Ih+@Q{H{#QbPxVfc52=?2p)Jp_2#yY3pK{OH0u0iLGo
zPI{u!J?S{rqX$l}-aZ<wG>}a`X*Wq<A~RDpR4NcdzJuBB3UgPVB$pm>bV;ccVqSY>
z2O(I)e#gUI8yV8G(P1AQabR(`nbk4DqlAN-f_qFl>iCg8x3b(C1pp3F5EUtiCBf3N
z5o)cNVw!R8ZH6Y%CK=!r`4`KzOpfCOg>x7m83i~8_9h88HiEW|&H*+$2c!_<V~AiZ
zau2{&V6ikXKxvh!AeL(xV7NgvH?p2>$cRRE%>nQzmZmQg@H~G}=g+^bE6=~HtIrR#
zy7v4)uj|hbjJomsK-9(a1Cy*oeADL|_k36cT8WWt>-%rj49{&v7UC|F;TH<eQ$-dE
z*G9z!+|k<T3SJO!NBs4O1493<4<dM)O5_<BuocJ0)z(p0I|A?+3737|XdMmUceD6e
zakH|uwq^ofU-_cAvn37c5{1r_Q#7EbJMoo#*6!6iu34d3ar1^SY3cxL=(BC)5$3eI
zryXab(d~63JzSN27Z0{RD^|)|+R16RK40(kPHx}0Q9WuOIB&z(-GH~<xVf_O-i?FP
zMzhzz9kflXZm#a_&~wSvy*s7Vigz3TytIZkxSPR^`+`jP<!@KJOYa1$i#V{zT6+!V
z&i<-#1mD&2k`L&Kc(_eZee7CvB+W_v;<z!vr?_e%Z=@T-w77cNvtQIB&NDzXctYw6
zXMs_Ir3XI=l8$329rH0%9l|2iC;E6e5Hzhh#hO=!@Ng>faB*pp6;GxVleit=T2g3t
z1s5fgNO)HbuJ~)vZ;&sqEaNTQrAskWnVALQ1kH~jCyBHv<*!d*bTnXe^f_Q7=7EAO
z0JF5{dYQrFF}?(AH6C88zzyn!$XfmGv077W+TTCD{xky*U6c3v-#`7kY=)7<hf>a^
z|09);t()pKSlU)(1zWg+HCTtY@h%-|4MyXdmveS|FQ`2YcvAfWw6LDVhxp@>+DL75
zeT>76^5Wa|F$F!n^kKDf{k04oi1d74t#QBBcL&<~n1&UF5So6eui`|w;(>l(tdAMw
z0;j{f7y2qsx|MJ68yw$H&0521P7SLGOtPlGLwNA-vMI)%Kc22lBO9^H?=YC2ni9%R
z)Do1fNT)gv(_N}vTEPoqx+NFW3AqXYUgponbA6bC4d8&tI*(w0KJ1`xZdJCn)j^Bf
zA+L+@zpj^?a=w>am>srk$qox)aFcQL&ruaaHPJ*wGtopuH#Jo^445th(14-(4sXcz
zTp2JIQOR6H!%gcY9XG9)3?ejd>J%3{XQW-K;nNA`p>m&K2oS};a60Xw^20C+^hYN~
zsMvb^;_yM(Z8sZ|;nj&7lsjQz^~dY8Yng#YBZliHaa>kdRJR0)24s`$+OPw{GJRbm
z<H7{)ST~42RxwAz61Wxpj54mPWCVXkhlbSkaKWJw9>c79jK_cc>#H+oj8L!B{?cJq
z4{p9}Io)oYEF<s12qDi<p&dTl_0ubd)swEM{26k@UHiBJeCb95el#@fOd#Rh_3B24
zk+hDkm5qIGYp3+Z)@He|VWP21X|=F1jA_yEWg(8m>a(rzOex&n+{YhTd<TGiLw`^z
z7kAt#_BB*42QL*>QVB)7olzLD{7)u^Csm3LRTL<a(ZYULTA1nu7b3VWxFNWQW>niX
zsg5Yh$z4#YbJPJ{4w~I8T1(uz#EB2cBCmkV#uZ}K1<Q?3Oibh^;RR@Bc!6K!a{wRl
zIGX@gU<xin5(I{G^8kj^Gduxcn8TcL<jHf$cTeIfo<O#J0@?NnHVa@pi!1<e6BmF*
zzX;sKMUO?F>u1q5VA1~z^|g5PG>RGNE?!!UeRpUgIM=KLa|-%$iKSN=L3zz~b9nk4
zHz(%iDCvuCPTb8=(+S3|WHG4$?*doToc=d2UuysQ<xBs6xKB^xYfs>U)DHcXkWa|2
zr_^idFBm(}pf~ASI@B9{H|Avg-duEZvVL#;cdPVnRlZw&^^3>-7whn1;z%Md#+<Rp
zi!mqjCNGY#QYx`hfMNbq{(J@7vtY8+^k4UNYk|7eVC=;|%DMU0?b9dT)O_o9>4rBm
z-?}}z;7!c8XU&T;{kJeL|H;dj{{MeVy$qx>4W%;d<zEJ!)Y4xLowPmbBu$yu$s68`
zd7ZrAP1v_*4VyCkZ(-Q}>z6O(|NoXc6i9+PN`ieI(g!*;9_kQHWw=8$li?20M7~*v
zLel4aZGHtWNCoBs9%1?nt%;|gmeMC$9X1Y~u0TqUzo$>ho7$`#o;ES4K+3DXD({D&
zd2_RPw@@y9Ry4P_c1xHTDw4Vlh7kM^Nz_H(B#^q6K8UmXv@C<N-srH;i|9wpT$*t6
zL_n>%H1F`0BXQRTQp4@b**MB+Bk+@=ZA?JfIcuC-6C7<klqp^6`jY8n#?|%3F~|mp
zQ+&jisdD2nT^SwY7~&&Mrjm$SlZaX~EQ@vss=M=(11zdXuqenCzZ{N44>V+mYR2FH
z9Y{V|lziMAF_2?I4v9im%|b>Jfit-tQ?EsEf#!)-n|PNEx1J!mDjRM-oONdVxK7>e
zD;G}3YvU_;K{(9?aH{pGd;5*2lpG9`;Hv6}D{w;?=$<1WkAx~vBB2WS*)NKh@D;A4
z@Oyhp6iojBuR(U^5AYgXU%$84^z&c;WG}kdCo>F~N<`yZ5gL*OZyH=^sJWr(I(ju?
zXky`f-Fx7)PVHXxpx8oCKQbXn<|S4QcjfW9I2o|G<=Lb5Dg3TBfp2%SrmJW7;bOO4
z>wW4xBM<db>*Tao=s4A_8hy3X?PXeya|EJIP$_m8^lPN!{P`)=3YYhJVGImk)PCo6
z4Nh_c?S!1DM9#{^fXn5%X*M=wmt7y^sH3JQ#)L2?g*lZAZ+PMshBPWsRO!>i6)jxk
zC(y=3(Om;J#RwOnZJQ$8y?s=N&+yp`JUe0upaCX;tO?lN0xDqv&ujzF41%(VDa-`P
z(26U}j;kz|P*^;nvP4p0$)w6sDTSp|D$4-%&!$y2lHqKWVGNM$fScr4;3i3XC!~i4
zW`Zu#O)`77(x5cB%b@Puy~A*G!<PGw6}Y$L<_DyP>kEc7^GByIK--x<tC5iO7&hE@
zMactz(WVqAb&`6AetSp+{bRSAQMQ3+?Av+0zg@gbUOrA|i(*c7nfP<*xH-h-Dmz$x
zz=>ZEJMl}?D(ILQa^J^K=3K7CVS9tP$71_j&#U(bRahG=zA*S<4|n=LEe@a7>bc=Z
z>_gwHDGn2Ryxw%a2DYOswL~E=?dTYc4r@6w3WK&l2=l%&NM*p*0a`#q3r`;;9i&ur
zk-~c&fkTtSV+;(Brs>%MrttOL&H4=QBg&gTe<)u~<H`rsW=Mx)*V~=OU!aL#^A)yb
zQ3cVTp8MG4KKFj<9B{6aLdbz2LhVNOT8GusCv_<c5nb$(nHsVgmaN%wdKl4WN0MFl
z@$R#3&pA%WW?imfxWBl^xd@`+tzO3c4Y@R&4tC-VO=2TPuo~L`TX?}vU@)zA*CB7|
z>QO@e6k12SXp$&9afZd}8TP3|3|T{=4BQd%7zH(F!1A+m@f=#}%!C}RO|((fW5P%X
zL0;A%-f6DszR<>S6I>e?+Jw+1g+`Hhv>Bm=tW(MLEj`pUl}t(js@x={6kT3n>7#G2
zqMI^7M)_p1YLTxpp~pqObcv5oSSI5M;1Cqx4piU_w8T8qlk?0-%`=gnXJ%%8csNG@
z>J%UMIRjxzM3I6{iRB<l;Z$vE<uR}E72Moec|1{@po=syovn`tFuyV}4CWDf`pt5J
z5>L){w~oUh79vobDV&@D>q;1St$hr09}@S^HO7?T;^Z5n3vT#Y7`EIdpE#klaOc^Y
zQ){#u<Vhp_SYYj`r=4b|(S=mlT03@t;7!jS*_1A~0sCdD{hwoZzpA;xUPh{e0bndL
zN8PFRFhT()(Z?nl#=%{)WwHsWS38ajo7)|cE<?K@svfkzzSC(OJ#n&!xDq2-b{ATe
zeaTR1q1kMI1;QFWoRMwFELz2e{BRFr==5#FuteAjHW<T*_l%WG<k0Z>N`H7fO@_yd
z3q2`Rk4HB~ggz?Nv40ZBnORy&Tw2%C!elN}@2xpx-u<+27qIF6snXAc;+fb=IH869
zVu2G1OS=62Tm0=CoLj)}E0e&llL<>!VfqO0`lIMkqDYUDap3hQ6c(EVUVlnqiD}^V
zXB3v21z!Jx!ZH_Bmc6L3k&7xDom1G@yuxw|3L9Tk*u;{;CNC*$>axP7VX<da4r0cj
z7spIsC#=+zXtb2D1RU>M-w)cIllpGGdgAo2@1W#I#hgh6?F4aWCP*WP{34-g%@BIj
zh>Tm@j=_}1RA0jPV=sH+4@YbI2sw9!A+@Hu;htzH;39>g&@fyZ?;i$=Hq<zYMv0-2
zFN9H|gQM>rIzH3m4oLj)w1ex5ti<EA)Lonr>mj<J{4NG+IsCHFMG4#JVk=$mL2A>x
zAv5z#xJk-Mgp0evkxBro(cOk#A=64)*)B%hYyqc04_YT3=P9LPPujgUkYudvrI9=*
zf%a1ciLU4Y>J2p_Q~n4UyC)qGiO!w>D8vjB^0OF$kQ0jkzOb!5z|8_%=+^@DYjEG(
z4Mn0Fecs12lM!+s3V(uun*-EhxPMx>Pzm86_YXR3NN&JOK<<)X0|EXrzjBq&%wl}A
z9O@1%z$Z5Ppa4FBRbT*DAQFI2l7LTAfKLG5!~oyKGb&2}&Pk&64{!!))IkGhkR9i2
z1kmy5Bxhq&oaLrD8;3PB!DoEjVOnw_O~BGI-w8Nj@<q8=ySO4vmT7~5oK)cAvJA8J
znUH3o52tL>EFy&W<CLJ}O?@wdCqvPzbi^Y}b4AVog~$;#xrO3^rA1Ll7;A=N#1Ya6
z<BKr5NY0$~g(cu?qDn(=QTF-SL?3y>&mW0C9a<6wDOki{Y$2TusJrmfV?3UK&$m3+
z6V=;*(9Ux`A(cW%vl3OU^huW6;aFz+W)Xx*rnlfzJ4RvS^TMNDquTtc`mC#AG!v4t
zhf9x<cK+BEENFk-r(E9N>{qX(YSk`zq;!z8Y`1*t^{85P;KA2cw0Oqm|MZF$)F6yR
zzmMnwi}(`xo>xYb2$a=2J(hHDDE%CObDQ%0fXh;!VhssRPAU~62uc?b%K{%Ow6(#}
z!0>a53_pi}!Nq`|M(F5<VP-Xm1NuLI2-D<yLYYt8g#P0>D7%k&qM&^?E&wg?!vr#@
zTUvx_`O96^EDGl(V|%My9nd7J0rNzwoFF_LFf#%OlYIuwGWz(P(_XLLI#)Xq!IQ4!
zcI+HAs>xkczWQMp5~p1U<9x54cDm?7CJ}0wbrPp1bfATWk#c0}sQp!oQeNBux=D5;
zEyu%s{n4JXnQ&{q6PN08Dr4bL;aVt&00su9I07IJsUDl6jtFCP#0$NK{;7T#vIuL@
zmq6sM^79j#8*ZE+BFD!k+|a`5v%)e0|6!Ucvw#P&EtSQ94~g5rX8<pf1YRTsyhs|b
zZ3dtz%M$~>t=Yi0HC0QkpuvT!eF#McMwm*3h)6$7g&ZQ(?ZO&EzYDQbT;C|JmPN;@
zVVHYkr?_1#ls$Kzq5e?ehW-SI$lU0_H~_PK7Mh8=()T&f)05|{vY}g)h{1j2Wgie^
zqxRN5>a<VF)y@;AhanenBQd&4`xctj?NvLywNCYkiP8url9W|$pB~onHi7y6-J7Wf
zBMb6;J)s<iK2=4GwiCyL<teF(+)fOy%}7XpPg|jownBgiF_U3^YQcznK#u1@F76=0
zS_5eSfbOb-(FBoPsjBJUlfOEx(^-DuBG*UICq3!;q{A8{dBFEchjp5ObqX?porHCo
z;w+x#ERo?Xne`5O(Fe4H=|DS3TZUt`F&EqCYPr50#E_RUerThg2x3qh7Cz14b@2ZW
zh|KdQ;dl^+Ut@26ATY(y?Rh`;aRlac0?0wg8)DK#dQf7DUN_*+8-@7!r-|xwR{WlD
zw4c|vQ#j8kAsVV9WN#3SRTPQa5f1ecj_xsR^CG%Mk%j`ADs*1L$g}BswHwKZebs0-
z%bmuPCr&4E<YE}A5vXee^I#bB#*>y!v7A1~{>CVIk2;-$Px{I|k}3p2It^0lFdDKe
zcQ`bJSCZOW_lDKmkd3?RNuJ_WJ8d?1DH<VQ^v<C}A#-WOHrj_@$}WA@IC9!ulhU`=
zy3!Ut6+B73PY3t%6U?uU;VbWM@1?`GBiMerN_yjU|AFcLjL>2jaW%?a+WlLv;yTE>
zpWu!RDv+a_OMRhF?1l{c4<9_z=+cOUmGUwi*coKwoB&WZJxBB)<{lbn=aRW>ZZtQZ
zn*yHT@sQ)=G}0|;38Bl#Po%&Wq*5}87+8O}@Vr9#xlle4N<k=hgt97>HK7!RvM!Xn
zLb)fDl2Gmo<x`<-2<3rLHifb!lx?B>LMS^z*%eAzD0@QrOemiV<)Kg>3FQl+{8A{t
z5(<3#zECPc`4>W|3gtkkheACPrt?cbwmPcWDfX_r?WO;)3q6Yjk)st2H~p3|;uAXU
zy9HD)=2xa$FBTL}x@4B?;e_T^B$d5)Bf|=)YK(#lz*Xl;3jLI?s<w^M3MiDhdr60z
zQ{1iviJ04`AmP6<gNaPvQ$g`yTf+U)pib8P8^MebnV>(--MjF1Bz)e2z9|-SnGlcB
zukj~!{>3jXoAHOEi%c0?WNL1aY2%AbpIBtZ<RTMOi_Dx}WY)|gvu77s?7||8UtDB~
zxkZ+oUu3C;MV4M%WSON!mc6vdMlLV1(JPB=?CK)RU0Y=1*B9Bu@*<neFS4n(7TNUM
zi)`k`0-Ie~WEb99U>Dz6WOFwc*!;~!ws32KE#6vWOYbhQOFvm)mw&RzuDmzTuD(Cd
zu6;1iuK#qNE#IDJ`48vWTOZA{w|}Ov8$VOo%Et<O=VO)K{JFwz{aj`5exk6Se4?`V
z3JQC_pt29{DD0<qRCaq+VIQul?4vb>{cKHT9~Tw&^L2%NvaYhiU4`AbtFqO53R}CU
zvSLYL>m`-ly|1u)_f=N<RAKiw6!z%@g>5`g*@I1mZEh)SYg=L4zfjmOb`-X=tFYa&
z!peIJ+xu*uefIf0`}`qi4<B*%2pFv|_!k3=))xVzMeP2sYQI{Mibjeq`peoc>Ebb3
zUj$;n#Mlr%>(&}eMY3<LSuQrcwHEeA@AG~k9h-Sj?cy<Uj&<lgf-H!~j-*{{Kfk>w
zA1B-nyrJGQ?miZgjnlMGm>f7pD=HXk8KEQF9Sh<L3>APq;Z{*~9hhi~+obi9hi1j%
z$UmC~nvVki46>~TvaJrXtpPl>0NK{G(R+o#Q!#&o$v;s96(qjwW(VrfL@lxMI9`j>
zh18+3VCu#vhD==n*#?Tx#LL=7alOnp+%Qf2j=qBte)*0G#T6`5${QA@DPJk?#AHob
zc4s5*-pb-TJHu_$g4af*-ccC(_<5m!RitWtLa-f^La+%!uth?!MMAJeMmQD)`n4#~
zuSJ1=EeiB&Ww{^K0!8FoZyv<=JOTQQC>V*0Lxz7X#688<_ck^vGNv=L0|sb3lwT=r
zmWvp^x%63atTv3paV@4?gQ=lYkQsROpMd^hyk8H4-{2nSpl)n^&QxIfj0eTF(%u6D
zwF;-l+C2b7tq$y?cBi;o)(!xTn3z}j;Nb`A2VZ}X@@^{9tki-$X;o@d$vf{oeCIv=
zo%g<e=e<mj;Z}}Oz8n8$xP~Xx#s7c7dTM6KWcdbn=I*_%&ntzE4JJ@9DKwi_@gcx;
zWxZ53ov#6o*Bd=+bE|S^YiF&vW479N+MOe(V?x&MYGI=&T5W1<c;L9`%l^cy`x1WW
z20IpKY@{D&f4=S=+C(Shy~E`1P5E<6{=6%Hej<O~lRxjvpAY2EPlbGb#r=K9{k=KF
z!qyJGH9VSW7|ryVj_ZBf-gJaW-zX<ja+CpTd4f(kNYE(<2|DE<fiCQN0$tdRgrNdR
z0|^F@PME4?SP4tD4Lf10F(a0Usc|Eoh@+c((w~)2U(d~bUn~g(^(7NyvoBc~n|;Z~
z*z8L&jLp6jugA}uMbae01!plCLic?^kNVuz$U>EoiK_3NW}dXW4aDJr<66skLOjdx
z_~d<U{t005r>?0taB@zkRc+obx(T9Swd$dhJ+5}Tbr9i;UmrT|_M}yPT5U8@gCiaI
zLautEg0^z^ccoj*!v`C2;3CmDxZH*tyW{juJ1vZ4lpA;x#c4@K`}67`G4`K9XXI(f
zQWa<(dQni_H)AY5csB)|5omgP+HrI`$A~)_zjya{<&<W_{dEl$U6$A9k~>ej?w1t0
z_ji3Jy5n?Dn?3dG<EGj^__K@*hEqb*K|IdVIf_?82cpGmuDTFo!TP$xG_Yaqj`MlF
z(Q~?JbuK>YbxxfdADbW5s?9DXTExG9Y<+aYO_?8csbe1-JI<5h*C+fkf1+Qm9-n*&
zJqN%%bofWw<!0|g{;_uXN$*2=(tSWcW6kD`kF_;qIzB=b%Ewx-aSX4$K{v6F9B<k`
zj(>C`xG|be>q)Pk{OClg0H4h@j()bFEWi^tyew$GiZk-DhMxH5M>pi1`B9tJ1%82>
zihp$4Izlr`=jg`A;=l_UDV4vnuSPq(@#YFKmj9U2I2yqNetla_8DuwX^(j@WIGj3-
zrH0>*(Ucs^|1O=ns2`#j!WWcZb(CMVlwU3IU-CSEY_*)P=5VC0@@s-Xer_RA!4s(9
zgYj)$ep|Wvm&#vVTU-c@+rr%PoCALg;qhDeFtrf==!FmUUgz1|U#2P*>T;#hLjb(W
zud3IseVF*GxkD74=B_%|=KhlZm8dvRtIhkn;S=`g$URezQfVzSu)M;4R0D-1cVXxv
zRgdQq;|Vi~fs1lmis{k6pF{|YAF6=c$ru+(+RAXjv#z<OK?*NEF8GAd$%aaw7CNcD
z^b112DD*kO=LKI7y07+H7RC*syk~vDr@8eJFiZtsJ(YaGg|%sIbL$32?G`@}yd{*j
zP)>yM=R)gb2zeS9(PGpFVb2)7pekI9f{Zqbg4z|~rP!#dv2k?{e&<xE21z~&X>MPE
zOauO0RLr})cgo+r5)-&Pk_3rw+_tAPDt{-Vsb)skvKd2<XM~Z-nBr!}GL@`t-O9%7
znM^#kl1apGWReLzlS=Y5f0qQt7$I&G5%-lU8dA_9;q%YQj))@apu~@Vm;Uqgx~5!v
ztgq{g{BJRS%zxmYU;iCo^7-E!YYv<HwK&%0kKwQv$J}Ax9xD#J{Pb9LSW}rBtuTfr
z3UI^MO)jg$jb5|zssDj$ea3!mA1h1jP{aK782inko}OjQa@c`>pe@R_o66%jT#fZO
zUr+FBH+3!Zf4_Wb>ZT?SaGk>{>nR1gmA=N<cPn48>xbI)mE~iOTe;{23@_$Qjumu9
zNp%*VZmQWNd~^m<+Ioin24g%t&eC0$|K=Y5&-lOL{~d5N#t2T{7*lMPW9qmJI5Ej|
z!KRoYn5t=-ar^lS4G+hm;4l=Ar`M<1HFy~eEp*}W48C{n^7@Q=?XJA}M7ctDOqs>@
zlT5k5G(}Uj#plEY)-FE%NBq4~z4%zXSQjvczr*`)s~5k+U<0~PwSNur|J<+bf4us;
zx!)dY>9;tuUOdeT#`2ecn+8D2U-|7lD}VLHH~DMdK;ru2(HHBZ9IfT@`TSdVl>FQ4
z^9tRr(Cs_k?M=G91-IYi--SnC%uQi)Ke_kf@j`9kAF?o1`S)Mc7Qe~=^c%<np!tXF
z2z(}vxCv#q;guhLa}OTKfAr#i%6`IVw*PU7o&F9Z30U9efA-xs`H#POoPF_KZ3)Kv
zoBYqe!TJ5}Z%%*r-HY0#vH$bs%ls$b=GFDfP<H2=d+zgx`itKj8tFx7<G?u3FTiI*
zTL;?E#%>yV<{trA3{%gqdTp)YNEGj-0YG2;?V+AuKhWKn2k%42@49y!fhm8_y;Cq0
zM!w|U4G9pTPydfEUuysI`<MUK_b>n3?_d7A?_a__pacyj>3?x2Y3|ooeg_K%=IP%<
z?=Ro8uH3U8Uwr|9zkZcNa+H#zkeq|N1;6P20+!;)(i-*a-G}x2_*(7SJu4U+T15s0
z?!e($#Mga$pw+HFjvr|FSe#dva9IAG9F}kIS$honb>_q0o%8T_(5+>^JL}8XP3%wl
ze}jHPb{?}~gn!|W@V|ml-0?^FuR`Okq}!qKR?}6u+jZ}>^e)_$-8(&9gu6ZW&Y)TQ
z%)JvdYu-GWG;5!`cUCZKHqDw1v$p;6rTrJ*zx=E3U;g_0m;dVfmw)&D%m4EGm;e3u
zFaOu?U#c%(e)96=HqN8aO;!7!6>lEx-_8H#P=h6>zxdnyz0se*TOPikb@PbU&7<|V
z<TCn#ZolwuAJXkF;r5&SLtHm@&Hjh%s=GKI+b`B_4vjCtG-&A@E|bR@oPZ@jPYBNk
z+TTFQf%aYP?XmwC*2k~D%|9lX-v7p1n7H^Vu=xJPH}?=^Fbo1@U6V_c()sEO`S!of
zmoOq7j>xqaa~L0C!(XO{#^W0=)^G6N912>m2jak3gzx?KK+hk3^EmV3K&M{GWd>B}
z{{oN@rjbALy5v9y2;1DlC~+`+{|$e>a`jM1#F$rq`@3&zZ!fXrdx(O+U1HSSZ-2MM
zPvMml@XGJ<kD=f|$oG8n+ut3Czk#v?0nd&7KQCX>ia=CX`wgMGC%=KQ$=CCZZ{Yj>
z>>EHYUw)HseuJpt_#5c@<COz_eTDz_&^R#WMgaik?mdn_HV+ISPXO7_%~V8qNe9Bq
zmD-gRyrA&%Zpg@B=3-dOd>eQ2n+|aM=r2PmXJc=Btxzs9<MagiJiCItZMO%kak5gC
zwdJ;X^!8Eo_KQA;rLYD)JNVLw>YJjrii6Vw5SF_3VYLOdQE;;So+Kh2iQGMk+<hT!
z36eEBLcZLVowDgY+x2SKagTECwIl8ZQv5_`w{c|Q{7_Rosu)lc!;Rr()Je}0K7qWE
z0J1Ag_y^LzZR4(({EwNyH(7W(^*M>G<kVapS{4lsF#@cK_a;(y6GKUv3^Gv*q^1;x
z@sf2w83w?a$SBOrsLUFjXZF}UMu`Pc+0ZzTlU6MOT$ZL=o_I_FQcT^LrQ^Q8D^Xk&
z1%pee7+gxj;8MB_aUwPNHATjL1(ug0xGFNrkXxwA*sorpDkJ{5g_?~0>J_4@$@B{`
z9FP?h;yY~<3g>{?uu)@&I|R62@Vu6MUQ0c%rJvU__ic<P8$(s%6x18ZC-SL$I-ki;
z<g@va{Ahk`eFP(2#)BOPGR(==vUH&xhmaa@Y^ra)fI!gbJtMF(Nr_!5KVoLp&5u<m
zRmEU${XTnSM;2+|wZPsETKqB4Y<rq69yay0B04VDh0FtG1UQYDMb%Vo`o}Z?N*yi?
zovu}1*BC>f)G^>5Lsv^1pfEAdwB$Sm-l5O~66Rnf3__c(8_5W?y%M~1C>)3Rr5L1W
zP>lXq&ujL5gQ8l&M;fD09M4<%SUwIwkjW?4;~0n72qvD?ULo~w#6fvtCOYxmXRX7)
zYcE#VeYCk+DemlS?J&FQ7YYZjr8S*?`yfDSeo}o+y%rE?xN-P~({Bgwa3R4$i!90r
z!gh{$3bv5yvoDyQ>IKtNMx|O`sN*_LybcqgYldoS2pcN8-k^3)^T0x+5iAf&3<jW}
zq~>W4ko0t1qo9mBMy3!EaKLb%qY@l2aBEE|>4bd{C=4#lX%sfRIY)j3rw<U#eSsK5
zHK9rlswDC@&3qCTekyOQClE1cf%z<L6VpZ`t$i}2g^O!G8!}FxosB?3$ohzeGX0>q
zxmPKbiw`QhMYN!0$z#`-WY<AU+89-kWi}Sc?0AK&ilp6VrV_H&+WM;H^ux}pqQek&
znW{9p4}wO+COzr?Zod}T#X?<7_xEt}%$NNzJS7eAW2BSMxlkD<x)erMaCt=Bfcu#y
z-OpU#vzP==z#zE)P2fq^-l)|u(W}Ex7??on3KWv*K9$X&5jWyEfdp3IKDKctfgPD=
zCJ<MPqOACPE!-yZ8Y6@^B+80r=*CDG?WqXnS_Jp0QQW6SNUIhlty+Y%T2a!95pGTF
z*3xk5dEeH5ZU65tfQVMpFOcwB(9i_b#l@2$+Bu2TGoM?}n)f0*_GIE3I?^>lKgV;C
z#e;#m2skugG7F3Xvybj=Z)_FTDyv%$wl|99Vg-w`rzhw@EsvP#IryAj!P>*9s^vHP
zT2TFl;2B`efsMFq0H#5-<5<X1QX7IiC0Rwx>5^5I6InG7Zw|qq2$UL&VFUw!J;0+{
zYF^^aV7~*>!X>V{F$~rK4k9F0m0%{Fd_6FO#S(y-4u#|WsP=g+c3-$8))1qFW@Ch8
zQvf5{dcq^IuE$G&WFz=B2&oHSIyxQ!k$`IHlDtY<s&@g$to6<QKyU*&wLTR-lOPVv
zY1kh!sOEc1spKt{7~r2mdxWaTKS|UBY?G?{lo4al=;|E(p~_U1YEz!!*%59N_XMO#
zTGE&>!&a1WvR(TboZSemL<E=hXk`gQz^*HtVy6dlK*LX)Sz%r$vPxUo=oAFpEsBDs
z%Yiz2VQsCrrdN-SoTDVAE9I@qZn<!`7^h5JOn8v&YGHG=xM9d8XRO{UY~C#zhxKaf
ziKDM>6bn1@v?@q%?G|Nh6VqG%cxnT!d9k{+xrrVrKzLe6;#Rk|A8B}0l)AcCRu4~m
z_FB>Fq<!Rgy^Iynz@)OiQ+QCc9VC?GCYPZMz%rY=<(<9Na&aw9M#w-IyS>ioA)Xyv
zd{`>W2QBC8hIH|c$>%l-cZwT!&G!~pOKZ2(#?dXUv{@=^xPuaVu(h`f6^n(>ing>E
zcB)SuZEL%@skKj>mcCusEf@8ZY8O6kr-%XB*Mv0FJ<7WG@b;|-a!Au|5pKrGVcjWi
zt`&ETj)P|#!rgA^iz05JHU7fEgVeV+HVkQ!K2t6}EC+@*Tbq>!TWj#`G!c{1MA&5@
zqzlR_&5a?M6r)QFiY@QZ%E6L3g=RCkixItiT%91#6c0;}lnZy@C8dou=&Ad*Ovt8O
zz9oybikpQy8}PZZQaZ4Imvz!urvzX7(5;d5%;Mdi?rkE?a0BAlXkH|(i$X?6X_#sp
zhg<NLog%<U%D2v2?Kl7^2`t^)DOR9#?GYKzpLU!br+V}(_E~AIxaGpoQ#AJ`SP;8=
zyD*z;qI=qf2|Y?-=QfKQl?TP$U6`^Y!g$MRJ^)4tCM@9<!+e&Dako%9(tW<Q^C>_n
zmBhYkcfNFe?fMlbE_-)69Mj3;=gy#WMvpi%FRp>)(?WEvj{^2#%M|($;Wl0M3F%TM
z@V<0R-cCIyRFK4w2577(t@E>uuAADH`OZ<;M7$rb{u1!&$LARmA$upaDbr*Gev!<-
z7ikCV3YmN_ld<;=GV{Jg2Hx+JY4?X@)ctcZ=Uyd4?z?2d{V5r5Z;{#dE*WfxthLo)
zrrOG(P>zJ+2&E>JCqk(Ur6H6*OCt_f*>XOwqKgrT$IF1%^X}hU?%&($9A92mm)H%s
z!3ry(zr0HbzU0kge&a191c`Tm)ZYX`a0}SXcNM1p1lY{?6eiy1%=~~e>!+OAw}G+z
zkhAzlK$U)m!HTW}nOG)vV42JxmdVU#nQW?-$);+VY^s*YrfNCMEyG$K<+foj=XlJB
zEl=>c5nrC-2_vyQ!;?mG`2tTFspUDIHqy%rJY!^*mw495E??#&#>nzjK5C3EU*}`S
z*m9odjNJ0ueB2mcUf~nQ#PUr(X-qD^%cqQ~<@flsF}?f&pD|{ZZ}VAWcKIWI!ML#e
zF~4YBT>ga58FR~b_`ET{yv7%dh2?d=Xe=(@<4eZU@_l~ExU{^%FB_MaH~AIg%JMe9
zYFu63;n$37%VmDuxW4=u=P7=}wGhS~!<YQcO~m%C{3zPZ<a1~@lb=Alnfz2ezMsg?
z)D!#3{DpdQKb4=Wr}oqNg?f5FlV7T5_OtoR_3Zvg{%U<>e>8u+KDs}a&)3KHbNRRH
zx&86{N_~8PB7d_!u|JuAw?4T)m4B~3wLhKzpgz4nlfPY`*`LjSRG;0ykpH-TVgF+O
zllsN|x%{2_-2Qxitv<iMkYBGa>@Vi;)fe}d^7rdY`<L<?^-KGg^PBa{`&aVY^(*^V
z^E>sc``7a2`nCP*`OoUt-6&PAD)_D1TPt`$Rq%}v-<6vgB>I8DF^gcEbgADSIdoRM
zZ;BCS%OrmCvB`k5(1@gNKh%Nf)%MY&eKkTjM;^158L*N@{@v2}a6e)-Ysp{$Tm~6Y
zlsR2hfU(wnKL-`><r&#J8d1xOaGeH5_~;l<0ZY$KZdd@THn4Ot;Qiyk8zwk2lH3jZ
zpBiwX55*)8G1B$aUGI=mjCg2|4^Ai{`qXM+8wg!#^KNDPUSYS$tU|d`F6`VbmXmk(
z?%dh%O9ttT9W)aWe}r$G6^Ryeo^ckL$7y69r>W|oaaO;f+ZzYsgqJQw$ADa$BqXkH
zt?umtPr*b@`a4-NXKSx)QqI<CFa2rpQAK9EY{!?*Git+ST_lSau8}5AFH|R4=>Yi!
zs^{w5D&2a6+`Y^SG`5QNoNuVwIrV}W&Qu!Rop9q}rHdVW>uX8D)91AHDhb*2zDc;B
zl!$!udHS7nE(ee^9ijL<CO94D6|%EL($6V~U^uXlCVj!?JYO)^5sda&3}#xEZN*em
z$D<+Raa@$l2I7hi_RPYBB{kPP9t-D;$lVs#qH_dQKS>=A)-&)BJ%I=7B``Gx<Yf#f
zJ_g3gfsi*2gn3+LBC9Ynt1@e1p4pSQ!GbooCJ|$kh_Ok;*tBuWCFyUuyu#*I6QqF&
zWOh=68n_7~B1$4XswC1QN+KhwBr+mOA`w**iOBv-BD(*A0R=$Z)r~74^(Rqzj#vmK
zeCPqZ2U@$IG=7~#B~rGUMI}-Uw`))ri;AQ1{6u~-KbyahzqmdsqFXQ&Low_d9X3Pl
z)5Hf(kx~<XhRea+87>Ev!s=>q8>GM4p}q&WH+cep9IFJyae1Dl>zoi>ys5tKyq;P$
z)ZQB^qoNx~0}82;VS3Z3LP|+{3oNu*>8nc(Pn%Edtl{oFCc?T=kwGq%icmLdkZLLp
z{Ay~RX=zV26{ta9rJ6Dfai$tHte^7lQ2(SEa5ptXJ@vd6mm2{(P+5V%m-IDMBY7>K
zUQddsj*8U(<aQKRVn((AGSd+dybGcr#eA1jzE=FKv<iTQ3K14Na-KF0odW4d+!9x|
zPspMjDb|aMyzK)h-%&p0zhzC<lhq>tmW=j9k7%^ywqGvcpUoE1Q>xPGR_fBzny->H
zT$Lp7H~x;ZY01OXajJzvEOuD)s3NAr_{wK!x%)Tw)FBFP9}&=@Y?1hiW|+7~cVg~3
z?PgoX2pwj+U{x@1dhhheu`95Ko>0=NRGVIA9Txj3EW>AZ<*Ao6Dj?W9M`oq&ROyt@
z!2aPJlZJGES6&MZm|p)Zzk8<FJIn8!<@Zget_inifjPvF*%n53!HfMy4jheCU8)=o
z`ln`I9q~_%5auxip%}AcF)!ebYT97~2;UGQ4#YSSmm2UNlR%?C+o$DIh^nR(JarQ*
zA-;;Eu|yn6dmKr791qTo<Ni+EKQ(3q=sWNP`Y6U4Rb{MEp!*ikeH-Y04CsCw=zd~C
zVaW-Vr6v`Yo>W<8W}and=h+BpZf&5!qeSh;hHQDqb>p4$3@q@3T_E)qp0#V&&F2R(
z@3_uCywOF3mxx7qiFkyUNJM#wq+f_zMya5X7IkE+DihtR%EqBEKgeigpVvm7*G8Y$
z#-7)5&uin)YZK3FllPM`XksJ@&n&<*)A@`v^~lfVb1vU8m7mVf<Y(8Xk*gUE5Dvv-
zB=!R?5zd3Gr6&6jP8T(VwA^xci@T&eEPuXLSqA~CxC0{9HXC^&E0w=$uft+<I_2t#
z8=G;pH((MFMj}Jhdj=wv=0o}ONXLV>9dX#}G=cRt09Bw=;j!Wdg`;>Ve;)O%`Lsld
zg_>`175<h%;W-m74oS{vMKadE3*yt0^8<uZbe}PKE<5dx=ww-9N@g9AfXj90>Kr%R
z-4dBlF@bv~8YZ-%32%EvxZ5j+ItR>*e92WK@&Z)2P4cN}J|Yl5WPiwcA}NKXfZ0iB
z=2<4oF)o+8?p0d%BmRy}-^v#@Stj`_A5W$|5C`UgwXV?lv?1W62tpwjyYLa%fOUq!
zrbPI6ig!WK)eoE}jh0IlU81NKH`i3Bb)*(HHq>g<^RA7+UOe2^pP2I@uG-0{z;Lfz
z-bU5BD;&r0p7ic}yUa#sDOos5`8&nk?X69a@nwZ9mhU*-lXk1?$a;3A>-1!D$ZljP
ztnsk*+@<GY9k<23osE>2zUN@<?{2>qzOVN~^jv*4LaP;7zs!&=YS(;mV5!n!nXv(8
z5LS*b+>J|IZUUE^i3zxX6ivCbs3-tl%ECous$2%vieaE#H56EDo|#F{SR!B}ZCC51
zp2tY0LknkJrH#&zAp&W}BFtkd1QqE>D6OG7%ONus<v9Dbp#Rib%>gy5mg6~LS}Y+r
z9?~Vackrp)d=4urm6VA`cj@GPq;b>JN#Z@n@TIiF>|TuUSzpKz8PF=K9+_gn9N56n
z$Iv(n@D-0o&i@jT^S|N&KAIkj4%LIARMeJe)AfP$5Z&5j$p-GZ9!p2jc54jFVX^I$
z!?i}B(k_Oy3)QqM_++!;wEB-jNCrX2-iA7M3EGqurGDD$%j=ukS^lejtg(nEhM_g_
z=ow<zfE}?m>TP?`(HX#BpJ8r?)=L5<wPe_C#LS`!ODBm9PooE#r2?(eGQ;df%=3hE
zv@b|U><eDQas)+lG}4P0=%E?H^IGD*8IjFXzI|>EZH(4aeX=>}gebCQ*g!Wb6;4J8
zVQDL{-!MyCu8pQ>wB^B>o5eD2y~^x(%jx0Xt8~d-EA6`Z7OYB{8UL)fQ(Au{vtv)4
zPNVj$IK;N|4D`_l9r1AI&a=-9vtr?ALdYEfDmAciDos&5Xp-?2$?{0|RXn-~nWZ2e
zC$`B)-?2ENZ^fDi^o{nKXOnQvkL#ky89$GRqg7`ju<9(4mNKx$B>f9T2d3E$2Y?BM
zfWhgWj#^}Uan$5|qyBzv>+?;9is`lXS1ki`_O^An-8(T4>(vgbt39=K41PCUx&2JO
zddSf$XYuQ=;<^)&-VW08Y@|Fi*_p7V?%5FvP)6@}M94~x+p<9jkKwFKj$4Y|E<+px
zVjhRfkc5p1duSrzQvbLMJ`;R$if0lCJ}EE$xdzl9@RF_r^#_C`3}C4NUqR;?kS`Vk
z);n$@OFa)P^*pfD941-`#|PmVo_PglV3Sh1UxSFkw2s2Gfx@&vVH(j!CSVu>%^zHd
zVaS94tr*=(B3oBE%c~ou)lV5rcH{8N_}bRqoedyym=_BjB5BLLB7{a6KM=vu%|vye
z%zOacf+aI?BZ~62PJ3=WsJ0{PZ2{^rW#-<tpsc-<)J}1uSdfqImez{NjsqY{4Rjj-
z-Ln4Y_lm_0X^`}J-Eo>G8Vcbf0!@XWt|c?zT_)wgtKttzYis^j9XF1S+^@>G1;NLq
zWa$I%6H}2Id)tXn`QAy4A}h&u?GA=Tq-N7HJ7_gYWqzZ{aQWVLJSg2eiMw__6|}Ps
zN4<<n&(STavsSwsmKWctA34nddsA0nf7PCydJd9^3hEZ}ix|Q4p`Utm?$+EZP>dbG
z=@8S#pfD8k{ATVwKri_pVT5yT=tb3wyQrNVbWy{gix;G_aC&BDcJ{&y{JW@{HsUH|
zFL681c2$RL7EsU}Tp|h9pCJ<$F##7ggNd2*6BjUXA)GT0f79?c=OVc~e07aqpGO93
zdIXT%2q3vpKyssi<Q4$QEh<bb0g_t+BzFmr+$H#=DLk79kX%k-$(+hk;|fcUt1L62
zu<V4&MkW<DI;pa;F@@#ER5pHDVH1~CHhE>9O<kR5)7LngVOc<m(}WbKi4IQ_9iAow
zpJ_7inI;3DX)^GcCIg>oGVqxu1D|O!@R=q9pJ_7inI;3DX)^GcCIg>oGVqzc%=s+8
z9zwe9Kde2?Pz~t_BK1*3>SKu1bBNT(5vfn0hIA4&q*L(VY=GXEYs)L)Biv`nGR8yi
z6H&Ht)9LwE<SC57Rj8C7ZA)WxmLRJ)JUI;Og!TmVN&^pR8;T>mvx~wlzoDa}hOG~k
zK>EFi&X!2}tkqrd@hpRNk8Q*?AKDp2;oD;yx$5o?i2=DINjrlI${pl75l7)e2?-yb
z^G_gl^ee{uog$Qw%n??7M|9mFa!7x_KA)h7#38q$Q~6PMH*gH)jzHpYfrgYy;aK{<
ztbwNL)BP~BPH~@U3YbwR6^=H<O=0*^ddX-5zYphykQ9pNJ=;=f=sW2-BsyqG59uQe
z&_Oq3%MJ`&$c@HUQ0j9-M;bOFLzqq!F7Xlv(IGMKo_%AGlUFG4<G>7aoMA<Jcgb1o
z^XlU;<@XKOxl7Js%y;Zd=heKn9`l^L+*zavq|HRQ^t<-;8NR_JJZQHXJ$EH#KtinS
zmUoJU2d>>POSMqr*Kw-H(s0<W_!)ik92_@lZF*HweJ^-D9N@p<$2e1&<l+}~`&2EA
z#UGX$w2+I6GG_R0pL(zvtPk<{#7U?5MvqUNZ*)!ZRp2_!yz#@lJ<oUV)B^X;kc*#m
z@6=z@y>nz>C5Kd~wgdsv5X*_cB5fF|4|(4WlLv`B^vzH*`m)GTRFRUteV6z!PtDLC
zElB;tr_S9(@is<~i%IiLmd9xKLpN#R!W=5N1p;$uN1ab%XKiH+oyia?rQ>cQ+ZSOu
zeqt^%10aW-oMKq0CwPF9B*P%1Z10sT+dEr#cZ$2aEZL4!N>u1j&26WJ`{A)laD3=F
zyKEyvUi4ZkG9G?e=%~^kv-|Fw?7RV0cDLTGfG`_AVFuRN*9e}W8YB{JdL-H)5*<f(
zZ9EwleH!PP0i;^^q}n7>ZT$#R{U*EAuO#FmAmpA|&uBo%%|79NC?QAayR;O6zHNks
zLhGnpJqho8j(MBB+X#P^!sZ(7@n+pU-q2IP6IM?)NZt&RkIsR^WUJltPj7IJEO>^T
zd>;C#N8@Mo>h<^p+ANNWz?R=fKlSJ=LHG^9`W5@hGiQ8C2*ssfEzAyI3%JRceD$f5
zs<c6o_>jy{R6HvnCdEq9ox?v}*Iltv?g@v~V1sMN`x^_^5MSVnOWc~qbz}$YC=Kf<
zt;%z1Gp=nY$ai9Lo|#j)-Q}$(n_GTxvp#P=J8p=JfsXXRIIs@vgILKzfk#1sC#rl`
zqRMx7b%iwZdQ>xSpq@5?t1BO0H~F<CMy4QsX2Q=jL7)^jAv2=CM>QF)CM2yg+y<^P
zRMO*C^?eJiFsuYTi6J_2ur|}=Iy@^KhdoP-^<3O_Aa<4fGqoA_pd30u8!l4GZ-t!|
zrux=v2z{GAfiO?p{Mhc+>Zd@&QF^nx?ZYpn40gt8({E;!(QlC%>B|tEZlt_#cQ$#Z
zPFD>ZU1hC7e|Ez50O9DyJ{KgckUpP04&s(H*X&cs0+Baj^CW_WjWtake}%I3Ot1A2
z?j@aSWG6Nrn#-vu|Gis9H0X=SvE2gt7D~Yz58ZYP<CR|B@%92uycr^Axl=b>+@c9h
z^}X)(40c1W7VevW3|}7F4(!8rud^elOj>74<uaIoAKoApCjM3mnRYXf&%MpTBmf1l
z2|5sdBO4|D);|OB@82|hUQ6D$i1>S)f0`seZ`UwwL`gsG8is-zM^VXmGz8YJb9mZ8
zgKA%wlH4t>?(LMy?yet8bi-AKZ2V;h+j#x0X5U%;&EV<P(Os-ifCB#@%f3CMaKs<g
z-7|7`3KjHb3hxx6{HOSiJt^8H1hG#^dQn{zit3`D9o40O|Bu4C%)oT&=*kn8^$-B=
z>m>3EPT^oc*fT-gL!mzdgo=c{(EcIWevq(7M%>}apN)iXzHlKr`=O(lq+Q?c)_S?}
zY4OpWt-{V)#dm@q4IkQ6a9zzOqLl-8^jx_1n(vxEF|_g0=H1+o)?tz}QD36Zs?AiT
zCk;nX8Tr`&>3Xd&F`0pnel2KC_xB|h>dLF2_w^lw613Sl77#{hjU1+mTKbIWFRl@?
zDIpj`u6YccA51MB38t1tgebfaY6eSTgck)6BFNEz2=$S9M3pjh6;McnH1CGVxuDoC
zCLzW%Ba06pNiv{_22ax?%1lykL~V0*4=WCj+Jf3kPbA6!PLxs3(BL(<o{|1NQG3F0
zAdYYhh}hhj3&XWl%FssJX1P+{Dc!wW+$pZHw0jttTf;d@?(L!>tXBcgvF!MT!;B3_
zhP)^uBjXv|MgR@uq}gX}sOj<`az*MaV4_q5Eeti^!f*&9bCy+M=qT>UN!(YX!{eU=
zSCE0-={P=G1QQg!p&}y)6h14IHVSu28yF@o*B$y)qEZdr^{wc5xGXYq)93Ud;t3Lv
z18YbC6XG~DUvs1enxjD3M~Wgvp=G7W^Jqyqq>_?P`+*_de7GdLkBFiuq^TR5Ib+}@
z=8`cnWE=$+lc6yvkiulBWN){!x9LvBMlp8U@}u$RqO}k|e_q%rnuw3Ts&@KYLFciJ
z;tsrPE#?QBL|-1)u(Lu(0q$ZL`hLz-*06&L(es}AzH7(?X8Pm>YnX?IYw+XJaABGQ
z@vrEQrd3+{XgYF&1_ilt&q5`eA3+OA5XKX<*C?dTk4xWQ?Z4QM{iOfmIoQvLD)G-f
z3Tk4aA1r)@s;jwmM_jMqaqmW@2{rr4r93P<^z7@gZP=hr?F}V+)-G<%oxdv=nc3JG
zn{$0}_yW(p0Ue+gaBAUbQhp*42`iQGbbuO*#FmPK7!ZdRQ$Y37Q87ULGl&6ay7u`x
zz$6emxdAYWW`xqUFC+*MFBmcK2|4wRMMIPMlcr&4N2cNaDy(Pn=|;=l{$P&s5MBSN
z*Nf#DH1~&%<@ws1I@%w>rp`dj&ez@48I8`UFAr%OrOi*7)@-!CwB5)^+k0h8#z8tc
z?U5Wd3^lx3`*U6(v7}!X()z^u4$g{3H&ntw#0G=JxvnlEWO6Sfh!KI-JROf8L9E}_
z*M7B${eZ7#XhVm_Jwm7Luv{Hg(Ut3+cCXizdS0`9Z)dAq-Y7D&=jIzkGo5rrMk!kN
z4g@~K;40GG>uJEL{ZwD`KW5#%F`o9slR@ik)IAeMHilzo!^6%)+^Yj43h{d}qBzf`
z+QYlv#_LFcca7J?yNSu6aDr0g5HQiV3m{VHCsmLnFyz_Z0}6R|dh85!T?)7MCvccl
zU+lwj<Jh$Y(aWU=#T}-jDNrX#H$l)f%JhP+^~(!q1PObk-C*$UA$Eg7VP8nZC@NEj
zXqOBbBnw3gQ}O)!JP*AP3L_a#74u91^rc!-tO(0<`YX|wM*Are?C(a%24Sv{WEa6)
zh`iw6fBfrD`evhj>iXrx%3FJ@_bSq@&hBCU9rUfUWIl)pCS?{|N4Cr&3t!4Z3tu;r
z%y}sjZEW3#(d<{|o%T{P%eTi(P{EFCl$#8f?v>*~;c3rptX$ZZjg_k>sqLMuhouLo
z$E1!YPde?d8^<6bQr{CnG4wy~7s59rgChKngkOf=5_%3h;g>-tLeEj}gEHuSHYoJI
zAnjLhzhb1n4z!YqRzl-s`oisYqtz>|jWoL3oyKvs^Q`RW_PNbse8h)zePo{CPRwb?
zc|B|3A-dkzGyr}*<KG`;=o^6Num$TEh75gIa<^c~UVn2#-`75DU8R%OwPDAsYiRLH
z3qDCEzB3o_-^H1k8P!Zkj|BKLy#G9V-@uS}&`9@n60c+a>ppO{(eKar$3N#+$>?{s
zf1@|6Fe8gWpcQ70;3*3Vvqx1H8&g<(>@|#jrxcc(QrY-|!X_3KHo2s*sU?+7Uz%q#
zm*?5+70xcO)bG#umtW*pLwNP^@6*(muyjf{J_$1?X=F|^XxN*@eeMz5=N?7F-Z3=n
z&7ooM`16A}+W98X&NoSRz83@Jeyw(`&(8O%i`?<}GPb-B#p<1EtBdSk#H7MA^!Q?H
z>j8_o_8nie+s85A1f;NOdv+hyR?^D`ex(2;*)7>=BhQ)e3U@y*Z5QKi+3r^j;8QDI
zJl6H0`}@eMbnp?{(rnjiU8nc|QTHX_Z5_wKZ+9Q|;RXTTltht|D9a9POQd|}1W8bY
z1%fmI>TnV;5DDrbA^`>fbvT#rD~{tF$mt}`eKt+gG);55ZJJ(bs~m09HcivCRns%+
z-KJ^s&+NVv04d2y{?C!V1!wo|dvD+F&g{(W?94F}*vfjOyZu)@S;G)68zui7_nJ-8
zj20Pxf10);lB4Jb^0d3XYcLYlNb70kO`MPz-ob`!;>GsZXB8Myu85>WXb56>CJ6)r
z1|^b)Ar$_*%tJ2A56KRfACh5YZlaqy9@)&X7|;qY&<Y>W3O~?_z|LVMI5ez;go4g5
z=z(9*1HYgLKtD-XxEzTH<C2Rg==>3`UE?x037!a@2upL5Ej*AI1|}Z2^@+!2eZt+=
zCx+WG<D%hq%)Ds09WyR^r3Vu8qE~t#F)sR~2NLrlHYf<RQG0r`s}QGQN|Uz`^z?y7
zCTMqZOE`>fOQP_Ieej6Ec$Z<Pve)(*f*#A_L-FDGuK4b$!49Y&wry8-t?b(W{2ePh
z+yuzwzpTf--@H&>Dr}t8>yG{Ah0H`^0naxX`^_89DtxhBERk62V=fK*r8D)P#$I#O
zZD#D=Yi16+a`Q;4t&~zgDpm;~U?3P27~^-Ur95F%Eu{z*b#PclmvN}2Jce4TY13Kt
zXx?^eDb4FtOKINT<~?YbX}5R`wUpd`4p`gI9r4gqz*I{a+s{HRCG5?`_L|e|(7pZa
zAG*k7sJR`lcDAW;ao?wXZSJxKw?2Y&#yA3?q5?vg@=GtJ8u9u-*7Y&z9soYkaz<*J
z@Kbx~Wh+bs;}kz)=_L*uYqvP{RNb^`zft3Mg1Y6#Or%K;7OR#m1RL5QV~Y()S34(b
zKEK#v6PwWJjz&=UrcGy{@Z67^Za!<%?P6On%?iCXd(TZmvg^=<X*R=%<G|F(VrA{-
z3EalAm=ML}O{~Mwe!FhiUDu2QUM()qY^>Hx>#L<=HF6R?DBAh(iPepw<8omYxE4F_
zgPUgsPZAI}O4yG#8O7oT346qr8(*pbPSjg$4jk6^?si)ELVLK>`<bU^*p>&d9X6`H
zro-SNOg|>zMdgzCNB4P6!&PehM{mTC!ygr@dkkdmCOy4GMSqRaF0>8fFtaq^Gc=fA
zUf?rerg6Y@4XCOYNUqNhd`1BHi~z_kz{G@tAiIP>b_s#(5(c>?4020^C|w=s)C~Ov
zs4bp~du*MT!=0kFlP+e`6;a1bnkm3|oK>9Mtz+_VdD$c6dNIAcM_|}0)iE;`2q};g
zWQi=(`dL~(XACnhiHPK0K-+S?R6pli5(jt2D`%q;I#ewzqk9i1;ey>Q`sz6HD2#gq
z8{8?5|60>QG$34eWxW`T0>d+4aFSfbhuQhcnOr4^5KO0ywQ{Z!Fp9Ba*uEg{Yi|c*
z&&h!Ne8*h$z+4<Q=A!gmZS4JAWG-&yv#*6+9)9u@mn-HZ<t7U)e&J^bXQ}X;O^qtX
z>}}4YckUrvWz1iqs^$+qhg0JnL%4I;?pMLLnU1&jkdeKF4FMK}2GI@(>8sCh_vJU-
zeFY46UqQp&SIBVp6(&j;X1wrA5GB&pS0_<Ay8sKi0SkJF0w|{R!l?B16QzHEC<EJw
z0y4I;eFsr?41)B&lPEg@TL3p(uw}@`mZ6oQ{rH2}!W`Qw2Rd7jWo%M$porHjG>u;u
z7ZcgB#l>q*7nit17U>4ZL>z0Sld~>R+<+A^Q9cQrqQEfeo_4*0xS&-FXV6yGYns0X
zmN9DQTB%$x_rk=S&Q+{d6xJ~`hPGZU;@=ibTrMsNpFTw(;sz9zx8w{2#F!GYWZn=&
z12UUMyo?zScGQj-MP~J&kr(wN7S77=?{ed{EbM5iRFl*I8>g)!swe6pN3Y~67V3ut
zcFRu6RU(cYUcG#h&`JYBX3sh_d2&s<((qufN_N|4x`c8#u4kqb7$(9`G2w=f^=YhM
zW8%aF+paO;wUdeC5^PvwyEG;QW;UX+y&AhhV?t(TS842N8jEY}>OF{83^5QfpGk-K
z3{jNH)dx5a1KkDox_%VIPef&)VQ?d`I0gVq7yKK7KOT>Gq+QUqoOnFO4^<hH4`sme
zKqZO-Jyk{f@ST8fUJk{=BbEcEs#o0J{440jHRRg;gzWQqfHy|77@!p@&<GFE3Jx?v
z3lYT&^uY)8!4LEy0Q4aU^dSWFAq?~(0`#E+=tC6f1G-u51p3eg^r0K*Ll4l0UZ4+s
zKp*;nJ`6xNZW{)gu?uL%ZlD=^fM$#kWoR!@`zwgD3pm6mbog!uJ8sgD-8K!`x3X_P
z{vZu;Fyf&;2ML+2;<_jBWNb2+Tma5^F_AfxPG%J+CGaPXrLyvZuW+_h6Q%xJ7l4bN
z&!lEE{ugZkB2>%p7=w;DNK(l4lAnQnxag3hhvtga+Imqa^XIA+Y&v|#W(<ntOe`84
zSSb}(fj2!;DxSgZ4dd<!Jmggktf00nT`Zrh>;Ae$F}vHou$2%Dw5`{~8w8qp1N#US
z@&<lG*i!^z;yNqvR;-s+iE1D~n83OxB@+$p{yeZ~0t<;EBMcshG7L>|P>)4?#;GRe
zn3(QC@Y#dlkTG1A`P)03qk#RYwDh!d7@8L{2Zi=7mq3myFBLtQuadLm9A6b3FBdH?
zRhqmA(|EP!t!<pB<NggREHC@Ys1{i*-Ck_s@3!F6{Gx5{5F;4GvL(PslheK}iFB8P
z${O4d5p>VwqbvXq?+S`Wm`QYjPcn(0;FRQ#6cMb;mY^WKp^|PGX>S-<BNbR950E<!
zWDnUQUl2$fkh=hoyC9Ie5Rkhtkh=(wyAB|CQ6P6Qm>WQ%w5UqGQ4b@XZAew8JqN^j
zFZgkiDx3pXbvfq1JoIt_3D4Hp=d<cH%?KQJ&zaJ4UFUicT?VPE#g)28cn@Or$~r$$
zsn;uO8h~lI5Rln<Q4{wI<y_H9wdC4*{hSwOfdI5pc?Bm~(D*ASrkqg$`NxzGfC!e#
zwU7yj;-HzsW(UQjtw~(=TbY_?Ly%TueqQoK3|n2%L>KmKN*8`YGJ~~0c-5r}52_-$
ze${dUZc(5u0A>gQZ2(jBweUq0J3)^CJ$Q%55-FM>3O_29@`d14@N=#p`>rJFZa@&<
z6?nKxGh7CH4VS?_!)34^T?QLcbkLBZLxvO`Mk$&p(FjP=5s;)iC`i&w>5fvRC(4vw
zK&C!GrhY)C0pK0B0q?LKc!wP@dV|0_>;&Fn2zZBK;2m}W@30$qhdsbMj6jd>1>WHb
z;2rh>)xENfRDPw6c)M42@5i4e`}Te(-r0&B_da)MQvQ|Gu2oEzC!5`R6dO6c7g_Mu
z#O3gk>-Lxw=!<1k*~teCIE&mb3#^yU7FWkHC}GXJX1uQRWU(%`+2M6o6V}@`!Dnl!
z+F0|sG((aP_Xt8CGZ0I4Q+ZV!<dZ=b)DBIJYHCbV1(jF3BQ}<px*N$9s|Mq2PG*i6
zgFl=|nHKqGIVpv|#tspxIM~jIHB3YeCZQK5pbsXXAE<W#CSMRHUkG=lNJq;=3Ab0@
zbl4Lm7IRFL1w3KdB#xS5rZwEs%DPo5HBBiDHc1wSUAbCNNME_inL>5BrWvnm9h{(X
z#U&zXk{yydI~X1J0xUKqxFX_NAYlQ~MMWaup+X&D$PgyGL?Y19$P0NehJbse^R(f8
zR2T2#xj65$&nf0xDz0OT$c8KYxcJL&lYeBtwd?bCY*A1k-*~ZprdTXnd=V~<<aTn#
z;EF=>PZpM&YH``WTtN>R%NwvhEmbSEnvt<tBTeYY#?JxIwNw>83;+hv-h`2nvbZW<
zE}lfoPPv%*%f&)9DL~B_?56eYqH3{_`MnN~3rBlbYe2G}_#(FxB@_x`CL5B!TREjS
z0aa0jA9{PKGq0-XpT+eU;jKmfc&v*Y-loAc#^7>H^QaQSVo{TEe7rpQ?KO;6M#$bP
zhzEC`0|Nnc#0@V6YT$t-iHA^pWx(tKWq>8gk5mDcqY&_PVOWMDuncv;G8BbnC<e<=
zCoDr<cq$K;p&nR<dSMyrgJq~6mZ1SyhPJ^nv>nLQ4#k6~$rU_IuAr}21*KL$APN~I
z9)s9;07<Swx$XQOvPapYj58G9&I3q92BbL5Kz3XPfg7~3$Fa$3iEmuJ`bR(dk%o%p
zL1T+zML5-}-8_zGG^B?u*A|5^<TBi&mCEH})n)Y^ay=wCUaGGZ*5y-du|gnKSO->d
zRd}()WysDZaQh)p(+kU$Gvbl~i*nD2)s5;g@q65Rs$5w*RoSR(h!7=YGV4`=ied*>
zVnV?29j(aF;kfEx`cTmBb-DVw^iT~F85knNcBFnm1;uW`6ETc%7(}HmV;JFD71LRT
z{~At6VlGq`fU6s)TbHx~sM+BjgSq3(c?nlZt~&I)+sO7Eq+3KB=zlVy8~_0#fB+q^
zEJgtdV!)Gi0#DWjJXv=Pc(WMrW}OsxGX`AJuri?FE4y2^MYq{IX+0}FO@{K_jxFGU
zrb+6UU&<D9&k$T&V|6$yHHo0AC4#EfE-!KI^fHw02{l~2w~^VHjeTOb7k->Fn-O|)
zc=K<%RZeV{o;|8?^sKlrqfVy|O(PPzKew~ZZBO-}lc-)B-2CIk+2~XzgSOm)(s*VU
za>;oQU_8(wj8UgzpgD6>)b*f_<_A616=@8e07m<odIQLun*>|VakrZ64jO5aMu`A^
z`+;rjUhRub`?rBj_it^z7&35_?lX2)1;t?|RbtJYx<f;z2Da3Y4ZAdCPLknkihQQ7
zsN%=9`40cWJKcRMmK4ce8(r(MJ)CUOtA>arJ2Kkxl-B<2X{pnsR`A+t1^XD9pSvRE
zIz@MJAwYs5AnMp_=#Pe~&}$wv=uz;5SxYZD?Dz#ub&w(Z_?NI(>2K+$^6ARz28wp>
zDJZ+E)u;Q#`%aU8jv0TCYs;n6rCOz`o+uS+Av7;9R!<k@I={4vE@Fi|>nRu|vg4bY
z)wbiC>Nq;yE8WI9mv-&qd%(iKM-L8wPf&cq@NC6CAI|n*5I1Vk0L#=Nir~d!=saX=
zfEgMU8!%NVb{$iVA|%!*$2F%@GmH_uhB1QAFh=kj#t4_JMj2MR6ts1Sw#=OFCU<ZS
zqUHAWzGJt0;z&Kmk`QKQnipq78RD0-LwE#k)<}vOW%>a&LS>(+7S=B|$$S9Gycd#q
zlwWL;mZ2fXY_Q2<S6#ys$t@GDyX|MR*;r^>PfR$?RC5Slg<ZCyLlu5w)qv({r{YjW
z<X%-c=I~$)6La3dLX2lnRhV}uURw^>h^7B?vxpY^X8{)bX92CeVhf8nK(=isF)hGh
z-u=W_M04K7wwias7m<q<jM;QOa>XS~yBQc;_2_(JP7zbcGm%cr%t_k9Q-?CM^GRMh
z34(diGclW<oj1&#+A$RUn?C<%EXtQhy&B)Ut%>oPtX9^uLeAPm=6jN2o(r=ajEP?_
zEgR>3By+d9G$#?Vqq&8xxY*rXrHSr$UpC!$!~z*WWC%#=j~u=Vco;BcIa7`^tle7)
z{iUo57U^#VtmUC)RS<zgIt8cN`x9Fgnw9IrN}qxoU7ao1+TY|M$F)kB5%)ZI-0=fV
z9Lw!%VsH<wTJz0G_Ah6?Z8pI!ZC3g17PR4r?Tbw_DRy}?Nmy-*ElDr>f}xb*?D5Lk
zgY$<n_q?&DODnL&<gn_PlS9}rc8JLl{jn#<uo6?yFJec_B<O59z3iF<ruth|uLiQS
zqe<AcYzbSnO_I<2NvWH-m?kwY=1GlL(Y~T~+1jMeHtlU=Lf)oUlXj`+$!nJws#<Mo
zgyddomIO7D=W&o8;lGRNm0E!xPn{%qg)XtQ_5Re<NhUSw+KL*9J#rWC(B+<pL+vM`
zgChN8=AkkD<h*lEIAcay^R#6G8k4l$JdCwAw{;r!wpMy7%)%|ETI;3O$=6!vXL1&z
z;AD8`I=Naofg3}@<O}r^tA%={s<g93U2=p$2En=B>~sZZY5&P$Jz*aA5RR&gsmV-X
ztyuF*UU#BUD|Se5vQ${Amg=RYT38kwE|f*AmXOS5&#j%Ptk$}W8}$NiNfoO{(JUld
z-dHPEOH1fXp-=@mzT63)Q=eTgig{a>uAyRZ159UUJG!gI7i|=4_2RO#R9h0yF?YH;
z+w_gs?3*^bTIMC!E@rP}`b6MQ#xKu|NJS-nk7@2j6~?HSXk;rcZEFV3Oq8R+r8K*w
z9>$!LwzDhXQ78sgW?sXT$Y+=m!K6j&2p>#ZKTO&HOxhq!+7L|IFicu8VPUdHqrjcS
z2(HN>Vi653AG@uP%C>46g-K6H$PDMd{FNz6uQX&YLv#?_9Q>f@;E0@TdOB=BXHgu|
zva|E(mQyh&sCOojo0x_YG%8rqaZ^&x;C4eCbUy0xeHjLR>b?xG9BJDD8&#muOXsG<
zsX$yjE`q(59@nKu>yoDmE#LOy;l?u5uD3eP_s$inwc>oSwz0Ye`bU<G+Nta;MsN(9
zd5Puiu(v&`w!!I+72(36QZB4cmQI%HwZKNLc&J+0SjT`%Ck<du^iA2nEUF-#=~yl<
zmDUQY*&^URj(gOsYn6n>4mjYsY-W#{b@zFXG_r3l4nW^x(23iM)k>&dg>Er2wLq;{
zH|uiQ@4Mt5oU}(vb$!CsJ*ir@uu}A_V^2q0#=D&svbm0nG==1ryG5ED<}XB0C-uiR
zLs!uZeZ(?Y6;X$nn-(c9l_Ofpm?uD_M1dwV9<8mSvbBx{SkEy5N#-c?aVnxI<3djS
z<`YD@B!YX%75m80FcQIG^xK4yHGsHzfVgoWZW^q@URZ^FunPNO6%KU5s@(~zb{DML
zU9f6*0}<?oRl5gP?H*XQdtue?g;l!`R_#7mwfm{k*Uyyx0jdlPFlE~|s%+oJU?nEX
z;0~hf93;xnPNED0@!aJl%5H@Okbv$XLxO;+P6A4)>IoVIbc%|A+B=b`N;f)FUOXYY
zr~UT(kVQ`{|2d{Qt36$D;J2bW?0-!CsPIyBy0E(8K<Z6tY&)vaMu=%s%fUWMm#D-o
z1)FY+q-hYWG1LpRm`Yn)vFK5AxeJm|m}p+HkAb^CT$t+``xsiQJ+yndB4W96m<9<q
zsPKcm>+qMgyDhbz#A7I>wc;gHYZZ8I*~x7ww2BWDdy#%*<(CV{qC0gMo73bUi|9sc
zA~b{emTdjpYOxlC7g;&X;AN39NSsgpS;$R<PKwZ4bzQCvkULr|o?0%Pv+`4=YRxQ+
zowQ$NQ1Mu;rKsI(i?;N38(P^?$3-jAinHIv#u3TJUFKmO6-i{LNf1FOK%S0j$kjRd
zGkGA!q;a?>DSm)|V00f1;ISJUR7~oK$9Hg>To5$wHKzFx8Qw*D`;eeT@ElBlN<*R$
zFf(DeIYJa~2VfF#ZGPa|0-Zz&b`d4iO_XpCQ6hjl9Uh`YjWaAU(koEI<0M3?s(QjE
zYJ7EyGQ<rZqXsFuV#<T0$Zr+wl?5>yd-_)T_Tvv?Pp^a7YfF>NvBG&WAtT1}so8np
z@)To|`Lnr1W-^hU%_JQNu?5%H+3uN7LFO;CB{{*y3tSVn35p;HQRsw2i;3~^`Q(vQ
zBA1%YbRaEBoH$V}o-T>|W7%oom|b<EH63_oXQeGVFWU0{r@E~J9vT|nswd@FOe|z`
zvoi``+NjklYby4nAjF0t49CEt8*3iXeIC(cY6hm9THboHh1_p(_Ep&Q^WEg)OE}|e
z>M^-?DZ*;6t+N3S_wXS0o@Vvl@WmWNZPk;TEOA%1MbdQZvf|Cm8ctHQaz!||=vl~u
zShhHoNT<gW6NeX%Cgw9x(6v#6uA3^XuAV3?ojO{mmLc0M>rN)85)0{^S+!GCoh+^t
zfIBd12Idm;*`$1xU$D#KWzmI9c42M~#ws}}FLrE{Ya8q9FmA<VQ6(md7bj*XlZy+P
z!<pHmnGWG|1*MgR@~Lv=Ou1_=k;7wji`nCuT;iB~QfytWKiPAzBA*q{>YYi>%+4QQ
zgm0Uj5J)AfcCQuJD%Ep|)m0;Qz3hopI-NX}NG~Sl4=v1~pMFuftF*cb(#C3{dU69-
zdr`N0d|_%TIWHXSO{Hg#%Br0wHda=ORrIm9vRXMKzbBPBl1Qf}7oo}XivTVpJ4$6>
z(@M*UdcArC`L*uM!pwN<)5?OqYyY%~>BRiv)a*iL(tH{!W~R_^zbiM74so!H?OL&V
zbwe2a+x7ZWnaSia^dq=9JGD5DwX#P4l*-G+v$GrZ*%f&dK)kziE}h6BkzY*ArC`FO
z(#gr_Itc1W@S$i5c$?yK$3iA~Y%V#0ug}dMPG%w-<>Fa9DNtO_RZbPRqGFwGW~>W0
z_qronTvnWIhQ6zs@VB!|;%^l2Hzx2mCh#{V@HZy#HzwS}#e{pfm~aml6Yk++!aZC}
zxQB}g_i!=c9xf)_!^MPqxR{6y9TTykV|$PebXs(v^#3a+^j7p_6AjO{wpvM(?bHkc
zp!iBxFH5v<cRIn?LB|Ld;#k&7VW}t?YQt%yQ)$_69*f7IfPh0)lku&oWmwYMvB&{n
zN7IG!$&JFvqE8%AIf+M50Lm^^OY3z%Kt~GIQlVV$0Pt|}90t%62v-Z0YT}eyu7c;*
z+Ugn2uXQRI%`(>smLAiqv9#eLm$sj*_J)LGSKJ6>`v@$t!eJ9Le7iO$!-kz`W&~2P
z=Nt7PQ|a^J;c8$i1HcplH_Cyr)PS+{0%Pd|#u6i~1WcaDi!5Z&u=SBM(dqKZEzzn%
zq7Am^iA?*S;m5y3&wrWT@fCXhYxL0{vd14(_kSz+z0ebp3$Y8G7rHKVU+B5ed!g?_
z|Am3`+t2TKeDH~(M~A<4?W6m@IC_5U{PiEb;fWj1->4{8>}@ycG6knbNjN!9F3iu)
zB@-DXn3zwDrzRGGkfkQNlgD!Cwg@P#qm*S1&-y2mM-rLDp~QSj8&76{#HYN67UpLb
z4o@R+3)Ii0JhStu;|WhLF_TL3Tr$0IXhA!i$Yc_e3Exa2oj49@M$JtpQY@XA)pDuv
zBrv$z%<)8KCNUp0{w`*x6B*Cp>6zrbZw7dk*>no>>D0{lLLieox|mC(7GVYOjzb$V
z$!yY>1*)4sh^LctK(4*BX`tGv!zp$ok@9B~3-gKWbZ$Q3Jq#_FUQDM{s5Ik8=5q09
zYBD#i&1Pp3nd1qeJ8U<RW34^tqN#i2;YQjl#Q(&PelR@T*hGML?Un=>cX5U_G&LUf
zqN(w)j{yN5_A?;B!vO{acsR&_01t;45a8i30|Go8VL*U~I~Wk);V1(FJRD;{fQLI7
z5a8i11_XGxn*jkH?qNWHhkIF!$A<e@C+{5YXI;E&cz|{D?%{2$hxZI`XT7|4cn9m_
zeZzySpZ5>%WCMI)c!+J|+lC3-&bJR!wuA2&W^9lT4y$Y@-#H9;$%lqH8b<H3Nc%U4
zu#Dc1w0-1TK_u=Y-wPpiA9*5z<bC8q4C(vGg-#^!BNw`m!jD|&MiM`Ap$BRF$c0`c
z@*@`nl^?m#k7R!2!T{3wk@MS;(2tzofs}sa@j)c@BTo$J(R^&=(P2H7?;QEowR&g1
zYvj@WdRM-C<cp(vcfM!j{FvU8?;SaRz22Me8~NxBdSAYO<cS;g{`|nm`5X0t{I;u!
zzAeA~YN~I~@3@-jJMx29tNLJm=hYs4XMX5vF4R_=E+@{jk-O~WWbf{_m@U|wA5&Z2
zRv3~`c51d{$xlfI^Z!rp-DPH-eYd%KTPmsp;#b~bsD4uAy5CR&;dyEa${LZTVQE#=
zbT!p*scF!~|IYR*ZS|54?Qg2mR#BxrytyX(C#At|QCt%*R`N09aH%*xN|?{Q5j8x!
z$(|9iV-OeP9e7j>1Hpu-;t5lQhnb>9C@jVd7GtXTL52)OsS=DbB^0AdIL4GnCsjH+
znG)@yO00`1o!wOF>SjuJ4^?`4n9|!zmA+o4^h4(k^b=*<08zGYBT{8e(K{0H<FY<P
zcC_yCwNX(!ye18<4DQDt#Mm9CLGO?7JeaMP?r5v=XhAZUQrf~+sgXt%P!*;fh!x&q
zd07CLh`Ozc!j?Ks77hM3Drw88L7r2<;EZ0>bC@0<jJd$@q>C}AArg)duP-2CJQ><)
zbo@q8^`^kR-c}8DlNyc)H5|9Q+Y!^%3a1VKx^}kfVM+ILK<#Q5RZa^Y`lmzQ0`*F|
zat83cP(yfOeO<!s#xLM#bDNWPj;k)JfjXB^d#Yh=)2m1|{F~xGYGaKb)f_<)7$Fcu
zwB+XKd2u@(cw|3nZPE7%@gVB>NZ^uC$Ki#=5n0O_SSx0jH=<^$aC2f~xm1}fV#KRz
zXmU0^etdB<btsifq?O=gW%a~4v0@ZfW3Fq9bLoX_hx7W}>PC%C=CT1uiy&ZQxMn}V
z$+N;E|8^{%o?OIpVT*8WHoYL!9f^g>)NCJIoSvKpc?ZzNI1?e-)oI){lgQ@KixF1t
z5S3?Oz7(sXlIa}A@l`?RSGBnE^t+?;$k;Bzk0*^bv40Y~(6w<>yfjV3OY@=ptp!m2
z)<P&fdo330iWccv6VkI!NY4QwJ%@z7^QO#7J6xpaBZ_ie%sGM+fCANm;y&@>><un!
zI5E*d1TW>xgYDv>ec<Ib$nQa^xE3hYvZnS71z*{c5c)<hPZz4o=*%@F!YY*N=hA41
z=sQs;FAI+@ez{3lpPI|EmGzq8;Kd_UKOLuv=S0LG5tjidxOcTuSw~G^V6B4FM?5Pe
zVN|15HtL?W4QPds)-7ju*2y#RMxWemuT`p@H6f3?UV(e@Y2z(g4fmy%i(&ECdZ8b(
z#<9kZ<!a$fu3~p*M0(M)`Yb5(vbWr!0x#<RHz4~_kf?w>s?`(d3H3yJqP?D;Yh?@w
z_pvQ0Edh(;32VGV(;O0#_p&{}Y#JfLw_l?NcA7L$G5nQ^Lt=&}B4PGxurU^FCfWoW
z)=7%BaZe2<2q8QluX;3%BNzw(LZg>C!UO;{ytt+B^NZhrL2yUO*g?Yf1^kMq4|p98
ze2x~wxDHgtbpXC506a|)_?b{2@IL)ii3|YmvyCdz?ZEr&pi1W;@IE_<(hVfOXP79x
zyNJ@an<)KzfcF^z-e)iHK3CvTc{LbgBotF=IO<`MC|Aj#;USVa55Jk-dIkCqHbp&f
zIDE6cMxuw+ZYK$t9=-mcn1EV3c_f)$JfM&RUIQGb2Tu45c<}%`aLoZLHww8?D>nwY
zG2;QF#4I0$dq%B$M&X{(YetP)V`R)IAA?$BR;@9pHD=X1NDdn12cgzMtJXoNb<nDH
z9l6dZzYc0$cg=w|WZh?dXN!WM>&Ylx+X?)!PD$}QfZ|65#g7V#9~BzcsL;4Zg~l~1
zG_Fyhag7R%YgA}lqe9~v6&ly5(6~m0#x*K5u2G?JjqbwLB4(`?OFw;G>sBj`IKu=#
zxY9UIF9mv=C)r%JvQk<tddCylBr1p$?+IYEK%OhAGl^72T`QEzZ3Zsjxc8~JWqQ@_
z<_{JAz~MuRg|%!^7+V30>-Y-i*IB*cU0jz}?TKn*krAL&dK$;Qq9qM$C5}v(9p+$T
zhxK}W{pM@0Ei6|~6t7vTtX&K1>$Ri%_g{bQiH*`Kv`6%}N9=oqTsuFS(FQ*TSd*JF
zCRMOVf=v%>T42)wlLpv0Z{oX+?KY;HSZ?FEjo&72+n6n*su}^yuoEKaOHH;|bXe~u
zz2DiU%n?>x?V(;|()Z%J$IR$`(g=f^Ou8C!i1wFjswUl~#)RwCy>_4x%iW^SPIM48
z-f|V(y$8KFp&NJ~Mh5XIJ9jC<Qg;}5{avP{wp+ycvlj*2&gOlRvwuEWAuCj8=keh9
ziX*_T@4T?s76CPyBK^4{?s`<_;oqj`_kVfHugIr;==G<sIvoou%9U1G0Lo%fMKJ@A
zk9<86k4=Tym0uC>jeOX;<tum#mUYOo0G5e@XmdfVxuCPTpsTsS(_GNqT+q{8(A!+l
z*IdxwTrkjFu&udZdvn2#54U#EZtNfoYkU4HG6agfe2=V*?0^2Al|AA|EZ@5wmIa+o
zf|HsYOO;nDinmrNpG1k)pa{HBtz#tF!s>~QHT7JvP(}N5#B|TeV!2xMp!20uPEw>9
zk80yU%edlDMFiYl6Pgt3!fOJvrnkdgs2`mn5UHoYKnD2Z!5?8!r^yp!;vSgB7xNnG
zAkJ+)XQ8SGM4qd9oE<h(TB=so^-8(8h1lb_Ygx)3vty<B6VBr1vE}xy-@YMP*73B<
z^6WbD_O(`FMi{19)w>~Q-eQ-k7=^;1aw{lF)aFntv~;Ri4;9N;ZpaGV<w~hm#Al<Z
zYzh;;Vj1-$M-r262}wN(i>wrb93oAy1{4(DFRFx%j3N2NHfqJ>l3sDVAzX8PdZg(7
zV5G`f#{;_|ztHj!Qz9CNZ@NqgCSrG!rD#DZW{(UI)lPP?yt@7PJ3T5ge!E-66mddU
z{1w+)HMUzEp0Lg}x~z;%XMd)oW9GevgrW#Ftq+A1&1iv#n(|E`V7sPdXm9M<{$v!k
zAk=hrGo=dzo9<q;F{aYS7zCSs5NrlOu-UeqDceD~*|CEugM&ob2?EX#2sp!v>IWev
z076U<gqRQtF}p4*#O$)Epa`Gj3f<-qVxqg+BejJ}fFc30lQ_9Bmrfp2{AjH<xv{=l
zJR6u!q^FE>zg}2fk;U3{GBKG=<}|%nScd5t%+4hfhm-S*GYh$7ptfEtoGMml0BhLn
z)D)|%thC`)d)l|;XWj_QRFiMk-3IO};c~^c9R~7(z9*c@BX1GNz+9oOBU$Y%1Gy@p
z$3NiWL}*L<w3oNAQLh{VY85Hfj#NrZ#mQn_*x5LHdvmJm=x})yAtVTcbqvri7A~vv
zgE9tH$Xc=}+Qd?U$I=gt;-S)z+XnEGqMFQFAc!O7M>|?>L{ZU<C@Nkfii*#Oq5@(H
zU?&NZ0E}5^tL06Ygg+k!bBd5F<5UJ!1F6O?M0b*QJq?TY{7A-EGwW$aJ&yH)qR59u
zSI9_fW;LHt&1+W+nALoCwSZC0Z@)EYy)|Ih3mWx;TPu~-FMORU#zJj|evy+*EU=1C
z7L|*2|H6EFUaIw-b08+_r7MMH40~K|6Ro|)(SyOxNY|rnm6D#7)k*;f06uyGCRQ2N
zMfZZwHma-9QVrVVjLT{`%!Ji`Tv*E?bvOYJt%>$6`vsh<)C;Suv^=K5OO|)y4<0eZ
zg|WD728Xbk(uLROCT3iPD(YMDq-?FI!3X0Otw*%)GM7@n{6btsy_PeVaL+Ix%#Id!
zE`IdrB1Iuj#Mt6&a_6F=I~PqI(9~_3x?NLuph>zaL?OOQQ+IdBa}(%DOL|asdS+G~
zYaJ@!d{~VHgVYCDHROR`asHNd5cEXE0v;`BM1_F|!7|7^eh~wLi4|Bzb{W{_1K9}A
z`qMCmNe8TiWzQ4ExU5vhW$glL+)WgJ4{)@-L_r59p?;!(v_c|epylvu#9pAbuWa9s
z!2-pPSfB=MirLxMGMSB;WS+Zr&f=!oC26IpX>MY;yy&NV4pt+d@KuhGTB}#qUDNe4
zCqmSDuY;>n1@R0Tl5wm3j6BChBR*&70NWLsaroJC?$tq1+vN|SSc}fRfQ&K^Q&gau
z!X=s)MOlS-9jw14*1FgP@1;a0Lnk^tt)qZUwLg<gr;pFfW|Q-ZKT}*?JvRfmRQ14;
zpFHNtt{01ERY1Cgy1uklKxhG>jW#R3-+t)Nn4=u}9q4QSU`q$NXsP0tcE2bNL}2bL
zotmqxmX^*<p*l{^<8}g6JF4tlk_~5#tkqc~(g#>@y&?pQoKYU(6O0P$ecTyUrFbZf
z_8qGyW%dTOPC%@t7dO?%S=-w>NoGoCi&e#v{kA~Wrp2cHdgAEBCS;BlaJz91$T{u}
zA+OjA5?59-n}V~Ms#FC7q#=$cR#zi<jvTnqEZQAcH`clf)uL!p&AAf!?ayc<LD?5w
z5)__!>u8ps)J+WK7>Z9}YtP#4f8X?#FZ>%&!|y($@FJl67|z?;(?PP(MY?-PI09rL
z2t0%aQiIkBQy}JH-cGLiVw%U->E-^IPxE*By@6=J7mNn|p=c<8h72uQf}jfvLiPj@
zkvQQ8Cx97*RRo=j4z$bwNBlzcwYOGe>+Ueiek8-v#x@{9VRaj<O50nJ2~=%E+^yzN
zYrH{sh0D{tL<}qvrxVdxrDZs9S%5=rgA^)A#1SzCd0!yP3JA3d2UZu}4ulR^TVQql
z!0G}I2uz>pMZS#=r!AU>x7OvL|7JIq)(a<#La(c|-E5X>V&NnYvAE4Hv&~uhGR3;o
z4!7C*_MR>k&&*Y-bsT^7_DW^Vvs_%S>;BXDa^WZ<Ai!y{#~ct&PqOO;K*UI)UN0=^
z*3*MBFQ4nTzu<E9ANHMMUib_{6K{{dC)m?xx#E*#RYTs*6VUjU=4rfF(@=-q;atZz
zi>YBDw`y~5xNgCZ%k6SB=JNvcbtxW7fI$m{sU1H?FkjJ&FaZu$Ozc7lH;(Y*^5BSj
zQM=mD9K)WdgnBfe6--v~S+QgTo5YxHC-}F2>{D*XiakNU2hSgHiCPkmT8vOH5kvgT
z#S^QQrBl!&zS>%)Qb!jUo1h2CEFkW0i5MQynyq4s7@gXTDK0c}3OP2ac%{o<K$Tb@
z>FL3+)DFkL>Lym<YE<(GMWNOmGz1tTA}SevfZb?f^1Rf*61n{0O}(VApM=6bt`J{4
zJ%JCspa9nxATp>DY86Pxl0ZCMB0<28FfJCf)~M2Y$e#Sco|chz?I0==IKAY}&dw(@
z+1ZRYTd5YywMv;CnY+Fn$7?^tHNAaJ2QiJa@=Y^*(}S4W#SUU>PtE~%Z_D=^M{FF(
ztvIpU+Y&Q6ut}8YcH7mCH~b77Q|;c_rgvOB*G(EdY3(GOg-N3-VP9nk0)|DDZHLuj
zYbCcdEDul85=ydDw*6CE3o1uDx7g2>JW|Z^VCWI7k+kPfO=ii7=3$eYMFe;0|3qRA
z*iZ)o{{wiAvMVYHJ=9z;J1~^8Q~+w!2>wKyV(kE8hXJu8#83csT$Tb*sMwfY$gRRn
zRDf2Y&no10q2DUh?81Om=xtK)3H76os-}W3Y$*bnS=3<^In;pBRyE)zv4gq{g^6K<
zP`x=<#7S4Lo>Q6xP3Lx;cWR?7!=u46P@XANL2U9ZRmx?dEQU!1at=JBv=l}#i*-b{
zr&>H&LOalj%Gw%C*J()b(!Pyy`wL-r<9t@*+699$uQ}LuRQiWEW!tSaN9+OkoQf3a
zT?IrZbe}J^VN~^){Ff;|30vS`2uKG=^qiyo6qE6Xd{M6YVfhL~y_|SSu!S4fTr<vV
zk5XtQv>$(Pl!6Xnd0Vg96F>uC0B)W`;FijXW=i4Q^0cJm^}>3wDp>)fA%2k;Tmpb6
zi}H#OLCHE)>{y|ub3$Qlui|J*W~H#aJO}mN3<J+X`|8EEqCwdG0TJ^9jI9H&nZFda
zTrw2Vp3a_b!FhL^R7Vp78WB3uF3r<pk{{=YhYa%L>D4%HI|eP%qZp*enN;JN5Wl$Q
zMI(RdgiubGSf@_|M%(3t19$wW+X)Bo9xy+Eu|Ny5pxbW5)cdQZ-k-YoZHAU5ZAgz<
z=yj4Fv(QC)%t9CGF$)70mGNSsY)Z)9g22VGiSl^NBAfEK-Ss-G(_H3h-oZ^~vAL0D
z&e)Ksk*G;y+>1;d*CK=w5Ijz0id0KOKckB%Ic7|i5mppj^Kk@NvrY>Tz3qDLhz8-@
z7Bxkk*6*?r$(K%KCbJWXIS_SLfx6X}013V5xL`h!%6SoEtA&!ei_-MTooycYloN8`
zU%%nUuU1^z07`J~=80mpURo(F34cMzooTuGg)A_1idL^~;879HaLJ%;NKXu!;g3Kw
zoDgWqV{@tb<fK+SyI!gmmqVG^+~V<MZc)?<0QEbLhq9q&Y;Hc4nMlng(u*^xtZ)w)
z#SUC5tru2jN;TmpFuIU2TCkW+9m*u<vmF~{qbb?a$#St;)8>;$W)H&~tHslmQ}9NI
zhlErnXgf!+EGNV6ua35SwQH<;<i_Zh)~^iBBANzJ?sWoA!T|ck0Qv=&>K7_&zu1-b
z3qx1GFm&|`Ls!2rboF=PPzS7`zUj%DuWmIdHaWf$-P1HFj$OBZKhSiX*c+vqUR*{C
zD#eUhjRsSdvN#1<sh%v9jdMU)(Bmv9tS*#Gbu12|(+y-{G1CbvRlPWio7<;h?1lT9
zz)}SVSzNbb*fkAWciUFAiOkTp-sPzZT_K-0O%6?<i1$o|>oZi-D|mWLXaa%f{fWhU
zhJV`!TZif<$80v-sk;QQCZ+o&b*pe~rkw_4L+706&Y`d>xy|kxAR(YkwU}5v34BOh
zUz<%$_O+JI6+lp_@lvg}0eqrB$xNj_UR(h&I%H-OE5K4}wGA<d+l{|-8z)vvOCahv
z-_X%~F)W`9bL>SM#nfcPxNhb(X%Ds>Y3iXihg+L!xOD%TBYuDkh<WLU<W-~*F4dtK
zeA>0aYi{z=rerFcMWE@<E;M=#Z7D`!U_vSa69ziac!^5mC80EI^#tpldXbB}fHgJ)
zY6WCwt2c{onkt~q_?&{u*QHZJG?kbp57J~sT><w_0{dS#LO(dlyE4TyErlW1tAfr~
zIhl!GuOpn2+b6%v%+kG^NHN}&2sni}ismZjPU0n4RJPkOgn#}acjvTztU|3bVj@nq
z`x9fWH*n*RlX>Fq{XuzX(%2ugKUOjl@KLzi!A-MKRozNyOl=NP=tLa+gNuRa*x~-r
zrqMHHQutWuwp=1pMO10?-I1pI-5>2bf!=1C*e)skZRoi?NlJqrNAK8#TO9S3c4R8$
zh#Oo{74y(9_M*cbW&1u;?LHF+3mrycE-NvAm%Go5u2SozHFL8V#kZwX((=~bL+z%)
zR@=n(G%)vvjcKsi_V8t@#v*-9A7deYv!rVWqctqu(5O~LJ%K8Yx8O?UtqH$9sYx@i
zvFqV}`{Azd51Pgo?NtV<G$>H5uCSC*{s4}*M<9iYKOU}dMdPqO`^<2T=sHKeWaX1#
zeP;EVFuQ;s>@~mLYrW>WeGd58wVM;`>#HT{hitNfCw!Ek^Ln)9y6CL->$!<5O&jj5
zJ9{DH^rw7c-%KjAI5~@FUKS0XY3XF<P;NSi-q_7r!DaDhMmSGH3+>6`N~tW&Z$f&Z
zX6Lq@H1w1!rQ)((ERLc(5AwHsnImKtZb2Y(7BTkeoUy?@?LA2ZT*fty=y_t}L2lYw
zu>{OrII*uz)Bp#x5I&S(9t4=e(W_?&7L+hid<yl(81cmb$Ng<0eEQpqoWvgS?%~Zw
zJXHo{UtPsW6Na0UV>9XYW9tq!Q4_UmlckfzTHRk-f-V$bpj0!TxeQX7fL!ybtKHi#
zb9=SF-7~DgLslsyj)I5Uo0?00Neycr!6_+nw+Kdt7;KJd_Px*00+1N+JczI`N>s2r
zc(R9@QN&TiY9Y_eMV=ieM}*+xKus5Jn#z82q&Dh0aGkdom#2z?qpc|y@63x2p<~x@
zVLmOj^v3uPEI|gUw|Q<vo>+i^IW<v$f$1pKj8-MZh2==8mN6W}2v>Wt*5<c~5Yk%7
zVeE)#=<8*se+CN?Jr2(dJgjlS^|GjSUW<y2K7nsk<y@ko8TC_)CJ4wHEUX&f639dh
zMpX5i=e1gWF}MjYzo-~%8e?xdj?(VRJ(_L$OCVdU&{E!mCa0~{{cD9&#Y4g)M&D-d
zyi8o%vDtH+#Ijdzp82eB#bU2k;F|}BiMJIzEY^pM$bJmBY>*@H5LYbG&6yrYWKqHI
zxT2gmIO6^NuF;q%tjoRsQqk5Ty3Y<t=T4<s5;Dsmxuwd9r7Co5y#rPnvrz1Dd7(h~
zqlgwxn?4VqKM^6YZo)A45~c<bvu?61eOEw!W^OD1f94G3T@2tX;9#*lUWIO6D%9#x
ztH`uL6D0y`;STw7XNhPRzDoecyZj|sAx~_aJXx%E2^9#M2hJA@%SL0ptA;Pb;98-)
zv4VbBs=zx}YLTV&jYM@xFQIWil=)G4F9R9}MX=PWvDzCFdY~rSDk9Hzte4IfR}(d~
zgPTWc;*%FA=TcD#*)BnjwUiu>)GHfHx-1rs<KUZ8GfDiDOJ@UXg|p)LQfhLd$ME7>
z8yg)j)s3?XfF@?~^#`5BzD3~?vRqj0!V%b5t(OeDTG5#<qzpP|OB<_P=VgZ=aFxSL
z!%x+%U8~auh8`RCUQ}arvDB;rXr~fzCfanb3FBHysADVaYI4oBWZ#v*{q9ke-5y|V
zIIuPvni9sODWN~+<$;(_3&#B3P%PjJ$AbPyEEMR7g@e&pBovEvggax=NEZOzvCe2u
ztSi<V>+bA}^>p>edb<Z=eLdS^{k_{`1ARMU+xiD%+Xr^Wc5EAp4Q?Nf?cA{|HZ-_9
zHoS9BY}e38Z1?cq*q&WiL`Qa$5wfp^^zU(z{t=t>3l9$PgQS0-O>Foc7qOXiFs&HT
zLl_~AO}Z(6?<TcuNuyT=gqQ4$r%AdZRB9AZrXrUrQ_&T=AAg#7#gKn-rM4tDRu$(q
zZjbA;rn1K7tLr;_R&kp>SL>QIiL>6qd#K0L%lkY%ApU5Cp!+OXn9&OlEc8L#%g4A!
zRGdkrmV+!YmwdpLNgV@zGl}BXJ5|LPa?%US2*!*Lp5MQ`O019##O@sC>Kyf=TNY;M
zA)^ygYcNW}4-q=p6Gqp*S&(FsGl|Tk;su_#h##myS$Z}x$tz`CI*tBxbzEngM?Dqy
zY<fD}9Wawr+HLuZGdz-ATn>Y5U@Q&d#Ghl&xeGn=U`%9rh{EWX<;sM0$F?QM<>G2l
z*byMDJ_&a_t|ic(rBW`srz3;*T_(HZg<Bj-*KkjV6ap{7DnLaN9^Aw-lb8V73sBY6
zv6}O^lXP{Xd4LB^%6v!@J)J7$KofZ<S2duC-l&)RqCU+ZmFCqLg}sG6^1Ik0$4;xT
zJ#*L#*aicrMj31#)Ct#+MHA_{=|pB>COMy)SQLQ;+(md;Q^WXL$!s!uOJYuVlwF)o
z%_j~eGKn6m<ZvRFI1DA?8EuO3IsEYKd@_+Sclz2POSGkhEyp^7TX~dicf><#V-&>;
z$m64kJU$io%X}W(FY|HSFY{@*U*_}TewojQ`(-|H^uuo<*qA^tDiBN+J7pfRQ^v(k
znI?A1yke)!Cw9vG!t>XrNZ3w+gA*p`9<W>Hl84+ULON`FPa`s;+dStY8lG_0*pQLg
zXv+&in;#qDQVwvdg{9s^7#gBS0W?RVUKNjzh$Ci(T3l?j6U9^#^JXQn>hW;2O8?4N
zPpBz|mg#O~@s=_`&w#7X-2L_B`lb1>O|;N*L(P2y$kCNEXqK5;Lkieq`9Ks6Dc9$O
zy31`R)8jI%#ftDG;OEgr>l%73H@VWzQkylz@Ph6hFPq%OTo+uY%7P~0lLB264yny2
zO~lZmu`Q$f9OEh}TR4C_MjA?WmM;k=&XM76qz{Q+01uXg<j99xbX=Ptg>^#2JfGUX
z%{9t1!0tnzn5X)hWW6RGaYtc!S*#CfG%hO}XGkpTHE|re3LM($qN|prTJBhrZ?k-0
zdc^Lsu!GX7#ib(jxjYc+nr2~lBQJBk>U7`j7{O>yXH%4DYXqg}!OaEC97kygMY{vd
z(z-{bc)Fc>8J-LB`x)k?jSTKHs|qSuD3dx*C^Qu<J*2mfL^|*+p%-I6V@ydOIvp5R
zJb~dRB`45e5|NzS7P}l=niH`&pJGG?;8M*ZzfojaF|l|6i-ca>-xMHPm}J9`pc4@X
z|2wqB49bcDot;Z&6t%KmENc_#S&T`d;jp6i0Q1R7E=IXMqu1tvKLbX{ySiPyV$wlA
zpPZS^B^8c%Q7=X?&Ivk(&rL5*rP9feP&A-CgXA&hxSC1kj?T^>?yxFkiuE&<>Zy>d
zV_4ltTaBDFxCtcY=F%w{M<w8(wC(s$&4>%(aqdclif0Q;b<-L-wk-7?i6b)ykO-oU
zLJgS66P2^5Y7n-Ll4=J8)s}FlfKz2b*Ny98as1m_1%frba>jg%YwY(dZ^%{`v+_mb
z)zb3GVye8pQ8%4@)i$X#yHR)4@>&Dnhz?<v*{*GSxAkn3A(mV1hr*@_(dJqQ=_yMc
zjEFfW!ar~`4g>;TBWW@b%`1QQkq$zAejgj6K-p!$2oW@5Cm9+h-FUV*B!ixK#nknR
zsp}P%NnT-@<PDMlIwk=gI0!s&5P0Aa@WA1imq&mH?f@P*3OsNu8uWKYLxHYnI7q^z
z+YwaaQao&gTu89V@wRTq-s!fsNYHNAtcg=_Z+EpjOX#X@>5-(+uUcwV)uPIZL1IBh
z_CdRWbrKiQZj`mzBXaBtvK6);f13A*2HJkyTmh(*6>-JHD{XE*btExyTwAY}P8XKW
z8EBi$%>v7xlxUl+SE_(R{+ZOo{OsH`24Y*Ye1Y(Z1c(j^z9h~QX_Kk!Tsm=FGgzLE
zY%+)Od$Wr(7&s$2j}D6jKFt)$@XTsE${KPt*+o-h(#mQRBRX-epozZ9^OR_Nz2zhY
zalk9g=e!+AcYPM!z4~%Y=C-28?QO3N-{{|Y_F$)b)Wjd9MF`%)I$vnIqjhw6A=OWY
z@8DxIX;xY*`d6yOqOs*F2D@(LFvtLMvS`@tJH2+qGS31ovb27pQm8Hm98dME7vKh1
zCu%^z)Z*Dvot|786opfj>Y<6$3PxR)@_lLz1M!sWew+@lkU~?q{IWK_a^;04jOlZ2
zL|j(PZDz!k*VsU;WyiwMd&<MN9%F+E_zlH8X9=^z1kf`EuFhVEm@m#;_VmKs>Hx9Z
zXPg4?1Bna7xEcf!7wq)%P|T-=fy6~(0bd7@xG0dg7?8NmXe87X?Fe^AqY)A%JuUHI
zeK_^dD4U}MG{wm@dOCH^tf)P+dRKb);}6cP9tZz3&}K$0tS=WZMn)6I%r`{2%lFz6
z`uJIG!c6BwE{VYv9IV&eRI-dKR73Zrx@>7s=5QERfFKDBC+;Kxmui^Lpe*Ux!r+LS
zR_dn59%kFJo6dREOO!MNgPZrD*u}^m2j*r*;Rb$A&d;!A%S(Y<1Z}<fvXz3qpMFTn
z?XC~bHEr5V0VPk)D|`jM4oP?JczPkrYxQ%h8?}~biLTF&G(YMo&M15ENs7{AoZLmH
zKgFAK_^Zt%bJMevStV)!k_}GGAIe%KiOl4p2+OpsrNpkSB46!Ir(gzUlJh8&+5+nA
z)RY%}_TiqG_oM*`FMfuoDngc-u%nG0(Z)8uheWx9wsuJG6PFgOi3#Qshk?RCG2#8r
z{A=-!CTl3w1QD35fYt#YCmJ9!yoXWFG{S)O(HK*?M?-I?T!C54p$5aaBY~*HeI2))
zO;~RF_YfS_JrqZE55r}6kBZAMl*2L%<%qkU%{KVkIi!GpI}AIzjnd7A@?@r1-mo+b
zUh`_N<LWs2_Dz*jFtg>xz7$W|`p@cj+-EJQ;?98Mic^^$JmGkJKn5(8uUajYPlcAu
zhv0qTCD$W6^wM(C**a8Hl#4sXZyN4S;HHgn#~iS5XrNrIHN_Ulh<SsLzs%F$9j<S+
z&VZ}10Ce|}o_=(e;BaoF`YdzG_FJe#p62S+w7#f|VYZwesYWmzv4%5`p`T}jN@tMF
z2;U<dJu=f&Yk+LqPPAwMW?u+H-ualK`qA#0NxSC&Q@lZ{_<#fnX9*#u1j9rLMTipa
zAWB3bXvPJyk=Alvyu&^(E<7ZNGf|F1m~I=+uAz2w&pCeXO__^N##-TYQ8>;p&j$<d
zWhzEp0G91csk|IssZ`Iv=)+7vf1n<5*ho&3R=Tl$llM6G$32e2mTk?m93$K1G?<n9
zDnBORiqOLFR3?d{vn%xye5b(B2Vv+#F!W&<`Unht2Mm2QNEBcgfsnBl>8rE-nN7!`
zu#R2rhSZJtt;A(>BEgn6>MDky0KU71Zfen|gRdrb&=RYwn+@FHrVn%sood=Rw{<s0
zgJIWjnRWmd1zZ+ER77S8phXa4@)Qe<jR(et!`NsrHeMJTcqg<3#>9)~B=J_-()SME
zLe7XQ)FJuywd;HQYNg4LRbW%|X?xL?){sP+9-%E2#KA+5V2zk+^3;iTx+I)HxoK$F
zrlBcY+__Xb+ST-Khef0poy7G-EsIFQQrn4dnsgJVaT(<Z&9&hl>hc5d&nA!-5w!r1
z!G;UFI*)K2r)}zF(>#CVu{JMFBIpGkRYU1T1(sVSR}RS|r6yq%dVgVV=kz4!j_4h;
zM)HtwOt8LD7d}&3FehSNpDdm(EfxLcjWr3m{6GhUl`$44>OSk1%T&>ats7mZc><23
z0!|7jL)Fm`cbOA2;t(UnK`+e<9Sz(jQ*pN##7GW25b?A*DWGm<G`IOl0en$ke`{~z
z469aFU7czk^WUs*4dsImx>!cPmENtr)#9q?BXKxG)zK2f5D}K;n1}$na6_Wr(cFN`
z9D?rV`yC^}g?h;CW@ZaRE#PWZR2aE8NlXIP5)qJC{-#McNdD4=8u4Dt1%=oR317tg
z(Xpi=b~7BTs*6|c+_C9Eih#B=vqzE`a9r`?=9bVe&(G$BqTO4q7$=e^Q}f9QEb=Xv
zs!~rAw0y2WanN$Qg2#==7jn7T3_r0^uUE=iZa#GgL_iJZ$w^y#XHA%{cCB*BdL2!1
zy&MWWA!RfPeVfMh652aWXzw(kz0<-Mi|f@^Z?~0T*fy@$6C;W;*w;D?5<?<0iDQdK
zNcU{&wq&cHr{*qeL5MbIEH(+|1!!p8Qwz(pEv5q((_#k?ObMs+7}85tP1HMuQwKEs
z#sHz>zFG|Z9lDD;L>Mr@!eyhNnHpRs=5{sR?ywEFovC#<i=<LT<k`}`k{K=?!q&W@
zAdf;qr%`~t2*8gBeGLhuQ8onPC~kHzfT&kx@_Ya@^m?&Qv?xdZkfMhN;0^859Dv#&
z5{QjX5C{Aq4g{jow*yC)0>HV%EU{Jf_;D7FJTW5l^KP6EU847dNSnzvC8(<>H@z@3
zu6XJ?kY!IQGnqUl2{NBaO-`nhe66&+yjpBNYQH&^myi7!^Q?+$tDe>_LRT^#pjOj4
z#UmU;s_EoZPDSUD7weFa>mg5dRn<M@jyvw~-U;b0NOwcJ2hzQe?t^qcqz5292<ah6
zuYmM0q*p?E1k$S@Jqqd7kX{4nwUAy1sR8Nrklq04jga01>CKSd0_ibGZ-w+WNN<O<
z|G?<j!RxNS;l`U1;}es~sYBDLTMnmZGP85H&S!HAM~)sle%q(Wr^#o?XUXTt=gAY~
z&&W5(pObHrn71nuy=LF;(6;p#RcrN)(`U|}yZyy4dFjjcTs_kLg2IWV<>Jaoy#%AQ
z`ogtc!&h_+`SvQx`&iT(@59A&LbQn-P9D!BW|E5wbBX!+*`o?wSdW@zlQ7t#RGoz3
zwu*5=$YOLE8Z(Q<q!HyF;aAjeUYI&Srw-V;Q93nh=f>#Nn4LRFrw-b=>*&;VcJ6vQ
zb-kUtfll3E=We7^H`=+I=+sRC`|bM~BuD-L<PSLVqmUnU<i{XC=Exs}{6R<lI>=w=
z$X^fn>mB(UAb*1+e<S2?bmVV>yrX@i(7sVe`$nOCqmK5CLi<J??Hh&mjXK&l3hf(p
zv~LvJH|l8LD70_X(Y{e=->9Q~qtL!lNBc&heWQ-{jY0dy9PJx}_Ki8(HwNt+bF^;^
z+BfEC-x#!S%+bCvXy4d%VKbk~WRvqbjur*gx>Y&}Y*jAF<w5MASvoyClT@cGYsHXR
zGM+q?%6P_$Crf4P4av+TOO}_dXU!!JB^Tz@xswa)9nLbG-cUMO?zBqhQ<+?LVm_J7
zc;~9+dUmN=w&pjK&!*Gq*@?p%l&_|jPKE5JEo76PIo!*$-kLq0oloA1+jjHC7uoHd
zPbLm~#;e7GefNAao6LFUix|$sx;r;Jr)JS%x>*AJ>4J)atyKc=oL3j1+nn#rC1)7C
zGvxXtk2qXoA@D>xnV3hlx@Tgwnl5*_%8i|94woit>oNB*iJM@k(ssAVkrEeRv>X@Y
z9TU@uc^upcz1nn(xB|Dpm7v|)<PmkQT0Cu)WRk~nY6fI_`y=7*i5!>4&=&nl9!pLv
z<dSOgY;no%q0Hp0x=>!O1ns_tlKG;eWC|Dn6;|+NdzK~BbLw<))&BUI*~w(~XbL`t
zqp@xFOgIZ1eddr!HQ9F`yQ9M>vWO-W-f0$EBohkniW-GB!GzMgeMafj0m$8B<whZQ
zuaz5v+<jK=Amr}1a@Rrb0V{Vs<Q}wgH$d(oD|aL0USZ{Kg51M?>+Sm?`${{Dt$D=G
zVsl<)XR$qx+F5MStL-ed=rwj0oAg>ci*0(HoyA5q>@2qG^;UKiTlEGzi>-R2oyAtY
z$<AV{-fU;FRd2Dg*s90uEVk;cb{1RpHam;0db^#)Ry}TI$FNoJu(Q~zciLHO)w}F0
zw(8w>7F+cmJBzJ)Z^+0>)Pa)snI#fspyd4lqXcOo<UbHJ@`4gV!3WJ}A{qSdV;?e~
zAgLgfd^qAL!PyFBKNmC0Yzhd)A2Fw@P5Yqq=Y!S*fCNFoN6mLgng=DnV6_VA9Ta@b
zED*#F3VzZ24y1ID|G1e)ItTe*GV@5~ApZ%+JCMeG_px6NI@=5dpER+}qHj?6E1k|l
zgSbKYr=qUDHfn!5>gsQ!^fT_dNVuT%v+lY^>E{AgtCB|`|9LZygp7Unt#?@8A;=h%
z+-VXMgM>lRUDn3~0fYSA0ju{!{vI=r#0&EGT9X1u7v%3Vn`RR(D81jC0l5bx?ENNi
zzywB3V9W##n!t4?aJ>oKU;;Oqz)d7U#>oVkBuO$w4v}e+BDavkBu!>WhRl*Vax0l9
zS&}0Q<On%Rj*;W!HeWV5lbV=K&t^QyTNe^(&&2G^Ou{ph$}D90Tyj1&JL$=$6WM9s
zcw*x4tqZfcWB}>t_&j8jIZ-OE2L&NDianyDFOkkA=Q9a_M76oZMAA2rn9DAT^;^6t
zGYNk)Ihfd7j-V=#0no;i%)s3|Dg4i=h-h4nypV-BeDqvm(kuVS&P3pV35=S+m<b#-
zf$L1*dK0+81a35eoBRfln4An7;AC<lHIqn(%xvmNYBCu#a-y{nBQvv*&ZXwk$IX0p
zVLS&tlk*|Ai^WM3(88RQ@;uq;)D-+;53yWgoC1x2S>`!}B!C}J0@5E<$I}Z*KTPmU
zCYgpigC>ZN<MYXh+4)Ho@ya78f{G{|oJwSKi&L}nM*-`g&QX}D!R+DGoLLqU85|wV
zsfZq4#F^CWLRL+ujwDqW+ng%co>XRP)^lh9zFAEkOXXC&%ad4`OwD@n`%<}dl1(0&
zXGdVlq%w00@IA>KuzZLP!5MfAs+Ay<=2;*D6VpvfrO1R{sG=#C%+}<tv~-EGR9LU2
zD@&)e^2Qqejfqpm)%r$Z)s&&S*7b9>(vn>uP6n5(lh3R6=7`s<(yHePnU@^a2JgUg
z|Burr6Z;vD#9kpHm_JR#F27cz2Q)gS(d#sNgGO)C=+ia&OpQKUqX~^pXf&zOLmEwK
z^sq)}G&-x%TQ!>1=z>O%YV^29pR3X5Yjjbg1&uCgw5ZXO8ZBw`lt$MyTG8l>G+NW>
zhDOh5^qfXttkIWh^yM18lW6pANcTdzAJT)6UIFQqkX{Ap)sS8bsR8K?klqC8Es)*{
z>Fto-0qI?k-UI1<kUjwELy&$B($7Qs1xUXL>6ak=GNfOD^l3<+h4gtyzY6KsA^irV
z--PtrkbW1^??L(lNMDBZRY-pb>5n1(38X)R^yiTN0@7bX`YT9(1L<!e{T-x#fb>t0
zz6<GJApIMp|A6#gkp2hK|3dmdNI!yfCyd_RknV+aKcojCy#mrJA-xLHt0BD>QUlT(
zAiW9FTOhp^(%T`u1Jb)7y&KYdAiWpT`yjm^(gz@Y5YmSreHhZuLHY=!pNI5ONWTE-
zV~~Ck(#IkF5~NQ+`ejI;g!C(rJ_YI1kUj(HvyeUq>GP1Dfb^@7eht#EL;3=w-+=T*
zNWTf`w;=sCq~C$`yO6#F>GvT0KBPZ@bRN=|A$<kXS0Q~3(jP+lBS?P?>FbdG1k#^E
z`ZMbAbR82q${t~dJs{3~4~i4tyTn=Vz2cPjH{gaphxAQIe*x)Rkp2?Vw;}x%q`!vr
zH;^ts`ddiff%JEf{vOglK>9~W{{-ouA$=Fp_aOZXq<@9<Z;<{S(tkkuPe}g->AxZU
z52Wuy`d>&tfb@TmehBGDknUhG(2(webT_1XAl(b;K1laNdH~XckRF2c3P=w_dL^Vs
zAiWCGqmW(=={1mE3+Z)`8jxNO=?#$H2<c6b-VEt2kRF5dR!DDy^ma&(GmX6y{=SQO
zg);4RsKT{>8Wv>Q8@-#6_ptXe@-~=b0Ts_9y$Ma^8dNCW8dPZB8dRtu8&vEVG^p4z
zXi#DC+n~Z@W`hcsnGGs}!#Aji4&R_6JbZ(S`0x!X0>n3{h!EePB1C+H?jlhhZO}a=
z#$ye-mvr*Z2Hi)xcvpj7MY?%+gT_e@?`hC$NH6bg(EX&3_ciD!>F50odXNn8fd;*v
zY~$M+^hUCsZ*S0>$qv4wL7zbe`Cx-Si|ph(8}vD3hz~XBI2q={4LV77@m&o%MRxPu
z4LVKs@I4KB3mM@f4Vor<`Q8T2kSq8V4LV2m@qG<CPp;%wHfWAq#jk46BjjoPX$^Xe
z#Cg0yZzEUps~hxr<QjfWgXYP#{MrV60ol*@H|Pm+fFEekWirY~8+3(?@v#Qg$w7Xw
zL0?F&<JUFlD!HCt-=Jl31HYj`*U63i#s;mDoA^x)S|>O2n;Y~rc{+c3gPtYN;Lm8#
z+sQNeGaK|J<XQY#4f-<jZ2s&9y@QbF@aHt>U4$ffqCxK=WSoyT=zWAt@QDU}fRIT(
z*`N;*lH|z-eVC9bKGmR)5ORngYS2dsndZ|C`Wiw~Jk_ADBjgr-OM||iki-0NgT9fF
zG*36^n+ciWGY$F}AsL=&(6<pX%V!((aYE+!T!X%okX!k!4f<|E=J|YszL$_J&o=1$
z3CZzXgMN^Z1-{UrA134oKhmHdA>=4O+MpjL<QPBJpdTaTI6vN?A1CBCep`cnf{^F(
z=Qijk33(oWUW0y$kmvK~H|S>w$@6@JevXhuzSy8o5b^^4f(HFHLJGXlpkE;51V7QB
zUnFFSFE!|I5wgse8}xSwDe_{2eu<D3zS5w-PsmArvO&)iqI11Lzd}ffmm2hIguIZy
zutEQbkW>6rgMOWmRleGwe@e(2Uu)2B5K`vl2K^=>6<%r3ZxOQ2*BkWPguIBqs6qdl
zkSeb>=mkP*yw;%KA*9ah4f^+lZ19Z+{YOGh^V1Fb&xD-eXBzZ-gq-DP8}wfZImgd6
z=)V(kJHNd_|C5jx^A|Vhe-rW&{*ng$J|QpVFKy5t5b`qqvIhMjAus1Ihw-Q64#MvM
z+`WsEI|;uNpnE8}i}1Sux{s2(3BMbl2PnCR@OuDyh?08=zZal~DY=jE`v7``lKTn2
zAD~Amd4TW-0D2824-)<$K(C|ZA;KR5==GGmg78-W^hQb^Cj4Q5-b~3W34bL(k5Tdn
z;g10HHcDPa_^SYVoRUWge-xm1Qu2DrUrpXXl~)t~8uCUu%w9wIYXR8BUQ77v0NBl5
zM|cB(J*+|a>j4;HuP6Ks0PJONApDI0T*2N*_?rOO$KFKvn*q3zy_xX00B{w13*nCe
z@HF-q;co>X&fZG++W@$ly^Zj<18@y{JK>K5a4mbB@OJ>PpS^?dcLH#Ly_4{F0Wiwm
zMfke`7-R1y{5=31WbYyTy#QRt-b?uV0JxsLkMQ>ca07ck;U56tM)m>1KM250?1O}V
z2!NZ}hY0^L08eKhCj93Bcn149!aoAQGucN7|9JqO#eSafj{@*)_EExr0f6VQUm*Nr
z03_JQ2>(R@#@R0t{&4^%*vAR~B>*PbFA@F;0Fvwzg#R)CQ|y-s|0Dp1*e4196#%B$
zuMqwz08;Ezgnt@<TiB-w{|o?!*=Gp<EC6ZtS;9XDzzq8w;hzT}!#+>=69CMzCkX#l
z0Or`Q68>ud+{%89@LvaDp8Y!EUjQJ>zCieI0FYz9LHHK|SYTfy{5JtO!hVzR-vZz$
z`z^wM8-Qc%w+a6p0FJZYA^dj%xQ+cT;a>vax$H}X{~iF(W4}lE?*s6B_WOkY0RVaS
z2ZWyoV3D0C{L28mfPI<puK-YBUm^Uf0Gwc7CH!juEU~W<{)Yf8vp*#Kj{qpLKO+2(
z0a#&wO!(IUILW?F_@4lvvp*sHPXQ>gKPCLn0C*w$Gs3?Cz$x|(!v7qARrcqEe-nT;
z_D#b70)R663&OtzK!tsa@V^9Lo&6=@-v;1C?AwI@6#!NCSA_pH05$g4g#Qfyb@n%e
zUjSf(T_F5#0XWV6mhkTYaE5({@V^7#Ec-jc{~myI?C%Nx2LNto|3LUZ0`Ow?kA(jd
z054(xMEE}g@KW~Agnt)+m$B~>{yhL*&b~+ZzW{ItVgEw-zXEh8VgE|_zX5a?VgE+>
zzXNnPVgF9}e*i?-e-Qqk08sXyg#Q-+jQtnk{|$i3{+sas0l>rlhw$$Mz}fc+|6c$!
z_P>Px001xh0pb4#fRFtj;Xeex&wfbwj{pd;9|27Q8WCi7P<|%>A$BL_cL5M)cTs*f
z01<XK<@W&4!S12_UI3!(UdrzSAja;a{C)sB+5MD106-Uefbs_c=w=U6{ty5?>><iu
z0YEQ%1?3L|(8nI8{FMOovsY672mk}@5z1c$z&7?O${z(_J9`vJ5CA*at0{jC0E6r`
zl)n~$o$R%gzYc&Q_9i?@_GTJWffbK=*kd%t)whDk<slldOb!d{??;}jbMU-B-lO~T
zfq0)D$Oq#CdN3b~Z`VWlaC}e?=OghUJ(BN;@6tQ+(fA%cnvccz>al!he4pN#?}}fg
zcjdd|alJd=6Te39$@j+h>%IBD_^95O?~fnU`||_w>-B;Bw)l<uw*2<^&HDEIj`%b5
z9r?ldv-H9I&iHfmo%x~oxIUC0j!){t`CaiTeOG>Wd|Ka~-xI$@-;*DSr}dHi-grje
zo4+DHr(coZ7oXSn<*$tA^egjM#gFJ$<)0QmravtokKd-p^H;~8r(d1FCZ5-?$zL0P
zfqrd%fBb~LKYt*;tRKja##i*w{8(Jq$MOf`FVqj_uZyqh*X6H|m-XxOH^kTV8}c{C
ztNM-ko8oo-ru@zE)B4T%r^nCgPtQLie!KpR{4?V((Vv-rR{Ul9v+~c5-$C?e=bsb5
zi|EhEC*t=IJ&_-e-$(TE{6zc#qEF-};|~#iGM|h;O!Q=aD*g!3r}Bs5j}rY*emedd
zqEF{j@z)VOmA@tadZOQwKOBD}(GTa-@i!Aaou7$6M)a9{CjK^}XY#Z0$B90hpNqef
z=yUm7<L@T=t@-)*dx<`u&&J<R^lUyC{~*zG`Gxq0iN26O68{L%kK~WWKT7nY`D5{q
z5&c;Hc>Lo;Kc2rW{t2SrmVa*ilSF@R{(13F5&e1j=f^)o^ylaE@y`)GpI?kWLG;D^
z3*x^<^cUm{@h=d)kUtUsBGFIem*T%g^rifA{C9}HoG-?|MD${QCI0(FU&)`0pC|gs
zydM7w(e->O{xzbP@-K}45z$|mKNbHv(NE=9<9|x@)%;rg8$@5rm*d|gdO2T-e~ajq
z{CfP`L|@OpDE`+(e^I^~zd-bAz83!u(QEm7{O^fg&u_&4k?0%w)A4^M`sw_c`1go@
zCVw{muS7qaKNtUZqMys(9{*3G-=2SQ{J)9*;`~eE-zWM@@-L15faovHzbyVkqQ5Nv
z^7tK8e|i2662FV;caZ#@Bz_Oo?<D!VNc=vk-$n9wllTKvznkRmA@PT(eh<mtOX3ex
z{a%v4kHjCL`h6sSKZ!p|_4`Tw0TO==)gK`F2TA;ORDY1<A0qMBQ~e>5e+7vHrGEv<
zKTP6pruxGq|4I^njOwo>`A10nZB+k%?Y#$hTUmM-dd}?^y$~P?7Euz^X2=;%-I>{)
z-GxX{;tbmo(3Euq8YBT-cu0T`05zk1<=Z%Roa&lv5+|``r#fESv7PQXc6#D8N@MRP
zv7I<^itQAq_jum_|L0cVf|7REFPitB^zq`}bIv{Y-c$ZwzLD3yiO=7atZ(AAZ|3vg
zEm_~pYv00)i`KXB+PCuJGuF5A+PCrIv(~rq+Hd2<=d9nxYrmZrpSONHuYHaeU$8#M
zYrlgRU$lM)ul-J5{D}2CdF^-c;!D==;<az*#h0yb=e6I>izVxK^V;v>#jDou;kDn(
zi%Zt;<+bnN#bxU|c<noRv21-OuifRv73(gqeHSlYv%ZVhzMB`XTi?xVzmFGJt>4FM
zzn>RhvwlCX{Q+Kl-TDK(_6K=!&H979_J??J-TFhk_J?_K!}`O#_C36~X?+i`{SjW=
zvi=CKeJ?M5%KBbj`#djhTc78(@8iXa^?khd{k&MUzMt2AfERCAKfr5$lo#Ky{wS~g
zATPdY{UERX5HG%E{SdGHFfYDs{V=cnF<$(%^~ZSakMj$#YX3N|{Rw{IN4WJTc<oQ}
z3$TFyB(MD`e&I*C^{064PxA|~mj5)b{TY7Y$GG)pc<o2{1z6TU!fSt)U-)Tm{aIf7
zQGNlI;g9m#pW_#PmRo<0*M5v&fED>;y!PX~n6ZAG*Zw>&8rGlZwZFiNW7c2bwZF)V
zN$W52+F#<uwDp&G?Jx7<Q`TSRwZFoPm#x3TYk!p&&s%?$*ZvwW#;w1`Yk!>=r>wuu
zYd^t@N7hg9+TY;C|IPXvy!JPFv1|QJUi(|T*t7l?ul;Ra>|1}E*ZvMK9$SBh*G_ox
zwspd5_jvJL>mIM&=f(G|`@Hr(FW#}<=e3{Y#m`tj$!kBwi~qazQ@r*CUi?3-FYwwI
zdGY_WzQ}8Tmlyvp>+kZ~-{Zxi_4jz~@AKk<_4j%0r+M*$_0zoeGrX9yeume6mKVR;
z`dME42fSFf{sFK3Ltfmq{vogZ953!!KgVnTh!^**f5dD5m=_z?KjyWc=f$S=^St&?
zc=49?Pk8O0@}gz^Q(pULyx6k-8L$0wUVO*;=e+g{yx6vWf!BVK7dzH3^4c%);(_%`
zy!J16@oTJq!E67L7Z0s}$!q_L7tdM$ir4-%FP^pjHLv|LFJ7{Knb-aeFQ%-2!)yPR
z7w4>h%WMCR7ftKm@!G%V#f#Rz=e7U97r6Bwc<n#(1<Cr4y!M~?f^7XKUi;5{L9zZb
zul*Okpj!Wh*ZwPT$<}}6wg1K!bnCzI+JEN@hV|ch?SJqE)A}F0_CNVT#QLAS_A7iL
zYW)hYeZUuD)(5=yS!p3|eO9XdT4^C+{aUH^wbDY;`dX>>>!gL0_3NbC*GUU$>+7W2
z*Gmf->+7Z3ua_3G)~}ap-ykiFS>GVleuK1-vwnkA`;F2<-ujJF?Kepa<JNDIYQI@p
zn6Q4cRQoN`!ld<Eq}p$l77EsHm1^H8ElgS8DAm46T9~%JNveIbv@m0RvsC*QX<^p-
z7OD2F(!v?*Tcz5!Negq<x1j~S7BD%|(d1}?Opd-&YJR7*D1OlF=sSG&_VL`19S(_%
z{UN1TtbTB0)!WC1jc#jCd%gVjR%uy#r*Y?~zCYwM=*pL4{{9|!3oI40>@pS`^N+?_
zM+CJXRSOe33LVB|2R>h2#-mZGmNu4AXFvja=jN#I=Ao32W{AsPSmH+!f}Sx|)wqWK
zckuN<_G%LP-)ZE3rztWFg&s7?3-_=)Z9sfR=K;^AggY4Po#S3(Fk(;8oheCemX5o<
zPItN9uP2;npQ1?Hqn|OSRQOhiIt4x66pYl7aFfYVMaq|5jtW$INQiHwc(~^lqXpB)
zjj|%A^l`yZ;j$Ah)3zL!WJ*dZOTIV{Uj8_fF~bR(sby7J2h!XC%G^vFS|n}i(R9S%
z5j!~Ch&bV4nd8uZVk|iP_E?o}R5zJYKkj!_Vc=Hpc02C|ZM+rOy31t5udZG#m)6zR
zt`}6=Tcy5k1FJOQuF{~Qhem7EDurFD(Js|!mue)e)ks#W#du(uK1?`}M_sI$iLlYa
zg~&pzu|)<=FWH?)eC>oA-iNz%tJAL>b^2x#1AA@P`;Cz+J;Y9Wpv6Ea`<O7G9|~nJ
zla;ibF#X;PqY}mAYD)4{8tv;5JYa$fRmKb^n7{-xsWD9#VZ97)JRpX)ak|Ak`ekLk
z@x>6m6bzX8A;BpL2GD}uY@szSnk;1<7(fo?WOUxkIc3)xJqlt@rRkpI`(qdP5{LEo
z=r)?LUh=ShM3>bL4Y@l<5$`2K5`ue`0oRk{!vPHi4cMbY^Akwj<IWfJyJJyINdy^~
za#G8N$Jvc$eIUa>WoBT?9t=R7NC1H;TXklE5H};ttzRowsyDXF`Ykca(dy=nrRzIe
zo2whuNZ%dpLHLmk>Gg5P^9Wa+z(JU^x!ZfCBwS@W6uxgDfT{opekU~b@EDGTUZcP5
zgbNe_AsoMrc%b)qp!Y{~x5xx;_AOO2;IB47NDTO^xy#gXv$g%zOclmT#RM=Ewgmmw
zLjBdGNB395L7of_^0h|iz$S>k(nB2e_5FwgobuiJ;Tc|)aSE{b0VSsSIXM00((97}
z*VX5i9q-xamP7q!Wgogj(lt47dwdn0P_7;~n~m;s%jQ<Ma|`g`bIT#X-G@ev^*TK2
zJ!lr5VD60u%&*(4);#Fc`_E@!qO0(x0C-mIK=8VKJu&cBPxVE4FS>NR+prtuG0Ks5
z>GTn`udmj7jkpu4tqinM_eok=@O|BC$8I!-u|HeT@tpmHIgyy^sVAOYp0nHZ=Gu+M
z{#?H^XVq^v=6c87W__<AOn*DwR~Mhbmw33wb6>Ui)Kf3qoZrK+{Bw2t<>uO*{#+ei
zWv_FqjVT`He4j9P=JH;>J?A}P4({}Q_Lai$S2;s5;3S>%wZ!lNVm@NcF02?kqJUOE
zc(;D1r@Yf>9C?X=2SQAU6t76%ME1L|qq?i@W+yA$)@Y!YFd{1j02HC4vU{C&vvrHU
z$a$=AhL7)e>+e>(EqY8(KY{_okW=uY_R5>_PGMp9;C=eN6#$H436822%W-Z*t-CJM
z(7?YmOMMJ+cJ%<pNaU95Q6w##to3^D9lTg>9QCa#z^0hDdQ1Jx@Ek;FbsikRFyLb<
z{YHDQbx<Og&EAApvfY3O!&!rzY%!yIWv|r(_~wp&MkIsrzi3(%`SxmDl-Liq>wU|_
zuD6FHMZ@0lCen1F#-qAbyElsbel{G9Va)D)K7T1+28jCN$XsknTvwC2M)AM+n6Bq^
zeO%`gx=x`FIb~Q-FX{%RRFIw^L$Z0YC3}j@$rj0?>{&7@d!FpdUL@19m&m&8oG!gW
zHfA3qGqaDArP(LR*z79Wo5{<%xuQ$g&JTuK6<i-cc2!ms1s(9EXfy(Etl~e+WTSH#
z{{!^LU*O7hXm=UN6%3Ss9T?IaFzJek`HO&Ohtr5eaamP3RiYYJD={E@@TM%rZRJ>m
z-u}dUa>{6)2BKb0W2ABs^_64qjQr4{AN(g>R?h?Le}VqXvW71wDfmD+2VKN4$T_fJ
z&_01gmO`G;O42<A769HhkNu?;3W*MnP0%rEW47yj^)>$7^U(<7bK}5mOaOM9keM>c
znOfjXn*wTYnlobtxW`$*pJzCW&T$qy%US#!P}b);OBOjxUEnNzk+aMt&a#&|8@s|;
z?g`HFPjWUs&)LKRXOmBHR(P7TsYTAFpW$rgS<Ys&oSlhtHkab;EKJck{@eos)MhX|
z(elaS{m*59TtB%tw-T4Gq!t;wk0IE9IFrIcI{yZ$$zx5jnfzf49FH|{{tYWB%2SZl
zfRF8+EEZXRPrdiKjKSE=%>2}A87|)wy-hN<s}$L!sF}u^B8SE)Ac*dXZbcI{A)3rk
z6A7C{sbF^g%v~%yxworgSnZXpijN+1qMwb;pIaHD=x66VI^l)p3yU|OZ$3{4q7$C;
z$grv6NV32O-elwiWMBl8PnWkhmCpdh8LMpG*j_5{kQgx9>l}CY8YL70Iu&Rvy=_+z
zWXwY+J7h4u<G(ix-LALV$GwWz$8b~XZJ;UjnqCIhWOaj_+C_({{RXC_C7O+T3pAmQ
z{7tBrDer+p{Y^MeT^{In#7*>su$$;fjur2~u#bfedw^G(5WMGujB8~Chyx5138FaW
z8_+OMG%!$6VxXcVf{Bs{CQ8<FQ8Jc`lC4~nOy#0vDHqKns}*xutxtS;YUI<HvM^p1
zfsmJqJ!GveA&r2jSEbQs>T-FjdR@n`YfGzZa%pW%4xwQ)!}kvb>@z}~)rZ3N1^l8>
z2n&S0jDFE5gjG~8JiZ(n<xIh`yUCjz6TEy6Mtl99FUdvP$#)VmK!DFNeWr1>R3S$Z
zX6ypZh{-g^oFZ7b8x_o0zfoS!I<-U(buonf{)m;E8hpm%m<T008qC?04(TA?C~sHG
zZ!zsQkx<6UcIg^M+Ax~k`Yj}lAGmq_ojs1jaDL=42&$CiKAr&CsBErO-z;sHjb5kO
z$6RS6Mj#u~&*L}%<D=IBX10M3q&F|Ey;*v@!fYl--6+GtP}@N2c9peqrJ?`}(u?5P
z4mksvcwNR=Y_@Yy1JC2vw#y}S=Ag3JEuyQt)J(Ulbi2^p*sO|X25@53<bg}g|Gxf_
z9&_`ljKC8z#?u%W`#?Sw8hev4gh?2}Bn)8^hA;_3n1mtBOjtgZN5Tq^nokAi@Z!ih
z3@}g1>*ewmBM#LgTQaK~OWPDaXQxuC-q?m&NVnR+^WgTbV8TS0kIZs;sL_67ppmw^
zf#5=GVP>0t!t3|V?b24<?eooU{V3t}N0n}0SSh26A#igeCOjYhasS_%^7!Z}x7pT}
zPWQ0hSFT>$E-_^nU~pt<bA4+YwrF`df|;kfm`ZRz<&_HJF6q?~P4~cA2t4mYAk0o)
z7(H~hI0cAJzp$Si))Y)!sjh5qZd6s0`y}X`V%%bVP#6?GXt~fQefT2Jq@Nr)gnn6z
zSQ7fm+GeS`^9&Qh%V+HCXT{~S_T_Wp@;UqRd0Wz{Uwyk;uE6E)oqnVD{D^U#I_2>n
zel_jP;9v&?%_7I)2n}MmP&svcgegBfVPMuP@NzBN63ElV+#wp6K)o-7qmtJhHLeqS
zQ}O8vDcF^pXIJKwCsE;wEZgbl2GzHiW>?ZMrKFQ?_dzOK^?@qe#E?$F7316E96F$y
z7{5_N=IH`Lq=0T+AbFJ`KxZ&&uoQ7a#!DF7(i@g2aI^?Wk+G7w$U;nU<JAWYiSj^j
znVB6NlAucB|LOHNs1X^?MG|cAtF!{mUyT)rPtFe#<gNzi6`xRAjQU9J0x76Y&!Il%
z8*}%*u!$&&vL%-+a1g$~(L<@7{Q9Lw4zcZZ69}=bQ()MP2n;(sr&3H;6DTN`Qo5cV
zm|T+QiuuJ;8BSG^0L)GNW=06qz$8mB$+F>0v^f<06((BK0~7s#xUZ&v(g)=f-lTun
zCS3pWCp-3)n`nvh`Pq~EzjT_BXdk_`eS;-t+5vx~H<s^~N7do`ZViO=)rCyL3F%AY
zs{}MWIAReVjlssjBqf;C7;9uZX!z(@ud*k8CrO0TROmqBcV8g!_!&2wz$?pl+V#WM
zo*l6Njz}RE%;~%u+Q!RBF!pY@)o%<m%7xxEJWhqsc7FS(acu&_U+QAaOqCO+4h$Qt
zK;|DfRfA?SrMVU(_aGE4KM+MH#=J4Z3~nN2DvRzndVAd#h3__D#v5(SaHJpB_e2&K
z&koI(!NI#f#0bo*^x2KtGGTdGCTxn7ny3dfcq}FY3Ok90f+sE!BiI@Z2aPm#610(-
zDoae09n(B*c*G<{Q8P4Rm{#@Vz9pT!Ps_@9ATx7*JUDu;TA3-!DAlm@0@;=y1H<Jd
zyfE-yGJ|xC`oax5f`$bOLRv~+AflGUNZE|}SK-k*U39vs!_I!I=_F>wghd$LR_V1q
zBVte6Ig5<_&bw{w&n8F7C{x?*cHZqZ;(;%FRHLfE%|3!k&qwn!F#UyKRCWVlvLbB%
z!XnrDbM)B(Zl^F=pE|2cXHtV2<v?s|JNbpAsHhT-#V`>ss%=dK=Q>qlK2M1j9M?>0
zM5}9#pFPLNCy;K#)CW=&mSzlAS6pIh0#;X2VtNWzavC_q4A6*KiABdai{&_r=Q&F-
zB>l!|<&93n6m#^B#(ZMMAiZN;lAWTYU6k}-;be1i@#aKxf(`@=$9<BDsSzs^bKo#F
zfZYvLG+?<s;ocfe58e8R)1M#ezy|_#GSD{$7l49DS@lmP8hyHx5##X$K|+!HDvVzl
zl|a=UI@-=Yh!_BgPONGix@+Ce@loZdu?Kr-I0sk(J_^&obx<pLt90DAI^EW1gdc*~
z`c8}E-Gf%o3bdFORjXTM*SS~k^-KHvNHpQ&CPgJoP#-l$M_Y|XcXb(SB8T;N8aLW4
z030GE1H2(Vy)5EaJ9C;kbb7TbCWMLAcEe2`YF8wV#OvFanWF~U)8GS_MV8S0Gp!@{
z9oHKO%7lSn&$$IHe#94U!Q{T%>53xJuTwPEYjke|^cTrr?OQSLaNr|zP%u0sZl2-U
zTR0&-7za$83SS-=(%w{{I#`#e2QIxuo(N8IAfq>?5S?<8utmrySqUcoh=%9k8I@F2
znwb@8+a&vdXbM1%gh``CDP?n$DX$*GOg)cwBB3#h=+1ZQR-=s#lV$Ij^fdn;?YYSU
zW}_N6fu;k1r$=OF0MIj|GK&D<i^gOY1K<~r%Pau^Fqx293V>ibDYFa!!Yly7v5drW
z8JXp?oQ(r8oB&`r3Ba&04kHSqI?WU{EpsicNP1e84NPD)!zW=k&jygQBr9<*I~}Dn
zmb^mEEtJvxChjGzqe8`NX}E<dmxAf86jda<Gwoz|Iu^yKD2hdwt|KiVInAPWGt+Ap
zcbY}KW^ub&)N7V-n#H_k3A<U`YnF7HCA?-yyIIm}mU5b<yk;r8S=wuscA90pW@)=w
z7PHZdqKsWM<`re_qMX;+nA2I_>uk(!HtrSW?4k*ztwd4YE}F#7#FUJ?Q&R8>C)~m*
zuW-^Woc0O}ZsCkas1=%pMLZy(HtE51BS8Akc>q3~2?!<qJ%}-abx`u$Q1Tj6bq=hc
zESwrB?>iFmoH6H*W2QF@eNPuMDP@VEm$^-}OA-8<xwn{K-)h<)Apq0^U+0vsd=o#f
zn-BTQR--r6ooEeTmsbo8m^|Ot0TgsTQ1*YIN*|~=AE=)4fj-PTKIy$OI`kbZbpTiF
zg_yD1gtZunfHga%AJ_N9joLot6s9!v+TKB{fsQe~EkIy^j2@KR+8f~Hz{{LY1o<43
z2JZ9GJ}Jt)k_s`=9F<Q{$tG-iNWf^xF@s01Ig&Se-b${cjFY$(QO+38<uT15%uK|Q
zJQ_g3h5~ucqH#*nfbMpfm&#4J>LaccRXJI_czw{U-j}C=SoKl4SuXjwrwvNC;Y>D(
zq-drUl<^LDLZX(q^G+ixehAZdZ}t4?&b_HKw;R2q4q8zNnm1=>aTe{$NM%8froCPo
z`|@$OCDxD$l*si)9qv?M5)a%ZC6-a56YSuq+j;K}^2Qmrt1YL<IPO7{>RQEsR{hRi
z=OA-fe-Ei0?~{94yHN)cPi^AS#EXp%kjzHYKFJ@qy`JG#7>Y*yuon*u+`}%+OyDlx
zvW(`>!LppQmnC<WB{y_V%TgYZb}*bjo1zGQGZe({494-3&+5wg*`O~Mvoi>*v{Yd=
ztFS5!DG~t!Mp7{emV{MkFe@4UwT<};sY>;Eg86F$e-Ycp7+Mrjo?>r`BEN8v&z^xz
zAy2w29c+js_px*mivT4P1-34hm05gDVu>-CC36x><$>xMmsn;(V%Z6qjZFg8Q;=AG
zN@C;F5}TNj*d##4f`)V?QazHB+#RT$*&&NsbX!4=4}}pcGP@!O6jcLgc~aynnxIcq
zpkI<$BHz3J{u}a&PBya!Aa1(1D7|kN%?zaNJ<~ix2il3V-cG!n3G757h?%#Ef{V=F
zg(11%dV(d%c0DEo+5)F=>rMi9Q~h>B?7N;V5=nO(n0Comf$iR`x9$Devm5wI1Zs9&
zl|(7|*ND^XexrS7pn43=Mi1dV_67U0)H!bV<LyT4mbKdvSJ7@`uYu|3fa{7mLx3I@
z3bIFWL?G492JA}cD&bs-`!nLQba3F5^rG+;&V>WK;!q|Ye;t8a3;Ldd9gX%bg1f7B
z=%F^tlRgl*1M2IyNPeCSlvF#0^O_I4>*LN1?uJJP+4HdB&-!wP8<Z-Xl6_&OplQk?
zE*xh4`NRF0!)JB*j4spm7AeGKOd+nzQ@T8Z{s2m`K;ld!=ZRCnjgDEufqTcihG9p5
zI}9_5GfJ_i+V>ELLZHBxmK^92<Y#orIZ^>PCHp`d{Q|#uiJzH6vB7wR3mFbzIt4JD
z3YboVO|QeIH(=A7u<0YP>1o5mW{<;WPrznR0{fDJ&7OwMo|yzTrvPlu6lb|<&hj(B
z=F9?{gUk~@LmN9Ez?O0#>9#HFk%3u}y`<Z5Dl)Oi;a{9~rrl0;WJ2<M#4ggjqL^Kz
zdqr`($nc61c9H27CGDb!_r#1{6!qRLi$%o`uG`WoQ8?xn#=XLv`wa=N$DG|`7K=o?
zakt$VzKkfGa0_!@;iOxb_iit^h2vNlqrxdHL?&gzE1Pl3CI_TIbImzA5J)`Z(_QC>
zK_bEfW`nK)@Hb;iQ7QlnP&tM|TO>3q4cO!RbG}+Tt5|r0Z2^UbdpI9#5ZcM4EegV?
z1Z$@48vE{nu7@N;!yQ~4Y7^R(E2pt>goi=`Ff|}zK{xQELkA~LBZXxoI7kR+FmC^|
z3F6cKWJjnGPoRFlL?H>eieh?BNu=jAk^Yqg{R<Ew!ce6US45gJPq$(Qt#1S;D$T1a
zlDz|DuTXOf6|Yct3stYsa0@lB&~yuRuQ1{k8eU=4Ei}Etm|Ga}3gcKvyCv#z%!y`V
z5f8{Q$9>k#GsEkD+ryD+`K{7Ym8p&Q>U({Cqg>i9SE_njAjqNF&xZ8yI9fDEFNA&c
z5HS<mrqA73S>3KwS+q+Zz0&IT`mwdmH{F^ju#`^4(2z`>(*I*QG=<@zK{$a^nZywO
zJ7lz5s;q8YV~KX-z5Xg%?bea?5%pxZOZ8N}+;FOg#wIoRfX8t_oOlm|0|E>u@Rw?N
zdmCM68t9p8Y;5jqZ{Dbujdo`aL2*N=lsBp<mKa_bnc>bp1eURWJu-a2dZ*n2#yu<;
zO!T1D>)YI`PaEpp^oS~^q<7~);1_$LIDubOBw~k65=eC{E2!N23Y#QI6gPmedNwdN
z;@dMKsVw>lZHVNu6_yt1WqneCgk8N;-P~DOuf%K-K(zxG58%(j5_W6#e!sqF30^HK
zE=tGyt&Xj5K5Xo_>XG%<Ubk~(b=r-XXtGp41fD|^Ka`)91ZqP5V$(w;(!exm!g#LQ
zI&36%UB7d@bX8Mc@miyOt8Xd5sU5|4-G=M+_hL3XMla`FywTckbdvsym92_;gb!7K
zziW`3#yoECH=5{T1uxlnXUrY&t%LfVO)_X8Mo1JQHIjF)T(uJx>qkPR71=xPc4743
zS>^%KW{m?oLkPMa0C3u0!I(w8$ZdQh%q6lHspD(YX`%w$<$kqWZ}*y=u9MYV$fDw%
zwoeFTx~~zg{m;@Dix!neAIZ61m<Y_V{)u=48f&%1cvoOVG(c9zhmB~zbL-YYgQiSD
z`ydq$&k|o6KlBeoY}YqeQ8K1p>(t@9BXnNv^y>$SUf?s6dl-vgs{@Gb4r+kIg=Pi!
zF<Zwy%i)*TT8FLvxLfsRtG(ZOcllT(SDtpuw{aTQ>)l(ewo`f5tt{QHw+`yNt%Fwo
zj?h&CiQ4MykGU;Y8URj2;cVz_6^E%GDUpjF`NVKE<M2)`RBOg*DL7X#w54z^($rAo
z2Nqdk($v^r60IK{ITU!>cP^Y&GB9D+>)m~HAX}yd*iAywYps62(G}C2y*<2C9#%+@
zaF?Mk-LRfd=AY018i1#7*qBH5QRhlZS4axTg$QsG;|K6_n2ScfpvxC^`4WZ@P@KpC
z@^iZSg08%%a}hJZl_{o4j`*@8M0_P&h-ilvC<dboh*$+B3Rgg32E2#`%ar0~g|ggS
zr$jfeQLdXcN_VqC8E>{I>CLmcv`wjRs+9fa4N8FX7UjVCG^WAPZoY}=6_^K1fUI#!
zj;zXna8<w+Fe<=V7^Vz37Ihv_9L3^j=t&H3g@Y(DeN|ZO9HOFc=g%o9ay13Frr|Fm
z&q=DH$hJDyeun#(4fz|xN5jE;ha8^30jlwZ=I}WWcj9)T`2O-x7#sJ0<U^crbpj7c
zXroCynWS{oK)Yn+qQtU!k<*0N_|8}J@f)Vjcy$Ue_%vYd8P1ehn4dF10?YxybQYMq
zvobT!Ni1?sX3_H!i=CHQ9QsKVWtO}kvD8J*(w8Kbxg<Yiqy&l0JS(x;=P*)&#O9ut
z*x45(cJ4)qo&Si$iZ4m*!pjo7_=?0XeN<wXKPIs&ACuV=uS)F6S7kQ;afvN_TxL&w
zLSj#UQeumrl-V;Si9K7A*>hJV_WV_uy|5&)7nfxAk!6X!v@Eli%MyE~EVGZUNbF<R
zB=+iciG6%kVxM@8vroP*vC``@ySgT^r8Su?uS=}FF0+*liCx=}+4W6{t!~QfwJpwG
z{}g9y+Y(#fmf1!{Vw)A2ZB-@qsjAGj6P#5doK*{)-5?U$B_R15wi#2Aa&-?A(Xu1#
z(SQRL(rU$#b!otVYPJl^ZI!T#Tp5-&pLWFDUaK*?$Z%xg7rtLwiEw0jWyuzLEB96+
zk`Q6pQYdYH9PcA8IO=saZg&>*+D*9a;$FK6yIsm_S8&^<y>?S}yNuUv+HIHh+D+T-
z#=N2#yC~-s&DuqIujq_jG_Jz~#^75|=I7=vo;2eZenJ24l>|ktnDEzK3f4_x-MC$c
zinw5P0o}jSR9&3ACn^-IIOEO9W&0K8+zI%+JppIEufF1b^*OiM57^Dld(ED3n-$$=
zKWI0*;FkQ5U2@U8ah`5uP<Y8JTyP67dxcNAg`adpfZF`CScoFPiY&@bF8l<)w^E=*
z^M*&z=bE|2n>U&_=rCwk=h$HfX!+70j*e2UOOcq9MKHWlpAr>EM0urLe%+)}B*<dr
zjb$kM)Q$4SQaK78RZx2Y1jZ0+SQ!1p4*`pKbuMJ+0wgyZ-|2<QPYYBYD)cPubVtcd
zXPm0g8?!q^z9Q+_*cS$Gz409<I6<&HFWS0lrK@+SxZpJ(tjhU&N9_%jP7e0()=UgM
z!L67Md4^kgZuGcRI~B6GD~=u?>_#+lpH3}(6@jM@R$e*1Yo8h4%y9p{+Oy#g@wKpd
z%<=Hm@#@sv$YFrGkuUk`?A&P!<khjc;T7`g#9a6id3Ag)bdA6Zj9etI=I6pz$*YCI
zXLwbUb0gNtt1}_b@oLYH9wKL@yn12uP<fN?y}{se2)@Bk?GvZ>?wf6xm(!NZtLMU>
z<8R{lc!V#Q$&q6*Ir1H+Pg^RP;f0b9UnaTGMKU>ZiHwCUkcm;tV|>Kom^x)?oPFTJ
zIR6mKVtmA+m^x)iTz=REF@4%{c;I4il~O*7xp4dw&`W&+kmx)bx^Xgu;hN4JLl_>>
zc~s{yoyT>a(0NklDV?Wvp3!+0BkI|V@S{e~3x>^;F=pO4$|$pJZ1|sql;l_LFXxCw
zpLi0<f=fUcjN$bd(h6hf(>BIbJZN~(@nGP=#6tuRQ9Q)(5XVCT4@o?v@Q}ts1`k<0
z<RvDJV?;ZNDU%XY3lh_&B&JUTpEe^ga~AltGZKr=0iOoETO9bd1n_K0;MY>XtEDd@
zp9UjySrU92ym+2J0W`~az<PL0QFn)2dro#0OF7w9E%jtqv$T_4-O^8X4a+#$H7)aG
zH)2IjcB5AGWH)BTPIlu~{A4#_B~EseR`O&wWu;Db(^mRqH)CZ^cC%LY8X3R|TBwOM
ztL$Ep65qX&$@<v2Qm*@wNHkT{^to3Ws`%V1{kkt4b<;qlo_l2?bK_n`P&MyfMUkO#
zuVSc-cdz1bm2|HXXh!T_C6U2#uTp3`>|Ujjsd29|sJM5pve#{6;cwt4i}T|!7<cC<
z?!qYCou7ms`R;rHew4fOQ}CnSou7su?e6>x{OEV*XW_@VJAVd#%)9e*@DsT^e-?hC
zcjwQ+PwejedH9LnoiD;q;_mzf_(|TKzX(66yYrXeCw+JRGW=xj&R>C_>|HVzaOu(~
zn@=v{0qN2wJi7GN@esO{$WeV~@3?z)s}dpdh3tg%ox}QjP-O0qAP>%x_L<Yd+#%^3
z)rd2v#@IngAXFs8iBlfiLD4Ho#i_2_0qWkCD(CIqNv?-?2r+El?s}j&CpsP|&G`Fp
zihTErqO|W`QKIhjy8V7a+`ZQ6^)N1fLfq+GnmdP$ejOpWvGd-c@F(6m?zZAU8;Wp+
z8}J$WPOG;DpxLJ593@ULQu2VV!UfwoTL2$K5vDsOX`GQDY46U6SC$CQQr4XsUz6Z;
zW%h^gQamtkd3V|d8u=$M7dn5r(CHfso4xeV<fVt^E;TrHN@crRjRz(!9+)@7nKs>?
zH8gyU`R7a%Qx?=Rd7DEZ$&Uh(eC10=l02_-iag6Fbzac<u&kG)$SCW*K<S?^IfC9V
z0kxjh<&VuEj+<nKkbhHC)6+AOp~mcg(I^9?^cDS^vj3*-zZv_N@b1e~h<BemgD$^-
z7y;=ifb>*AdKw@-9gv;@NY4bM7XhRfy#k2w2|$cb0%Dv8#JB*6@hL!zPXl6H1jP6Z
zAjW4UmU~WO`R64z{({6NUW9M|h{OsnaW)0`y@1axAbu|(elH+?FCcy|Abu|(elH+?
zFCcy|Abu|(elH+?FCcy|Abu|(elH+?FCcy|Abu|ZhKB=S<tdiO1CTM(Xd5>TgU@Er
zNno144A^=mfUOIP`dR*~j;>F3$E>lF-JF#>+09$|lihJ^{A72+nmE~=B%hK0ADO$z
z+`Sq@RO(*k(BRI!%A={Bdo_+mcJ9>#diS_jlYY0J+4-|8vz}XzgQcgMQ;T>&Ed8>F
zrBkyZSlXx4WooZq@Al<`MqBGNo4rOq(xWy6%LFEgcMkR|UZFrnkv?iITjc5P`TmDJ
z;-L%^Y%}_}h$1(_yF-rY3fj=it~COI05f8!jBBtLRosRuO6PQ}(Q%XNxFJ>CI}*m2
z3tA_j>@z2}PVrY@?-W0P%>xJ77R}kRO^P((4>IA8F_AkrVu-8m2=%nm)>e6AnQ1~V
zsggibC0V9cd2_Y8bY1Jc+kz2MDsPsyl-|4bBc)Q^gtLC<NQ2fl*2}gAIw`uMC}?k%
zRsmg6m!<apoAuVPUChMDSMrNK(W@ppGJ2nko(cnEP%~nZ7!;5fH%JU>kQmgUSX~Ci
z>M|&FpFyGfj1+e#0L7yVj}o-+G_k2~TD$-+@P;X$KXTA*MJcVXJje9q@=EE(TJ;o%
zFx!KR9BSa6MKWK=?T0l=1RoI+BPrOxjpiWdRS_RavO|Cb7Cg$IRT^+vp2K)5bIuH)
zb5RoGaw%9an0^gNi;T>5^p{ZF5J|29S5c<Gzp~Ihjfze+B4Ag{XO`o72{CdwGFFb;
zBJ5=_W`pNV6cUZgts6*;rjfUt;&+%sTX;zX8XzZKVTok&NEAK+mm~bMEs>PrfEBV#
z0F=<={S_`<2}b%DVXs#388lbO&8^bed#BN7Bk1pO+g}@<0x5t*qtdVUk9&^$hm#cs
zdTRCWB;R^r@nv6I$6d-ze-dug;&<Ik4?XZKdWW~#_3oV|tBy7-tpi$eUJIXrvHzPi
z`{&VO2c`X8_yP#&`B*+Z!Si{Rb|AVFsY0S;3bxsDk`{YPS2MawE>U{U2xP7iPTg~o
zinhlRx`~R3ALkR3Jf1K$CMhP+ei5MkqGy>JBj+FkJ@9~vcH>7l@r0y6JRw*Cn(nhl
z7QW6BY{aN%P%ONgow!5fn3rm%7X3!RGoBeR;-z{2va#x2$ESwLtq|kIn7@hZwkIw<
zr@n!e=B$+gGd5w{H16+l<>0tyiDjs-tlg+wFE6W2ER&l@j!zNUrcwNowExzp>b>GK
zXRUt!=#{6RuJ3nt8&B<Z4xcVno_qS)#l;t&-i5{0Z?&iWYvYxHg=1hUk`{nUVZUYW
zHx3%GkPi-Gx3Hr3&W&FER>Ob`a{M%JVSbXsPQMZEb!fXxVJsGrmu0{{%C?${ii9cz
zqr(io9@eraFdV+TA*z}mSB>!rUf_j^{3Xf6<eVxXI`h02&uPFQUnZVT7EXW|Eq{uS
zaQcf88<$4*3ta`r0xTWBs7EeO(jMUG$b$zN03s&!h{Yli%*>&}g^U-G2-7gDhDN)F
zy!s^F6i}3*!;i!zw7h{<jO%eEo9sXLHgp-(>451zVAG0NFVFy3EG=zs$1D7aC%Jsi
z)R~@20NXXr83rneOaf^EY+P(gX7Opx5;L47XMydSm023tw#*rsWmBAu&2g5CaF#!d
z(nu|nmU%X<NMmVL&ZRXa56~f>1sY?*wla<Q=s44h_!6@tzC>LAKY1l09CBo6be<gj
z(B|Q5zi|Iz0T?zU?tm|VThn+e?SHayFv&bZsMB5h24g;BKOo@+o*DC^%-GM=>}Tfi
znbX8w+-oN97l2^8hUfR|$&-64DcjpWXcT*{d5#W)ak`>s!$C^O?q)h|Z-5a<Dz0u^
z(~(3Bvl$-+CmuV~aRjQ9KGNgH_8OT}c3Eg_D8IkEOO`m0m27eMDJ2vfM9^Blg(iVq
zpP43xTOj~}k$4(y0G1f+$@X`4U*u7f5xF-8{0g%$))}8)VKDP%z?V=s8)kF`-3clF
z9=hpb#2=MFkqQt1^YFl*>(!2p@*JR6GKD^Ux-P;zz#N&dXHZxXVX?DJio>)eoS1w`
zH!-ZU;e09J(#^Du4dFm*HtCzPms7q)D+nihR&WvqF&dg9caD81&zUg?*Nq4UD^Qr2
zkjN^^<tW!<lukuhhXhThZK`_E@Lbmiu?KFHdOIc*h+@~6z&;79kqEib(rHYbiuW_!
za?zq<0c~c`>1w;5qLUlIdEII^_Mt#DTETeBQ4vj|a||z)pmWl#VOQe*8`YJ#b3zY}
z(%aZEsGK)T;feDEETDI$*GT)Ts6@vSc#WjL2CnHIdaDSYiI<AwsrycJE4)d}{-rk(
z#Dw?~vCirK!Jq;*dHIO@B<dq9bz4mEO#V5F0{DziRN!D*^0haU+)Qzj9}M`~M;`2M
zk2v>X1gHs5hN?WPt0+Ca;yUc2T`3?{j2)yZwy(bCkH3d5_bRu8tEuSXi~bfOFBkAC
zzH>k-*j5T2s3XHZKnG5LqEpR_+&1)Uh(BZv?f2j!4ge!euQHobzz=zmf8-_p)YGOW
znGt?5ic#F;U=+86%=9Fn`y_ynl*A%wK=&CAY$9jzF+le@ZhHW8mPXh%$^-ZeXOlnz
z6af8Co#Sl!JZCdS&So!gcIF~ybC)<fdzrIyS2#QW1ZTx3IlC~=*~JCUE&-If%%37C
zrJwFSEc{<J^1Wr(eU_JYAvx|2xe6CO$79C{__7B97n_TVH=k}kO$UO2Px&n0W<qe*
zvWs?<YWb}yQ!vD+c6D{5wEecWORSsuMrnJsbaky<F>lwqWCY(Eb`T8d@k3zJmKh6-
ziH))Yd71+rAM$bcK!jF2Z1k<pesm9m&$s&+B_z=mcZ--KJ#D{*`GG@e0>Af@SLzcx
zoGyJ74z+S3>BqDo$*<iK_hdN0j2qTED&x?{M&-peU}G7uv4Fjem@<n3iyH&dE6y;5
zYjh}Id%_!fxhXH=0f#>73x-q(8+tK#jDlRMw=uWluyf&H>wwjV<_lx%2yA2l3xP2)
zU`a?^@brRE#4DM2dm)%rl)>ntK)@sdI*o@T5f_3aqL6%gQIK51A{b*dbh(7n8c4SI
zNDLnx5hO6e$%@oIu)9ljz;t#bKjWw)<gwa;&_E((>CqcsKCU0c@ec0)l5xEtvON4w
zB5Kne>o0){_W8{S1aIUc`Adl4l?x$JZWY{zW}JWN@pJ|dynInt5xdV0#X)tmYvK-;
z?Hx==QdXT44S8>!(r!}9OKxLW$@lA=+cyC$a6<7aPMB5Z{xbdqe{!CmJ8x>-<Wv60
zsQ|cDz`I%;Km)SafOk#6yAi;<QNX(~z`Jq4y9vO%Nx-`)z`JR{yC~hy0^S`1yqg2O
zn+Lo*4tRG0@a`nw-2&j<sk0bnhw&MH?g37mzUVl`W^wW6`Q~{#5av7Q!+fEjW}P6o
zvb9;MGWlA$DsSDWYRl!da<!~nFPE0}%`NikJPiPeK86roWH3#hO%R4)Jd&Gp)IDmj
zju7MN3SvB1e~PB)8fq_e9kmxa;XuR1fs{FKULqW*5DrvHZ=sRiLMOe2LBWnkV#N`H
z^>{uoUT-*9KZqBF^JIu|Ud(^b@J37ft9>|6chX)2f(e_dAIZ7s%pX(RP{K1``0>#L
za$VqV%lH8HTkC5N&m)qG!G*qqj3S9MZ4TYjL%0ukc%5XNB5fpsjD|@I%<xkM=*}ml
z%|ZI#iP*y^IuEByW=HcONE3}AAFiQf8xTJ{gaOrMN0;Mv^zA4NvH9?H?FZp>EqN4)
zur7uZ)+ID7j(ca+4U5AEBjp$#5TIn46owxT1O$BaM%32AA%Xi!soigt4qEjdMMK}%
z++HuOF|Cbc>w!^PextOpR9-gf`?oQ;wu7Q0UI+1D2alVG3jRg%zRz8%tUGR`%xD71
zT4{X-or-&{{l?O9zte2SVIg~0j%MBKBI@fRKyQuMwXzrf-CkaTw8tQmV%gzHD1zov
zhiI-*5#1k5(T^p4-@O8#IuI+HcB?7`UA7{u(LP4M_<jSM_khN@g~GKiUeREot$|6S
z*1vPmpdy@g)2jEb9o#vxdcJW|@UCH)XJWAr)+GjZ@~D70NK}}PcpcML2;9#EgY5i?
zD0<i`%`;gZi<>aI7#b3lQ7WKqEs7gh($X^5)3Eyt9vjk12DPug(D`90XfZ(f*uX&3
z=;+(!Yd6+P+YCsyTgM0Wu5xvAZCTmv9PDeW)zaGPlGf_i4_bRsEZ-4D5v*RN;^D1k
zx_y86a;3$y17k$dB+Khp%gf8<WoBSBx&8gde#|M_Sz1|%I;C(9^vD~lOJ%^dw_C11
znQw3mr_&DsuO0V8q-)*Q{z{8p-Ir`n-CBLCyrv$t-fJ8fl^a*-(&!!UQpxb=M}6IV
z2u2{8^Nj#%H(Gm`jm0Iau-x}`5wA%w_fLFT{MumV(Ujy#uU8+VL-}9wQ5Tdu8DMlR
zB;pE1@RyY+C4rHKBCdp|%aJ{`HK8mTBY)VHfQl&>94grT6|2#3fO*jVm_WLJ-0<6k
z2rAOUTM>ZwP^&8dc+Wl&I$N{v1idhh>fK&rsZxn}4}4hNY|^_WkRTy71nA|k2*Cj8
z6+yBQ`^9Yuj-<FeABkEOhcC<U>=?j#!y(w5#6>`?0YtOmJ#*o_Ut!{-m!zh&=m+ls
z_#U8_XtiL%cHC)^<<j=+BC$JD_UqkuqHC+yu2)5gdeFLM^+PD8Ko^fA#pG~_?g!hu
z4C7bHYfH;aKG@rrm$s|&UbpYqZ0WXP!0-nr2fBFN;gceQ9pMp{&Zox)24khwIM`<c
zft-aw8j7+=7!|q&9a_@cAa=W3jn1LD4MRf7P-(c<TI~j~)ZNxz&yKKj3fxPzdPG%W
z=I4G3n8~b2P+hS)?^YTI!U!c^_Y>*{rtwDFH-c9Gm}{cFpY%>?d1||z?tY^i6+cuI
z-|h7Kox{prw{vjtMr5zvZS*PAWgOiF8tq==O{>*!r0uof13!eyiL8v?@=%pw^$!oQ
zl`U$^_9@yL(42L8X<RPGVg0=&3jk6CPQ;V1d#7)t4?D;B*oK>l!=xxUn5EtTdKO2r
zm$t{P)N^up7#QddhPSWxM3?sO8<8H37=^nLry})Rw&#o_`M=Xwr`@u0d!I_o9=z#M
z8}oqo+-W9sX7-(JAHlQh7$Zm&zS-LETV~&C?Y)CHQZge0-x1S5kHN=nxArW7rCLY3
zoqBgaBJ4}CEDgXMN9QU|TfN(A^s;sdy-%sX)qw>$4rLU)PgHExyY*YpxrJ?Ufc$MU
z{<6&`-VwKpghxigzOvV+Q@Kf|%2E3Y-wk_mA0_U^#@?!k+E?4h?Op^;jOy>=C7!;u
zzDDRCShGggxuS5)^}R;LH!o4U49{Z}hrn6zJ^!O{oK_F(w|wcJ_Buy*oS}^$)q&G-
zu1t5Ir`^Tq#C3i|A|v5;McB}^g{iT8Y8;?_{tfo2(4=7q1r@R?kdnIk<;haNTyGPf
zBc~mqsN@7DdWd*L+Lo?;N|(2Fm4Xo&H+Gnpxz$1OGWSb%-4nOUFY6sBakxLXMzbZr
zr**8_0${(`IM|DOqK5Vqls6Byal6y8P#2PBE*qiZYu)=3ZHGVKIiX^1qPSYsvAr5R
z6^Dp>COK!421g+bm!fnk$udg9<|N6zRAe~iHgiqpYbw%O68^x2*9DI`gUKEHl{fiY
zZ}asH6L{;dN=Qrw-cv~e%bk>&mcpE3GBeT=Gt;t&N1c&bEGq$9D6_<v1T3`7QaOpG
z^AgL9ODsDsv#|+@<tAj7pOo16q|7D?5}Pc@tS}|9sVSLFPfI|kNo;mjVrOP$Hg`s1
zXXhk#?ySVlpOsnhoWw4ili9`d61!BC*yW<ku3V7V6BlIm<VA_iUzFLxC5b(CNoG%9
zme}HDnLTqwV$VJyvFDzY*z@xedtqK?FD^*zBMUNn=_!f5{FKaId0Jv0eOhK8Ta?(V
z&q(a!&r0kQ&&uqR&q=KGoXoC1FR`WPWw!i+#L6$oY~@AHu6=~F>o0M(`Z8y)y~5e+
zALVTAW1OwO%Gt)pIotdMXIr1->{BJqwy$zlS>mh;1nZ45XK$=<_U1Lt-n!1&+pC;?
z`ZdnJ>UGY3%^GJn8IPxB&TD+#C2xVSCi1q1Mzt4+%GqpgF5cW~ZrL)yjpha&h}W30
z)_r{0bQrNyvS|f>GWfOfN>w>%H2d08d81n1*7i^o+*P-c09L!<q;Gnt%MYI<V~87|
z??GZlUESEaQDtfim5}=K+Z(0z)g|3_O&GxkxHmtJe88F9;HMHQb+~lL7@FjWM5L;9
z;Cb57-Gk2FJ4imX`$FEedwg)v=&O53{pdC+rl9mtYf&p(5~jb?=(f>~76@xp&_-~5
ziNJ_)xF42R<*2>~6;WDWqK1r)4WQR5{mxNO>qB9qPoXorNCKjr!U%HQ$Fq8+KG9?W
zW?}MS)7qS_@|35@3Mo#B(s1C#@8x)G<iFF<*D09tk?wk!lVQ|5{7{5D(|l%@PhiSd
ze(_OFC!!KdL}iwYNh}4dUpfw0ATF~kV3IM|`#HcQdB7y&fJr6*lS~38DF7y!0!%Uu
zm}CYp$t+-!Gk{6v0F#^rOmZ$Kv-5yWig}q`0E}`GFp98Anix`vUG{bY2?F4NJ7L1x
z3E4r8SS*$jE_VWj>;bS)f9*!4y1MeV{x!$Feye#$tyD|fRol_8ys<1}6xwjk+4rab
zkVv`e)gk{dvOzsfy-EN>Czz=d%+$#_Oeg0sJrSl}eV|*|m!Mva4xt<RR-3uiRyWpG
z0pS3Uz@4mKUE5rGT_xZ$3bh1oe+(gNbavo_2YB591)NzauZf7trpsv#e|k2oqsQ>$
zhr~)gCX(^@)OV2&)+}O-wR#UXk&elm@z=%(!|J#}X-PmOXImhIL2yUP1dxg8^v@CP
z8m39PmxB(g3LaEEXm}uPoiU`X(-rmXgS@^UYG<U!2gYi<ff%jP4OkwatjQJ+1*JQO
z_4n3*6+MXVdt$d~;D<}L9@kacVm2=nb@)a!=6_s>(SpC)hb^PRU3IjZuoRCtvhxwv
zd1#uz9jzWh=mbxuFe|-+=I}b^Z&S01q-9iD%L2^G=&GJIG$U>5-1KFscjm(gEKu`w
z|5T)YGlPSE+-9TYc|zL0>q>)+hAjjl0gq^-+uaP0W6ZAc4WR-<XyOpc18Wtj4Lgmv
zV7X2~_pVw(H)tJGDrmsPfRh!#$tvJvO>=UH>qEHEr|zUYTX4Wp((O@_*=K(RrJ|FA
z>$B3XAN8zGz?sgGk*a==08dhC?pbw_vdU<-gft5ULXL1J={v_d-4+%lJfRUr@5op!
zxa?68X0_Vt^b)QZh~#b2p4ZXfI(J@s#5#AXeUpUFAlXNz3S}e-V}AV+aBZa6kh!hn
zK)#!NU+GLzupC%#<hn5kGd$-qG()iL=sw74B%Q%&Hi5K~Oj!OA&Xgz@4wrGx0GBf(
z3Ck+wq=HEgd*KGQi7%f@rkPp911^BHZ=0O+2Jxvz8<v0Lm8;!G{hdv6e?4xu`gfGl
zjp`;-P|7TqHr|%&?K{Lh67wjR*4E_ufuqJu4|SIs?CwLzCQc6z($dNbCQL)<?Qzn{
z>zmuFpWfW4mezJE)$)3RGCKorR6nTn8;2vuDB|_@*dcrAm;XCFXJ#&B2!xe*S(uI`
zuWgsMuCFfb0GYE6q%(^*M1?ILCTZ$=3lopTu$S#lpTgr0k4C)gzwvZkr45|A*jZzd
zWW86BsFWQ;<QOF_v3n#?WgPc}JwFNTsdd&p^Yj6+TfQ6hu8?Mv^gj{&@Q_#p!3IA6
zGm%?97ciuBa?6WlPbB{c{!>Q&GlBDtupe%eiMxayB+oIEqL8D+5Kc5a(L_LWrh9)p
zqTA8Q3w&ytXUEVuE*8f{4*Z#v6p6nT3Hp}-x5$87fKMZ7AEuiG{1XNIgW0DvKuj`^
z^Q<rUfr%?^fm?jY+DQWXNe21}7ggL_Z)44|MLgho%le4Rso}-8+`853FV%YuM@PwA
zB_%Kxs~gue;49Ez6Af@G)wkEm28C5Y3!72f&U8C{+|`)OOYAc=D5P>48kN}A_U6{+
zHu4*#wb)U&gYXx&Tm3+<mad{PlisiIqAk;CsN{A3AsC-rad>>nm_4J{s<&SwPQ3*r
zcSbPnZfYxUeMnzZj{qXOdfZ=w+u}#ZJ!`f7daK>*ymK6Imdp%yJ3M$ArNwNdk=uRE
z|40%Qx;M`4bq+BtO0`=@E$6M({YHmWY^^<%j|qQ(c4HXEj1RxW00HlM+PHM5u)gz%
z8AFhvD7`Xd6=exLL{?<j1Uy-1s0Ple%2DeBV8}#kJOCDvv&c%p{pxT+W^|Rsu;%yf
zuObVDzyT1os=;jDRB<8^<DNA6YpN{L$_1hV`3P5^RzHR->&Y`AGww$nEQw0$WneqI
zt)p;UlWYcCxOSvMz^T>`j;wkBU#0dthpjfSXjcJl;OwSJP>N4=O5(frNyTb4`;H_u
z-Upuk9ZYwKOmWP)T0>crSS+dC0aD4_cK}pm-`$IGcwD`I+-(q7nC#y<a#jpMGMh3#
z_DFZ4+|+L8u-?uB?pq#sf2q@!8f_Pv!h$@sBg{ApK8nNWSTN9f45Da!{dXGsNX+|M
z4zJlv;4XK$DtQT(>#WTzJ&aR!AkAyu$?i&-UZr!oOv+Lx#|sH-(+n1GHkZp~b6Na>
zf0B_#3vyJJO(He~dVCs5cX@_S@>%$Q2L4zMc0nEvEQ=>u|A|{Qh9_hG666B%++Q+$
zGThH8ZH60<;|Uzt1pF23Eqa+>d4d;aaEo3<Cc^OXiYDfhwEbFuxW;^w5y0gDxdBqh
z7=Zyu0GTC$21q4kmIl0^Ny#h=xPL4yvmDR^d7uZzBNCecB6Kn?u|iyCQ^12x0}nbA
zmDp@lW@lm&n*&^M7U+d@8JV4*l2~y{W*4S8yEy6ik``Pr;mKPvirOS_fA4b{fJ`^}
zYn*+S|CFD4K<SH$(iaV-FFMBDGce|!i81#g7;`U*G52B^b1#lD_YxR$FNrbtQW$eD
zjWPE!@U%-ANm17*dLBID-t7#q!S_}s@p(53_fDGfNmDs#swYkD1YwhL(lk$+k&|Zh
zq!~MD#!s4w6U<kUI%%d)nwi%M>FWW>^GtJQ5f6x>3Lc7@Iy(%o1|Za+Es|@h9l?_~
zNuCzPQ(%n|22k-@2T;^eyi0-{xCtdhk-cWqVJUWi;B7T+IiziMD?|MNdqR8u!60+U
zLMh+sEmNPtVjC)qLSSP95AtCz^ruRVX3Irfh5%_iMwpBgF?05hMtBWTn-&FHHHHDb
zcv2uZ)6t4N^a<{06L)mP-f9zkvcMxr3=ft>rxM*Kj)ARWz*aF~>j5<mBr|L=*lKau
zk_p(7N!U6m*g9$8=QB)-rez*O`}Hi33~dWJAcmA-BPg&DRNM#}ZUh}S0?HaQI$+!a
zpw!6l>U}MuQO*~4eNu!aIN<t>oX+R2xa-Td+Gh3w8g1P@lAiSS_1JN_s2G|F|9nTR
ztu_v?cHYaPso6V?z6I>zElU_m<pX6^$NDSjYA!{yjC<`h=^gKiEg+gC-0KRFkG<og
zM%UjU<tw2kI`((1eiUkd=p?is`mksSqPG39QvS@xBfYedh*WIVl!TE@TxF+-cI2cs
zR?(pimKI*ea4usgevhH}J%%)645gPblnKW$L`n=LTQMP$j}M9Dql)^%mlB9IIR6hw
zEj&2=Hl!U;=LG#eMy~m&zlX<d(Vw#A1*RGJW}nx~se9bM`EmPPDalwqM2>Y$P|r4T
z%3`+MN)X%jg)s5dZ9@B0$AwW_?n@VIiRg5}*L<)LD%jrV6`|!#Vi4m40R>PDrN(Tv
zGiFc3?QIIRnxbOpHNd4vGjozVVfZ4%inie%nX-8&h$FLnEXO0!C`Qf%oCu`0Ctd;$
z5~kT!T||amq7_}$CSYQBm0fjLTSd&rVYf?&1%vkfWClgNA{>ZK^r5ub*|7Qc1bYk>
z3if#~BrWh)avI6oHaKm=BFZR=2kdiaC5mwTx7-&k_2YiwB;uLCb^5T;z18q_)Jwqv
zZS{R6N!!xaX^`{x?photy;8ak(X9C2-M7XRJJE5@=ITVEV~K<iA~dCv6fV7|n8U_#
z6)6m3RY-<n$3N$8+&pfeMWd<FDIBDT<{o7Uj!rwx)&~QVH$B5m9T#K-W9`H^ItVf)
z&Y23!Sp)J=PjP0XIWseyMY0?tb^+~Z4vRH#N2FkZ-hY2rf#rE`h1*f^03cnV$k@Fv
z6j|?!sWfBey_5G>VjS7D_piVI<GnAwe?Rw&AACTb#4&FrlQ`6;g9s=z<00~`*M?+S
z$*mie>pQC(JFl;9R5o9~!GdzEI8|@nsP1fTti2t@y3OPMX8YjI)YkUu=JslJ_0#2@
zwQ{La-6<`joePTcCy%-<;1v3;&otH=D0bRMA=;srCVY68WQJeuLm)$pPY#dq>q2@X
zZEi5B)0Q_^R^(2zNjfnStc)B2-M;ff@ZISUN!prU%H-2=>FcW-tLrz`^}|-Xb$EQJ
zEp4u^Z*JIfBjd(~xHgX4qC_jdwOIv1sqtQ?e+r=#4?Hh0W(lE6A2N<2KjMLr(+x3l
zD9zMp<TM&Njnsr1Sw?9w97Ww7#j_8xi8^gW!xZbNS3Ms#q64Df=#33wO14^FX3^ue
zEt+oZ$4YB!J6B<suE9q138gbwzPhorb_0V>Qf&%qSKE6B$7oW6ZN{B@*Gn7ArRwJP
z+dEgc%ca-HL^td8_I@1@+Z|HNj+~D4(93=Z)wUt4dfP7}86a<EU|vxyGJ1^$?|$6q
zTlhB~Lf(=d!Bc<)t#2LON2Bdue}S+9HbI*R_VXocJQ6nCuwNk2IqLf_59{ywE=LKE
zvcZ=b(0sVutA2{|L(m;DM+G9=Dv(HoY?;U>6^U6z4Lvb!ieilC@?0ZxOw&<{V4Q52
zd^L(83V_6oNz4EUZ^qBsW*gc=DM=!Zl7ti_2xCx5qRH2VU58CG5HssDJPYiAWC-<J
zt?!l`g@v$OwR2Pi4PG5XR(-j=v<jO<-*4=-knbI}Ib!~fKV-lHCo>g-`>VndotdtR
z$BieJv&X~z<Z9=gh9kAL2h?XI6+#}^orhVIi5lOkjyTq2o=nEGe6+2}6jgyWtfNVh
z;LJ3KGt*RCpQqUdc_O)iz?GV_YzGzpKBKaS3uE#Cb2HS@hOI|5y|7hL>h>mJEhcnT
zTB(97(y<<0F4LuBMVee)E^j&}C)LfZM9b5hRy#)-f3;ZHX<v&aTH}F6S2wHG&2@jH
ztK=V>yHP3cEN=qUQ`)HRTrE|~XviF<NIPX~_`dPW&I=NKeDi`REcWAH_bP2C`nMEf
z$l;pkFx?I_={kJG`+h_bL>t4S3OEb7R<{K(<P_h&5yN42)U`237yIc(w`1<M_FF_?
zPS%f(4(@Dp+DPZrDJl+1Q(^kXof`)96DfZ=YKR9|`4HiOyTyZY0I|GL8sOmBL8Xfy
zau|+Lbjr4sbU#=i$5d~im>hBK5ly(G{g8<U6l4i)2W}LNI2{?cVQ}_a{W~e=b>6TG
z)Hh0NtIM7(m0Cs<uXw3@>llZHu3|^s#_d+;xQ91JP)z<Vl_%CqZ|&fA+Ie$zxq4k#
zji;77OF*0U8_tuAzH{POZl#*&|Ge6!m%<v83aAY%6FSK|cTs0BsN0R+@j-tK%~Lm^
zsswx6cC@}TfrVT4JNhf!)^B#Y`=PD<6?uDx@Top2N@6eYIjL?VSTNpgz#`~1{4a}N
z8S|C*l>OtwBhS9gh9VI=AV*p~JFXk&Fj<1^B}y<jh985ISA3E_E!?_QPU#A2)n@=T
zkT8bCFtX#7EKlp4yps7DozIyWJ_X>4^z59RlH~!XWb#Pni;w1uETb>-WkgUWizSs*
zDxJxWNrovTKRKQU;1i8vavGKaY?jN|n(<uL*23pd3!lOhIItL=z=5Ul1k)(weSa7^
zI)`z*QvQ3ASc-=<-ZXH?!$HaC$Hp=wj*?}J{jTN*OHfHK<??yauS(T<=`t|$kw`2C
zkC?+p2#lO_Oyv1XFGmf=FJ3{oX`%se2qmclC8+}?2`D=PC_8FMEM~|o{)EI5Pf9E~
zFR>J$?=+zA%!0(Sn#9I58Qw>NPnOyEQ=Cma&DrE4XN6}tn|hYB>E}3`d7iV`7dSif
zB4=|SvEx7&I6Hrav*I{s7bZEo$T0ivOLn9@FX>N2QNLPf?QdrkMkK*~aR!9J`?pb(
zkK{oL2<;P$i8F7ks9Y#*v|aUfMul=$kBPb)bJw_?iD0RLDt(ip-BG4E%>1x2&Q>Nc
zuyjU}6g7Xc=;-bz*k_fWI=QzpNm97H3`EK&v3-GkHu+QcK9_+Zp1Y0-+>m0f@T*Y#
zg(B;JF_nPfzJKri=Jd)8zw-XK^uPH2z2<E0mp=I5K4z1{ewN@VpTnn|%&nY(?jNa_
zllycJV>6nnsNc>hf1mw2_ijINJ2S=Dm3z&(n`fJ6o990NIVeKAEGRmE0#}(dqcEU1
zFElS)_{rq_{K`f7%KakyKD-si?#ix0x4?j1xqma?%r`Inz|c)k+c$mQf0K9xU^w32
zRpwSMV{X7%4XEtz;`F%#T|7fw;QbfzNyG1ZU%W3|;REj9`+WGTzwdu_)qVB%Pkr@!
zbM-4EXWdori8sCE(IGE4UtYum(jhPTy!=A6c|Q5K9TI#br~mLm{(zE(QcC%PSoo#+
z57gMCe2snKmMDmo>yBfGuyPf#HczX%qH@U<m7AR6D`6~4$C)I>(;4(0R8hYwiwH{;
zThs{Az^JO0@CmqyDOEhqlL){7=jro#nhTM=1gI2dM=KPh#-k7o8mh?q-3QY$(%00b
zcRJE%tcNn#9FT7WsZV>MAiepiV<0+ENJ8(AraAsV)*<qj;CGunI}KBapoErCI8AE{
zS4PQ0GJ$7!dKe>;Pv*yly<Et;PD!|0KFkcpLqd^=D2*n@NM;c<eTk3>%p6Zdgb+lW
zV51p6dxo1C%oe7mfFF%x4g<hlY0k75<qb$;bOXcIrKo-^qA0S`K3SamEdSy?9|V+&
z()S67AU9=19taWi6%`;tkrkyCP5SyT+@FtrFW#Xc)R~X@&f@@rqKp`R=r;xM8#z)q
zegEE7%sC{%L)8VsT{ojAD^Wh5EBK%FGs*chJ`0daj05~3TLDU@s=%vW5AeHw?;1Br
zBC<kks}Q~sa8VDCzfA0c-0HzW<5vA(^9aLtVmu<+4K@tI^PX=v_@nvz^Y0k;qHIM8
z?7Y`sZ?um?OyFIL(&aOpY}jJShp;tcuA3%#b8I(mp^)#;chQSGO&*f%C<YYjuLKn8
z`2Kb1s(U8bXegS`)G3{unm|nx?{34QQ=xsRmCb490G_u=v$J>H!+WB@?=D%bgZ*x!
z9f5NvR6U#$zaY{th#B+vsx$^>4XE^WC;|SgXSD6X4nWKSuiMZ-Rnb1CUn)_97@aSR
z)}lf*4|9%*+x{?i5UJi#V~=1W^*ZL0Bv+kBxeTOP2mXpQ+NfO)EFnsBgX|ZM7lyOK
z^TE(pzA~4?ireMHi1kv=mBZ{iT~&Q%+y!6Rz{gDtRyhH|oW}_1(WHIl=Kwd`XwIFm
zYwYR5$2-!WEn9p@>|8#4orlD!@*ustvk1s%Ns6T9WBEirtB#K+j0sAZH;I|U3)A^C
z`Lp@+Qj7!GH_S*h7EdHU>7+tc2kp9)xUMF3)e(+sW4fA~N${jD<uQ*Qv45#KJ$+8k
z{I7^bm3dvytUcl8XH_*k=<dP514d|$_*|Z%_FwFjKg0fWuH*6?SL1eJ3NDg4=v4)3
z$p8*-jvG+U^M-R4chBe$!-I~8ak`9)9_f|W`Nk%Xemojs{PF}+Nt5T9R5;J%sq;*k
zKF`#d^GutSn0^NMygA^4&jQvxC$Z>x;PZ+Si(ddf?;`Mdmw?Z^41C@diDiKI%L4B=
z2E1Pmc)t8o67YF4@OhGmtpU8=6!3b}!0XKbuQv<4-WlNa=785b3%uUBmw?ZE8Th<c
zfY19V@OdBO?9!{8T_ztdgUkGiod_kuB=ke}`*;C5H$B;)46J(QghFm0620*C=@ms}
zfgM?+jI2>d)@UPZrX<BMpQa4rpG^tliyZQ0?>95e?7afe$arcSU^K^aKmWl8h{vb#
zGXy1a1yH*Fq^By+HFJwM$D8AeH$Tz*#Ny45H$P4X5o{?Ch&_3EG@cJip!CX(rKNJE
z!t~zp-d>~EGt2Ac?Q7+YrMJxnS?;v=?ifp(>sy$#!9WKg%;%X|-KgAHSy^3LEpJo>
z!H{mXd&f<n9$SvN+DL{bAO0>MGCd8d5H5}$XFoDw!(-r5IH3g0sc3(IcMGKgTrp(?
z@v-PM;b3HOX%iZ{ZP%sk622NH=O@En(532Svfz`11>b=AUKB0(Q~=}&8<wkX0Ny~_
z70QL;gxqtzyQCP|>QU@nAmIbC)+JjbBt5|A+(#Ark`|CQ`xKw^aH%p=iE2n~ZB{C)
zSJ&R&S>2%W<WZ;BYwaG~u|>eTU9PvpwN|N?(B`B^L7_*xrVl>#!?zvMBQ$CbnPY5k
z!cdfV7MbfKZI`^fXo!-R7bAAjGcPTgq72TQ!e>9?6vEj<m_5b(kN?oy@#I2WcB(;-
zyCK(GwYpkeE35rh|Dd5Pm9{F%Uj3*SsjQ=A4qltR!}`I&5)_&@wzkUKOQlNLJU#+`
zZx8x2*EZj@%MLp4in1);wo}?z-tl@#VXvk3e#Pl*<dh@_-uVB`DoFSj^P}R{AqFZq
zbkz2xK8(@salf$*FuTFx-Npey-3lt~qs|o&{Du=R7<1s<ZeS*Ozs4>Re8l9)M+9OR
znZs&)g4`4oMiwGG6~%QnycWAa!F@o<F>v@b^q<g#hlD=lA)zYjc({keLoN4l=Kn~4
zCbtkdKqwZR92oo6)%EfcB@EB)d1FMwO*~cBSL*Ot865A{UY(*zuhs8#j{9S7%&by-
z&*})a&sRvyl8EDce6$b1$~Peyn89YNd*~~2LKh2$F)I3@`EnxCthU8v@N**G=V*D3
zHqJ&QpF`&>N$0Z86`ecwUkWf(Wb3Rrw$4f#RcuNY6AG(&%rS^-Tl`7hIf|uV$&)OX
z8<cQd(nJ9r6+F_-)Il1SMKpqm#wl!!B(z3=u1AH9iSe|;MS24nsdzL%mLj++=H6od
z*f1#;$S5N+LW%JRX7Y=->$lN*vr+9pp-soktYFKHM!!N@?N?q2G%_)N6rD{DwsUJT
zPR<&73kq>HUF`rd3@rUCuMAhBJb|vR-l6MBukk>Q40ET#PIPC@-ig9YEP=^h`J99S
ze9#9TPhl!39VOar88DXc7lpq#{3TI-sg}lN8151#8`n#d(1B4ZU;+u8ElKQ72c`J4
zZx#F!<qEoX?Kxs)y?z@ge>YWlxa>K$PgVoF4Ga|)Us)?vu0ON51HacQ@>}a`e$h0F
zA(k7>R-1Of)jN2*Jy%7VgB#GwnS_wGm};U5d!RcR)|zUP@G|uyFT?WOP|JY^>Erf5
z$+@9hhMFiid-*6!+4Bd$l>402Fvf{NKIAc7R>)}_@t6S<0n>>G*llov>DLtQoEi3p
zLSKLc{H5S81Ak+f#M=ZU7eNEg608Om<Ek7ljl)bQN)s@<$<ibm@X45k)5I)Z_f}+1
z$-nFZ_1=n#1;Dv-2{Val_mGrZ(IgCbFtk9T8Q-kEQl`X~k*llMb}-j`X@i-&ty`ir
zzP4HgQp2u@9klvDa)>GiZ2P*>?3%~WZZ*OPy7=GLpIqFR5Om5vHml|L00OjOQ+x(R
zs3MQIQ$}euor~l^Q(Qx`f#CwV<S|iBYCevk+3+CyA+3f87}N1_RlrY$$a)WwDgj99
zH!jSl{jW`Xh1qiUA%v@UkK5=spzZ@TatF1Ez_AM#puOX6*YO8ZyNzB$WCs=IhW^1*
z=@E~ZD>Onk`81D-hw=p#6g;Vs$eNbY^I@1X=EMV3oS=4!!+k2gKi5+%7RP8r=rs*%
zi~&K(;Gqnqdm5lN*n|vdOJ+u$=x4)OU<U1CM`eMznAo8#IV5NWj?q7K%nNFlsx<me
z6B-+{>m(d7R*u_yK2xn}|NIW#7H`>C6gw|BSpASXlHnzEs#1eihK?B;kGl;8Gh~o$
zSE|0hPc7FFd$t>0G3!(mSTDfEte3a-PMhk*5(@?aRLO?Uzd%*$Ml8M&xfLQkfh&Nf
zi_sj|7ietej7mH(Ik9mmFRKwXmY0n9M5GWYBnruVUW&MOPLVSJMC~OCn1Fk6L8mB9
zy@(j1k&{_8=SI@9wVWCyT!_x<DkWTqp4HWJx_Vw$i@JINji~_0VNepqcS_=1yi@>s
zX2<Yi+=Z7DQJn$bk5^G7)nQkRu{023iUe2&5K3BBxuGKboZ{p1G@p<}%#i{!5mrjk
zlg0f5?s$}uOd$bSL%DbV;`^^DN)s(0q~V6Lui+)PA*H26sjcw_tD}aVa#B8dvUsn^
zzw2wifK0&srU~8ra3(8Mq;R<sVOQw%YfK?>g>n7_*#e*)Op*1FUoZ0BD*9tak-vzY
zkcIk6oLlP61O^wN=ol*r>B`N_N`_IMO9cSPi{u+OchZcl<fJP_j+P%|vuGVe7Vav%
mRnr`ci&qiX;w20()z)Nla`9%NSy;R|(VU=zNVSC+<^Kjbjxj+1
--- a/browser/extensions/shumway/content/playerglobal/playerglobal.json
+++ b/browser/extensions/shumway/content/playerglobal/playerglobal.json
@@ -904,1842 +904,1842 @@
     "length": 525
   },
   {
     "name": "flash/events/UncaughtErrorEvents",
     "defs": [
       "flash.events:UncaughtErrorEvents"
     ],
     "offset": 62984,
-    "length": 194
+    "length": 236
   },
   {
     "name": "flash/events/VideoEvent",
     "defs": [
       "flash.events:VideoEvent"
     ],
-    "offset": 63178,
+    "offset": 63220,
     "length": 461
   },
   {
     "name": "flash/geom/ColorTransform",
     "defs": [
       "flash.geom:ColorTransform"
     ],
-    "offset": 63639,
+    "offset": 63681,
     "length": 586
   },
   {
     "name": "flash/geom/Matrix",
     "defs": [
       "flash.geom:Matrix"
     ],
-    "offset": 64225,
+    "offset": 64267,
     "length": 814
   },
   {
     "name": "flash/geom/Matrix3D",
     "defs": [
       "flash.geom:Matrix3D"
     ],
-    "offset": 65039,
+    "offset": 65081,
     "length": 1092
   },
   {
     "name": "flash/geom/Orientation3D",
     "defs": [
       "flash.geom:Orientation3D"
     ],
-    "offset": 66131,
+    "offset": 66173,
     "length": 290
   },
   {
     "name": "flash/geom/PerspectiveProjection",
     "defs": [
       "flash.geom:PerspectiveProjection"
     ],
-    "offset": 66421,
+    "offset": 66463,
     "length": 389
   },
   {
     "name": "flash/geom/Point",
     "defs": [
       "flash.geom:Point"
     ],
-    "offset": 66810,
+    "offset": 66852,
     "length": 516
   },
   {
     "name": "flash/geom/Rectangle",
     "defs": [
       "flash.geom:Rectangle"
     ],
-    "offset": 67326,
+    "offset": 67368,
     "length": 889
   },
   {
     "name": "flash/geom/Transform",
     "defs": [
       "flash.geom:Transform"
     ],
-    "offset": 68215,
+    "offset": 68257,
     "length": 553
   },
   {
     "name": "flash/geom/Utils3D",
     "defs": [
       "flash.geom:Utils3D"
     ],
-    "offset": 68768,
+    "offset": 68810,
     "length": 342
   },
   {
     "name": "flash/geom/Vector3D",
     "defs": [
       "flash.geom:Vector3D"
     ],
-    "offset": 69110,
+    "offset": 69152,
     "length": 830
   },
   {
     "name": "flash/filters/BevelFilter",
     "defs": [
       "flash.filters:BevelFilter"
     ],
-    "offset": 69940,
+    "offset": 69982,
     "length": 685
   },
   {
     "name": "flash/filters/BitmapFilter",
     "defs": [
       "flash.filters:BitmapFilter"
     ],
-    "offset": 70625,
+    "offset": 70667,
     "length": 209
   },
   {
     "name": "flash/filters/BitmapFilterQuality",
     "defs": [
       "flash.filters:BitmapFilterQuality"
     ],
-    "offset": 70834,
+    "offset": 70876,
     "length": 256
   },
   {
     "name": "flash/filters/BitmapFilterType",
     "defs": [
       "flash.filters:BitmapFilterType"
     ],
-    "offset": 71090,
+    "offset": 71132,
     "length": 268
   },
   {
     "name": "flash/filters/BlurFilter",
     "defs": [
       "flash.filters:BlurFilter"
     ],
-    "offset": 71358,
+    "offset": 71400,
     "length": 342
   },
   {
     "name": "flash/filters/ColorMatrixFilter",
     "defs": [
       "flash.filters:ColorMatrixFilter"
     ],
-    "offset": 71700,
+    "offset": 71742,
     "length": 294
   },
   {
     "name": "flash/filters/ConvolutionFilter",
     "defs": [
       "flash.filters:ConvolutionFilter"
     ],
-    "offset": 71994,
+    "offset": 72036,
     "length": 570
   },
   {
     "name": "flash/filters/DisplacementMapFilter",
     "defs": [
       "flash.filters:DisplacementMapFilter"
     ],
-    "offset": 72564,
+    "offset": 72606,
     "length": 632
   },
   {
     "name": "flash/filters/DisplacementMapFilterMode",
     "defs": [
       "flash.filters:DisplacementMapFilterMode"
     ],
-    "offset": 73196,
+    "offset": 73238,
     "length": 315
   },
   {
     "name": "flash/filters/DropShadowFilter",
     "defs": [
       "flash.filters:DropShadowFilter"
     ],
-    "offset": 73511,
+    "offset": 73553,
     "length": 627
   },
   {
     "name": "flash/filters/GlowFilter",
     "defs": [
       "flash.filters:GlowFilter"
     ],
-    "offset": 74138,
+    "offset": 74180,
     "length": 517
   },
   {
     "name": "flash/filters/GradientBevelFilter",
     "defs": [
       "flash.filters:GradientBevelFilter"
     ],
-    "offset": 74655,
+    "offset": 74697,
     "length": 649
   },
   {
     "name": "flash/filters/GradientGlowFilter",
     "defs": [
       "flash.filters:GradientGlowFilter"
     ],
-    "offset": 75304,
+    "offset": 75346,
     "length": 646
   },
   {
     "name": "flash/globalization/Collator",
     "defs": [
       "flash.globalization:Collator"
     ],
-    "offset": 75950,
+    "offset": 75992,
     "length": 692
   },
   {
     "name": "flash/globalization/CollatorMode",
     "defs": [
       "flash.globalization:CollatorMode"
     ],
-    "offset": 76642,
+    "offset": 76684,
     "length": 257
   },
   {
     "name": "flash/globalization/CurrencyFormatter",
     "defs": [
       "flash.globalization:CurrencyFormatter"
     ],
-    "offset": 76899,
+    "offset": 76941,
     "length": 1104
   },
   {
     "name": "flash/globalization/CurrencyParseResult",
     "defs": [
       "flash.globalization:CurrencyParseResult"
     ],
-    "offset": 78003,
+    "offset": 78045,
     "length": 350
   },
   {
     "name": "flash/globalization/DateTimeFormatter",
     "defs": [
       "flash.globalization:DateTimeFormatter"
     ],
-    "offset": 78353,
+    "offset": 78395,
     "length": 830
   },
   {
     "name": "flash/globalization/DateTimeNameContext",
     "defs": [
       "flash.globalization:DateTimeNameContext"
     ],
-    "offset": 79183,
+    "offset": 79225,
     "length": 273
   },
   {
     "name": "flash/globalization/DateTimeNameStyle",
     "defs": [
       "flash.globalization:DateTimeNameStyle"
     ],
-    "offset": 79456,
+    "offset": 79498,
     "length": 330
   },
   {
     "name": "flash/globalization/DateTimeStyle",
     "defs": [
       "flash.globalization:DateTimeStyle"
     ],
-    "offset": 79786,
+    "offset": 79828,
     "length": 330
   },
   {
     "name": "flash/globalization/LastOperationStatus",
     "defs": [
       "flash.globalization:LastOperationStatus"
     ],
-    "offset": 80116,
+    "offset": 80158,
     "length": 1104
   },
   {
     "name": "flash/globalization/LocaleID",
     "defs": [
       "flash.globalization:LocaleID"
     ],
-    "offset": 81220,
+    "offset": 81262,
     "length": 560
   },
   {
     "name": "flash/globalization/NationalDigitsType",
     "defs": [
       "flash.globalization:NationalDigitsType"
     ],
-    "offset": 81780,
+    "offset": 81822,
     "length": 1055
   },
   {
     "name": "flash/globalization/NumberFormatter",
     "defs": [
       "flash.globalization:NumberFormatter"
     ],
-    "offset": 82835,
+    "offset": 82877,
     "length": 946
   },
   {
     "name": "flash/globalization/NumberParseResult",
     "defs": [
       "flash.globalization:NumberParseResult"
     ],
-    "offset": 83781,
+    "offset": 83823,
     "length": 367
   },
   {
     "name": "flash/globalization/StringTools",
     "defs": [
       "flash.globalization:StringTools"
     ],
-    "offset": 84148,
+    "offset": 84190,
     "length": 460
   },
   {
     "name": "flash/media/AudioDecoder",
     "defs": [
       "flash.media:AudioDecoder"
     ],
-    "offset": 84608,
+    "offset": 84650,
     "length": 448
   },
   {
     "name": "flash/media/Camera",
     "defs": [
       "flash.media:Camera"
     ],
-    "offset": 85056,
+    "offset": 85098,
     "length": 1029
   },
   {
     "name": "flash/media/H264Level",
     "defs": [
       "flash.media:H264Level"
     ],
-    "offset": 86085,
+    "offset": 86127,
     "length": 613
   },
   {
     "name": "flash/media/H264Profile",
     "defs": [
       "flash.media:H264Profile"
     ],
-    "offset": 86698,
+    "offset": 86740,
     "length": 233
   },
   {
     "name": "flash/media/H264VideoStreamSettings",
     "defs": [
       "flash.media:H264VideoStreamSettings"
     ],
-    "offset": 86931,
+    "offset": 86973,
     "length": 1137
   },
   {
     "name": "flash/media/ID3Info",
     "defs": [
       "flash.media:ID3Info"
     ],
-    "offset": 88068,
+    "offset": 88110,
     "length": 300
   },
   {
     "name": "flash/media/Microphone",
     "defs": [
       "flash.media:Microphone"
     ],
-    "offset": 88368,
+    "offset": 88410,
     "length": 986
   },
   {
     "name": "flash/media/MicrophoneEnhancedMode",
     "defs": [
       "flash.media:MicrophoneEnhancedMode"
     ],
-    "offset": 89354,
+    "offset": 89396,
     "length": 367
   },
   {
     "name": "flash/media/MicrophoneEnhancedOptions",
     "defs": [
       "flash.media:MicrophoneEnhancedOptions"
     ],
-    "offset": 89721,
+    "offset": 89763,
     "length": 604
   },
   {
     "name": "flash/media/Sound",
     "defs": [
       "flash.media:Sound"
     ],
-    "offset": 90325,
+    "offset": 90367,
     "length": 726
   },
   {
     "name": "flash/media/SoundChannel",
     "defs": [
       "flash.media:SoundChannel"
     ],
-    "offset": 91051,
+    "offset": 91093,
     "length": 390
   },
   {
     "name": "flash/media/SoundCodec",
     "defs": [
       "flash.media:SoundCodec"
     ],
-    "offset": 91441,
+    "offset": 91483,
     "length": 287
   },
   {
     "name": "flash/media/SoundLoaderContext",
     "defs": [
       "flash.media:SoundLoaderContext"
     ],
-    "offset": 91728,
+    "offset": 91770,
     "length": 261
   },
   {
     "name": "flash/media/SoundMixer",
     "defs": [
       "flash.media:SoundMixer"
     ],
-    "offset": 91989,
+    "offset": 92031,
     "length": 513
   },
   {
     "name": "flash/media/SoundTransform",
     "defs": [
       "flash.media:SoundTransform"
     ],
-    "offset": 92502,
+    "offset": 92544,
     "length": 422
   },
   {
     "name": "flash/media/StageVideo",
     "defs": [
       "flash.media:StageVideo"
     ],
-    "offset": 92924,
+    "offset": 92966,
     "length": 570
   },
   {
     "name": "flash/media/StageVideoAvailability",
     "defs": [
       "flash.media:StageVideoAvailability"
     ],
-    "offset": 93494,
+    "offset": 93536,
     "length": 271
   },
   {
     "name": "flash/media/Video",
     "defs": [
       "flash.media:Video"
     ],
-    "offset": 93765,
+    "offset": 93807,
     "length": 494
   },
   {
     "name": "flash/media/VideoCodec",
     "defs": [
       "flash.media:VideoCodec"
     ],
-    "offset": 94259,
+    "offset": 94301,
     "length": 256
   },
   {
     "name": "flash/media/VideoStatus",
     "defs": [
       "flash.media:VideoStatus"
     ],
-    "offset": 94515,
+    "offset": 94557,
     "length": 286
   },
   {
     "name": "flash/media/VideoStreamSettings",
     "defs": [
       "flash.media:VideoStreamSettings"
     ],
-    "offset": 94801,
+    "offset": 94843,
     "length": 651
   },
   {
     "name": "flash/profiler/Telemetry",
     "defs": [
       "flash.profiler:Telemetry"
     ],
-    "offset": 95452,
+    "offset": 95494,
     "length": 422
   },
   {
     "name": "flash/printing/PrintJob",
     "defs": [
       "flash.printing:PrintJob"
     ],
-    "offset": 95874,
+    "offset": 95916,
     "length": 711
   },
   {
     "name": "flash/printing/PrintJobOptions",
     "defs": [
       "flash.printing:PrintJobOptions"
     ],
-    "offset": 96585,
+    "offset": 96627,
     "length": 216
   },
   {
     "name": "flash/printing/PrintJobOrientation",
     "defs": [
       "flash.printing:PrintJobOrientation"
     ],
-    "offset": 96801,
+    "offset": 96843,
     "length": 265
   },
   {
     "name": "flash/security/CertificateStatus",
     "defs": [
       "flash.security:CertificateStatus"
     ],
-    "offset": 97066,
+    "offset": 97108,
     "length": 533
   },
   {
     "name": "flash/security/X500DistinguishedName",
     "defs": [
       "flash.security:X500DistinguishedName"
     ],
-    "offset": 97599,
+    "offset": 97641,
     "length": 427
   },
   {
     "name": "flash/security/X509Certificate",
     "defs": [
       "flash.security:X509Certificate"
     ],
-    "offset": 98026,
+    "offset": 98068,
     "length": 635
   },
   {
     "name": "flash/sampler/ClassFactory",
     "defs": [
       "flash.sampler:ClassFactory"
     ],
-    "offset": 98661,
+    "offset": 98703,
     "length": 285
   },
   {
     "name": "flash/sampler/DeleteObjectSample",
     "defs": [
       "flash.sampler:DeleteObjectSample"
     ],
-    "offset": 98946,
+    "offset": 98988,
     "length": 233
   },
   {
     "name": "flash/sampler/NewObjectSample",
     "defs": [
       "flash.sampler:NewObjectSample"
     ],
-    "offset": 99179,
+    "offset": 99221,
     "length": 308
   },
   {
     "name": "flash/sampler/Sample",
     "defs": [
       "flash.sampler:Sample"
     ],
-    "offset": 99487,
+    "offset": 99529,
     "length": 205
   },
   {
     "name": "flash/sampler/StackFrame",
     "defs": [
       "flash.sampler:StackFrame"
     ],
-    "offset": 99692,
+    "offset": 99734,
     "length": 310
   },
   {
     "name": "flash/system/ApplicationDomain",
     "defs": [
       "flash.system:ApplicationDomain"
     ],
-    "offset": 100002,
+    "offset": 100044,
     "length": 498
   },
   {
     "name": "flash/system/ApplicationInstaller",
     "defs": [
       "flash.system:ApplicationInstaller"
     ],
-    "offset": 100500,
+    "offset": 100542,
     "length": 426
   },
   {
     "name": "flash/system/AuthorizedFeatures",
     "defs": [
       "flash.system:AuthorizedFeatures"
     ],
-    "offset": 100926,
+    "offset": 100968,
     "length": 456
   },
   {
     "name": "flash/system/AuthorizedFeaturesLoader",
     "defs": [
       "flash.system:AuthorizedFeaturesLoader"
     ],
-    "offset": 101382,
+    "offset": 101424,
     "length": 398
   },
   {
     "name": "flash/system/Capabilities",
     "defs": [
       "flash.system:Capabilities"
     ],
-    "offset": 101780,
+    "offset": 101822,
     "length": 1133
   },
   {
     "name": "flash/system/DomainMemoryWithStage3D",
     "defs": [
       "flash.system:DomainMemoryWithStage3D"
     ],
-    "offset": 102913,
+    "offset": 102955,
     "length": 191
   },
   {
     "name": "flash/system/FSCommand",
     "defs": [
       "flash.system:FSCommand",
       "flash.system:fscommand"
     ],
-    "offset": 103104,
+    "offset": 103146,
     "length": 285
   },
   {
     "name": "flash/system/ImageDecodingPolicy",
     "defs": [
       "flash.system:ImageDecodingPolicy"
     ],
-    "offset": 103389,
+    "offset": 103431,
     "length": 257
   },
   {
     "name": "flash/system/IME",
     "defs": [
       "flash.system:IME"
     ],
-    "offset": 103646,
+    "offset": 103688,
     "length": 469
   },
   {
     "name": "flash/system/IMEConversionMode",
     "defs": [
       "flash.system:IMEConversionMode"
     ],
-    "offset": 104115,
+    "offset": 104157,
     "length": 432
   },
   {
     "name": "flash/system/JPEGLoaderContext",
     "defs": [
       "flash.system:JPEGLoaderContext"
     ],
-    "offset": 104547,
+    "offset": 104589,
     "length": 309
   },
   {
     "name": "flash/system/LoaderContext",
     "defs": [
       "flash.system:LoaderContext"
     ],
-    "offset": 104856,
+    "offset": 104898,
     "length": 480
   },
   {
     "name": "flash/system/MessageChannel",
     "defs": [
       "flash.system:MessageChannel"
     ],
-    "offset": 105336,
+    "offset": 105378,
     "length": 584
   },
   {
     "name": "flash/system/MessageChannelState",
     "defs": [
       "flash.system:MessageChannelState"
     ],
-    "offset": 105920,
+    "offset": 105962,
     "length": 278
   },
   {
     "name": "flash/system/Security",
     "defs": [
       "flash.system:Security"
     ],
-    "offset": 106198,
+    "offset": 106240,
     "length": 773
   },
   {
     "name": "flash/system/SecurityDomain",
     "defs": [
       "flash.system:SecurityDomain"
     ],
-    "offset": 106971,
+    "offset": 107013,
     "length": 221
   },
   {
     "name": "flash/system/SecurityPanel",
     "defs": [
       "flash.system:SecurityPanel"
     ],
-    "offset": 107192,
+    "offset": 107234,
     "length": 430
   },
   {
     "name": "flash/system/System",
     "defs": [
       "flash.system:System"
     ],
-    "offset": 107622,
+    "offset": 107664,
     "length": 602
   },
   {
     "name": "flash/system/SystemUpdater",
     "defs": [
       "flash.system:SystemUpdater"
     ],
-    "offset": 108224,
+    "offset": 108266,
     "length": 322
   },
   {
     "name": "flash/system/SystemUpdaterType",
     "defs": [
       "flash.system:SystemUpdaterType"
     ],
-    "offset": 108546,
+    "offset": 108588,
     "length": 241
   },
   {
     "name": "flash/system/TouchscreenType",
     "defs": [
       "flash.system:TouchscreenType"
     ],
-    "offset": 108787,
+    "offset": 108829,
     "length": 268
   },
   {
     "name": "flash/trace/Trace",
     "defs": [
       "flash.trace:Trace"
     ],
-    "offset": 109055,
+    "offset": 109097,
     "length": 488
   },
   {
     "name": "flash/ui/ContextMenu",
     "defs": [
       "flash.ui:ContextMenu"
     ],
-    "offset": 109543,
+    "offset": 109585,
     "length": 636
   },
   {
     "name": "flash/ui/ContextMenuBuiltInItems",
     "defs": [
       "flash.ui:ContextMenuBuiltInItems"
     ],
-    "offset": 110179,
+    "offset": 110221,
     "length": 467
   },
   {
     "name": "flash/ui/ContextMenuClipboardItems",
     "defs": [
       "flash.ui:ContextMenuClipboardItems"
     ],
-    "offset": 110646,
+    "offset": 110688,
     "length": 380
   },
   {
     "name": "flash/ui/ContextMenuItem",
     "defs": [
       "flash.ui:ContextMenuItem"
     ],
-    "offset": 111026,
+    "offset": 111068,
     "length": 458
   },
   {
     "name": "flash/ui/GameInput",
     "defs": [
       "flash.ui:GameInput"
     ],
-    "offset": 111484,
+    "offset": 111526,
     "length": 333
   },
   {
     "name": "flash/ui/GameInputControl",
     "defs": [
       "flash.ui:GameInputControl"
     ],
-    "offset": 111817,
+    "offset": 111859,
     "length": 458
   },
   {
     "name": "flash/ui/GameInputControlType",
     "defs": [
       "flash.ui:GameInputControlType"
     ],
-    "offset": 112275,
+    "offset": 112317,
     "length": 389
   },
   {
     "name": "flash/ui/GameInputDevice",
     "defs": [
       "flash.ui:GameInputDevice"
     ],
-    "offset": 112664,
+    "offset": 112706,
     "length": 623
   },
   {
     "name": "flash/ui/GameInputFinger",
     "defs": [
       "flash.ui:GameInputFinger"
     ],
-    "offset": 113287,
+    "offset": 113329,
     "length": 291
   },
   {
     "name": "flash/ui/GameInputHand",
     "defs": [
       "flash.ui:GameInputHand"
     ],
-    "offset": 113578,
+    "offset": 113620,
     "length": 256
   },
   {
     "name": "flash/ui/Keyboard",
     "defs": [
       "flash.ui:Keyboard"
     ],
-    "offset": 113834,
+    "offset": 113876,
     "length": 9336
   },
   {
     "name": "flash/ui/KeyboardType",
     "defs": [
       "flash.ui:KeyboardType"
     ],
-    "offset": 123170,
+    "offset": 123212,
     "length": 266
   },
   {
     "name": "flash/ui/KeyLocation",
     "defs": [
       "flash.ui:KeyLocation"
     ],
-    "offset": 123436,
+    "offset": 123478,
     "length": 273
   },
   {
     "name": "flash/ui/Mouse",
     "defs": [
       "flash.ui:Mouse"
     ],
-    "offset": 123709,
+    "offset": 123751,
     "length": 383
   },
   {
     "name": "flash/ui/MouseCursor",
     "defs": [
       "flash.ui:MouseCursor"
     ],
-    "offset": 124092,
+    "offset": 124134,
     "length": 302
   },
   {
     "name": "flash/ui/MouseCursorData",
     "defs": [
       "flash.ui:MouseCursorData"
     ],
-    "offset": 124394,
+    "offset": 124436,
     "length": 352
   },
   {
     "name": "flash/ui/Multitouch",
     "defs": [
       "flash.ui:Multitouch"
     ],
-    "offset": 124746,
+    "offset": 124788,
     "length": 435
   },
   {
     "name": "flash/ui/MultitouchInputMode",
     "defs": [
       "flash.ui:MultitouchInputMode"
     ],
-    "offset": 125181,
+    "offset": 125223,
     "length": 279
   },
   {
     "name": "flash/sensors/Accelerometer",
     "defs": [
       "flash.sensors:Accelerometer"
     ],
-    "offset": 125460,
+    "offset": 125502,
     "length": 357
   },
   {
     "name": "flash/sensors/Geolocation",
     "defs": [
       "flash.sensors:Geolocation"
     ],
-    "offset": 125817,
+    "offset": 125859,
     "length": 351
   },
   {
     "name": "flash/display3D/Context3D",
     "defs": [
       "flash.display3D:Context3D"
     ],
-    "offset": 126168,
+    "offset": 126210,
     "length": 2088
   },
   {
     "name": "flash/display3D/Context3DBlendFactor",
     "defs": [
       "flash.display3D:Context3DBlendFactor"
     ],
-    "offset": 128256,
+    "offset": 128298,
     "length": 681
   },
   {
     "name": "flash/display3D/Context3DClearMask",
     "defs": [
       "flash.display3D:Context3DClearMask"
     ],
-    "offset": 128937,
+    "offset": 128979,
     "length": 292
   },
   {
     "name": "flash/display3D/Context3DProfile",
     "defs": [
       "flash.display3D:Context3DProfile"
     ],
-    "offset": 129229,
+    "offset": 129271,
     "length": 282
   },
   {
     "name": "flash/display3D/Context3DProgramType",
     "defs": [
       "flash.display3D:Context3DProgramType"
     ],
-    "offset": 129511,
+    "offset": 129553,
     "length": 263
   },
   {
     "name": "flash/display3D/Context3DRenderMode",
     "defs": [
       "flash.display3D:Context3DRenderMode"
     ],
-    "offset": 129774,
+    "offset": 129816,
     "length": 257
   },
   {
     "name": "flash/display3D/Context3DCompareMode",
     "defs": [
       "flash.display3D:Context3DCompareMode"
     ],
-    "offset": 130031,
+    "offset": 130073,
     "length": 452
   },
   {
     "name": "flash/display3D/Context3DStencilAction",
     "defs": [
       "flash.display3D:Context3DStencilAction"
     ],
-    "offset": 130483,
+    "offset": 130525,
     "length": 499
   },
   {
     "name": "flash/display3D/Context3DTextureFormat",
     "defs": [
       "flash.display3D:Context3DTextureFormat"
     ],
-    "offset": 130982,
+    "offset": 131024,
     "length": 315
   },
   {
     "name": "flash/display3D/Context3DTriangleFace",
     "defs": [
       "flash.display3D:Context3DTriangleFace"
     ],
-    "offset": 131297,
+    "offset": 131339,
     "length": 323
   },
   {
     "name": "flash/display3D/Context3DVertexBufferFormat",
     "defs": [
       "flash.display3D:Context3DVertexBufferFormat"
     ],
-    "offset": 131620,
+    "offset": 131662,
     "length": 365
   },
   {
     "name": "flash/display3D/IndexBuffer3D",
     "defs": [
       "flash.display3D:IndexBuffer3D"
     ],
-    "offset": 131985,
+    "offset": 132027,
     "length": 364
   },
   {
     "name": "flash/display3D/Program3D",
     "defs": [
       "flash.display3D:Program3D"
     ],
-    "offset": 132349,
+    "offset": 132391,
     "length": 275
   },
   {
     "name": "flash/display3D/VertexBuffer3D",
     "defs": [
       "flash.display3D:VertexBuffer3D"
     ],
-    "offset": 132624,
+    "offset": 132666,
     "length": 367
   },
   {
     "name": "flash/display3D/textures/CubeTexture",
     "defs": [
       "flash.display3D.textures:CubeTexture"
     ],
-    "offset": 132991,
+    "offset": 133033,
     "length": 501
   },
   {
     "name": "flash/display3D/textures/Texture",
     "defs": [
       "flash.display3D.textures:Texture"
     ],
-    "offset": 133492,
+    "offset": 133534,
     "length": 487
   },
   {
     "name": "flash/display3D/textures/TextureBase",
     "defs": [
       "flash.display3D.textures:TextureBase"
     ],
-    "offset": 133979,
+    "offset": 134021,
     "length": 292
   },
   {
     "name": "flash/net/DynamicPropertyOutput",
     "defs": [
       "flash.net:DynamicPropertyOutput"
     ],
-    "offset": 134271,
+    "offset": 134313,
     "length": 308
   },
   {
     "name": "flash/net/FileFilter",
     "defs": [
       "flash.net:FileFilter"
     ],
-    "offset": 134579,
+    "offset": 134621,
     "length": 318
   },
   {
     "name": "flash/net/FileReference",
     "defs": [
       "flash.net:FileReference"
     ],
-    "offset": 134897,
+    "offset": 134939,
     "length": 666
   },
   {
     "name": "flash/net/FileReferenceList",
     "defs": [
       "flash.net:FileReferenceList"
     ],
-    "offset": 135563,
+    "offset": 135605,
     "length": 315
   },
   {
     "name": "flash/net/GroupSpecifier",
     "defs": [
       "flash.net:GroupSpecifier"
     ],
-    "offset": 135878,
+    "offset": 135920,
     "length": 1492
   },
   {
     "name": "flash/net/IDynamicPropertyOutput",
     "defs": [
       "flash.net:IDynamicPropertyOutput"
     ],
-    "offset": 137370,
+    "offset": 137412,
     "length": 197
   },
   {
     "name": "flash/net/IDynamicPropertyWriter",
     "defs": [
       "flash.net:IDynamicPropertyWriter"
     ],
-    "offset": 137567,
+    "offset": 137609,
     "length": 225
   },
   {
     "name": "flash/net/LocalConnection",
     "defs": [
       "flash.net:LocalConnection"
     ],
-    "offset": 137792,
+    "offset": 137834,
     "length": 495
   },
   {
     "name": "flash/net/NetConnection",
     "defs": [
       "flash.net:NetConnection"
     ],
-    "offset": 138287,
+    "offset": 138329,
     "length": 906
   },
   {
     "name": "flash/net/NetGroup",
     "defs": [
       "flash.net:NetGroup"
     ],
-    "offset": 139193,
+    "offset": 139235,
     "length": 1299
   },
   {
     "name": "flash/net/NetGroupInfo",
     "defs": [
       "flash.net:NetGroupInfo"
     ],
-    "offset": 140492,
+    "offset": 140534,
     "length": 768
   },
   {
     "name": "flash/net/NetGroupReceiveMode",
     "defs": [
       "flash.net:NetGroupReceiveMode"
     ],
-    "offset": 141260,
+    "offset": 141302,
     "length": 245
   },
   {
     "name": "flash/net/NetGroupReplicationStrategy",
     "defs": [
       "flash.net:NetGroupReplicationStrategy"
     ],
-    "offset": 141505,
+    "offset": 141547,
     "length": 283
   },
   {
     "name": "flash/net/NetGroupSendMode",
     "defs": [
       "flash.net:NetGroupSendMode"
     ],
-    "offset": 141788,
+    "offset": 141830,
     "length": 273
   },
   {
     "name": "flash/net/NetGroupSendResult",
     "defs": [
       "flash.net:NetGroupSendResult"
     ],
-    "offset": 142061,
+    "offset": 142103,
     "length": 270
   },
   {
     "name": "flash/net/NetMonitor",
     "defs": [
       "flash.net:NetMonitor"
     ],
-    "offset": 142331,
+    "offset": 142373,
     "length": 279
   },
   {
     "name": "flash/net/NetStream",
     "defs": [
       "flash.net:NetStream"
     ],
-    "offset": 142610,
+    "offset": 142652,
     "length": 3025
   },
   {
     "name": "flash/net/NetStreamAppendBytesAction",
     "defs": [
       "flash.net:NetStreamAppendBytesAction"
     ],
-    "offset": 145635,
+    "offset": 145677,
     "length": 315
   },
   {
     "name": "flash/net/NetStreamMulticastInfo",
     "defs": [
       "flash.net:NetStreamMulticastInfo"
     ],
-    "offset": 145950,
+    "offset": 145992,
     "length": 2712
   },
   {
     "name": "flash/net/NetStreamInfo",
     "defs": [
       "flash.net:NetStreamInfo"
     ],
-    "offset": 148662,
+    "offset": 148704,
     "length": 1958
   },
   {
     "name": "flash/net/NetStreamPlayOptions",
     "defs": [
       "flash.net:NetStreamPlayOptions"
     ],
-    "offset": 150620,
+    "offset": 150662,
     "length": 355
   },
   {
     "name": "flash/net/NetStreamPlayTransitions",
     "defs": [
       "flash.net:NetStreamPlayTransitions"
     ],
-    "offset": 150975,
+    "offset": 151017,
     "length": 406
   },
   {
     "name": "flash/net/ObjectEncoding",
     "defs": [
       "flash.net:ObjectEncoding"
     ],
-    "offset": 151381,
+    "offset": 151423,
     "length": 345
   },
   {
     "name": "flash/net/Responder",
     "defs": [
       "flash.net:Responder"
     ],
-    "offset": 151726,
+    "offset": 151768,
     "length": 239
   },
   {
     "name": "flash/net/SecureSocket",
     "defs": [
       "flash.net:SecureSocket"
     ],
-    "offset": 151965,
+    "offset": 152007,
     "length": 566
   },
   {
     "name": "flash/net/SharedObject",
     "defs": [
       "flash.net:SharedObject"
     ],
-    "offset": 152531,
+    "offset": 152573,
     "length": 1108
   },
   {
     "name": "flash/net/SharedObjectFlushStatus",
     "defs": [
       "flash.net:SharedObjectFlushStatus"
     ],
-    "offset": 153639,
+    "offset": 153681,
     "length": 257
   },
   {
     "name": "flash/net/URLLoader",
     "defs": [
       "flash.net:URLLoader"
     ],
-    "offset": 153896,
+    "offset": 153938,
     "length": 435
   },
   {
     "name": "flash/net/Socket",
     "defs": [
       "flash.net:Socket"
     ],
-    "offset": 154331,
+    "offset": 154373,
     "length": 1282
   },
   {
     "name": "flash/net/URLLoaderDataFormat",
     "defs": [
       "flash.net:URLLoaderDataFormat"
     ],
-    "offset": 155613,
+    "offset": 155655,
     "length": 276
   },
   {
     "name": "flash/net/URLRequest",
     "defs": [
       "flash.net:URLRequest"
     ],
-    "offset": 155889,
+    "offset": 155931,
     "length": 379
   },
   {
     "name": "flash/net/URLRequestHeader",
     "defs": [
       "flash.net:URLRequestHeader"
     ],
-    "offset": 156268,
+    "offset": 156310,
     "length": 223
   },
   {
     "name": "flash/net/URLStream",
     "defs": [
       "flash.net:URLStream"
     ],
-    "offset": 156491,
+    "offset": 156533,
     "length": 908
   },
   {
     "name": "flash/net/URLRequestMethod",
     "defs": [
       "flash.net:URLRequestMethod"
     ],
-    "offset": 157399,
+    "offset": 157441,
     "length": 304
   },
   {
     "name": "flash/net/URLVariables",
     "defs": [
       "flash.net:URLVariables"
     ],
-    "offset": 157703,
+    "offset": 157745,
     "length": 245
   },
   {
     "name": "flash/net/XMLSocket",
     "defs": [
       "flash.net:XMLSocket"
     ],
-    "offset": 157948,
+    "offset": 157990,
     "length": 480
   },
   {
     "name": "flash/text/AntiAliasType",
     "defs": [
       "flash.text:AntiAliasType"
     ],
-    "offset": 158428,
+    "offset": 158470,
     "length": 239
   },
   {
     "name": "flash/text/CSMSettings",
     "defs": [
       "flash.text:CSMSettings"
     ],
-    "offset": 158667,
+    "offset": 158709,
     "length": 248
   },
   {
     "name": "flash/text/Font",
     "defs": [
       "flash.text:Font"
     ],
-    "offset": 158915,
+    "offset": 158957,
     "length": 361
   },
   {
     "name": "flash/text/FontStyle",
     "defs": [
       "flash.text:FontStyle"
     ],
-    "offset": 159276,
+    "offset": 159318,
     "length": 292
   },
   {
     "name": "flash/text/FontType",
     "defs": [
       "flash.text:FontType"
     ],
-    "offset": 159568,
+    "offset": 159610,
     "length": 269
   },
   {
     "name": "flash/text/GridFitType",
     "defs": [
       "flash.text:GridFitType"
     ],
-    "offset": 159837,
+    "offset": 159879,
     "length": 258
   },
   {
     "name": "flash/text/StaticText",
     "defs": [
       "flash.text:StaticText"
     ],
-    "offset": 160095,
+    "offset": 160137,
     "length": 299
   },
   {
     "name": "flash/text/StyleSheet",
     "defs": [
       "flash.text:StyleSheet"
     ],
-    "offset": 160394,
+    "offset": 160436,
     "length": 386
   },
   {
     "name": "flash/text/TextColorType",
     "defs": [
       "flash.text:TextColorType"
     ],
-    "offset": 160780,
+    "offset": 160822,
     "length": 241
   },
   {
     "name": "flash/text/TextDisplayMode",
     "defs": [
       "flash.text:TextDisplayMode"
     ],
-    "offset": 161021,
+    "offset": 161063,
     "length": 258
   },
   {
     "name": "flash/text/TextField",
     "defs": [
       "flash.text:TextField"
     ],
-    "offset": 161279,
+    "offset": 161321,
     "length": 2296
   },
   {
     "name": "flash/text/TextFieldAutoSize",
     "defs": [
       "flash.text:TextFieldAutoSize"
     ],
-    "offset": 163575,
+    "offset": 163617,
     "length": 291
   },
   {
     "name": "flash/text/TextFieldType",
     "defs": [
       "flash.text:TextFieldType"
     ],
-    "offset": 163866,
+    "offset": 163908,
     "length": 235
   },
   {
     "name": "flash/text/TextFormat",
     "defs": [
       "flash.text:TextFormat"
     ],
-    "offset": 164101,
+    "offset": 164143,
     "length": 778
   },
   {
     "name": "flash/text/TextFormatAlign",
     "defs": [
       "flash.text:TextFormatAlign"
     ],
-    "offset": 164879,
+    "offset": 164921,
     "length": 343
   },
   {
     "name": "flash/text/TextFormatDisplay",
     "defs": [
       "flash.text:TextFormatDisplay"
     ],
-    "offset": 165222,
+    "offset": 165264,
     "length": 241
   },
   {
     "name": "flash/text/TextInteractionMode",
     "defs": [
       "flash.text:TextInteractionMode"
     ],
-    "offset": 165463,
+    "offset": 165505,
     "length": 253
   },
   {
     "name": "flash/text/TextLineMetrics",
     "defs": [
       "flash.text:TextLineMetrics"
     ],
-    "offset": 165716,
+    "offset": 165758,
     "length": 300
   },
   {
     "name": "flash/text/TextRenderer",
     "defs": [
       "flash.text:TextRenderer"
     ],
-    "offset": 166016,
+    "offset": 166058,
     "length": 373
   },
   {
     "name": "flash/text/TextRun",
     "defs": [
       "flash.text:TextRun"
     ],
-    "offset": 166389,
+    "offset": 166431,
     "length": 294
   },
   {
     "name": "flash/text/TextSnapshot",
     "defs": [
       "flash.text:TextSnapshot"
     ],
-    "offset": 166683,
+    "offset": 166725,
     "length": 513
   },
   {
     "name": "flash/text/engine/BreakOpportunity",
     "defs": [
       "flash.text.engine:BreakOpportunity"
     ],
-    "offset": 167196,
+    "offset": 167238,
     "length": 293
   },
   {
     "name": "flash/text/engine/CFFHinting",
     "defs": [
       "flash.text.engine:CFFHinting"
     ],
-    "offset": 167489,
+    "offset": 167531,
     "length": 256
   },
   {
     "name": "flash/text/engine/ContentElement",
     "defs": [
       "flash.text.engine:ContentElement"
     ],
-    "offset": 167745,
+    "offset": 167787,
     "length": 624
   },
   {
     "name": "flash/text/engine/DigitCase",
     "defs": [
       "flash.text.engine:DigitCase"
     ],
-    "offset": 168369,
+    "offset": 168411,
     "length": 277
   },
   {
     "name": "flash/text/engine/DigitWidth",
     "defs": [
       "flash.text.engine:DigitWidth"
     ],
-    "offset": 168646,
+    "offset": 168688,
     "length": 288
   },
   {
     "name": "flash/text/engine/EastAsianJustifier",
     "defs": [
       "flash.text.engine:EastAsianJustifier"
     ],
-    "offset": 168934,
+    "offset": 168976,
     "length": 495
   },
   {
     "name": "flash/text/engine/ElementFormat",
     "defs": [
       "flash.text.engine:ElementFormat"
     ],
-    "offset": 169429,
+    "offset": 169471,
     "length": 1204
   },
   {
     "name": "flash/text/engine/FontDescription",
     "defs": [
       "flash.text.engine:FontDescription"
     ],
-    "offset": 170633,
+    "offset": 170675,
     "length": 672
   },
   {
     "name": "flash/text/engine/FontLookup",
     "defs": [
       "flash.text.engine:FontLookup"
     ],
-    "offset": 171305,
+    "offset": 171347,
     "length": 254
   },
   {
     "name": "flash/text/engine/FontMetrics",
     "defs": [
       "flash.text.engine:FontMetrics"
     ],
-    "offset": 171559,
+    "offset": 171601,
     "length": 512
   },
   {
     "name": "flash/text/engine/FontPosture",
     "defs": [
       "flash.text.engine:FontPosture"
     ],
-    "offset": 172071,
+    "offset": 172113,
     "length": 245
   },
   {
     "name": "flash/text/engine/FontWeight",
     "defs": [
       "flash.text.engine:FontWeight"
     ],
-    "offset": 172316,
+    "offset": 172358,
     "length": 239
   },
   {
     "name": "flash/text/engine/GraphicElement",
     "defs": [
       "flash.text.engine:GraphicElement"
     ],
-    "offset": 172555,
+    "offset": 172597,
     "length": 497
   },
   {
     "name": "flash/text/engine/GroupElement",
     "defs": [
       "flash.text.engine:GroupElement"
     ],
-    "offset": 173052,
+    "offset": 173094,
     "length": 714
   },
   {
     "name": "flash/text/engine/JustificationStyle",
     "defs": [
       "flash.text.engine:JustificationStyle"
     ],
-    "offset": 173766,
+    "offset": 173808,
     "length": 356
   },
   {
     "name": "flash/text/engine/Kerning",
     "defs": [
       "flash.text.engine:Kerning"
     ],
-    "offset": 174122,
+    "offset": 174164,
     "length": 248
   },
   {
     "name": "flash/text/engine/LigatureLevel",
     "defs": [
       "flash.text.engine:LigatureLevel"
     ],
-    "offset": 174370,
+    "offset": 174412,
     "length": 338
   },
   {
     "name": "flash/text/engine/LineJustification",
     "defs": [
       "flash.text.engine:LineJustification"
     ],
-    "offset": 174708,
+    "offset": 174750,
     "length": 388
   },
   {
     "name": "flash/text/engine/RenderingMode",
     "defs": [
       "flash.text.engine:RenderingMode"
     ],
-    "offset": 175096,
+    "offset": 175138,
     "length": 243
   },
   {
     "name": "flash/text/engine/SpaceJustifier",
     "defs": [
       "flash.text.engine:SpaceJustifier"
     ],
-    "offset": 175339,
+    "offset": 175381,
     "length": 527
   },
   {
     "name": "flash/text/engine/TabAlignment",
     "defs": [
       "flash.text.engine:TabAlignment"
     ],
-    "offset": 175866,
+    "offset": 175908,
     "length": 299
   },
   {
     "name": "flash/text/engine/TabStop",
     "defs": [
       "flash.text.engine:TabStop"
     ],
-    "offset": 176165,
+    "offset": 176207,
     "length": 357
   },
   {
     "name": "flash/text/engine/TextBaseline",
     "defs": [
       "flash.text.engine:TextBaseline"
     ],
-    "offset": 176522,
+    "offset": 176564,
     "length": 483
   },
   {
     "name": "flash/text/engine/TextBlock",
     "defs": [
       "flash.text.engine:TextBlock"
     ],
-    "offset": 177005,
+    "offset": 177047,
     "length": 2184
   },
   {
     "name": "flash/text/engine/TextElement",
     "defs": [
       "flash.text.engine:TextElement"
     ],
-    "offset": 179189,
+    "offset": 179231,
     "length": 383
   },
   {
     "name": "flash/text/engine/TextJustifier",
     "defs": [
       "flash.text.engine:TextJustifier"
     ],
-    "offset": 179572,
+    "offset": 179614,
     "length": 774
   },
   {
     "name": "flash/text/engine/TextLine",
     "defs": [
       "flash.text.engine:TextLine"
     ],
-    "offset": 180346,
+    "offset": 180388,
     "length": 2027
   },
   {
     "name": "flash/text/engine/TextLineCreationResult",
     "defs": [
       "flash.text.engine:TextLineCreationResult"
     ],
-    "offset": 182373,
+    "offset": 182415,
     "length": 360
   },
   {
     "name": "flash/text/engine/TextLineMirrorRegion",
     "defs": [
       "flash.text.engine:TextLineMirrorRegion"
     ],
-    "offset": 182733,
+    "offset": 182775,
     "length": 451
   },
   {
     "name": "flash/text/engine/TextLineValidity",
     "defs": [
       "flash.text.engine:TextLineValidity"
     ],
-    "offset": 183184,
+    "offset": 183226,
     "length": 332
   },
   {
     "name": "flash/text/engine/TextRotation",
     "defs": [
       "flash.text.engine:TextRotation"
     ],
-    "offset": 183516,
+    "offset": 183558,
     "length": 352
   },
   {
     "name": "flash/text/engine/TypographicCase",
     "defs": [
       "flash.text.engine:TypographicCase"
     ],
-    "offset": 183868,
+    "offset": 183910,
     "length": 436
   },
   {
     "name": "flash/text/ime/CompositionAttributeRange",
     "defs": [
       "flash.text.ime:CompositionAttributeRange"
     ],
-    "offset": 184304,
+    "offset": 184346,
     "length": 315
   },
   {
     "name": "flash/text/ime/IIMEClient",
     "defs": [
       "flash.text.ime:IIMEClient"
     ],
-    "offset": 184619,
+    "offset": 184661,
     "length": 525
   },
   {
     "name": "flash/net/FlashNetScript",
     "defs": [
       "flash.net:navigateToURL",
       "flash.net:sendToURL",
       "flash.net:registerClassAlias",
       "flash.net:getClassByAlias"
     ],
-    "offset": 185144,
+    "offset": 185186,
     "length": 343
   },
   {
     "name": "flash/utils/FlashUtilScript",
     "defs": [
       "flash.utils:describeType",
       "flash.utils:getAliasName",
       "flash.utils:getQualifiedClassName",
       "flash.utils:getDefinitionByName",
       "flash.utils:getQualifiedSuperclassName",
       "flash.utils:getTimer",
       "flash.utils:escapeMultiByte",
       "flash.utils:unescapeMultiByte"
     ],
-    "offset": 185487,
+    "offset": 185529,
     "length": 545
   },
   {
     "name": "flash/utils/Endian",
     "defs": [
       "flash.utils:Endian"
     ],
-    "offset": 186032,
+    "offset": 186074,
     "length": 243
   },
   {
     "name": "flash/utils/IExternalizable",
     "defs": [
       "flash.utils:IExternalizable"
     ],
-    "offset": 186275,
+    "offset": 186317,
     "length": 223
   },
   {
     "name": "flash/utils/Timer",
     "defs": [
       "flash.utils:Timer"
     ],
-    "offset": 186498,
+    "offset": 186540,
     "length": 400
   },
   {
     "name": "flash/utils/SetIntervalTimer",
     "defs": [
       "flash.utils:SetIntervalTimer",
       "flash.utils:setInterval",
       "flash.utils:setTimeout",
       "flash.utils:clearInterval",
       "flash.utils:clearTimeout"
     ],
-    "offset": 186898,
+    "offset": 186940,
     "length": 995
   }
 ]
\ No newline at end of file
--- a/browser/extensions/shumway/content/shumway.gfx.js
+++ b/browser/extensions/shumway/content/shumway.gfx.js
@@ -10,3936 +10,4298 @@
 
  Unless required by applicable law or agreed to in writing, software
  distributed under the License is distributed on an "AS IS" BASIS,
  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
  See the License for the specific language governing permissions and
  limitations under the License.
 */
 console.time("Load Shared Dependencies");
+var Shumway, Shumway$$inline_0 = Shumway || (Shumway = {});
+Shumway$$inline_0.version = "0.9.3775";
+Shumway$$inline_0.build = "a82ac47";
 var jsGlobal = function() {
   return this || (0,eval)("this//# sourceURL=jsGlobal-getter");
 }(), inBrowser = "undefined" !== typeof window && "document" in window && "plugins" in window.document, inFirefox = "undefined" !== typeof navigator && 0 <= navigator.userAgent.indexOf("Firefox");
-function dumpLine(g) {
-  "undefined" !== typeof dump && dump(g + "\n");
+function dumpLine(l) {
 }
 jsGlobal.performance || (jsGlobal.performance = {});
 jsGlobal.performance.now || (jsGlobal.performance.now = "undefined" !== typeof dateNow ? dateNow : Date.now);
-var START_TIME = performance.now(), Shumway;
-(function(g) {
-  function m(a) {
-    return(a | 0) === a;
-  }
-  function e(a) {
-    return "object" === typeof a || "function" === typeof a;
+function lazyInitializer(l, r, g) {
+  Object.defineProperty(l, r, {get:function() {
+    var c = g();
+    Object.defineProperty(l, r, {value:c, configurable:!0, enumerable:!0});
+    return c;
+  }, configurable:!0, enumerable:!0});
+}
+var START_TIME = performance.now();
+(function(l) {
+  function r(d) {
+    return(d | 0) === d;
   }
-  function c(a) {
-    return String(Number(a)) === a;
+  function g(d) {
+    return "object" === typeof d || "function" === typeof d;
+  }
+  function c(d) {
+    return String(Number(d)) === d;
   }
-  function w(a) {
-    var h = 0;
-    if ("number" === typeof a) {
-      return h = a | 0, a === h && 0 <= h ? !0 : a >>> 0 === a;
+  function t(d) {
+    var e = 0;
+    if ("number" === typeof d) {
+      return e = d | 0, d === e && 0 <= e ? !0 : d >>> 0 === d;
     }
-    if ("string" !== typeof a) {
+    if ("string" !== typeof d) {
       return!1;
     }
-    var f = a.length;
-    if (0 === f) {
+    var b = d.length;
+    if (0 === b) {
       return!1;
     }
-    if ("0" === a) {
+    if ("0" === d) {
       return!0;
     }
-    if (f > g.UINT32_CHAR_BUFFER_LENGTH) {
+    if (b > l.UINT32_CHAR_BUFFER_LENGTH) {
       return!1;
     }
-    var d = 0, h = a.charCodeAt(d++) - 48;
-    if (1 > h || 9 < h) {
+    var f = 0, e = d.charCodeAt(f++) - 48;
+    if (1 > e || 9 < e) {
       return!1;
     }
-    for (var q = 0, x = 0;d < f;) {
-      x = a.charCodeAt(d++) - 48;
-      if (0 > x || 9 < x) {
+    for (var q = 0, w = 0;f < b;) {
+      w = d.charCodeAt(f++) - 48;
+      if (0 > w || 9 < w) {
         return!1;
       }
-      q = h;
-      h = 10 * h + x;
+      q = e;
+      e = 10 * e + w;
     }
-    return q < g.UINT32_MAX_DIV_10 || q === g.UINT32_MAX_DIV_10 && x <= g.UINT32_MAX_MOD_10 ? !0 : !1;
+    return q < l.UINT32_MAX_DIV_10 || q === l.UINT32_MAX_DIV_10 && w <= l.UINT32_MAX_MOD_10 ? !0 : !1;
   }
-  (function(a) {
-    a[a._0 = 48] = "_0";
-    a[a._1 = 49] = "_1";
-    a[a._2 = 50] = "_2";
-    a[a._3 = 51] = "_3";
-    a[a._4 = 52] = "_4";
-    a[a._5 = 53] = "_5";
-    a[a._6 = 54] = "_6";
-    a[a._7 = 55] = "_7";
-    a[a._8 = 56] = "_8";
-    a[a._9 = 57] = "_9";
-  })(g.CharacterCodes || (g.CharacterCodes = {}));
-  g.UINT32_CHAR_BUFFER_LENGTH = 10;
-  g.UINT32_MAX = 4294967295;
-  g.UINT32_MAX_DIV_10 = 429496729;
-  g.UINT32_MAX_MOD_10 = 5;
-  g.isString = function(a) {
-    return "string" === typeof a;
+  (function(d) {
+    d[d._0 = 48] = "_0";
+    d[d._1 = 49] = "_1";
+    d[d._2 = 50] = "_2";
+    d[d._3 = 51] = "_3";
+    d[d._4 = 52] = "_4";
+    d[d._5 = 53] = "_5";
+    d[d._6 = 54] = "_6";
+    d[d._7 = 55] = "_7";
+    d[d._8 = 56] = "_8";
+    d[d._9 = 57] = "_9";
+  })(l.CharacterCodes || (l.CharacterCodes = {}));
+  l.UINT32_CHAR_BUFFER_LENGTH = 10;
+  l.UINT32_MAX = 4294967295;
+  l.UINT32_MAX_DIV_10 = 429496729;
+  l.UINT32_MAX_MOD_10 = 5;
+  l.isString = function(d) {
+    return "string" === typeof d;
   };
-  g.isFunction = function(a) {
-    return "function" === typeof a;
+  l.isFunction = function(d) {
+    return "function" === typeof d;
   };
-  g.isNumber = function(a) {
-    return "number" === typeof a;
+  l.isNumber = function(d) {
+    return "number" === typeof d;
   };
-  g.isInteger = m;
-  g.isArray = function(a) {
-    return a instanceof Array;
+  l.isInteger = r;
+  l.isArray = function(d) {
+    return d instanceof Array;
   };
-  g.isNumberOrString = function(a) {
-    return "number" === typeof a || "string" === typeof a;
+  l.isNumberOrString = function(d) {
+    return "number" === typeof d || "string" === typeof d;
   };
-  g.isObject = e;
-  g.toNumber = function(a) {
-    return+a;
+  l.isObject = g;
+  l.toNumber = function(d) {
+    return+d;
   };
-  g.isNumericString = c;
-  g.isNumeric = function(a) {
-    if ("number" === typeof a) {
+  l.isNumericString = c;
+  l.isNumeric = function(d) {
+    if ("number" === typeof d) {
       return!0;
     }
-    if ("string" === typeof a) {
-      var h = a.charCodeAt(0);
-      return 65 <= h && 90 >= h || 97 <= h && 122 >= h || 36 === h || 95 === h ? !1 : w(a) || c(a);
+    if ("string" === typeof d) {
+      var e = d.charCodeAt(0);
+      return 65 <= e && 90 >= e || 97 <= e && 122 >= e || 36 === e || 95 === e ? !1 : t(d) || c(d);
     }
     return!1;
   };
-  g.isIndex = w;
-  g.isNullOrUndefined = function(a) {
-    return void 0 == a;
+  l.isIndex = t;
+  l.isNullOrUndefined = function(d) {
+    return void 0 == d;
   };
-  var k;
-  (function(a) {
-    a.error = function(f) {
-      console.error(f);
-      throw Error(f);
-    };
-    a.assert = function(f, d) {
-      void 0 === d && (d = "assertion failed");
-      "" === f && (f = !0);
-      if (!f) {
+  var m;
+  (function(d) {
+    d.error = function(b) {
+      console.error(b);
+      throw Error(b);
+    };
+    d.assert = function(b, f) {
+      void 0 === f && (f = "assertion failed");
+      "" === b && (b = !0);
+      if (!b) {
         if ("undefined" !== typeof console && "assert" in console) {
-          throw console.assert(!1, d), Error(d);
-        }
-        a.error(d.toString());
-      }
-    };
-    a.assertUnreachable = function(f) {
-      throw Error("Reached unreachable location " + Error().stack.split("\n")[1] + f);
-    };
-    a.assertNotImplemented = function(f, d) {
-      f || a.error("notImplemented: " + d);
-    };
-    a.warning = function(f, d, q) {
-      console.warn.apply(console, arguments);
-    };
-    a.notUsed = function(f) {
-      a.assert(!1, "Not Used " + f);
-    };
-    a.notImplemented = function(f) {
-      a.assert(!1, "Not Implemented " + f);
-    };
-    a.dummyConstructor = function(f) {
-      a.assert(!1, "Dummy Constructor: " + f);
-    };
-    a.abstractMethod = function(f) {
-      a.assert(!1, "Abstract Method " + f);
-    };
-    var h = {};
-    a.somewhatImplemented = function(f) {
-      h[f] || (h[f] = !0, a.warning("somewhatImplemented: " + f));
-    };
-    a.unexpected = function(f) {
-      a.assert(!1, "Unexpected: " + f);
-    };
-    a.unexpectedCase = function(f) {
-      a.assert(!1, "Unexpected Case: " + f);
-    };
-  })(k = g.Debug || (g.Debug = {}));
-  g.getTicks = function() {
+          throw console.assert(!1, f), Error(f);
+        }
+        d.error(f.toString());
+      }
+    };
+    d.assertUnreachable = function(b) {
+      throw Error("Reached unreachable location " + Error().stack.split("\n")[1] + b);
+    };
+    d.assertNotImplemented = function(b, f) {
+      b || d.error("notImplemented: " + f);
+    };
+    d.warning = function(b, f, q) {
+    };
+    d.notUsed = function(b) {
+    };
+    d.notImplemented = function(b) {
+    };
+    d.dummyConstructor = function(b) {
+    };
+    d.abstractMethod = function(b) {
+    };
+    var e = {};
+    d.somewhatImplemented = function(b) {
+      e[b] || (e[b] = !0);
+    };
+    d.unexpected = function(b) {
+      d.assert(!1, "Unexpected: " + b);
+    };
+    d.unexpectedCase = function(b) {
+      d.assert(!1, "Unexpected Case: " + b);
+    };
+  })(m = l.Debug || (l.Debug = {}));
+  l.getTicks = function() {
     return performance.now();
   };
-  var b;
-  (function(a) {
-    function h(d, f) {
-      for (var a = 0, h = d.length;a < h;a++) {
-        if (d[a] === f) {
-          return a;
-        }
-      }
-      d.push(f);
-      return d.length - 1;
+  (function(d) {
+    function e(f, q) {
+      for (var b = 0, e = f.length;b < e;b++) {
+        if (f[b] === q) {
+          return b;
+        }
+      }
+      f.push(q);
+      return f.length - 1;
     }
-    var f = g.Debug.assert;
-    a.popManyInto = function(d, a, h) {
-      f(d.length >= a);
-      for (var b = a - 1;0 <= b;b--) {
-        h[b] = d.pop();
-      }
-      h.length = a;
-    };
-    a.popMany = function(d, a) {
-      f(d.length >= a);
-      var h = d.length - a, b = d.slice(h, this.length);
-      d.length = h;
-      return b;
-    };
-    a.popManyIntoVoid = function(d, a) {
-      f(d.length >= a);
-      d.length -= a;
-    };
-    a.pushMany = function(d, f) {
-      for (var a = 0;a < f.length;a++) {
-        d.push(f[a]);
-      }
-    };
-    a.top = function(d) {
-      return d.length && d[d.length - 1];
-    };
-    a.last = function(d) {
-      return d.length && d[d.length - 1];
-    };
-    a.peek = function(d) {
-      f(0 < d.length);
-      return d[d.length - 1];
-    };
-    a.indexOf = function(d, f) {
-      for (var a = 0, h = d.length;a < h;a++) {
-        if (d[a] === f) {
-          return a;
+    d.popManyInto = function(f, q, b) {
+      for (var e = q - 1;0 <= e;e--) {
+        b[e] = f.pop();
+      }
+      b.length = q;
+    };
+    d.popMany = function(f, q) {
+      var b = f.length - q, e = f.slice(b, this.length);
+      f.length = b;
+      return e;
+    };
+    d.popManyIntoVoid = function(f, q) {
+      f.length -= q;
+    };
+    d.pushMany = function(f, q) {
+      for (var b = 0;b < q.length;b++) {
+        f.push(q[b]);
+      }
+    };
+    d.top = function(f) {
+      return f.length && f[f.length - 1];
+    };
+    d.last = function(f) {
+      return f.length && f[f.length - 1];
+    };
+    d.peek = function(f) {
+      return f[f.length - 1];
+    };
+    d.indexOf = function(f, q) {
+      for (var b = 0, e = f.length;b < e;b++) {
+        if (f[b] === q) {
+          return b;
         }
       }
       return-1;
     };
-    a.equals = function(d, f) {
-      if (d.length !== f.length) {
+    d.equals = function(f, q) {
+      if (f.length !== q.length) {
         return!1;
       }
-      for (var a = 0;a < d.length;a++) {
-        if (d[a] !== f[a]) {
+      for (var b = 0;b < f.length;b++) {
+        if (f[b] !== q[b]) {
           return!1;
         }
       }
       return!0;
     };
-    a.pushUnique = h;
-    a.unique = function(d) {
-      for (var f = [], a = 0;a < d.length;a++) {
-        h(f, d[a]);
+    d.pushUnique = e;
+    d.unique = function(f) {
+      for (var q = [], b = 0;b < f.length;b++) {
+        e(q, f[b]);
+      }
+      return q;
+    };
+    d.copyFrom = function(f, b) {
+      f.length = 0;
+      d.pushMany(f, b);
+    };
+    d.ensureTypedArrayCapacity = function(f, b) {
+      if (f.length < b) {
+        var w = f;
+        f = new f.constructor(l.IntegerUtilities.nearestPowerOfTwo(b));
+        f.set(w, 0);
       }
       return f;
     };
-    a.copyFrom = function(d, f) {
-      d.length = 0;
-      a.pushMany(d, f);
-    };
-    a.ensureTypedArrayCapacity = function(d, f) {
-      if (d.length < f) {
-        var a = d;
-        d = new d.constructor(g.IntegerUtilities.nearestPowerOfTwo(f));
-        d.set(a, 0);
-      }
-      return d;
-    };
-    var d = function() {
-      function d(f) {
+    var b = function() {
+      function f(f) {
         void 0 === f && (f = 16);
         this._f32 = this._i32 = this._u16 = this._u8 = null;
         this._offset = 0;
         this.ensureCapacity(f);
       }
-      d.prototype.reset = function() {
+      f.prototype.reset = function() {
         this._offset = 0;
       };
-      Object.defineProperty(d.prototype, "offset", {get:function() {
+      Object.defineProperty(f.prototype, "offset", {get:function() {
         return this._offset;
       }, enumerable:!0, configurable:!0});
-      d.prototype.getIndex = function(d) {
-        f(1 === d || 2 === d || 4 === d || 8 === d || 16 === d);
-        d = this._offset / d;
-        f((d | 0) === d);
-        return d;
-      };
-      d.prototype.ensureAdditionalCapacity = function() {
+      f.prototype.getIndex = function(f) {
+        return this._offset / f;
+      };
+      f.prototype.ensureAdditionalCapacity = function() {
         this.ensureCapacity(this._offset + 68);
       };
-      d.prototype.ensureCapacity = function(d) {
+      f.prototype.ensureCapacity = function(f) {
         if (!this._u8) {
-          this._u8 = new Uint8Array(d);
+          this._u8 = new Uint8Array(f);
         } else {
-          if (this._u8.length > d) {
+          if (this._u8.length > f) {
             return;
           }
         }
-        var f = 2 * this._u8.length;
-        f < d && (f = d);
-        d = new Uint8Array(f);
-        d.set(this._u8, 0);
-        this._u8 = d;
-        this._u16 = new Uint16Array(d.buffer);
-        this._i32 = new Int32Array(d.buffer);
-        this._f32 = new Float32Array(d.buffer);
-      };
-      d.prototype.writeInt = function(d) {
-        f(0 === (this._offset & 3));
+        var b = 2 * this._u8.length;
+        b < f && (b = f);
+        f = new Uint8Array(b);
+        f.set(this._u8, 0);
+        this._u8 = f;
+        this._u16 = new Uint16Array(f.buffer);
+        this._i32 = new Int32Array(f.buffer);
+        this._f32 = new Float32Array(f.buffer);
+      };
+      f.prototype.writeInt = function(f) {
         this.ensureCapacity(this._offset + 4);
-        this.writeIntUnsafe(d);
-      };
-      d.prototype.writeIntAt = function(d, q) {
-        f(0 <= q && q <= this._offset);
-        f(0 === (q & 3));
-        this.ensureCapacity(q + 4);
-        this._i32[q >> 2] = d;
-      };
-      d.prototype.writeIntUnsafe = function(d) {
-        this._i32[this._offset >> 2] = d;
+        this.writeIntUnsafe(f);
+      };
+      f.prototype.writeIntAt = function(f, b) {
+        this.ensureCapacity(b + 4);
+        this._i32[b >> 2] = f;
+      };
+      f.prototype.writeIntUnsafe = function(f) {
+        this._i32[this._offset >> 2] = f;
         this._offset += 4;
       };
-      d.prototype.writeFloat = function(d) {
-        f(0 === (this._offset & 3));
+      f.prototype.writeFloat = function(f) {
         this.ensureCapacity(this._offset + 4);
-        this.writeFloatUnsafe(d);
-      };
-      d.prototype.writeFloatUnsafe = function(d) {
-        this._f32[this._offset >> 2] = d;
+        this.writeFloatUnsafe(f);
+      };
+      f.prototype.writeFloatUnsafe = function(f) {
+        this._f32[this._offset >> 2] = f;
         this._offset += 4;
       };
-      d.prototype.write4Floats = function(d, q, a, h) {
-        f(0 === (this._offset & 3));
+      f.prototype.write4Floats = function(f, b, e, d) {
         this.ensureCapacity(this._offset + 16);
-        this.write4FloatsUnsafe(d, q, a, h);
-      };
-      d.prototype.write4FloatsUnsafe = function(d, f, q, a) {
-        var h = this._offset >> 2;
-        this._f32[h + 0] = d;
-        this._f32[h + 1] = f;
-        this._f32[h + 2] = q;
-        this._f32[h + 3] = a;
+        this.write4FloatsUnsafe(f, b, e, d);
+      };
+      f.prototype.write4FloatsUnsafe = function(f, b, e, d) {
+        var a = this._offset >> 2;
+        this._f32[a + 0] = f;
+        this._f32[a + 1] = b;
+        this._f32[a + 2] = e;
+        this._f32[a + 3] = d;
         this._offset += 16;
       };
-      d.prototype.write6Floats = function(d, q, a, h, b, u) {
-        f(0 === (this._offset & 3));
+      f.prototype.write6Floats = function(f, b, e, d, a, h) {
         this.ensureCapacity(this._offset + 24);
-        this.write6FloatsUnsafe(d, q, a, h, b, u);
-      };
-      d.prototype.write6FloatsUnsafe = function(d, f, q, a, h, b) {
-        var u = this._offset >> 2;
-        this._f32[u + 0] = d;
-        this._f32[u + 1] = f;
-        this._f32[u + 2] = q;
-        this._f32[u + 3] = a;
-        this._f32[u + 4] = h;
-        this._f32[u + 5] = b;
+        this.write6FloatsUnsafe(f, b, e, d, a, h);
+      };
+      f.prototype.write6FloatsUnsafe = function(f, b, e, d, a, h) {
+        var p = this._offset >> 2;
+        this._f32[p + 0] = f;
+        this._f32[p + 1] = b;
+        this._f32[p + 2] = e;
+        this._f32[p + 3] = d;
+        this._f32[p + 4] = a;
+        this._f32[p + 5] = h;
         this._offset += 24;
       };
-      d.prototype.subF32View = function() {
+      f.prototype.subF32View = function() {
         return this._f32.subarray(0, this._offset >> 2);
       };
-      d.prototype.subI32View = function() {
+      f.prototype.subI32View = function() {
         return this._i32.subarray(0, this._offset >> 2);
       };
-      d.prototype.subU16View = function() {
+      f.prototype.subU16View = function() {
         return this._u16.subarray(0, this._offset >> 1);
       };
-      d.prototype.subU8View = function() {
+      f.prototype.subU8View = function() {
         return this._u8.subarray(0, this._offset);
       };
-      d.prototype.hashWords = function(d, f, q) {
-        f = this._i32;
-        for (var a = 0;a < q;a++) {
-          d = (31 * d | 0) + f[a] | 0;
-        }
-        return d;
-      };
-      d.prototype.reserve = function(d) {
-        d = d + 3 & -4;
-        this.ensureCapacity(this._offset + d);
-        this._offset += d;
-      };
-      return d;
+      f.prototype.hashWords = function(f, b, e) {
+        b = this._i32;
+        for (var d = 0;d < e;d++) {
+          f = (31 * f | 0) + b[d] | 0;
+        }
+        return f;
+      };
+      f.prototype.reserve = function(f) {
+        f = f + 3 & -4;
+        this.ensureCapacity(this._offset + f);
+        this._offset += f;
+      };
+      return f;
     }();
-    a.ArrayWriter = d;
-  })(b = g.ArrayUtilities || (g.ArrayUtilities = {}));
+    d.ArrayWriter = b;
+  })(l.ArrayUtilities || (l.ArrayUtilities = {}));
   var a = function() {
-    function a(h) {
-      this._u8 = new Uint8Array(h);
-      this._u16 = new Uint16Array(h);
-      this._i32 = new Int32Array(h);
-      this._f32 = new Float32Array(h);
+    function d(e) {
+      this._u8 = new Uint8Array(e);
+      this._u16 = new Uint16Array(e);
+      this._i32 = new Int32Array(e);
+      this._f32 = new Float32Array(e);
       this._offset = 0;
     }
-    Object.defineProperty(a.prototype, "offset", {get:function() {
+    Object.defineProperty(d.prototype, "offset", {get:function() {
       return this._offset;
     }, enumerable:!0, configurable:!0});
-    a.prototype.isEmpty = function() {
+    d.prototype.isEmpty = function() {
       return this._offset === this._u8.length;
     };
-    a.prototype.readInt = function() {
-      k.assert(0 === (this._offset & 3));
-      k.assert(this._offset <= this._u8.length - 4);
-      var a = this._i32[this._offset >> 2];
+    d.prototype.readInt = function() {
+      var e = this._i32[this._offset >> 2];
+      this._offset += 4;
+      return e;
+    };
+    d.prototype.readFloat = function() {
+      var e = this._f32[this._offset >> 2];
       this._offset += 4;
-      return a;
-    };
-    a.prototype.readFloat = function() {
-      k.assert(0 === (this._offset & 3));
-      k.assert(this._offset <= this._u8.length - 4);
-      var a = this._f32[this._offset >> 2];
-      this._offset += 4;
-      return a;
-    };
-    return a;
+      return e;
+    };
+    return d;
   }();
-  g.ArrayReader = a;
-  (function(a) {
-    function h(d, f) {
-      return Object.prototype.hasOwnProperty.call(d, f);
+  l.ArrayReader = a;
+  (function(d) {
+    function e(f, b) {
+      return Object.prototype.hasOwnProperty.call(f, b);
     }
-    function f(d, f) {
-      for (var a in f) {
-        h(f, a) && (d[a] = f[a]);
+    function b(f, b) {
+      for (var w in b) {
+        e(b, w) && (f[w] = b[w]);
       }
     }
-    a.boxValue = function(d) {
-      return void 0 == d || e(d) ? d : Object(d);
-    };
-    a.toKeyValueArray = function(d) {
-      var f = Object.prototype.hasOwnProperty, a = [], h;
-      for (h in d) {
-        f.call(d, h) && a.push([h, d[h]]);
-      }
-      return a;
-    };
-    a.isPrototypeWriteable = function(d) {
-      return Object.getOwnPropertyDescriptor(d, "prototype").writable;
-    };
-    a.hasOwnProperty = h;
-    a.propertyIsEnumerable = function(d, f) {
-      return Object.prototype.propertyIsEnumerable.call(d, f);
-    };
-    a.getOwnPropertyDescriptor = function(d, f) {
-      return Object.getOwnPropertyDescriptor(d, f);
-    };
-    a.hasOwnGetter = function(d, f) {
-      var a = Object.getOwnPropertyDescriptor(d, f);
-      return!(!a || !a.get);
-    };
-    a.getOwnGetter = function(d, f) {
-      var a = Object.getOwnPropertyDescriptor(d, f);
-      return a ? a.get : null;
-    };
-    a.hasOwnSetter = function(d, f) {
-      var a = Object.getOwnPropertyDescriptor(d, f);
-      return!(!a || !a.set);
-    };
-    a.createMap = function() {
+    d.boxValue = function(f) {
+      return void 0 == f || g(f) ? f : Object(f);
+    };
+    d.toKeyValueArray = function(f) {
+      var b = Object.prototype.hasOwnProperty, e = [], d;
+      for (d in f) {
+        b.call(f, d) && e.push([d, f[d]]);
+      }
+      return e;
+    };
+    d.isPrototypeWriteable = function(f) {
+      return Object.getOwnPropertyDescriptor(f, "prototype").writable;
+    };
+    d.hasOwnProperty = e;
+    d.propertyIsEnumerable = function(f, b) {
+      return Object.prototype.propertyIsEnumerable.call(f, b);
+    };
+    d.getOwnPropertyDescriptor = function(f, b) {
+      return Object.getOwnPropertyDescriptor(f, b);
+    };
+    d.hasOwnGetter = function(f, b) {
+      var e = Object.getOwnPropertyDescriptor(f, b);
+      return!(!e || !e.get);
+    };
+    d.getOwnGetter = function(f, b) {
+      var e = Object.getOwnPropertyDescriptor(f, b);
+      return e ? e.get : null;
+    };
+    d.hasOwnSetter = function(f, b) {
+      var e = Object.getOwnPropertyDescriptor(f, b);
+      return!(!e || !e.set);
+    };
+    d.createMap = function() {
       return Object.create(null);
     };
-    a.createArrayMap = function() {
+    d.createArrayMap = function() {
       return[];
     };
-    a.defineReadOnlyProperty = function(d, f, a) {
-      Object.defineProperty(d, f, {value:a, writable:!1, configurable:!0, enumerable:!1});
-    };
-    a.getOwnPropertyDescriptors = function(d) {
-      for (var f = a.createMap(), h = Object.getOwnPropertyNames(d), s = 0;s < h.length;s++) {
-        f[h[s]] = Object.getOwnPropertyDescriptor(d, h[s]);
-      }
-      return f;
-    };
-    a.cloneObject = function(d) {
-      var q = Object.create(Object.getPrototypeOf(d));
-      f(q, d);
+    d.defineReadOnlyProperty = function(f, b, e) {
+      Object.defineProperty(f, b, {value:e, writable:!1, configurable:!0, enumerable:!1});
+    };
+    d.getOwnPropertyDescriptors = function(f) {
+      for (var b = d.createMap(), e = Object.getOwnPropertyNames(f), a = 0;a < e.length;a++) {
+        b[e[a]] = Object.getOwnPropertyDescriptor(f, e[a]);
+      }
+      return b;
+    };
+    d.cloneObject = function(f) {
+      var q = Object.create(Object.getPrototypeOf(f));
+      b(q, f);
       return q;
     };
-    a.copyProperties = function(d, f) {
-      for (var a in f) {
-        d[a] = f[a];
-      }
-    };
-    a.copyOwnProperties = f;
-    a.copyOwnPropertyDescriptors = function(d, f, a) {
-      void 0 === a && (a = !0);
-      for (var s in f) {
-        if (h(f, s)) {
-          var b = Object.getOwnPropertyDescriptor(f, s);
-          if (a || !h(d, s)) {
-            k.assert(b);
+    d.copyProperties = function(f, b) {
+      for (var e in b) {
+        f[e] = b[e];
+      }
+    };
+    d.copyOwnProperties = b;
+    d.copyOwnPropertyDescriptors = function(f, b, w) {
+      void 0 === w && (w = !0);
+      for (var d in b) {
+        if (e(b, d)) {
+          var a = Object.getOwnPropertyDescriptor(b, d);
+          if (w || !e(f, d)) {
             try {
-              Object.defineProperty(d, s, b);
-            } catch (u) {
-            }
-          }
-        }
-      }
-    };
-    a.getLatestGetterOrSetterPropertyDescriptor = function(d, f) {
-      for (var a = {};d;) {
-        var h = Object.getOwnPropertyDescriptor(d, f);
-        h && (a.get = a.get || h.get, a.set = a.set || h.set);
-        if (a.get && a.set) {
+              Object.defineProperty(f, d, a);
+            } catch (h) {
+            }
+          }
+        }
+      }
+    };
+    d.getLatestGetterOrSetterPropertyDescriptor = function(f, b) {
+      for (var e = {};f;) {
+        var d = Object.getOwnPropertyDescriptor(f, b);
+        d && (e.get = e.get || d.get, e.set = e.set || d.set);
+        if (e.get && e.set) {
           break;
         }
-        d = Object.getPrototypeOf(d);
-      }
-      return a;
-    };
-    a.defineNonEnumerableGetterOrSetter = function(d, f, h, s) {
-      var b = a.getLatestGetterOrSetterPropertyDescriptor(d, f);
-      b.configurable = !0;
-      b.enumerable = !1;
-      s ? b.get = h : b.set = h;
-      Object.defineProperty(d, f, b);
-    };
-    a.defineNonEnumerableGetter = function(d, f, a) {
-      Object.defineProperty(d, f, {get:a, configurable:!0, enumerable:!1});
-    };
-    a.defineNonEnumerableSetter = function(d, f, a) {
-      Object.defineProperty(d, f, {set:a, configurable:!0, enumerable:!1});
-    };
-    a.defineNonEnumerableProperty = function(d, f, a) {
-      Object.defineProperty(d, f, {value:a, writable:!0, configurable:!0, enumerable:!1});
-    };
-    a.defineNonEnumerableForwardingProperty = function(d, f, a) {
-      Object.defineProperty(d, f, {get:n.makeForwardingGetter(a), set:n.makeForwardingSetter(a), writable:!0, configurable:!0, enumerable:!1});
-    };
-    a.defineNewNonEnumerableProperty = function(d, f, h) {
-      k.assert(!Object.prototype.hasOwnProperty.call(d, f), "Property: " + f + " already exits.");
-      a.defineNonEnumerableProperty(d, f, h);
-    };
-    a.createPublicAliases = function(d, f) {
-      for (var a = {value:null, writable:!0, configurable:!0, enumerable:!1}, h = 0;h < f.length;h++) {
-        var b = f[h];
-        a.value = d[b];
-        Object.defineProperty(d, "$Bg" + b, a);
-      }
-    };
-  })(g.ObjectUtilities || (g.ObjectUtilities = {}));
-  var n;
-  (function(a) {
-    a.makeForwardingGetter = function(a) {
-      return new Function('return this["' + a + '"]//# sourceURL=fwd-get-' + a + ".as");
-    };
-    a.makeForwardingSetter = function(a) {
-      return new Function("value", 'this["' + a + '"] = value;//# sourceURL=fwd-set-' + a + ".as");
-    };
-    a.bindSafely = function(a, f) {
-      function d() {
-        return a.apply(f, arguments);
-      }
-      k.assert(!a.boundTo);
-      k.assert(f);
-      d.boundTo = f;
-      return d;
-    };
-  })(n = g.FunctionUtilities || (g.FunctionUtilities = {}));
-  (function(a) {
-    function h(d) {
-      return "string" === typeof d ? '"' + d + '"' : "number" === typeof d || "boolean" === typeof d ? String(d) : d instanceof Array ? "[] " + d.length : typeof d;
+        f = Object.getPrototypeOf(f);
+      }
+      return e;
+    };
+    d.defineNonEnumerableGetterOrSetter = function(f, b, e, a) {
+      var h = d.getLatestGetterOrSetterPropertyDescriptor(f, b);
+      h.configurable = !0;
+      h.enumerable = !1;
+      a ? h.get = e : h.set = e;
+      Object.defineProperty(f, b, h);
+    };
+    d.defineNonEnumerableGetter = function(f, b, e) {
+      Object.defineProperty(f, b, {get:e, configurable:!0, enumerable:!1});
+    };
+    d.defineNonEnumerableSetter = function(f, b, e) {
+      Object.defineProperty(f, b, {set:e, configurable:!0, enumerable:!1});
+    };
+    d.defineNonEnumerableProperty = function(f, b, e) {
+      Object.defineProperty(f, b, {value:e, writable:!0, configurable:!0, enumerable:!1});
+    };
+    d.defineNonEnumerableForwardingProperty = function(f, b, e) {
+      Object.defineProperty(f, b, {get:h.makeForwardingGetter(e), set:h.makeForwardingSetter(e), writable:!0, configurable:!0, enumerable:!1});
+    };
+    d.defineNewNonEnumerableProperty = function(b, q, e) {
+      d.defineNonEnumerableProperty(b, q, e);
+    };
+    d.createPublicAliases = function(b, q) {
+      for (var e = {value:null, writable:!0, configurable:!0, enumerable:!1}, d = 0;d < q.length;d++) {
+        var a = q[d];
+        e.value = b[a];
+        Object.defineProperty(b, "$Bg" + a, e);
+      }
+    };
+  })(l.ObjectUtilities || (l.ObjectUtilities = {}));
+  var h;
+  (function(d) {
+    d.makeForwardingGetter = function(e) {
+      return new Function('return this["' + e + '"]//# sourceURL=fwd-get-' + e + ".as");
+    };
+    d.makeForwardingSetter = function(e) {
+      return new Function("value", 'this["' + e + '"] = value;//# sourceURL=fwd-set-' + e + ".as");
+    };
+    d.bindSafely = function(e, b) {
+      function f() {
+        return e.apply(b, arguments);
+      }
+      f.boundTo = b;
+      return f;
+    };
+  })(h = l.FunctionUtilities || (l.FunctionUtilities = {}));
+  (function(d) {
+    function e(b) {
+      return "string" === typeof b ? '"' + b + '"' : "number" === typeof b || "boolean" === typeof b ? String(b) : b instanceof Array ? "[] " + b.length : typeof b;
     }
-    var f = g.Debug.assert;
-    a.repeatString = function(d, f) {
-      for (var q = "", a = 0;a < f;a++) {
-        q += d;
+    d.repeatString = function(b, f) {
+      for (var q = "", e = 0;e < f;e++) {
+        q += b;
       }
       return q;
     };
-    a.memorySizeToString = function(d) {
-      d |= 0;
-      return 1024 > d ? d + " B" : 1048576 > d ? (d / 1024).toFixed(2) + "KB" : (d / 1048576).toFixed(2) + "MB";
-    };
-    a.toSafeString = h;
-    a.toSafeArrayString = function(d) {
-      for (var f = [], q = 0;q < d.length;q++) {
-        f.push(h(d[q]));
+    d.memorySizeToString = function(b) {
+      b |= 0;
+      return 1024 > b ? b + " B" : 1048576 > b ? (b / 1024).toFixed(2) + "KB" : (b / 1048576).toFixed(2) + "MB";
+    };
+    d.toSafeString = e;
+    d.toSafeArrayString = function(b) {
+      for (var f = [], q = 0;q < b.length;q++) {
+        f.push(e(b[q]));
       }
       return f.join(", ");
     };
-    a.utf8decode = function(d) {
-      for (var f = new Uint8Array(4 * d.length), q = 0, a = 0, h = d.length;a < h;a++) {
-        var x = d.charCodeAt(a);
-        if (127 >= x) {
-          f[q++] = x;
+    d.utf8decode = function(b) {
+      for (var f = new Uint8Array(4 * b.length), q = 0, e = 0, w = b.length;e < w;e++) {
+        var d = b.charCodeAt(e);
+        if (127 >= d) {
+          f[q++] = d;
         } else {
-          if (55296 <= x && 56319 >= x) {
-            var b = d.charCodeAt(a + 1);
-            56320 <= b && 57343 >= b && (x = ((x & 1023) << 10) + (b & 1023) + 65536, ++a);
-          }
-          0 !== (x & 4292870144) ? (f[q++] = 248 | x >>> 24 & 3, f[q++] = 128 | x >>> 18 & 63, f[q++] = 128 | x >>> 12 & 63, f[q++] = 128 | x >>> 6 & 63) : 0 !== (x & 4294901760) ? (f[q++] = 240 | x >>> 18 & 7, f[q++] = 128 | x >>> 12 & 63, f[q++] = 128 | x >>> 6 & 63) : 0 !== (x & 4294965248) ? (f[q++] = 224 | x >>> 12 & 15, f[q++] = 128 | x >>> 6 & 63) : f[q++] = 192 | x >>> 6 & 31;
-          f[q++] = 128 | x & 63;
+          if (55296 <= d && 56319 >= d) {
+            var a = b.charCodeAt(e + 1);
+            56320 <= a && 57343 >= a && (d = ((d & 1023) << 10) + (a & 1023) + 65536, ++e);
+          }
+          0 !== (d & 4292870144) ? (f[q++] = 248 | d >>> 24 & 3, f[q++] = 128 | d >>> 18 & 63, f[q++] = 128 | d >>> 12 & 63, f[q++] = 128 | d >>> 6 & 63) : 0 !== (d & 4294901760) ? (f[q++] = 240 | d >>> 18 & 7, f[q++] = 128 | d >>> 12 & 63, f[q++] = 128 | d >>> 6 & 63) : 0 !== (d & 4294965248) ? (f[q++] = 224 | d >>> 12 & 15, f[q++] = 128 | d >>> 6 & 63) : f[q++] = 192 | d >>> 6 & 31;
+          f[q++] = 128 | d & 63;
         }
       }
       return f.subarray(0, q);
     };
-    a.utf8encode = function(d) {
-      for (var f = 0, q = "";f < d.length;) {
-        var a = d[f++] & 255;
-        if (127 >= a) {
-          q += String.fromCharCode(a);
+    d.utf8encode = function(b) {
+      for (var f = 0, q = "";f < b.length;) {
+        var e = b[f++] & 255;
+        if (127 >= e) {
+          q += String.fromCharCode(e);
         } else {
-          var h = 192, x = 5;
+          var d = 192, w = 5;
           do {
-            if ((a & (h >> 1 | 128)) === h) {
+            if ((e & (d >> 1 | 128)) === d) {
               break;
             }
-            h = h >> 1 | 128;
-            --x;
-          } while (0 <= x);
-          if (0 >= x) {
-            q += String.fromCharCode(a);
+            d = d >> 1 | 128;
+            --w;
+          } while (0 <= w);
+          if (0 >= w) {
+            q += String.fromCharCode(e);
           } else {
-            for (var a = a & (1 << x) - 1, h = !1, b = 5;b >= x;--b) {
-              var s = d[f++];
-              if (128 != (s & 192)) {
-                h = !0;
+            for (var e = e & (1 << w) - 1, d = !1, a = 5;a >= w;--a) {
+              var h = b[f++];
+              if (128 != (h & 192)) {
+                d = !0;
                 break;
               }
-              a = a << 6 | s & 63;
-            }
-            if (h) {
-              for (x = f - (7 - b);x < f;++x) {
-                q += String.fromCharCode(d[x] & 255);
+              e = e << 6 | h & 63;
+            }
+            if (d) {
+              for (w = f - (7 - a);w < f;++w) {
+                q += String.fromCharCode(b[w] & 255);
               }
             } else {
-              q = 65536 <= a ? q + String.fromCharCode(a - 65536 >> 10 & 1023 | 55296, a & 1023 | 56320) : q + String.fromCharCode(a);
+              q = 65536 <= e ? q + String.fromCharCode(e - 65536 >> 10 & 1023 | 55296, e & 1023 | 56320) : q + String.fromCharCode(e);
             }
           }
         }
       }
       return q;
     };
-    a.base64ArrayBuffer = function(d) {
+    d.base64ArrayBuffer = function(b) {
       var f = "";
-      d = new Uint8Array(d);
-      for (var q = d.byteLength, a = q % 3, q = q - a, h, x, b, s, u = 0;u < q;u += 3) {
-        s = d[u] << 16 | d[u + 1] << 8 | d[u + 2], h = (s & 16515072) >> 18, x = (s & 258048) >> 12, b = (s & 4032) >> 6, s &= 63, f += "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[h] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[x] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[b] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[s];
-      }
-      1 == a ? (s = d[q], f += "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[(s & 252) >> 2] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[(s & 3) << 4] + "==") : 2 == a && (s = d[q] << 8 | d[q + 1], f += "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[(s & 64512) >> 10] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[(s & 1008) >> 4] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[(s & 15) << 
+      b = new Uint8Array(b);
+      for (var q = b.byteLength, e = q % 3, q = q - e, d, w, a, h, G = 0;G < q;G += 3) {
+        h = b[G] << 16 | b[G + 1] << 8 | b[G + 2], d = (h & 16515072) >> 18, w = (h & 258048) >> 12, a = (h & 4032) >> 6, h &= 63, f += "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[d] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[w] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[a] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[h];
+      }
+      1 == e ? (h = b[q], f += "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[(h & 252) >> 2] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[(h & 3) << 4] + "==") : 2 == e && (h = b[q] << 8 | b[q + 1], f += "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[(h & 64512) >> 10] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[(h & 1008) >> 4] + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"[(h & 15) << 
       2] + "=");
       return f;
     };
-    a.escapeString = function(d) {
-      void 0 !== d && (d = d.replace(/[^\w$]/gi, "$"), /^\d/.test(d) && (d = "$" + d));
-      return d;
-    };
-    a.fromCharCodeArray = function(d) {
-      for (var f = "", q = 0;q < d.length;q += 16384) {
-        var a = Math.min(d.length - q, 16384), f = f + String.fromCharCode.apply(null, d.subarray(q, q + a))
+    d.escapeString = function(b) {
+      void 0 !== b && (b = b.replace(/[^\w$]/gi, "$"), /^\d/.test(b) && (b = "$" + b));
+      return b;
+    };
+    d.fromCharCodeArray = function(b) {
+      for (var f = "", q = 0;q < b.length;q += 16384) {
+        var e = Math.min(b.length - q, 16384), f = f + String.fromCharCode.apply(null, b.subarray(q, q + e))
+      }
+      return f;
+    };
+    d.variableLengthEncodeInt32 = function(b) {
+      for (var f = 32 - Math.clz32(b), q = Math.ceil(f / 6), f = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789$_"[q], q = q - 1;0 <= q;q--) {
+        f += "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789$_"[b >> 6 * q & 63];
       }
       return f;
     };
-    a.variableLengthEncodeInt32 = function(d) {
-      var q = 32 - Math.clz32(d);
-      f(32 >= q, q);
-      for (var h = Math.ceil(q / 6), x = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789$_"[h], b = h - 1;0 <= b;b--) {
-        x += "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789$_"[d >> 6 * b & 63];
-      }
-      f(a.variableLengthDecodeInt32(x) === d, d + " : " + x + " - " + h + " bits: " + q);
-      return x;
-    };
-    a.toEncoding = function(d) {
-      return "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789$_"[d];
-    };
-    a.fromEncoding = function(d) {
-      d = d.charCodeAt(0);
-      if (65 <= d && 90 >= d) {
-        return d - 65;
-      }
-      if (97 <= d && 122 >= d) {
-        return d - 71;
-      }
-      if (48 <= d && 57 >= d) {
-        return d + 4;
-      }
-      if (36 === d) {
+    d.toEncoding = function(b) {
+      return "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789$_"[b];
+    };
+    d.fromEncoding = function(b) {
+      b = b.charCodeAt(0);
+      if (65 <= b && 90 >= b) {
+        return b - 65;
+      }
+      if (97 <= b && 122 >= b) {
+        return b - 71;
+      }
+      if (48 <= b && 57 >= b) {
+        return b + 4;
+      }
+      if (36 === b) {
         return 62;
       }
-      if (95 === d) {
+      if (95 === b) {
         return 63;
       }
-      f(!1, "Invalid Encoding");
-    };
-    a.variableLengthDecodeInt32 = function(d) {
-      for (var f = a.fromEncoding(d[0]), q = 0, h = 0;h < f;h++) {
-        var x = 6 * (f - h - 1), q = q | a.fromEncoding(d[1 + h]) << x
+    };
+    d.variableLengthDecodeInt32 = function(b) {
+      for (var f = d.fromEncoding(b[0]), q = 0, e = 0;e < f;e++) {
+        var w = 6 * (f - e - 1), q = q | d.fromEncoding(b[1 + e]) << w
       }
       return q;
     };
-    a.trimMiddle = function(d, f) {
-      if (d.length <= f) {
-        return d;
-      }
-      var q = f >> 1, a = f - q - 1;
-      return d.substr(0, q) + "\u2026" + d.substr(d.length - a, a);
-    };
-    a.multiple = function(d, f) {
-      for (var q = "", a = 0;a < f;a++) {
-        q += d;
+    d.trimMiddle = function(b, f) {
+      if (b.length <= f) {
+        return b;
+      }
+      var q = f >> 1, e = f - q - 1;
+      return b.substr(0, q) + "\u2026" + b.substr(b.length - e, e);
+    };
+    d.multiple = function(b, f) {
+      for (var q = "", e = 0;e < f;e++) {
+        q += b;
       }
       return q;
     };
-    a.indexOfAny = function(d, f, q) {
-      for (var a = d.length, h = 0;h < f.length;h++) {
-        var x = d.indexOf(f[h], q);
-        0 <= x && (a = Math.min(a, x));
-      }
-      return a === d.length ? -1 : a;
-    };
-    var d = Array(3), q = Array(4), x = Array(5), b = Array(6), n = Array(7), p = Array(8), r = Array(9);
-    a.concat3 = function(f, q, a) {
-      d[0] = f;
-      d[1] = q;
-      d[2] = a;
-      return d.join("");
-    };
-    a.concat4 = function(d, f, a, h) {
-      q[0] = d;
+    d.indexOfAny = function(b, f, q) {
+      for (var e = b.length, d = 0;d < f.length;d++) {
+        var w = b.indexOf(f[d], q);
+        0 <= w && (e = Math.min(e, w));
+      }
+      return e === b.length ? -1 : e;
+    };
+    var b = Array(3), f = Array(4), q = Array(5), w = Array(6), a = Array(7), h = Array(8), p = Array(9);
+    d.concat3 = function(f, q, e) {
+      b[0] = f;
+      b[1] = q;
+      b[2] = e;
+      return b.join("");
+    };
+    d.concat4 = function(b, q, e, d) {
+      f[0] = b;
+      f[1] = q;
+      f[2] = e;
+      f[3] = d;
+      return f.join("");
+    };
+    d.concat5 = function(b, f, e, d, w) {
+      q[0] = b;
       q[1] = f;
-      q[2] = a;
-      q[3] = h;
+      q[2] = e;
+      q[3] = d;
+      q[4] = w;
       return q.join("");
     };
-    a.concat5 = function(d, f, q, a, h) {
-      x[0] = d;
-      x[1] = f;
-      x[2] = q;
-      x[3] = a;
-      x[4] = h;
-      return x.join("");
-    };
-    a.concat6 = function(d, f, q, a, h, x) {
-      b[0] = d;
-      b[1] = f;
-      b[2] = q;
-      b[3] = a;
-      b[4] = h;
-      b[5] = x;
-      return b.join("");
-    };
-    a.concat7 = function(d, f, q, a, h, x, b) {
-      n[0] = d;
-      n[1] = f;
-      n[2] = q;
-      n[3] = a;
-      n[4] = h;
-      n[5] = x;
-      n[6] = b;
-      return n.join("");
-    };
-    a.concat8 = function(d, f, q, a, h, x, b, s) {
-      p[0] = d;
+    d.concat6 = function(b, f, q, e, d, a) {
+      w[0] = b;
+      w[1] = f;
+      w[2] = q;
+      w[3] = e;
+      w[4] = d;
+      w[5] = a;
+      return w.join("");
+    };
+    d.concat7 = function(b, f, q, e, d, w, h) {
+      a[0] = b;
+      a[1] = f;
+      a[2] = q;
+      a[3] = e;
+      a[4] = d;
+      a[5] = w;
+      a[6] = h;
+      return a.join("");
+    };
+    d.concat8 = function(b, f, q, e, d, w, a, G) {
+      h[0] = b;
+      h[1] = f;
+      h[2] = q;
+      h[3] = e;
+      h[4] = d;
+      h[5] = w;
+      h[6] = a;
+      h[7] = G;
+      return h.join("");
+    };
+    d.concat9 = function(b, f, q, e, d, w, a, h, G) {
+      p[0] = b;
       p[1] = f;
       p[2] = q;
-      p[3] = a;
-      p[4] = h;
-      p[5] = x;
-      p[6] = b;
-      p[7] = s;
+      p[3] = e;
+      p[4] = d;
+      p[5] = w;
+      p[6] = a;
+      p[7] = h;
+      p[8] = G;
       return p.join("");
     };
-    a.concat9 = function(d, f, q, a, h, x, b, s, u) {
-      r[0] = d;
-      r[1] = f;
-      r[2] = q;
-      r[3] = a;
-      r[4] = h;
-      r[5] = x;
-      r[6] = b;
-      r[7] = s;
-      r[8] = u;
-      return r.join("");
-    };
-  })(g.StringUtilities || (g.StringUtilities = {}));
-  (function(a) {
-    var h = new Uint8Array([7, 12, 17, 22, 7, 12, 17, 22, 7, 12, 17, 22, 7, 12, 17, 22, 5, 9, 14, 20, 5, 9, 14, 20, 5, 9, 14, 20, 5, 9, 14, 20, 4, 11, 16, 23, 4, 11, 16, 23, 4, 11, 16, 23, 4, 11, 16, 23, 6, 10, 15, 21, 6, 10, 15, 21, 6, 10, 15, 21, 6, 10, 15, 21]), f = new Int32Array([-680876936, -389564586, 606105819, -1044525330, -176418897, 1200080426, -1473231341, -45705983, 1770035416, -1958414417, -42063, -1990404162, 1804603682, -40341101, -1502002290, 1236535329, -165796510, -1069501632, 
+  })(l.StringUtilities || (l.StringUtilities = {}));
+  (function(d) {
+    var e = new Uint8Array([7, 12, 17, 22, 7, 12, 17, 22, 7, 12, 17, 22, 7, 12, 17, 22, 5, 9, 14, 20, 5, 9, 14, 20, 5, 9, 14, 20, 5, 9, 14, 20, 4, 11, 16, 23, 4, 11, 16, 23, 4, 11, 16, 23, 4, 11, 16, 23, 6, 10, 15, 21, 6, 10, 15, 21, 6, 10, 15, 21, 6, 10, 15, 21]), b = new Int32Array([-680876936, -389564586, 606105819, -1044525330, -176418897, 1200080426, -1473231341, -45705983, 1770035416, -1958414417, -42063, -1990404162, 1804603682, -40341101, -1502002290, 1236535329, -165796510, -1069501632, 
     643717713, -373897302, -701558691, 38016083, -660478335, -405537848, 568446438, -1019803690, -187363961, 1163531501, -1444681467, -51403784, 1735328473, -1926607734, -378558, -2022574463, 1839030562, -35309556, -1530992060, 1272893353, -155497632, -1094730640, 681279174, -358537222, -722521979, 76029189, -640364487, -421815835, 530742520, -995338651, -198630844, 1126891415, -1416354905, -57434055, 1700485571, -1894986606, -1051523, -2054922799, 1873313359, -30611744, -1560198380, 1309151649, 
     -145523070, -1120210379, 718787259, -343485551]);
-    a.hashBytesTo32BitsMD5 = function(d, q, a) {
-      var b = 1732584193, u = -271733879, n = -1732584194, p = 271733878, r = a + 72 & -64, c = new Uint8Array(r), k;
-      for (k = 0;k < a;++k) {
-        c[k] = d[q++];
-      }
-      c[k++] = 128;
-      for (d = r - 8;k < d;) {
-        c[k++] = 0;
-      }
-      c[k++] = a << 3 & 255;
-      c[k++] = a >> 5 & 255;
-      c[k++] = a >> 13 & 255;
-      c[k++] = a >> 21 & 255;
-      c[k++] = a >>> 29 & 255;
-      c[k++] = 0;
-      c[k++] = 0;
-      c[k++] = 0;
-      d = new Int32Array(16);
-      for (k = 0;k < r;) {
-        for (a = 0;16 > a;++a, k += 4) {
-          d[a] = c[k] | c[k + 1] << 8 | c[k + 2] << 16 | c[k + 3] << 24;
-        }
-        var y = b;
-        q = u;
-        var l = n, t = p, v, e;
-        for (a = 0;64 > a;++a) {
-          16 > a ? (v = q & l | ~q & t, e = a) : 32 > a ? (v = t & q | ~t & l, e = 5 * a + 1 & 15) : 48 > a ? (v = q ^ l ^ t, e = 3 * a + 5 & 15) : (v = l ^ (q | ~t), e = 7 * a & 15);
-          var g = t, y = y + v + f[a] + d[e] | 0;
-          v = h[a];
-          t = l;
-          l = q;
-          q = q + (y << v | y >>> 32 - v) | 0;
-          y = g;
-        }
-        b = b + y | 0;
-        u = u + q | 0;
-        n = n + l | 0;
-        p = p + t | 0;
-      }
-      return b;
-    };
-    a.hashBytesTo32BitsAdler = function(d, f, a) {
-      var h = 1, b = 0;
-      for (a = f + a;f < a;++f) {
-        h = (h + (d[f] & 255)) % 65521, b = (b + h) % 65521;
-      }
-      return b << 16 | h;
-    };
-  })(g.HashUtilities || (g.HashUtilities = {}));
+    d.hashBytesTo32BitsMD5 = function(f, q, d) {
+      var a = 1732584193, h = -271733879, p = -1732584194, c = 271733878, k = d + 72 & -64, m = new Uint8Array(k), n;
+      for (n = 0;n < d;++n) {
+        m[n] = f[q++];
+      }
+      m[n++] = 128;
+      for (f = k - 8;n < f;) {
+        m[n++] = 0;
+      }
+      m[n++] = d << 3 & 255;
+      m[n++] = d >> 5 & 255;
+      m[n++] = d >> 13 & 255;
+      m[n++] = d >> 21 & 255;
+      m[n++] = d >>> 29 & 255;
+      m[n++] = 0;
+      m[n++] = 0;
+      m[n++] = 0;
+      f = new Int32Array(16);
+      for (n = 0;n < k;) {
+        for (d = 0;16 > d;++d, n += 4) {
+          f[d] = m[n] | m[n + 1] << 8 | m[n + 2] << 16 | m[n + 3] << 24;
+        }
+        var u = a;
+        q = h;
+        var s = p, g = c, v, l;
+        for (d = 0;64 > d;++d) {
+          16 > d ? (v = q & s | ~q & g, l = d) : 32 > d ? (v = g & q | ~g & s, l = 5 * d + 1 & 15) : 48 > d ? (v = q ^ s ^ g, l = 3 * d + 5 & 15) : (v = s ^ (q | ~g), l = 7 * d & 15);
+          var r = g, u = u + v + b[d] + f[l] | 0;
+          v = e[d];
+          g = s;
+          s = q;
+          q = q + (u << v | u >>> 32 - v) | 0;
+          u = r;
+        }
+        a = a + u | 0;
+        h = h + q | 0;
+        p = p + s | 0;
+        c = c + g | 0;
+      }
+      return a;
+    };
+    d.hashBytesTo32BitsAdler = function(b, q, e) {
+      var d = 1, a = 0;
+      for (e = q + e;q < e;++q) {
+        d = (d + (b[q] & 255)) % 65521, a = (a + d) % 65521;
+      }
+      return a << 16 | d;
+    };
+  })(l.HashUtilities || (l.HashUtilities = {}));
   var p = function() {
-    function a() {
+    function d() {
     }
-    a.seed = function(h) {
-      a._state[0] = h;
-      a._state[1] = h;
-    };
-    a.next = function() {
-      var a = this._state, f = Math.imul(18273, a[0] & 65535) + (a[0] >>> 16) | 0;
-      a[0] = f;
-      var d = Math.imul(36969, a[1] & 65535) + (a[1] >>> 16) | 0;
-      a[1] = d;
-      a = (f << 16) + (d & 65535) | 0;
-      return 2.3283064365386963E-10 * (0 > a ? a + 4294967296 : a);
-    };
-    a._state = new Uint32Array([57005, 48879]);
-    return a;
+    d.seed = function(e) {
+      d._state[0] = e;
+      d._state[1] = e;
+    };
+    d.next = function() {
+      var e = this._state, b = Math.imul(18273, e[0] & 65535) + (e[0] >>> 16) | 0;
+      e[0] = b;
+      var f = Math.imul(36969, e[1] & 65535) + (e[1] >>> 16) | 0;
+      e[1] = f;
+      e = (b << 16) + (f & 65535) | 0;
+      return 2.3283064365386963E-10 * (0 > e ? e + 4294967296 : e);
+    };
+    d._state = new Uint32Array([57005, 48879]);
+    return d;
   }();
-  g.Random = p;
+  l.Random = p;
   Math.random = function() {
     return p.next();
   };
   (function() {
-    function a() {
-      this.id = "$weakmap" + h++;
+    function d() {
+      this.id = "$weakmap" + e++;
     }
     if ("function" !== typeof jsGlobal.WeakMap) {
-      var h = 0;
-      a.prototype = {has:function(f) {
-        return f.hasOwnProperty(this.id);
-      }, get:function(f, d) {
-        return f.hasOwnProperty(this.id) ? f[this.id] : d;
-      }, set:function(f, d) {
-        Object.defineProperty(f, this.id, {value:d, enumerable:!1, configurable:!0});
+      var e = 0;
+      d.prototype = {has:function(b) {
+        return b.hasOwnProperty(this.id);
+      }, get:function(b, f) {
+        return b.hasOwnProperty(this.id) ? b[this.id] : f;
+      }, set:function(b, f) {
+        Object.defineProperty(b, this.id, {value:f, enumerable:!1, configurable:!0});
       }};
-      jsGlobal.WeakMap = a;
+      jsGlobal.WeakMap = d;
     }
   })();
   a = function() {
-    function a() {
+    function d() {
       "undefined" !== typeof netscape && netscape.security.PrivilegeManager ? this._map = new WeakMap : this._list = [];
     }
-    a.prototype.clear = function() {
+    d.prototype.clear = function() {
       this._map ? this._map.clear() : this._list.length = 0;
     };
-    a.prototype.push = function(a) {
-      this._map ? (k.assert(!this._map.has(a)), this._map.set(a, null)) : (k.assert(-1 === this._list.indexOf(a)), this._list.push(a));
-    };
-    a.prototype.remove = function(a) {
-      this._map ? (k.assert(this._map.has(a)), this._map.delete(a)) : (k.assert(-1 < this._list.indexOf(a)), this._list[this._list.indexOf(a)] = null, k.assert(-1 === this._list.indexOf(a)));
-    };
-    a.prototype.forEach = function(a) {
+    d.prototype.push = function(e) {
+      this._map ? this._map.set(e, null) : this._list.push(e);
+    };
+    d.prototype.remove = function(e) {
+      this._map ? this._map.delete(e) : this._list[this._list.indexOf(e)] = null;
+    };
+    d.prototype.forEach = function(e) {
       if (this._map) {
-        "undefined" !== typeof netscape && netscape.security.PrivilegeManager.enablePrivilege("UniversalXPConnect"), Components.utils.nondeterministicGetWeakMapKeys(this._map).forEach(function(d) {
-          0 !== d._referenceCount && a(d);
+        "undefined" !== typeof netscape && netscape.security.PrivilegeManager.enablePrivilege("UniversalXPConnect"), Components.utils.nondeterministicGetWeakMapKeys(this._map).forEach(function(b) {
+          0 !== b._referenceCount && e(b);
         });
       } else {
-        for (var f = this._list, d = 0, q = 0;q < f.length;q++) {
-          var x = f[q];
-          x && (0 === x._referenceCount ? (f[q] = null, d++) : a(x));
-        }
-        if (16 < d && d > f.length >> 2) {
-          d = [];
-          for (q = 0;q < f.length;q++) {
-            (x = f[q]) && 0 < x._referenceCount && d.push(x);
-          }
-          this._list = d;
-        }
-      }
-    };
-    Object.defineProperty(a.prototype, "length", {get:function() {
+        for (var b = this._list, f = 0, q = 0;q < b.length;q++) {
+          var d = b[q];
+          d && (0 === d._referenceCount ? (b[q] = null, f++) : e(d));
+        }
+        if (16 < f && f > b.length >> 2) {
+          f = [];
+          for (q = 0;q < b.length;q++) {
+            (d = b[q]) && 0 < d._referenceCount && f.push(d);
+          }
+          this._list = f;
+        }
+      }
+    };
+    Object.defineProperty(d.prototype, "length", {get:function() {
       return this._map ? -1 : this._list.length;
     }, enumerable:!0, configurable:!0});
-    return a;
+    return d;
   }();
-  g.WeakList = a;
-  var y;
-  (function(a) {
-    a.pow2 = function(a) {
-      return a === (a | 0) ? 0 > a ? 1 / (1 << -a) : 1 << a : Math.pow(2, a);
-    };
-    a.clamp = function(a, f, d) {
-      return Math.max(f, Math.min(d, a));
-    };
-    a.roundHalfEven = function(a) {
-      if (.5 === Math.abs(a % 1)) {
-        var f = Math.floor(a);
-        return 0 === f % 2 ? f : Math.ceil(a);
-      }
-      return Math.round(a);
-    };
-    a.epsilonEquals = function(a, f) {
-      return 1E-7 > Math.abs(a - f);
-    };
-  })(y = g.NumberUtilities || (g.NumberUtilities = {}));
-  (function(a) {
-    a[a.MaxU16 = 65535] = "MaxU16";
-    a[a.MaxI16 = 32767] = "MaxI16";
-    a[a.MinI16 = -32768] = "MinI16";
-  })(g.Numbers || (g.Numbers = {}));
-  var v;
-  (function(a) {
-    function h(d) {
-      return 256 * d << 16 >> 16;
+  l.WeakList = a;
+  var k;
+  (function(d) {
+    d.pow2 = function(e) {
+      return e === (e | 0) ? 0 > e ? 1 / (1 << -e) : 1 << e : Math.pow(2, e);
+    };
+    d.clamp = function(e, b, f) {
+      return Math.max(b, Math.min(f, e));
+    };
+    d.roundHalfEven = function(e) {
+      if (.5 === Math.abs(e % 1)) {
+        var b = Math.floor(e);
+        return 0 === b % 2 ? b : Math.ceil(e);
+      }
+      return Math.round(e);
+    };
+    d.epsilonEquals = function(e, b) {
+      return 1E-7 > Math.abs(e - b);
+    };
+  })(k = l.NumberUtilities || (l.NumberUtilities = {}));
+  (function(d) {
+    d[d.MaxU16 = 65535] = "MaxU16";
+    d[d.MaxI16 = 32767] = "MaxI16";
+    d[d.MinI16 = -32768] = "MinI16";
+  })(l.Numbers || (l.Numbers = {}));
+  var u;
+  (function(d) {
+    function e(b) {
+      return 256 * b << 16 >> 16;
     }
-    var f = new ArrayBuffer(8);
-    a.i8 = new Int8Array(f);
-    a.u8 = new Uint8Array(f);
-    a.i32 = new Int32Array(f);
-    a.f32 = new Float32Array(f);
-    a.f64 = new Float64Array(f);
-    a.nativeLittleEndian = 1 === (new Int8Array((new Int32Array([1])).buffer))[0];
-    a.floatToInt32 = function(d) {
-      a.f32[0] = d;
-      return a.i32[0];
-    };
-    a.int32ToFloat = function(d) {
-      a.i32[0] = d;
-      return a.f32[0];
-    };
-    a.swap16 = function(d) {
-      return(d & 255) << 8 | d >> 8 & 255;
-    };
-    a.swap32 = function(d) {
-      return(d & 255) << 24 | (d & 65280) << 8 | d >> 8 & 65280 | d >> 24 & 255;
-    };
-    a.toS8U8 = h;
-    a.fromS8U8 = function(d) {
-      return d / 256;
-    };
-    a.clampS8U8 = function(d) {
-      return h(d) / 256;
-    };
-    a.toS16 = function(d) {
-      return d << 16 >> 16;
-    };
-    a.bitCount = function(d) {
-      d -= d >> 1 & 1431655765;
-      d = (d & 858993459) + (d >> 2 & 858993459);
-      return 16843009 * (d + (d >> 4) & 252645135) >> 24;
-    };
-    a.ones = function(d) {
-      d -= d >> 1 & 1431655765;
-      d = (d & 858993459) + (d >> 2 & 858993459);
-      return 16843009 * (d + (d >> 4) & 252645135) >> 24;
-    };
-    a.trailingZeros = function(d) {
-      return a.ones((d & -d) - 1);
-    };
-    a.getFlags = function(d, f) {
-      var a = "";
-      for (d = 0;d < f.length;d++) {
-        d & 1 << d && (a += f[d] + " ");
-      }
-      return 0 === a.length ? "" : a.trim();
-    };
-    a.isPowerOfTwo = function(d) {
-      return d && 0 === (d & d - 1);
-    };
-    a.roundToMultipleOfFour = function(d) {
-      return d + 3 & -4;
-    };
-    a.nearestPowerOfTwo = function(d) {
-      d--;
-      d |= d >> 1;
-      d |= d >> 2;
-      d |= d >> 4;
-      d |= d >> 8;
-      d |= d >> 16;
-      d++;
-      return d;
-    };
-    a.roundToMultipleOfPowerOfTwo = function(d, f) {
-      var a = (1 << f) - 1;
-      return d + a & ~a;
-    };
-    Math.imul || (Math.imul = function(d, f) {
-      var a = d & 65535, h = f & 65535;
-      return a * h + ((d >>> 16 & 65535) * h + a * (f >>> 16 & 65535) << 16 >>> 0) | 0;
+    var b = new ArrayBuffer(8);
+    d.i8 = new Int8Array(b);
+    d.u8 = new Uint8Array(b);
+    d.i32 = new Int32Array(b);
+    d.f32 = new Float32Array(b);
+    d.f64 = new Float64Array(b);
+    d.nativeLittleEndian = 1 === (new Int8Array((new Int32Array([1])).buffer))[0];
+    d.floatToInt32 = function(b) {
+      d.f32[0] = b;
+      return d.i32[0];
+    };
+    d.int32ToFloat = function(b) {
+      d.i32[0] = b;
+      return d.f32[0];
+    };
+    d.swap16 = function(b) {
+      return(b & 255) << 8 | b >> 8 & 255;
+    };
+    d.swap32 = function(b) {
+      return(b & 255) << 24 | (b & 65280) << 8 | b >> 8 & 65280 | b >> 24 & 255;
+    };
+    d.toS8U8 = e;
+    d.fromS8U8 = function(b) {
+      return b / 256;
+    };
+    d.clampS8U8 = function(b) {
+      return e(b) / 256;
+    };
+    d.toS16 = function(b) {
+      return b << 16 >> 16;
+    };
+    d.bitCount = function(b) {
+      b -= b >> 1 & 1431655765;
+      b = (b & 858993459) + (b >> 2 & 858993459);
+      return 16843009 * (b + (b >> 4) & 252645135) >> 24;
+    };
+    d.ones = function(b) {
+      b -= b >> 1 & 1431655765;
+      b = (b & 858993459) + (b >> 2 & 858993459);
+      return 16843009 * (b + (b >> 4) & 252645135) >> 24;
+    };
+    d.trailingZeros = function(b) {
+      return d.ones((b & -b) - 1);
+    };
+    d.getFlags = function(b, q) {
+      var e = "";
+      for (b = 0;b < q.length;b++) {
+        b & 1 << b && (e += q[b] + " ");
+      }
+      return 0 === e.length ? "" : e.trim();
+    };
+    d.isPowerOfTwo = function(b) {
+      return b && 0 === (b & b - 1);
+    };
+    d.roundToMultipleOfFour = function(b) {
+      return b + 3 & -4;
+    };
+    d.nearestPowerOfTwo = function(b) {
+      b--;
+      b |= b >> 1;
+      b |= b >> 2;
+      b |= b >> 4;
+      b |= b >> 8;
+      b |= b >> 16;
+      b++;
+      return b;
+    };
+    d.roundToMultipleOfPowerOfTwo = function(b, q) {
+      var e = (1 << q) - 1;
+      return b + e & ~e;
+    };
+    Math.imul || (Math.imul = function(b, q) {
+      var e = b & 65535, d = q & 65535;
+      return e * d + ((b >>> 16 & 65535) * d + e * (q >>> 16 & 65535) << 16 >>> 0) | 0;
     });
-    Math.clz32 || (Math.clz32 = function(d) {
-      d |= d >> 1;
-      d |= d >> 2;
-      d |= d >> 4;
-      d |= d >> 8;
-      return 32 - a.ones(d | d >> 16);
+    Math.clz32 || (Math.clz32 = function(b) {
+      b |= b >> 1;
+      b |= b >> 2;
+      b |= b >> 4;
+      b |= b >> 8;
+      return 32 - d.ones(b | b >> 16);
     });
-  })(v = g.IntegerUtilities || (g.IntegerUtilities = {}));
-  (function(a) {
-    function h(f, d, a, h, b, u) {
-      return(a - f) * (u - d) - (h - d) * (b - f);
+  })(u = l.IntegerUtilities || (l.IntegerUtilities = {}));
+  (function(d) {
+    function e(b, f, q, e, d, a) {
+      return(q - b) * (a - f) - (e - f) * (d - b);
     }
-    a.pointInPolygon = function(f, d, a) {
-      for (var h = 0, b = a.length - 2, u = 0;u < b;u += 2) {
-        var n = a[u + 0], p = a[u + 1], r = a[u + 2], c = a[u + 3];
-        (p <= d && c > d || p > d && c <= d) && f < n + (d - p) / (c - p) * (r - n) && h++;
-      }
-      return 1 === (h & 1);
-    };
-    a.signedArea = h;
-    a.counterClockwise = function(f, d, a, b, s, u) {
-      return 0 < h(f, d, a, b, s, u);
-    };
-    a.clockwise = function(f, d, a, b, s, u) {
-      return 0 > h(f, d, a, b, s, u);
-    };
-    a.pointInPolygonInt32 = function(f, d, a) {
+    d.pointInPolygon = function(b, f, q) {
+      for (var e = 0, d = q.length - 2, a = 0;a < d;a += 2) {
+        var h = q[a + 0], p = q[a + 1], c = q[a + 2], k = q[a + 3];
+        (p <= f && k > f || p > f && k <= f) && b < h + (f - p) / (k - p) * (c - h) && e++;
+      }
+      return 1 === (e & 1);
+    };
+    d.signedArea = e;
+    d.counterClockwise = function(b, f, q, d, a, h) {
+      return 0 < e(b, f, q, d, a, h);
+    };
+    d.clockwise = function(b, f, q, d, a, h) {
+      return 0 > e(b, f, q, d, a, h);
+    };
+    d.pointInPolygonInt32 = function(b, f, q) {
+      b |= 0;
       f |= 0;
-      d |= 0;
-      for (var h = 0, b = a.length - 2, u = 0;u < b;u += 2) {
-        var n = a[u + 0], p = a[u + 1], r = a[u + 2], c = a[u + 3];
-        (p <= d && c > d || p > d && c <= d) && f < n + (d - p) / (c - p) * (r - n) && h++;
-      }
-      return 1 === (h & 1);
-    };
-  })(g.GeometricUtilities || (g.GeometricUtilities = {}));
-  (function(a) {
-    a[a.Error = 1] = "Error";
-    a[a.Warn = 2] = "Warn";
-    a[a.Debug = 4] = "Debug";
-    a[a.Log = 8] = "Log";
-    a[a.Info = 16] = "Info";
-    a[a.All = 31] = "All";
-  })(g.LogLevel || (g.LogLevel = {}));
+      for (var e = 0, d = q.length - 2, a = 0;a < d;a += 2) {
+        var h = q[a + 0], p = q[a + 1], c = q[a + 2], k = q[a + 3];
+        (p <= f && k > f || p > f && k <= f) && b < h + (f - p) / (k - p) * (c - h) && e++;
+      }
+      return 1 === (e & 1);
+    };
+  })(l.GeometricUtilities || (l.GeometricUtilities = {}));
+  (function(d) {
+    d[d.Error = 1] = "Error";
+    d[d.Warn = 2] = "Warn";
+    d[d.Debug = 4] = "Debug";
+    d[d.Log = 8] = "Log";
+    d[d.Info = 16] = "Info";
+    d[d.All = 31] = "All";
+  })(l.LogLevel || (l.LogLevel = {}));
   a = function() {
-    function a(h, f) {
-      void 0 === h && (h = !1);
+    function d(e, b) {
+      void 0 === e && (e = !1);
       this._tab = "  ";
       this._padding = "";
-      this._suppressOutput = h;
-      this._out = f || a._consoleOut;
-      this._outNoNewline = f || a._consoleOutNoNewline;
+      this._suppressOutput = e;
+      this._out = b || d._consoleOut;
+      this._outNoNewline = b || d._consoleOutNoNewline;
     }
-    a.prototype.write = function(a, f) {
-      void 0 === a && (a = "");
-      void 0 === f && (f = !1);
-      this._suppressOutput || this._outNoNewline((f ? this._padding : "") + a);
-    };
-    a.prototype.writeLn = function(a) {
-      void 0 === a && (a = "");
-      this._suppressOutput || this._out(this._padding + a);
-    };
-    a.prototype.writeObject = function(a, f) {
-      void 0 === a && (a = "");
-      this._suppressOutput || this._out(this._padding + a, f);
-    };
-    a.prototype.writeTimeLn = function(a) {
-      void 0 === a && (a = "");
-      this._suppressOutput || this._out(this._padding + performance.now().toFixed(2) + " " + a);
-    };
-    a.prototype.writeComment = function(a) {
-      a = a.split("\n");
-      if (1 === a.length) {
-        this.writeLn("// " + a[0]);
+    d.prototype.write = function(e, b) {
+      void 0 === e && (e = "");
+      void 0 === b && (b = !1);
+      this._suppressOutput || this._outNoNewline((b ? this._padding : "") + e);
+    };
+    d.prototype.writeLn = function(e) {
+      void 0 === e && (e = "");
+      this._suppressOutput || this._out(this._padding + e);
+    };
+    d.prototype.writeObject = function(e, b) {
+      void 0 === e && (e = "");
+      this._suppressOutput || this._out(this._padding + e, b);
+    };
+    d.prototype.writeTimeLn = function(e) {
+      void 0 === e && (e = "");
+      this._suppressOutput || this._out(this._padding + performance.now().toFixed(2) + " " + e);
+    };
+    d.prototype.writeComment = function(e) {
+      e = e.split("\n");
+      if (1 === e.length) {
+        this.writeLn("// " + e[0]);
       } else {
         this.writeLn("/**");
-        for (var f = 0;f < a.length;f++) {
-          this.writeLn(" * " + a[f]);
+        for (var b = 0;b < e.length;b++) {
+          this.writeLn(" * " + e[b]);
         }
         this.writeLn(" */");
       }
     };
-    a.prototype.writeLns = function(a) {
-      a = a.split("\n");
-      for (var f = 0;f < a.length;f++) {
-        this.writeLn(a[f]);
-      }
-    };
-    a.prototype.errorLn = function(h) {
-      a.logLevel & 1 && this.boldRedLn(h);
-    };
-    a.prototype.warnLn = function(h) {
-      a.logLevel & 2 && this.yellowLn(h);
-    };
-    a.prototype.debugLn = function(h) {
-      a.logLevel & 4 && this.purpleLn(h);
-    };
-    a.prototype.logLn = function(h) {
-      a.logLevel & 8 && this.writeLn(h);
-    };
-    a.prototype.infoLn = function(h) {
-      a.logLevel & 16 && this.writeLn(h);
-    };
-    a.prototype.yellowLn = function(h) {
-      this.colorLn(a.YELLOW, h);
-    };
-    a.prototype.greenLn = function(h) {
-      this.colorLn(a.GREEN, h);
-    };
-    a.prototype.boldRedLn = function(h) {
-      this.colorLn(a.BOLD_RED, h);
-    };
-    a.prototype.redLn = function(h) {
-      this.colorLn(a.RED, h);
-    };
-    a.prototype.purpleLn = function(h) {
-      this.colorLn(a.PURPLE, h);
-    };
-    a.prototype.colorLn = function(h, f) {
-      this._suppressOutput || (inBrowser ? this._out(this._padding + f) : this._out(this._padding + h + f + a.ENDC));
-    };
-    a.prototype.redLns = function(h) {
-      this.colorLns(a.RED, h);
-    };
-    a.prototype.colorLns = function(a, f) {
-      for (var d = f.split("\n"), q = 0;q < d.length;q++) {
-        this.colorLn(a, d[q]);
-      }
-    };
-    a.prototype.enter = function(a) {
-      this._suppressOutput || this._out(this._padding + a);
+    d.prototype.writeLns = function(e) {
+      e = e.split("\n");
+      for (var b = 0;b < e.length;b++) {
+        this.writeLn(e[b]);
+      }
+    };
+    d.prototype.errorLn = function(e) {
+      d.logLevel & 1 && this.boldRedLn(e);
+    };
+    d.prototype.warnLn = function(e) {
+      d.logLevel & 2 && this.yellowLn(e);
+    };
+    d.prototype.debugLn = function(e) {
+      d.logLevel & 4 && this.purpleLn(e);
+    };
+    d.prototype.logLn = function(e) {
+      d.logLevel & 8 && this.writeLn(e);
+    };
+    d.prototype.infoLn = function(e) {
+      d.logLevel & 16 && this.writeLn(e);
+    };
+    d.prototype.yellowLn = function(e) {
+      this.colorLn(d.YELLOW, e);
+    };
+    d.prototype.greenLn = function(e) {
+      this.colorLn(d.GREEN, e);
+    };
+    d.prototype.boldRedLn = function(e) {
+      this.colorLn(d.BOLD_RED, e);
+    };
+    d.prototype.redLn = function(e) {
+      this.colorLn(d.RED, e);
+    };
+    d.prototype.purpleLn = function(e) {
+      this.colorLn(d.PURPLE, e);
+    };
+    d.prototype.colorLn = function(e, b) {
+      this._suppressOutput || (inBrowser ? this._out(this._padding + b) : this._out(this._padding + e + b + d.ENDC));
+    };
+    d.prototype.redLns = function(e) {
+      this.colorLns(d.RED, e);
+    };
+    d.prototype.colorLns = function(e, b) {
+      for (var f = b.split("\n"), q = 0;q < f.length;q++) {
+        this.colorLn(e, f[q]);
+      }
+    };
+    d.prototype.enter = function(e) {
+      this._suppressOutput || this._out(this._padding + e);
       this.indent();
     };
-    a.prototype.leaveAndEnter = function(a) {
-      this.leave(a);
+    d.prototype.leaveAndEnter = function(e) {
+      this.leave(e);
       this.indent();
     };
-    a.prototype.leave = function(a) {
+    d.prototype.leave = function(e) {
       this.outdent();
-      !this._suppressOutput && a && this._out(this._padding + a);
-    };
-    a.prototype.indent = function() {
+      !this._suppressOutput && e && this._out(this._padding + e);
+    };
+    d.prototype.indent = function() {
       this._padding += this._tab;
     };
-    a.prototype.outdent = function() {
+    d.prototype.outdent = function() {
       0 < this._padding.length && (this._padding = this._padding.substring(0, this._padding.length - this._tab.length));
     };
-    a.prototype.writeArray = function(a, f, d) {
+    d.prototype.writeArray = function(e, b, f) {
+      void 0 === b && (b = !1);
       void 0 === f && (f = !1);
-      void 0 === d && (d = !1);
-      f = f || !1;
-      for (var q = 0, b = a.length;q < b;q++) {
-        var s = "";
-        f && (s = null === a[q] ? "null" : void 0 === a[q] ? "undefined" : a[q].constructor.name, s += " ");
-        var n = d ? "" : ("" + q).padRight(" ", 4);
-        this.writeLn(n + s + a[q]);
-      }
-    };
-    a.PURPLE = "\u001b[94m";
-    a.YELLOW = "\u001b[93m";
-    a.GREEN = "\u001b[92m";
-    a.RED = "\u001b[91m";
-    a.BOLD_RED = "\u001b[1;91m";
-    a.ENDC = "\u001b[0m";
-    a.logLevel = 31;
-    a._consoleOut = console.info.bind(console);
-    a._consoleOutNoNewline = console.info.bind(console);
-    return a;
+      b = b || !1;
+      for (var q = 0, d = e.length;q < d;q++) {
+        var a = "";
+        b && (a = null === e[q] ? "null" : void 0 === e[q] ? "undefined" : e[q].constructor.name, a += " ");
+        var h = f ? "" : ("" + q).padRight(" ", 4);
+        this.writeLn(h + a + e[q]);
+      }
+    };
+    d.PURPLE = "\u001b[94m";
+    d.YELLOW = "\u001b[93m";
+    d.GREEN = "\u001b[92m";
+    d.RED = "\u001b[91m";
+    d.BOLD_RED = "\u001b[1;91m";
+    d.ENDC = "\u001b[0m";
+    d.logLevel = 31;
+    d._consoleOut = console.info.bind(console);
+    d._consoleOutNoNewline = console.info.bind(console);
+    return d;
   }();
-  g.IndentingWriter = a;
-  var l = function() {
-    return function(a, h) {
-      this.value = a;
-      this.next = h;
+  l.IndentingWriter = a;
+  var n = function() {
+    return function(d, e) {
+      this.value = d;
+      this.next = e;
     };
   }(), a = function() {
-    function a(h) {
-      k.assert(h);
-      this._compare = h;
+    function d(e) {
+      this._compare = e;
       this._head = null;
       this._length = 0;
     }
-    a.prototype.push = function(a) {
-      k.assert(void 0 !== a);
+    d.prototype.push = function(e) {
       this._length++;
       if (this._head) {
-        var f = this._head, d = null;
-        a = new l(a, null);
-        for (var q = this._compare;f;) {
-          if (0 < q(f.value, a.value)) {
-            d ? (a.next = f, d.next = a) : (a.next = this._head, this._head = a);
+        var b = this._head, f = null;
+        e = new n(e, null);
+        for (var q = this._compare;b;) {
+          if (0 < q(b.value, e.value)) {
+            f ? (e.next = b, f.next = e) : (e.next = this._head, this._head = e);
             return;
           }
-          d = f;
-          f = f.next;
-        }
-        d.next = a;
+          f = b;
+          b = b.next;
+        }
+        f.next = e;
       } else {
-        this._head = new l(a, null);
-      }
-    };
-    a.prototype.forEach = function(h) {
-      for (var f = this._head, d = null;f;) {
-        var q = h(f.value);
-        if (q === a.RETURN) {
+        this._head = new n(e, null);
+      }
+    };
+    d.prototype.forEach = function(e) {
+      for (var b = this._head, f = null;b;) {
+        var q = e(b.value);
+        if (q === d.RETURN) {
           break;
         } else {
-          q === a.DELETE ? f = d ? d.next = f.next : this._head = this._head.next : (d = f, f = f.next);
-        }
-      }
-    };
-    a.prototype.isEmpty = function() {
+          q === d.DELETE ? b = f ? f.next = b.next : this._head = this._head.next : (f = b, b = b.next);
+        }
+      }
+    };
+    d.prototype.isEmpty = function() {
       return!this._head;
     };
-    a.prototype.pop = function() {
+    d.prototype.pop = function() {
       if (this._head) {
         this._length--;
-        var a = this._head;
+        var e = this._head;
         this._head = this._head.next;
-        return a.value;
-      }
-    };
-    a.prototype.contains = function(a) {
-      for (var f = this._head;f;) {
-        if (f.value === a) {
+        return e.value;
+      }
+    };
+    d.prototype.contains = function(e) {
+      for (var b = this._head;b;) {
+        if (b.value === e) {
           return!0;
         }
-        f = f.next;
+        b = b.next;
       }
       return!1;
     };
-    a.prototype.toString = function() {
-      for (var a = "[", f = this._head;f;) {
-        a += f.value.toString(), (f = f.next) && (a += ",");
-      }
-      return a + "]";
-    };
-    a.RETURN = 1;
-    a.DELETE = 2;
-    return a;
+    d.prototype.toString = function() {
+      for (var e = "[", b = this._head;b;) {
+        e += b.value.toString(), (b = b.next) && (e += ",");
+      }
+      return e + "]";
+    };
+    d.RETURN = 1;
+    d.DELETE = 2;
+    return d;
   }();
-  g.SortedList = a;
+  l.SortedList = a;
   a = function() {
-    function a(h, f) {
-      void 0 === f && (f = 12);
+    function d(e, b) {
+      void 0 === b && (b = 12);
       this.start = this.index = 0;
-      this._size = 1 << f;
+      this._size = 1 << b;
       this._mask = this._size - 1;
-      this.array = new h(this._size);
+      this.array = new e(this._size);
     }
-    a.prototype.get = function(a) {
-      return this.array[a];
-    };
-    a.prototype.forEachInReverse = function(a) {
+    d.prototype.get = function(e) {
+      return this.array[e];
+    };
+    d.prototype.forEachInReverse = function(e) {
       if (!this.isEmpty()) {
-        for (var f = 0 === this.index ? this._size - 1 : this.index - 1, d = this.start - 1 & this._mask;f !== d && !a(this.array[f], f);) {
-          f = 0 === f ? this._size - 1 : f - 1;
-        }
-      }
-    };
-    a.prototype.write = function(a) {
-      this.array[this.index] = a;
+        for (var b = 0 === this.index ? this._size - 1 : this.index - 1, f = this.start - 1 & this._mask;b !== f && !e(this.array[b], b);) {
+          b = 0 === b ? this._size - 1 : b - 1;
+        }
+      }
+    };
+    d.prototype.write = function(e) {
+      this.array[this.index] = e;
       this.index = this.index + 1 & this._mask;
       this.index === this.start && (this.start = this.start + 1 & this._mask);
     };
-    a.prototype.isFull = function() {
+    d.prototype.isFull = function() {
       return(this.index + 1 & this._mask) === this.start;
     };
-    a.prototype.isEmpty = function() {
+    d.prototype.isEmpty = function() {
       return this.index === this.start;
     };
-    a.prototype.reset = function() {
+    d.prototype.reset = function() {
       this.start = this.index = 0;
     };
-    return a;
+    return d;
   }();
-  g.CircularBuffer = a;
-  (function(a) {
-    function h(d) {
-      return d + (a.BITS_PER_WORD - 1) >> a.ADDRESS_BITS_PER_WORD << a.ADDRESS_BITS_PER_WORD;
+  l.CircularBuffer = a;
+  (function(d) {
+    function e(b) {
+      return b + (d.BITS_PER_WORD - 1) >> d.ADDRESS_BITS_PER_WORD << d.ADDRESS_BITS_PER_WORD;
     }
-    function f(d, a) {
-      d = d || "1";
-      a = a || "0";
-      for (var f = "", q = 0;q < length;q++) {
-        f += this.get(q) ? d : a;
-      }
-      return f;
+    function b(b, f) {
+      b = b || "1";
+      f = f || "0";
+      for (var q = "", e = 0;e < length;e++) {
+        q += this.get(e) ? b : f;
+      }
+      return q;
     }
-    function d(d) {
-      for (var a = [], f = 0;f < length;f++) {
-        this.get(f) && a.push(d ? d[f] : f);
-      }
-      return a.join(", ");
+    function f(b) {
+      for (var f = [], q = 0;q < length;q++) {
+        this.get(q) && f.push(b ? b[q] : q);
+      }
+      return f.join(", ");
     }
-    var q = g.Debug.assert;
-    a.ADDRESS_BITS_PER_WORD = 5;
-    a.BITS_PER_WORD = 1 << a.ADDRESS_BITS_PER_WORD;
-    a.BIT_INDEX_MASK = a.BITS_PER_WORD - 1;
-    var b = function() {
-      function d(f) {
-        this.size = h(f);
+    d.ADDRESS_BITS_PER_WORD = 5;
+    d.BITS_PER_WORD = 1 << d.ADDRESS_BITS_PER_WORD;
+    d.BIT_INDEX_MASK = d.BITS_PER_WORD - 1;
+    var q = function() {
+      function b(f) {
+        this.size = e(f);
         this.dirty = this.count = 0;
         this.length = f;
-        this.bits = new Uint32Array(this.size >> a.ADDRESS_BITS_PER_WORD);
-      }
-      d.prototype.recount = function() {
+        this.bits = new Uint32Array(this.size >> d.ADDRESS_BITS_PER_WORD);
+      }
+      b.prototype.recount = function() {
         if (this.dirty) {
-          for (var d = this.bits, a = 0, f = 0, q = d.length;f < q;f++) {
-            var h = d[f], h = h - (h >> 1 & 1431655765), h = (h & 858993459) + (h >> 2 & 858993459), a = a + (16843009 * (h + (h >> 4) & 252645135) >> 24)
-          }
-          this.count = a;
+          for (var b = this.bits, f = 0, q = 0, e = b.length;q < e;q++) {
+            var d = b[q], d = d - (d >> 1 & 1431655765), d = (d & 858993459) + (d >> 2 & 858993459), f = f + (16843009 * (d + (d >> 4) & 252645135) >> 24)
+          }
+          this.count = f;
           this.dirty = 0;
         }
       };
-      d.prototype.set = function(d) {
-        var f = d >> a.ADDRESS_BITS_PER_WORD, q = this.bits[f];
-        d = q | 1 << (d & a.BIT_INDEX_MASK);
-        this.bits[f] = d;
-        this.dirty |= q ^ d;
-      };
-      d.prototype.setAll = function() {
-        for (var d = this.bits, a = 0, f = d.length;a < f;a++) {
-          d[a] = 4294967295;
+      b.prototype.set = function(b) {
+        var f = b >> d.ADDRESS_BITS_PER_WORD, q = this.bits[f];
+        b = q | 1 << (b & d.BIT_INDEX_MASK);
+        this.bits[f] = b;
+        this.dirty |= q ^ b;
+      };
+      b.prototype.setAll = function() {
+        for (var b = this.bits, f = 0, q = b.length;f < q;f++) {
+          b[f] = 4294967295;
         }
         this.count = this.size;
         this.dirty = 0;
       };
-      d.prototype.assign = function(d) {
-        this.count = d.count;
-        this.dirty = d.dirty;
-        this.size = d.size;
-        for (var a = 0, f = this.bits.length;a < f;a++) {
-          this.bits[a] = d.bits[a];
-        }
-      };
-      d.prototype.clear = function(d) {
-        var f = d >> a.ADDRESS_BITS_PER_WORD, q = this.bits[f];
-        d = q & ~(1 << (d & a.BIT_INDEX_MASK));
-        this.bits[f] = d;
-        this.dirty |= q ^ d;
-      };
-      d.prototype.get = function(d) {
-        return 0 !== (this.bits[d >> a.ADDRESS_BITS_PER_WORD] & 1 << (d & a.BIT_INDEX_MASK));
-      };
-      d.prototype.clearAll = function() {
-        for (var d = this.bits, a = 0, f = d.length;a < f;a++) {
-          d[a] = 0;
+      b.prototype.assign = function(b) {
+        this.count = b.count;
+        this.dirty = b.dirty;
+        this.size = b.size;
+        for (var f = 0, q = this.bits.length;f < q;f++) {
+          this.bits[f] = b.bits[f];
+        }
+      };
+      b.prototype.clear = function(b) {
+        var f = b >> d.ADDRESS_BITS_PER_WORD, q = this.bits[f];
+        b = q & ~(1 << (b & d.BIT_INDEX_MASK));
+        this.bits[f] = b;
+        this.dirty |= q ^ b;
+      };
+      b.prototype.get = function(b) {
+        return 0 !== (this.bits[b >> d.ADDRESS_BITS_PER_WORD] & 1 << (b & d.BIT_INDEX_MASK));
+      };
+      b.prototype.clearAll = function() {
+        for (var b = this.bits, f = 0, q = b.length;f < q;f++) {
+          b[f] = 0;
         }
         this.dirty = this.count = 0;
       };
-      d.prototype._union = function(d) {
-        var a = this.dirty, f = this.bits;
-        d = d.bits;
-        for (var q = 0, h = f.length;q < h;q++) {
-          var b = f[q], x = b | d[q];
-          f[q] = x;
-          a |= b ^ x;
-        }
-        this.dirty = a;
-      };
-      d.prototype.intersect = function(d) {
-        var a = this.dirty, f = this.bits;
-        d = d.bits;
-        for (var q = 0, h = f.length;q < h;q++) {
-          var b = f[q], x = b & d[q];
-          f[q] = x;
-          a |= b ^ x;
-        }
-        this.dirty = a;
-      };
-      d.prototype.subtract = function(d) {
-        var a = this.dirty, f = this.bits;
-        d = d.bits;
-        for (var q = 0, h = f.length;q < h;q++) {
-          var b = f[q], x = b & ~d[q];
-          f[q] = x;
-          a |= b ^ x;
-        }
-        this.dirty = a;
-      };
-      d.prototype.negate = function() {
-        for (var d = this.dirty, a = this.bits, f = 0, q = a.length;f < q;f++) {
-          var h = a[f], b = ~h;
-          a[f] = b;
-          d |= h ^ b;
-        }
-        this.dirty = d;
-      };
-      d.prototype.forEach = function(d) {
-        q(d);
-        for (var f = this.bits, h = 0, b = f.length;h < b;h++) {
-          var x = f[h];
-          if (x) {
-            for (var s = 0;s < a.BITS_PER_WORD;s++) {
-              x & 1 << s && d(h * a.BITS_PER_WORD + s);
-            }
-          }
-        }
-      };
-      d.prototype.toArray = function() {
-        for (var d = [], f = this.bits, q = 0, h = f.length;q < h;q++) {
-          var b = f[q];
-          if (b) {
-            for (var x = 0;x < a.BITS_PER_WORD;x++) {
-              b & 1 << x && d.push(q * a.BITS_PER_WORD + x);
-            }
-          }
-        }
-        return d;
-      };
-      d.prototype.equals = function(d) {
-        if (this.size !== d.size) {
+      b.prototype._union = function(b) {
+        var f = this.dirty, q = this.bits;
+        b = b.bits;
+        for (var e = 0, d = q.length;e < d;e++) {
+          var a = q[e], w = a | b[e];
+          q[e] = w;
+          f |= a ^ w;
+        }
+        this.dirty = f;
+      };
+      b.prototype.intersect = function(b) {
+        var f = this.dirty, q = this.bits;
+        b = b.bits;
+        for (var e = 0, d = q.length;e < d;e++) {
+          var a = q[e], w = a & b[e];
+          q[e] = w;
+          f |= a ^ w;
+        }
+        this.dirty = f;
+      };
+      b.prototype.subtract = function(b) {
+        var f = this.dirty, q = this.bits;
+        b = b.bits;
+        for (var e = 0, d = q.length;e < d;e++) {
+          var a = q[e], w = a & ~b[e];
+          q[e] = w;
+          f |= a ^ w;
+        }
+        this.dirty = f;
+      };
+      b.prototype.negate = function() {
+        for (var b = this.dirty, f = this.bits, q = 0, e = f.length;q < e;q++) {
+          var d = f[q], a = ~d;
+          f[q] = a;
+          b |= d ^ a;
+        }
+        this.dirty = b;
+      };
+      b.prototype.forEach = function(b) {
+        for (var f = this.bits, q = 0, e = f.length;q < e;q++) {
+          var a = f[q];
+          if (a) {
+            for (var w = 0;w < d.BITS_PER_WORD;w++) {
+              a & 1 << w && b(q * d.BITS_PER_WORD + w);
+            }
+          }
+        }
+      };
+      b.prototype.toArray = function() {
+        for (var b = [], f = this.bits, q = 0, e = f.length;q < e;q++) {
+          var a = f[q];
+          if (a) {
+            for (var w = 0;w < d.BITS_PER_WORD;w++) {
+              a & 1 << w && b.push(q * d.BITS_PER_WORD + w);
+            }
+          }
+        }
+        return b;
+      };
+      b.prototype.equals = function(b) {
+        if (this.size !== b.size) {
           return!1;
         }
-        var a = this.bits;
-        d = d.bits;
-        for (var f = 0, q = a.length;f < q;f++) {
-          if (a[f] !== d[f]) {
+        var f = this.bits;
+        b = b.bits;
+        for (var q = 0, e = f.length;q < e;q++) {
+          if (f[q] !== b[q]) {
             return!1;
           }
         }
         return!0;
       };
-      d.prototype.contains = function(d) {
-        if (this.size !== d.size) {
+      b.prototype.contains = function(b) {
+        if (this.size !== b.size) {
           return!1;
         }
-        var a = this.bits;
-        d = d.bits;
-        for (var f = 0, q = a.length;f < q;f++) {
-          if ((a[f] | d[f]) !== a[f]) {
+        var f = this.bits;
+        b = b.bits;
+        for (var q = 0, e = f.length;q < e;q++) {
+          if ((f[q] | b[q]) !== f[q]) {
             return!1;
           }
         }
         return!0;
       };
-      d.prototype.isEmpty = function() {
+      b.prototype.isEmpty = function() {
         this.recount();
         return 0 === this.count;
       };
-      d.prototype.clone = function() {
-        var a = new d(this.length);
-        a._union(this);
-        return a;
-      };
-      return d;
+      b.prototype.clone = function() {
+        var f = new b(this.length);
+        f._union(this);
+        return f;
+      };
+      return b;
     }();
-    a.Uint32ArrayBitSet = b;
-    var s = function() {
-      function d(a) {
+    d.Uint32ArrayBitSet = q;
+    var a = function() {
+      function b(f) {
         this.dirty = this.count = 0;
-        this.size = h(a);
+        this.size = e(f);
         this.bits = 0;
         this.singleWord = !0;
-        this.length = a;
-      }
-      d.prototype.recount = function() {
+        this.length = f;
+      }
+      b.prototype.recount = function() {
         if (this.dirty) {
-          var d = this.bits, d = d - (d >> 1 & 1431655765), d = (d & 858993459) + (d >> 2 & 858993459);
-          this.count = 0 + (16843009 * (d + (d >> 4) & 252645135) >> 24);
+          var b = this.bits, b = b - (b >> 1 & 1431655765), b = (b & 858993459) + (b >> 2 & 858993459);
+          this.count = 0 + (16843009 * (b + (b >> 4) & 252645135) >> 24);
           this.dirty = 0;
         }
       };
-      d.prototype.set = function(d) {
+      b.prototype.set = function(b) {
         var f = this.bits;
-        this.bits = d = f | 1 << (d & a.BIT_INDEX_MASK);
-        this.dirty |= f ^ d;
-      };
-      d.prototype.setAll = function() {
+        this.bits = b = f | 1 << (b & d.BIT_INDEX_MASK);
+        this.dirty |= f ^ b;
+      };
+      b.prototype.setAll = function() {
         this.bits = 4294967295;
         this.count = this.size;
         this.dirty = 0;
       };
-      d.prototype.assign = function(d) {
-        this.count = d.count;
-        this.dirty = d.dirty;
-        this.size = d.size;
-        this.bits = d.bits;
-      };
-      d.prototype.clear = function(d) {
+      b.prototype.assign = function(b) {
+        this.count = b.count;
+        this.dirty = b.dirty;
+        this.size = b.size;
+        this.bits = b.bits;
+      };
+      b.prototype.clear = function(b) {
         var f = this.bits;
-        this.bits = d = f & ~(1 << (d & a.BIT_INDEX_MASK));
-        this.dirty |= f ^ d;
-      };
-      d.prototype.get = function(d) {
-        return 0 !== (this.bits & 1 << (d & a.BIT_INDEX_MASK));
-      };
-      d.prototype.clearAll = function() {
+        this.bits = b = f & ~(1 << (b & d.BIT_INDEX_MASK));
+        this.dirty |= f ^ b;
+      };
+      b.prototype.get = function(b) {
+        return 0 !== (this.bits & 1 << (b & d.BIT_INDEX_MASK));
+      };
+      b.prototype.clearAll = function() {
         this.dirty = this.count = this.bits = 0;
       };
-      d.prototype._union = function(d) {
-        var a = this.bits;
-        this.bits = d = a | d.bits;
-        this.dirty = a ^ d;
-      };
-      d.prototype.intersect = function(d) {
-        var a = this.bits;
-        this.bits = d = a & d.bits;
-        this.dirty = a ^ d;
-      };
-      d.prototype.subtract = function(d) {
-        var a = this.bits;
-        this.bits = d = a & ~d.bits;
-        this.dirty = a ^ d;
-      };
-      d.prototype.negate = function() {
-        var d = this.bits, a = ~d;
-        this.bits = a;
-        this.dirty = d ^ a;
-      };
-      d.prototype.forEach = function(d) {
-        q(d);
+      b.prototype._union = function(b) {
+        var f = this.bits;
+        this.bits = b = f | b.bits;
+        this.dirty = f ^ b;
+      };
+      b.prototype.intersect = function(b) {
+        var f = this.bits;
+        this.bits = b = f & b.bits;
+        this.dirty = f ^ b;
+      };
+      b.prototype.subtract = function(b) {
+        var f = this.bits;
+        this.bits = b = f & ~b.bits;
+        this.dirty = f ^ b;
+      };
+      b.prototype.negate = function() {
+        var b = this.bits, f = ~b;
+        this.bits = f;
+        this.dirty = b ^ f;
+      };
+      b.prototype.forEach = function(b) {
         var f = this.bits;
         if (f) {
-          for (var h = 0;h < a.BITS_PER_WORD;h++) {
-            f & 1 << h && d(h);
-          }
-        }
-      };
-      d.prototype.toArray = function() {
-        var d = [], f = this.bits;
+          for (var q = 0;q < d.BITS_PER_WORD;q++) {
+            f & 1 << q && b(q);
+          }
+        }
+      };
+      b.prototype.toArray = function() {
+        var b = [], f = this.bits;
         if (f) {
-          for (var q = 0;q < a.BITS_PER_WORD;q++) {
-            f & 1 << q && d.push(q);
-          }
-        }
-        return d;
-      };
-      d.prototype.equals = function(d) {
-        return this.bits === d.bits;
-      };
-      d.prototype.contains = function(d) {
-        var a = this.bits;
-        return(a | d.bits) === a;
-      };
-      d.prototype.isEmpty = function() {
+          for (var q = 0;q < d.BITS_PER_WORD;q++) {
+            f & 1 << q && b.push(q);
+          }
+        }
+        return b;
+      };
+      b.prototype.equals = function(b) {
+        return this.bits === b.bits;
+      };
+      b.prototype.contains = function(b) {
+        var f = this.bits;
+        return(f | b.bits) === f;
+      };
+      b.prototype.isEmpty = function() {
         this.recount();
         return 0 === this.count;
       };
-      d.prototype.clone = function() {
-        var a = new d(this.length);
-        a._union(this);
-        return a;
-      };
-      return d;
+      b.prototype.clone = function() {
+        var f = new b(this.length);
+        f._union(this);
+        return f;
+      };
+      return b;
     }();
-    a.Uint32BitSet = s;
-    s.prototype.toString = d;
-    s.prototype.toBitString = f;
-    b.prototype.toString = d;
-    b.prototype.toBitString = f;
-    a.BitSetFunctor = function(d) {
-      var f = 1 === h(d) >> a.ADDRESS_BITS_PER_WORD ? s : b;
+    d.Uint32BitSet = a;
+    a.prototype.toString = f;
+    a.prototype.toBitString = b;
+    q.prototype.toString = f;
+    q.prototype.toBitString = b;
+    d.BitSetFunctor = function(b) {
+      var f = 1 === e(b) >> d.ADDRESS_BITS_PER_WORD ? a : q;
       return function() {
-        return new f(d);
-      };
-    };
-  })(g.BitSets || (g.BitSets = {}));
+        return new f(b);
+      };
+    };
+  })(l.BitSets || (l.BitSets = {}));
   a = function() {
-    function a() {
+    function d() {
     }
-    a.randomStyle = function() {
-      a._randomStyleCache || (a._randomStyleCache = "#ff5e3a #ff9500 #ffdb4c #87fc70 #52edc7 #1ad6fd #c644fc #ef4db6 #4a4a4a #dbddde #ff3b30 #ff9500 #ffcc00 #4cd964 #34aadc #007aff #5856d6 #ff2d55 #8e8e93 #c7c7cc #5ad427 #c86edf #d1eefc #e0f8d8 #fb2b69 #f7f7f7 #1d77ef #d6cec3 #55efcb #ff4981 #ffd3e0 #f7f7f7 #ff1300 #1f1f21 #bdbec2 #ff3a2d".split(" "));
-      return a._randomStyleCache[a._nextStyle++ % a._randomStyleCache.length];
-    };
-    a.gradientColor = function(h) {
-      return a._gradient[a._gradient.length * y.clamp(h, 0, 1) | 0];
-    };
-    a.contrastStyle = function(a) {
-      a = parseInt(a.substr(1), 16);
-      return 128 <= (299 * (a >> 16) + 587 * (a >> 8 & 255) + 114 * (a & 255)) / 1E3 ? "#000000" : "#ffffff";
-    };
-    a.reset = function() {
-      a._nextStyle = 0;
-    };
-    a.TabToolbar = "#252c33";
-    a.Toolbars = "#343c45";
-    a.HighlightBlue = "#1d4f73";
-    a.LightText = "#f5f7fa";
-    a.ForegroundText = "#b6babf";
-    a.Black = "#000000";
-    a.VeryDark = "#14171a";
-    a.Dark = "#181d20";
-    a.Light = "#a9bacb";
-    a.Grey = "#8fa1b2";
-    a.DarkGrey = "#5f7387";
-    a.Blue = "#46afe3";
-    a.Purple = "#6b7abb";
-    a.Pink = "#df80ff";
-    a.Red = "#eb5368";
-    a.Orange = "#d96629";
-    a.LightOrange = "#d99b28";
-    a.Green = "#70bf53";
-    a.BlueGrey = "#5e88b0";
-    a._nextStyle = 0;
-    a._gradient = "#FF0000 #FF1100 #FF2300 #FF3400 #FF4600 #FF5700 #FF6900 #FF7B00 #FF8C00 #FF9E00 #FFAF00 #FFC100 #FFD300 #FFE400 #FFF600 #F7FF00 #E5FF00 #D4FF00 #C2FF00 #B0FF00 #9FFF00 #8DFF00 #7CFF00 #6AFF00 #58FF00 #47FF00 #35FF00 #24FF00 #12FF00 #00FF00".split(" ");
-    return a;
+    d.randomStyle = function() {
+      d._randomStyleCache || (d._randomStyleCache = "#ff5e3a #ff9500 #ffdb4c #87fc70 #52edc7 #1ad6fd #c644fc #ef4db6 #4a4a4a #dbddde #ff3b30 #ff9500 #ffcc00 #4cd964 #34aadc #007aff #5856d6 #ff2d55 #8e8e93 #c7c7cc #5ad427 #c86edf #d1eefc #e0f8d8 #fb2b69 #f7f7f7 #1d77ef #d6cec3 #55efcb #ff4981 #ffd3e0 #f7f7f7 #ff1300 #1f1f21 #bdbec2 #ff3a2d".split(" "));
+      return d._randomStyleCache[d._nextStyle++ % d._randomStyleCache.length];
+    };
+    d.gradientColor = function(e) {
+      return d._gradient[d._gradient.length * k.clamp(e, 0, 1) | 0];
+    };
+    d.contrastStyle = function(e) {
+      e = parseInt(e.substr(1), 16);
+      return 128 <= (299 * (e >> 16) + 587 * (e >> 8 & 255) + 114 * (e & 255)) / 1E3 ? "#000000" : "#ffffff";
+    };
+    d.reset = function() {
+      d._nextStyle = 0;
+    };
+    d.TabToolbar = "#252c33";
+    d.Toolbars = "#343c45";
+    d.HighlightBlue = "#1d4f73";
+    d.LightText = "#f5f7fa";
+    d.ForegroundText = "#b6babf";
+    d.Black = "#000000";
+    d.VeryDark = "#14171a";
+    d.Dark = "#181d20";
+    d.Light = "#a9bacb";
+    d.Grey = "#8fa1b2";
+    d.DarkGrey = "#5f7387";
+    d.Blue = "#46afe3";
+    d.Purple = "#6b7abb";
+    d.Pink = "#df80ff";
+    d.Red = "#eb5368";
+    d.Orange = "#d96629";
+    d.LightOrange = "#d99b28";
+    d.Green = "#70bf53";
+    d.BlueGrey = "#5e88b0";
+    d._nextStyle = 0;
+    d._gradient = "#FF0000 #FF1100 #FF2300 #FF3400 #FF4600 #FF5700 #FF6900 #FF7B00 #FF8C00 #FF9E00 #FFAF00 #FFC100 #FFD300 #FFE400 #FFF600 #F7FF00 #E5FF00 #D4FF00 #C2FF00 #B0FF00 #9FFF00 #8DFF00 #7CFF00 #6AFF00 #58FF00 #47FF00 #35FF00 #24FF00 #12FF00 #00FF00".split(" ");
+    return d;
   }();
-  g.ColorStyle = a;
+  l.ColorStyle = a;
   a = function() {
-    function a(h, f, d, q) {
-      this.xMin = h | 0;
-      this.yMin = f | 0;
-      this.xMax = d | 0;
+    function d(e, b, f, q) {
+      this.xMin = e | 0;
+      this.yMin = b | 0;
+      this.xMax = f | 0;
       this.yMax = q | 0;
     }
-    a.FromUntyped = function(h) {
-      return new a(h.xMin, h.yMin, h.xMax, h.yMax);
-    };
-    a.FromRectangle = function(h) {
-      return new a(20 * h.x | 0, 20 * h.y | 0, 20 * (h.x + h.width) | 0, 20 * (h.y + h.height) | 0);
-    };
-    a.prototype.setElements = function(a, f, d, q) {
-      this.xMin = a;
-      this.yMin = f;
-      this.xMax = d;
+    d.FromUntyped = function(e) {
+      return new d(e.xMin, e.yMin, e.xMax, e.yMax);
+    };
+    d.FromRectangle = function(e) {
+      return new d(20 * e.x | 0, 20 * e.y | 0, 20 * (e.x + e.width) | 0, 20 * (e.y + e.height) | 0);
+    };
+    d.prototype.setElements = function(e, b, f, q) {
+      this.xMin = e;
+      this.yMin = b;
+      this.xMax = f;
       this.yMax = q;
     };
-    a.prototype.copyFrom = function(a) {
-      this.setElements(a.xMin, a.yMin, a.xMax, a.yMax);
-    };
-    a.prototype.contains = function(a, f) {
-      return a < this.xMin !== a < this.xMax && f < this.yMin !== f < this.yMax;
-    };
-    a.prototype.unionInPlace = function(a) {
-      a.isEmpty() || (this.extendByPoint(a.xMin, a.yMin), this.extendByPoint(a.xMax, a.yMax));
-    };
-    a.prototype.extendByPoint = function(a, f) {
-      this.extendByX(a);
-      this.extendByY(f);
-    };
-    a.prototype.extendByX = function(a) {
-      134217728 === this.xMin ? this.xMin = this.xMax = a : (this.xMin = Math.min(this.xMin, a), this.xMax = Math.max(this.xMax, a));
-    };
-    a.prototype.extendByY = function(a) {
-      134217728 === this.yMin ? this.yMin = this.yMax = a : (this.yMin = Math.min(this.yMin, a), this.yMax = Math.max(this.yMax, a));
-    };
-    a.prototype.intersects = function(a) {
-      return this.contains(a.xMin, a.yMin) || this.contains(a.xMax, a.yMax);
-    };
-    a.prototype.isEmpty = function() {
+    d.prototype.copyFrom = function(e) {
+      this.setElements(e.xMin, e.yMin, e.xMax, e.yMax);
+    };
+    d.prototype.contains = function(e, b) {
+      return e < this.xMin !== e < this.xMax && b < this.yMin !== b < this.yMax;
+    };
+    d.prototype.unionInPlace = function(e) {
+      e.isEmpty() || (this.extendByPoint(e.xMin, e.yMin), this.extendByPoint(e.xMax, e.yMax));
+    };
+    d.prototype.extendByPoint = function(e, b) {
+      this.extendByX(e);
+      this.extendByY(b);
+    };
+    d.prototype.extendByX = function(e) {
+      134217728 === this.xMin ? this.xMin = this.xMax = e : (this.xMin = Math.min(this.xMin, e), this.xMax = Math.max(this.xMax, e));
+    };
+    d.prototype.extendByY = function(e) {
+      134217728 === this.yMin ? this.yMin = this.yMax = e : (this.yMin = Math.min(this.yMin, e), this.yMax = Math.max(this.yMax, e));
+    };
+    d.prototype.intersects = function(e) {
+      return this.contains(e.xMin, e.yMin) || this.contains(e.xMax, e.yMax);
+    };
+    d.prototype.isEmpty = function() {
       return this.xMax <= this.xMin || this.yMax <= this.yMin;
     };
-    Object.defineProperty(a.prototype, "width", {get:function() {
+    Object.defineProperty(d.prototype, "width", {get:function() {
       return this.xMax - this.xMin;
-    }, set:function(a) {
-      this.xMax = this.xMin + a;
+    }, set:function(e) {
+      this.xMax = this.xMin + e;
     }, enumerable:!0, configurable:!0});
-    Object.defineProperty(a.prototype, "height", {get:function() {
+    Object.defineProperty(d.prototype, "height", {get:function() {
       return this.yMax - this.yMin;
-    }, set:function(a) {
-      this.yMax = this.yMin + a;
+    }, set:function(e) {
+      this.yMax = this.yMin + e;
     }, enumerable:!0, configurable:!0});
-    a.prototype.getBaseWidth = function(a) {
-      return Math.abs(Math.cos(a)) * (this.xMax - this.xMin) + Math.abs(Math.sin(a)) * (this.yMax - this.yMin);
-    };
-    a.prototype.getBaseHeight = function(a) {
-      return Math.abs(Math.sin(a)) * (this.xMax - this.xMin) + Math.abs(Math.cos(a)) * (this.yMax - this.yMin);
-    };
-    a.prototype.setEmpty = function() {
+    d.prototype.getBaseWidth = function(e) {
+      return Math.abs(Math.cos(e)) * (this.xMax - this.xMin) + Math.abs(Math.sin(e)) * (this.yMax - this.yMin);
+    };
+    d.prototype.getBaseHeight = function(e) {
+      return Math.abs(Math.sin(e)) * (this.xMax - this.xMin) + Math.abs(Math.cos(e)) * (this.yMax - this.yMin);
+    };
+    d.prototype.setEmpty = function() {
       this.xMin = this.yMin = this.xMax = this.yMax = 0;
     };
-    a.prototype.setToSentinels = function() {
+    d.prototype.setToSentinels = function() {
       this.xMin = this.yMin = this.xMax = this.yMax = 134217728;
     };
-    a.prototype.clone = function() {
-      return new a(this.xMin, this.yMin, this.xMax, this.yMax);
-    };
-    a.prototype.toString = function() {
+    d.prototype.clone = function() {
+      return new d(this.xMin, this.yMin, this.xMax, this.yMax);
+    };
+    d.prototype.toString = function() {
       return "{ xMin: " + this.xMin + ", xMin: " + this.yMin + ", xMax: " + this.xMax + ", xMax: " + this.yMax + " }";
     };
-    return a;
+    return d;
   }();
-  g.Bounds = a;
+  l.Bounds = a;
   a = function() {
-    function a(h, f, d, q) {
-      k.assert(m(h));
-      k.assert(m(f));
-      k.assert(m(d));
-      k.assert(m(q));
-      this._xMin = h | 0;
-      this._yMin = f | 0;
-      this._xMax = d | 0;
+    function d(e, b, f, q) {
+      m.assert(r(e));
+      m.assert(r(b));
+      m.assert(r(f));
+      m.assert(r(q));
+      this._xMin = e | 0;
+      this._yMin = b | 0;
+      this._xMax = f | 0;
       this._yMax = q | 0;
     }
-    a.FromUntyped = function(h) {
-      return new a(h.xMin, h.yMin, h.xMax, h.yMax);
-    };
-    a.FromRectangle = function(h) {
-      return new a(20 * h.x | 0, 20 * h.y | 0, 20 * (h.x + h.width) | 0, 20 * (h.y + h.height) | 0);
-    };
-    a.prototype.setElements = function(a, f, d, q) {
-      this.xMin = a;
-      this.yMin = f;
-      this.xMax = d;
+    d.FromUntyped = function(e) {
+      return new d(e.xMin, e.yMin, e.xMax, e.yMax);
+    };
+    d.FromRectangle = function(e) {
+      return new d(20 * e.x | 0, 20 * e.y | 0, 20 * (e.x + e.width) | 0, 20 * (e.y + e.height) | 0);
+    };
+    d.prototype.setElements = function(e, b, f, q) {
+      this.xMin = e;
+      this.yMin = b;
+      this.xMax = f;
       this.yMax = q;
     };
-    a.prototype.copyFrom = function(a) {
-      this.setElements(a.xMin, a.yMin, a.xMax, a.yMax);
-    };
-    a.prototype.contains = function(a, f) {
-      return a < this.xMin !== a < this.xMax && f < this.yMin !== f < this.yMax;
-    };
-    a.prototype.unionInPlace = function(a) {
-      a.isEmpty() || (this.extendByPoint(a.xMin, a.yMin), this.extendByPoint(a.xMax, a.yMax));
-    };
-    a.prototype.extendByPoint = function(a, f) {
-      this.extendByX(a);
-      this.extendByY(f);
-    };
-    a.prototype.extendByX = function(a) {
-      134217728 === this.xMin ? this.xMin = this.xMax = a : (this.xMin = Math.min(this.xMin, a), this.xMax = Math.max(this.xMax, a));
-    };
-    a.prototype.extendByY = function(a) {
-      134217728 === this.yMin ? this.yMin = this.yMax = a : (this.yMin = Math.min(this.yMin, a), this.yMax = Math.max(this.yMax, a));
-    };
-    a.prototype.intersects = function(a) {
-      return this.contains(a._xMin, a._yMin) || this.contains(a._xMax, a._yMax);
-    };
-    a.prototype.isEmpty = function() {
+    d.prototype.copyFrom = function(e) {
+      this.setElements(e.xMin, e.yMin, e.xMax, e.yMax);
+    };
+    d.prototype.contains = function(e, b) {
+      return e < this.xMin !== e < this.xMax && b < this.yMin !== b < this.yMax;
+    };
+    d.prototype.unionInPlace = function(e) {
+      e.isEmpty() || (this.extendByPoint(e.xMin, e.yMin), this.extendByPoint(e.xMax, e.yMax));
+    };
+    d.prototype.extendByPoint = function(e, b) {
+      this.extendByX(e);
+      this.extendByY(b);
+    };
+    d.prototype.extendByX = function(e) {
+      134217728 === this.xMin ? this.xMin = this.xMax = e : (this.xMin = Math.min(this.xMin, e), this.xMax = Math.max(this.xMax, e));
+    };
+    d.prototype.extendByY = function(e) {
+      134217728 === this.yMin ? this.yMin = this.yMax = e : (this.yMin = Math.min(this.yMin, e), this.yMax = Math.max(this.yMax, e));
+    };
+    d.prototype.intersects = function(e) {
+      return this.contains(e._xMin, e._yMin) || this.contains(e._xMax, e._yMax);
+    };
+    d.prototype.isEmpty = function() {
       return this._xMax <= this._xMin || this._yMax <= this._yMin;
     };
-    Object.defineProperty(a.prototype, "xMin", {get:function() {
+    Object.defineProperty(d.prototype, "xMin", {get:function() {
       return this._xMin;
-    }, set:function(a) {
-      k.assert(m(a));
-      this._xMin = a;
+    }, set:function(e) {
+      m.assert(r(e));
+      this._xMin = e;
     }, enumerable:!0, configurable:!0});
-    Object.defineProperty(a.prototype, "yMin", {get:function() {
+    Object.defineProperty(d.prototype, "yMin", {get:function() {
       return this._yMin;
-    }, set:function(a) {
-      k.assert(m(a));
-      this._yMin = a | 0;
+    }, set:function(e) {
+      m.assert(r(e));
+      this._yMin = e | 0;
     }, enumerable:!0, configurable:!0});
-    Object.defineProperty(a.prototype, "xMax", {get:function() {
+    Object.defineProperty(d.prototype, "xMax", {get:function() {
       return this._xMax;
-    }, set:function(a) {
-      k.assert(m(a));
-      this._xMax = a | 0;
+    }, set:function(e) {
+      m.assert(r(e));
+      this._xMax = e | 0;
     }, enumerable:!0, configurable:!0});
-    Object.defineProperty(a.prototype, "width", {get:function() {
+    Object.defineProperty(d.prototype, "width", {get:function() {
       return this._xMax - this._xMin;
     }, enumerable:!0, configurable:!0});
-    Object.defineProperty(a.prototype, "yMax", {get:function() {
+    Object.defineProperty(d.prototype, "yMax", {get:function() {
       return this._yMax;
-    }, set:function(a) {
-      k.assert(m(a));
-      this._yMax = a | 0;
+    }, set:function(e) {
+      m.assert(r(e));
+      this._yMax = e | 0;
     }, enumerable:!0, configurable:!0});
-    Object.defineProperty(a.prototype, "height", {get:function() {
+    Object.defineProperty(d.prototype, "height", {get:function() {
       return this._yMax - this._yMin;
     }, enumerable:!0, configurable:!0});
-    a.prototype.getBaseWidth = function(a) {
-      return Math.abs(Math.cos(a)) * (this._xMax - this._xMin) + Math.abs(Math.sin(a)) * (this._yMax - this._yMin);
-    };
-    a.prototype.getBaseHeight = function(a) {
-      return Math.abs(Math.sin(a)) * (this._xMax - this._xMin) + Math.abs(Math.cos(a)) * (this._yMax - this._yMin);
-    };
-    a.prototype.setEmpty = function() {
+    d.prototype.getBaseWidth = function(e) {
+      return Math.abs(Math.cos(e)) * (this._xMax - this._xMin) + Math.abs(Math.sin(e)) * (this._yMax - this._yMin);
+    };
+    d.prototype.getBaseHeight = function(e) {
+      return Math.abs(Math.sin(e)) * (this._xMax - this._xMin) + Math.abs(Math.cos(e)) * (this._yMax - this._yMin);
+    };
+    d.prototype.setEmpty = function() {
       this._xMin = this._yMin = this._xMax = this._yMax = 0;
     };
-    a.prototype.clone = function() {
-      return new a(this.xMin, this.yMin, this.xMax, this.yMax);
-    };
-    a.prototype.toString = function() {
+    d.prototype.clone = function() {
+      return new d(this.xMin, this.yMin, this.xMax, this.yMax);
+    };
+    d.prototype.toString = function() {
       return "{ xMin: " + this._xMin + ", xMin: " + this._yMin + ", xMax: " + this._xMax + ", yMax: " + this._yMax + " }";
     };
-    a.prototype.assertValid = function() {
-    };
-    return a;
+    d.prototype.assertValid = function() {
+    };
+    return d;
   }();
-  g.DebugBounds = a;
+  l.DebugBounds = a;
   a = function() {
-    function a(h, f, d, q) {
-      this.r = h;
-      this.g = f;
-      this.b = d;
+    function d(e, b, f, q) {
+      this.r = e;
+      this.g = b;
+      this.b = f;
       this.a = q;
     }
-    a.FromARGB = function(h) {
-      return new a((h >> 16 & 255) / 255, (h >> 8 & 255) / 255, (h >> 0 & 255) / 255, (h >> 24 & 255) / 255);
-    };
-    a.FromRGBA = function(h) {
-      return a.FromARGB(t.RGBAToARGB(h));
-    };
-    a.prototype.toRGBA = function() {
+    d.FromARGB = function(e) {
+      return new d((e >> 16 & 255) / 255, (e >> 8 & 255) / 255, (e >> 0 & 255) / 255, (e >> 24 & 255) / 255);
+    };
+    d.FromRGBA = function(e) {
+      return d.FromARGB(s.RGBAToARGB(e));
+    };
+    d.prototype.toRGBA = function() {
       return 255 * this.r << 24 | 255 * this.g << 16 | 255 * this.b << 8 | 255 * this.a;
     };
-    a.prototype.toCSSStyle = function() {
-      return t.rgbaToCSSStyle(this.toRGBA());
-    };
-    a.prototype.set = function(a) {
-      this.r = a.r;
-      this.g = a.g;
-      this.b = a.b;
-      this.a = a.a;
-    };
-    a.randomColor = function() {
-      var h = .4;
-      void 0 === h && (h = 1);
-      return new a(Math.random(), Math.random(), Math.random(), h);
-    };
-    a.parseColor = function(h) {
-      a.colorCache || (a.colorCache = Object.create(null));
-      if (a.colorCache[h]) {
-        return a.colorCache[h];
-      }
-      var f = document.createElement("span");
-      document.body.appendChild(f);
-      f.style.backgroundColor = h;
-      var d = getComputedStyle(f).backgroundColor;
-      document.body.removeChild(f);
-      (f = /^rgb\((\d+), (\d+), (\d+)\)$/.exec(d)) || (f = /^rgba\((\d+), (\d+), (\d+), ([\d.]+)\)$/.exec(d));
-      d = new a(0, 0, 0, 0);
-      d.r = parseFloat(f[1]) / 255;
-      d.g = parseFloat(f[2]) / 255;
-      d.b = parseFloat(f[3]) / 255;
-      d.a = f[4] ? parseFloat(f[4]) / 255 : 1;
-      return a.colorCache[h] = d;
-    };
-    a.Red = new a(1, 0, 0, 1);
-    a.Green = new a(0, 1, 0, 1);
-    a.Blue = new a(0, 0, 1, 1);
-    a.None = new a(0, 0, 0, 0);
-    a.White = new a(1, 1, 1, 1);
-    a.Black = new a(0, 0, 0, 1);
-    a.colorCache = {};
-    return a;
+    d.prototype.toCSSStyle = function() {
+      return s.rgbaToCSSStyle(this.toRGBA());
+    };
+    d.prototype.set = function(e) {
+      this.r = e.r;
+      this.g = e.g;
+      this.b = e.b;
+      this.a = e.a;
+    };
+    d.randomColor = function() {
+      var e = .4;
+      void 0 === e && (e = 1);
+      return new d(Math.random(), Math.random(), Math.random(), e);
+    };
+    d.parseColor = function(e) {
+      d.colorCache || (d.colorCache = Object.create(null));
+      if (d.colorCache[e]) {
+        return d.colorCache[e];
+      }
+      var b = document.createElement("span");
+      document.body.appendChild(b);
+      b.style.backgroundColor = e;
+      var f = getComputedStyle(b).backgroundColor;
+      document.body.removeChild(b);
+      (b = /^rgb\((\d+), (\d+), (\d+)\)$/.exec(f)) || (b = /^rgba\((\d+), (\d+), (\d+), ([\d.]+)\)$/.exec(f));
+      f = new d(0, 0, 0, 0);
+      f.r = parseFloat(b[1]) / 255;
+      f.g = parseFloat(b[2]) / 255;
+      f.b = parseFloat(b[3]) / 255;
+      f.a = b[4] ? parseFloat(b[4]) / 255 : 1;
+      return d.colorCache[e] = f;
+    };
+    d.Red = new d(1, 0, 0, 1);
+    d.Green = new d(0, 1, 0, 1);
+    d.Blue = new d(0, 0, 1, 1);
+    d.None = new d(0, 0, 0, 0);
+    d.White = new d(1, 1, 1, 1);
+    d.Black = new d(0, 0, 0, 1);
+    d.colorCache = {};
+    return d;
   }();
-  g.Color = a;
-  var t;
-  (function(a) {
-    function h(a) {
-      var d, f, h = a >> 24 & 255;
-      f = (Math.imul(a >> 16 & 255, h) + 127) / 255 | 0;
-      d = (Math.imul(a >> 8 & 255, h) + 127) / 255 | 0;
-      a = (Math.imul(a >> 0 & 255, h) + 127) / 255 | 0;
-      return h << 24 | f << 16 | d << 8 | a;
+  l.Color = a;
+  var s;
+  (function(d) {
+    function e(b) {
+      var f, e, d = b >> 24 & 255;
+      e = (Math.imul(b >> 16 & 255, d) + 127) / 255 | 0;
+      f = (Math.imul(b >> 8 & 255, d) + 127) / 255 | 0;
+      b = (Math.imul(b >> 0 & 255, d) + 127) / 255 | 0;
+      return d << 24 | e << 16 | f << 8 | b;
     }
-    a.RGBAToARGB = function(a) {
-      return a >> 8 & 16777215 | (a & 255) << 24;
-    };
-    a.ARGBToRGBA = function(a) {
-      return a << 8 | a >> 24 & 255;
-    };
-    a.rgbaToCSSStyle = function(a) {
-      return g.StringUtilities.concat9("rgba(", a >> 24 & 255, ",", a >> 16 & 255, ",", a >> 8 & 255, ",", (a & 255) / 255, ")");
-    };
-    a.cssStyleToRGBA = function(a) {
-      if ("#" === a[0]) {
-        if (7 === a.length) {
-          return parseInt(a.substring(1), 16) << 8 | 255;
+    d.RGBAToARGB = function(b) {
+      return b >> 8 & 16777215 | (b & 255) << 24;
+    };
+    d.ARGBToRGBA = function(b) {
+      return b << 8 | b >> 24 & 255;
+    };
+    d.rgbaToCSSStyle = function(b) {
+      return l.StringUtilities.concat9("rgba(", b >> 24 & 255, ",", b >> 16 & 255, ",", b >> 8 & 255, ",", (b & 255) / 255, ")");
+    };
+    d.cssStyleToRGBA = function(b) {
+      if ("#" === b[0]) {
+        if (7 === b.length) {
+          return parseInt(b.substring(1), 16) << 8 | 255;
         }
       } else {
-        if ("r" === a[0]) {
-          return a = a.substring(5, a.length - 1).split(","), (parseInt(a[0]) & 255) << 24 | (parseInt(a[1]) & 255) << 16 | (parseInt(a[2]) & 255) << 8 | 255 * parseFloat(a[3]) & 255;
+        if ("r" === b[0]) {
+          return b = b.substring(5, b.length - 1).split(","), (parseInt(b[0]) & 255) << 24 | (parseInt(b[1]) & 255) << 16 | (parseInt(b[2]) & 255) << 8 | 255 * parseFloat(b[3]) & 255;
         }
       }
       return 4278190335;
     };
-    a.hexToRGB = function(a) {
-      return parseInt(a.slice(1), 16);
-    };
-    a.rgbToHex = function(a) {
-      return "#" + ("000000" + (a >>> 0).toString(16)).slice(-6);
-    };
-    a.isValidHexColor = function(a) {
-      return/^#([A-Fa-f0-9]{6}|[A-Fa-f0-9]{3})$/.test(a);
-    };
-    a.clampByte = function(a) {
-      return Math.max(0, Math.min(255, a));
-    };
-    a.unpremultiplyARGB = function(a) {
-      var d, f, h = a >> 24 & 255;
-      f = Math.imul(255, a >> 16 & 255) / h & 255;
-      d = Math.imul(255, a >> 8 & 255) / h & 255;
-      a = Math.imul(255, a >> 0 & 255) / h & 255;
-      return h << 24 | f << 16 | d << 8 | a;
-    };
-    a.premultiplyARGB = h;
-    var f;
-    a.ensureUnpremultiplyTable = function() {
-      if (!f) {
-        f = new Uint8Array(65536);
-        for (var a = 0;256 > a;a++) {
-          for (var d = 0;256 > d;d++) {
-            f[(d << 8) + a] = Math.imul(255, a) / d;
-          }
-        }
-      }
-    };
-    a.tableLookupUnpremultiplyARGB = function(a) {
-      a |= 0;
-      var d = a >> 24 & 255;
-      if (0 === d) {
+    d.hexToRGB = function(b) {
+      return parseInt(b.slice(1), 16);
+    };
+    d.rgbToHex = function(b) {
+      return "#" + ("000000" + (b >>> 0).toString(16)).slice(-6);
+    };
+    d.isValidHexColor = function(b) {
+      return/^#([A-Fa-f0-9]{6}|[A-Fa-f0-9]{3})$/.test(b);
+    };
+    d.clampByte = function(b) {
+      return Math.max(0, Math.min(255, b));
+    };
+    d.unpremultiplyARGB = function(b) {
+      var f, e, d = b >> 24 & 255;
+      e = Math.imul(255, b >> 16 & 255) / d & 255;
+      f = Math.imul(255, b >> 8 & 255) / d & 255;
+      b = Math.imul(255, b >> 0 & 255) / d & 255;
+      return d << 24 | e << 16 | f << 8 | b;
+    };
+    d.premultiplyARGB = e;
+    var b;
+    d.ensureUnpremultiplyTable = function() {
+      if (!b) {
+        b = new Uint8Array(65536);
+        for (var f = 0;256 > f;f++) {
+          for (var e = 0;256 > e;e++) {
+            b[(e << 8) + f] = Math.imul(255, f) / e;
+          }
+        }
+      }
+    };
+    d.tableLookupUnpremultiplyARGB = function(f) {
+      f |= 0;
+      var e = f >> 24 & 255;
+      if (0 === e) {
         return 0;
       }
-      if (255 === d) {
-        return a;
-      }
-      var h, b, n = d << 8, p = f;
-      b = p[n + (a >> 16 & 255)];
-      h = p[n + (a >> 8 & 255)];
-      a = p[n + (a >> 0 & 255)];
-      return d << 24 | b << 16 | h << 8 | a;
-    };
-    a.blendPremultipliedBGRA = function(a, d) {
-      var f, h;
-      h = 256 - (d & 255);
-      f = Math.imul(a & 16711935, h) >> 8;
-      h = Math.imul(a >> 8 & 16711935, h) >> 8;
-      return((d >> 8 & 16711935) + h & 16711935) << 8 | (d & 16711935) + f & 16711935;
-    };
-    var d = v.swap32;
-    a.convertImage = function(a, b, s, n) {
-      s !== n && k.assert(s.buffer !== n.buffer, "Can't handle overlapping views.");
-      var p = s.length;
-      if (a === b) {
-        if (s !== n) {
-          for (a = 0;a < p;a++) {
-            n[a] = s[a];
+      if (255 === e) {
+        return f;
+      }
+      var d, a, h = e << 8, p = b;
+      a = p[h + (f >> 16 & 255)];
+      d = p[h + (f >> 8 & 255)];
+      f = p[h + (f >> 0 & 255)];
+      return e << 24 | a << 16 | d << 8 | f;
+    };
+    d.blendPremultipliedBGRA = function(b, f) {
+      var e, d;
+      d = 256 - (f & 255);
+      e = Math.imul(b & 16711935, d) >> 8;
+      d = Math.imul(b >> 8 & 16711935, d) >> 8;
+      return((f >> 8 & 16711935) + d & 16711935) << 8 | (f & 16711935) + e & 16711935;
+    };
+    var f = u.swap32;
+    d.convertImage = function(q, d, a, h) {
+      var p = a.length;
+      if (q === d) {
+        if (a !== h) {
+          for (q = 0;q < p;q++) {
+            h[q] = a[q];
           }
         }
       } else {
-        if (1 === a && 3 === b) {
-          for (g.ColorUtilities.ensureUnpremultiplyTable(), a = 0;a < p;a++) {
-            var c = s[a];
-            b = c & 255;
-            if (0 === b) {
-              n[a] = 0;
+        if (1 === q && 3 === d) {
+          for (l.ColorUtilities.ensureUnpremultiplyTable(), q = 0;q < p;q++) {
+            var c = a[q];
+            d = c & 255;
+            if (0 === d) {
+              h[q] = 0;
             } else {
-              if (255 === b) {
-                n[a] = 4278190080 | c >> 8 & 16777215;
+              if (255 === d) {
+                h[q] = 4278190080 | c >> 8 & 16777215;
               } else {
-                var u = c >> 24 & 255, l = c >> 16 & 255, c = c >> 8 & 255, y = b << 8, t = f, c = t[y + c], l = t[y + l], u = t[y + u];
-                n[a] = b << 24 | u << 16 | l << 8 | c;
+                var k = c >> 24 & 255, n = c >> 16 & 255, c = c >> 8 & 255, u = d << 8, s = b, c = s[u + c], n = s[u + n], k = s[u + k];
+                h[q] = d << 24 | k << 16 | n << 8 | c;
               }
             }
           }
         } else {
-          if (2 === a && 3 === b) {
-            for (a = 0;a < p;a++) {
-              n[a] = d(s[a]);
+          if (2 === q && 3 === d) {
+            for (q = 0;q < p;q++) {
+              h[q] = f(a[q]);
             }
           } else {
-            if (3 === a && 1 === b) {
-              for (a = 0;a < p;a++) {
-                b = s[a], n[a] = d(h(b & 4278255360 | b >> 16 & 255 | (b & 255) << 16));
+            if (3 === q && 1 === d) {
+              for (q = 0;q < p;q++) {
+                d = a[q], h[q] = f(e(d & 4278255360 | d >> 16 & 255 | (d & 255) << 16));
               }
             } else {
-              for (k.somewhatImplemented("Image Format Conversion: " + r[a] + " -> " + r[b]), a = 0;a < p;a++) {
-                n[a] = s[a];
+              for (m.somewhatImplemented("Image Format Conversion: " + v[q] + " -> " + v[d]), q = 0;q < p;q++) {
+                h[q] = a[q];
               }
             }
           }
         }
       }
     };
-  })(t = g.ColorUtilities || (g.ColorUtilities = {}));
+  })(s = l.ColorUtilities || (l.ColorUtilities = {}));
   a = function() {
-    function a(h) {
-      void 0 === h && (h = 32);
+    function d(e) {
+      void 0 === e && (e = 32);
       this._list = [];
-      this._maxSize = h;
+      this._maxSize = e;
     }
-    a.prototype.acquire = function(h) {
-      if (a._enabled) {
-        for (var f = this._list, d = 0;d < f.length;d++) {
-          var q = f[d];
-          if (q.byteLength >= h) {
-            return f.splice(d, 1), q;
-          }
-        }
-      }
-      return new ArrayBuffer(h);
-    };
-    a.prototype.release = function(h) {
-      if (a._enabled) {
-        var f = this._list;
-        k.assert(0 > b.indexOf(f, h));
-        f.length === this._maxSize && f.shift();
-        f.push(h);
-      }
-    };
-    a.prototype.ensureUint8ArrayLength = function(a, f) {
-      if (a.length >= f) {
-        return a;
-      }
-      var d = Math.max(a.length + f, (3 * a.length >> 1) + 1), d = new Uint8Array(this.acquire(d), 0, d);
-      d.set(a);
-      this.release(a.buffer);
-      return d;
-    };
-    a.prototype.ensureFloat64ArrayLength = function(a, f) {
-      if (a.length >= f) {
-        return a;
-      }
-      var d = Math.max(a.length + f, (3 * a.length >> 1) + 1), d = new Float64Array(this.acquire(d * Float64Array.BYTES_PER_ELEMENT), 0, d);
-      d.set(a);
-      this.release(a.buffer);
-      return d;
-    };
-    a._enabled = !0;
-    return a;
+    d.prototype.acquire = function(e) {
+      if (d._enabled) {
+        for (var b = this._list, f = 0;f < b.length;f++) {
+          var q = b[f];
+          if (q.byteLength >= e) {
+            return b.splice(f, 1), q;
+          }
+        }
+      }
+      return new ArrayBuffer(e);
+    };
+    d.prototype.release = function(e) {
+      if (d._enabled) {
+        var b = this._list;
+        b.length === this._maxSize && b.shift();
+        b.push(e);
+      }
+    };
+    d.prototype.ensureUint8ArrayLength = function(e, b) {
+      if (e.length >= b) {
+        return e;
+      }
+      var f = Math.max(e.length + b, (3 * e.length >> 1) + 1), f = new Uint8Array(this.acquire(f), 0, f);
+      f.set(e);
+      this.release(e.buffer);
+      return f;
+    };
+    d.prototype.ensureFloat64ArrayLength = function(e, b) {
+      if (e.length >= b) {
+        return e;
+      }
+      var f = Math.max(e.length + b, (3 * e.length >> 1) + 1), f = new Float64Array(this.acquire(f * Float64Array.BYTES_PER_ELEMENT), 0, f);
+      f.set(e);
+      this.release(e.buffer);
+      return f;
+    };
+    d._enabled = !0;
+    return d;
   }();
-  g.ArrayBufferPool = a;
-  (function(a) {
-    (function(a) {
-      a[a.EXTERNAL_INTERFACE_FEATURE = 1] = "EXTERNAL_INTERFACE_FEATURE";
-      a[a.CLIPBOARD_FEATURE = 2] = "CLIPBOARD_FEATURE";
-      a[a.SHAREDOBJECT_FEATURE = 3] = "SHAREDOBJECT_FEATURE";
-      a[a.VIDEO_FEATURE = 4] = "VIDEO_FEATURE";
-      a[a.SOUND_FEATURE = 5] = "SOUND_FEATURE";
-      a[a.NETCONNECTION_FEATURE = 6] = "NETCONNECTION_FEATURE";
-    })(a.Feature || (a.Feature = {}));
-    (function(a) {
-      a[a.AVM1_ERROR = 1] = "AVM1_ERROR";
-      a[a.AVM2_ERROR = 2] = "AVM2_ERROR";
-    })(a.ErrorTypes || (a.ErrorTypes = {}));
-    a.instance;
-  })(g.Telemetry || (g.Telemetry = {}));
-  (function(a) {
-    a.instance;
-  })(g.FileLoadingService || (g.FileLoadingService = {}));
-  g.registerCSSFont = function(a, b, f) {
+  l.ArrayBufferPool = a;
+  (function(d) {
+    (function(e) {
+      e[e.EXTERNAL_INTERFACE_FEATURE = 1] = "EXTERNAL_INTERFACE_FEATURE";
+      e[e.CLIPBOARD_FEATURE = 2] = "CLIPBOARD_FEATURE";
+      e[e.SHAREDOBJECT_FEATURE = 3] = "SHAREDOBJECT_FEATURE";
+      e[e.VIDEO_FEATURE = 4] = "VIDEO_FEATURE";
+      e[e.SOUND_FEATURE = 5] = "SOUND_FEATURE";
+      e[e.NETCONNECTION_FEATURE = 6] = "NETCONNECTION_FEATURE";
+    })(d.Feature || (d.Feature = {}));
+    (function(e) {
+      e[e.AVM1_ERROR = 1] = "AVM1_ERROR";
+      e[e.AVM2_ERROR = 2] = "AVM2_ERROR";
+    })(d.ErrorTypes || (d.ErrorTypes = {}));
+    d.instance;
+  })(l.Telemetry || (l.Telemetry = {}));
+  (function(d) {
+    d.instance;
+  })(l.FileLoadingService || (l.FileLoadingService = {}));
+  l.registerCSSFont = function(d, e, b) {
     if (inBrowser) {
-      var d = document.head;
-      d.insertBefore(document.createElement("style"), d.firstChild);
-      d = document.styleSheets[0];
-      b = "@font-face{font-family:swffont" + a + ";src:url(data:font/opentype;base64," + g.StringUtilities.base64ArrayBuffer(b) + ")}";
-      d.insertRule(b, d.cssRules.length);
-      f && (f = document.createElement("div"), f.style.fontFamily = "swffont" + a, f.innerHTML = "hello", document.body.appendChild(f), document.body.removeChild(f));
-    } else {
-      k.warning("Cannot register CSS font outside the browser");
+      var f = document.head;
+      f.insertBefore(document.createElement("style"), f.firstChild);
+      f = document.styleSheets[0];
+      e = "@font-face{font-family:swffont" + d + ";src:url(data:font/opentype;base64," + l.StringUtilities.base64ArrayBuffer(e) + ")}";
+      f.insertRule(e, f.cssRules.length);
+      b && (b = document.createElement("div"), b.style.fontFamily = "swffont" + d, b.innerHTML = "hello", document.body.appendChild(b), document.body.removeChild(b));
     }
   };
-  (function(a) {
-    a.instance = {enabled:!1, initJS:function(a) {
-    }, registerCallback:function(a) {
-    }, unregisterCallback:function(a) {
-    }, eval:function(a) {
-    }, call:function(a) {
+  (function(d) {
+    d.instance = {enabled:!1, initJS:function(e) {
+    }, registerCallback:function(e) {
+    }, unregisterCallback:function(e) {
+    }, eval:function(e) {
+    }, call:function(e) {
     }, getId:function() {
       return null;
     }};
-  })(g.ExternalInterfaceService || (g.ExternalInterfaceService = {}));
+  })(l.ExternalInterfaceService || (l.ExternalInterfaceService = {}));
   a = function() {
-    function a() {
+    function d() {
     }
-    a.prototype.setClipboard = function(a) {
-      k.abstractMethod("public ClipboardService::setClipboard");
-    };
-    a.instance = null;
-    return a;
+    d.prototype.setClipboard = function(e) {
+    };
+    d.instance = null;
+    return d;
   }();
-  g.ClipboardService = a;
+  l.ClipboardService = a;
   a = function() {
-    function a() {
+    function d() {
       this._queues = {};
     }
-    a.prototype.register = function(a, f) {
-      k.assert(a);
-      k.assert(f);
-      var d = this._queues[a];
-      if (d) {
-        if (-1 < d.indexOf(f)) {
+    d.prototype.register = function(e, b) {
+      m.assert(e);
+      m.assert(b);
+      var f = this._queues[e];
+      if (f) {
+        if (-1 < f.indexOf(b)) {
           return;
         }
       } else {
-        d = this._queues[a] = [];
-      }
-      d.push(f);
-    };
-    a.prototype.unregister = function(a, f) {
-      k.assert(a);
-      k.assert(f);
-      var d = this._queues[a];
-      if (d) {
-        var q = d.indexOf(f);
-        -1 !== q && d.splice(q, 1);
-        0 === d.length && (this._queues[a] = null);
-      }
-    };
-    a.prototype.notify = function(a, f) {
-      var d = this._queues[a];
-      if (d) {
-        d = d.slice();
-        f = Array.prototype.slice.call(arguments, 0);
-        for (var q = 0;q < d.length;q++) {
-          d[q].apply(null, f);
-        }
-      }
-    };
-    a.prototype.notify1 = function(a, f) {
-      var d = this._queues[a];
-      if (d) {
-        for (var d = d.slice(), q = 0;q < d.length;q++) {
-          (0,d[q])(a, f);
-        }
-      }
-    };
-    return a;
+        f = this._queues[e] = [];
+      }
+      f.push(b);
+    };
+    d.prototype.unregister = function(e, b) {
+      m.assert(e);
+      m.assert(b);
+      var f = this._queues[e];
+      if (f) {
+        var q = f.indexOf(b);
+        -1 !== q && f.splice(q, 1);
+        0 === f.length && (this._queues[e] = null);
+      }
+    };
+    d.prototype.notify = function(e, b) {
+      var f = this._queues[e];
+      if (f) {
+        f = f.slice();
+        b = Array.prototype.slice.call(arguments, 0);
+        for (var q = 0;q < f.length;q++) {
+          f[q].apply(null, b);
+        }
+      }
+    };
+    d.prototype.notify1 = function(e, b) {
+      var f = this._queues[e];
+      if (f) {
+        for (var f = f.slice(), q = 0;q < f.length;q++) {
+          (0,f[q])(e, b);
+        }
+      }
+    };
+    return d;
   }();
-  g.Callback = a;
-  (function(a) {
-    a[a.None = 0] = "None";
-    a[a.PremultipliedAlphaARGB = 1] = "PremultipliedAlphaARGB";
-    a[a.StraightAlphaARGB = 2] = "StraightAlphaARGB";
-    a[a.StraightAlphaRGBA = 3] = "StraightAlphaRGBA";
-    a[a.JPEG = 4] = "JPEG";
-    a[a.PNG = 5] = "PNG";
-    a[a.GIF = 6] = "GIF";
-  })(g.ImageType || (g.ImageType = {}));
-  var r = g.ImageType;
-  g.getMIMETypeForImageType = function(a) {
-    switch(a) {
+  l.Callback = a;
+  (function(d) {
+    d[d.None = 0] = "None";
+    d[d.PremultipliedAlphaARGB = 1] = "PremultipliedAlphaARGB";
+    d[d.StraightAlphaARGB = 2] = "StraightAlphaARGB";
+    d[d.StraightAlphaRGBA = 3] = "StraightAlphaRGBA";
+    d[d.JPEG = 4] = "JPEG";
+    d[d.PNG = 5] = "PNG";
+    d[d.GIF = 6] = "GIF";
+  })(l.ImageType || (l.ImageType = {}));
+  var v = l.ImageType;
+  l.getMIMETypeForImageType = function(d) {
+    switch(d) {
       case 4:
         return "image/jpeg";
       case 5:
         return "image/png";
       case 6:
         return "image/gif";
       default:
         return "text/plain";
     }
   };
-  (function(a) {
-    a.toCSSCursor = function(a) {
-      switch(a) {
+  (function(d) {
+    d.toCSSCursor = function(e) {
+      switch(e) {
         case 0:
           return "auto";
         case 2:
           return "pointer";
         case 3:
           return "grab";
         case 4:
           return "text";
         default:
           return "default";
       }
     };
-  })(g.UI || (g.UI = {}));
+  })(l.UI || (l.UI = {}));
   a = function() {
-    function a() {
-      this.promise = new Promise(function(a, f) {
-        this.resolve = a;
-        this.reject = f;
+    function d() {
+      this.promise = new Promise(function(e, b) {
+        this.resolve = e;
+        this.reject = b;
       }.bind(this));
     }
-    a.prototype.then = function(a, f) {
-      return this.promise.then(a, f);
-    };
-    return a;
+    d.prototype.then = function(e, b) {
+      return this.promise.then(e, b);
+    };
+    return d;
   }();
-  g.PromiseWrapper = a;
+  l.PromiseWrapper = a;
 })(Shumway || (Shumway = {}));
 (function() {
-  function g(a) {
-    if ("function" !== typeof a) {
+  function l(b) {
+    if ("function" !== typeof b) {
       throw new TypeError("Invalid deferred constructor");
     }
-    var f = l();
-    a = new a(f);
-    var b = f.resolve;
-    if ("function" !== typeof b) {
+    var f = s();
+    b = new b(f);
+    var e = f.resolve;
+    if ("function" !== typeof e) {
       throw new TypeError("Invalid resolve construction function");
     }
     f = f.reject;
     if ("function" !== typeof f) {
       throw new TypeError("Invalid reject construction function");
     }
-    return{promise:a, resolve:b, reject:f};
+    return{promise:b, resolve:e, reject:f};
   }
-  function m(a, f) {
-    if ("object" !== typeof a || null === a) {
+  function r(b, f) {
+    if ("object" !== typeof b || null === b) {
       return!1;
     }
     try {
-      var b = a.then;
-      if ("function" !== typeof b) {
+      var e = b.then;
+      if ("function" !== typeof e) {
         return!1;
       }
-      b.call(a, f.resolve, f.reject);
-    } catch (h) {
-      b = f.reject, b(h);
+      e.call(b, f.resolve, f.reject);
+    } catch (d) {
+      e = f.reject, e(d);
     }
     return!0;
   }
-  function e(a) {
-    return "object" === typeof a && null !== a && "undefined" !== typeof a.promiseStatus;
+  function g(b) {
+    return "object" === typeof b && null !== b && "undefined" !== typeof b.promiseStatus;
   }
-  function c(a, f) {
-    if ("unresolved" === a.promiseStatus) {
-      var b = a.rejectReactions;
-      a.result = f;
-      a.resolveReactions = void 0;
-      a.rejectReactions = void 0;
-      a.promiseStatus = "has-rejection";
-      w(b, f);
+  function c(b, f) {
+    if ("unresolved" === b.promiseStatus) {
+      var e = b.rejectReactions;
+      b.result = f;
+      b.resolveReactions = void 0;
+      b.rejectReactions = void 0;
+      b.promiseStatus = "has-rejection";
+      t(e, f);
     }
   }
-  function w(a, f) {
-    for (var b = 0;b < a.length;b++) {
-      k({reaction:a[b], argument:f});
+  function t(b, f) {
+    for (var e = 0;e < b.length;e++) {
+      m({reaction:b[e], argument:f});
     }
   }
-  function k(d) {
-    0 === f.length && setTimeout(a, 0);
-    f.push(d);
+  function m(b) {
+    0 === f.length && setTimeout(h, 0);
+    f.push(b);
   }
-  function b(a, f) {
-    var b = a.deferred, h = a.handler, n, p;
+  function a(b, f) {
+    var e = b.deferred, d = b.handler, a, h;
     try {
-      n = h(f);
-    } catch (c) {
-      return b = b.reject, b(c);
+      a = d(f);
+    } catch (p) {
+      return e = e.reject, e(p);
     }
-    if (n === b.promise) {
-      return b = b.reject, b(new TypeError("Self resolution"));
+    if (a === e.promise) {
+      return e = e.reject, e(new TypeError("Self resolution"));
     }
     try {
-      if (p = m(n, b), !p) {
-        var r = b.resolve;
-        return r(n);
+      if (h = r(a, e), !h) {
+        var c = e.resolve;
+        return c(a);
       }
     } catch (k) {
-      return b = b.reject, b(k);
+      return e = e.reject, e(k);
     }
   }
-  function a() {
+  function h() {
     for (;0 < f.length;) {
-      var a = f[0];
+      var b = f[0];
       try {
-        b(a.reaction, a.argument);
-      } catch (q) {
-        if ("function" === typeof u.onerror) {
-          u.onerror(q);
+        a(b.reaction, b.argument);
+      } catch (d) {
+        if ("function" === typeof e.onerror) {
+          e.onerror(d);
         }
       }
       f.shift();
     }
   }
-  function n(a) {
-    throw a;
+  function p(b) {
+    throw b;
   }
-  function p(a) {
-    return a;
+  function k(b) {
+    return b;
   }
-  function y(a) {
+  function u(b) {
     return function(f) {
-      c(a, f);
+      c(b, f);
     };
   }
-  function v(a) {
+  function n(b) {
     return function(f) {
-      if ("unresolved" === a.promiseStatus) {
-        var b = a.resolveReactions;
-        a.result = f;
-        a.resolveReactions = void 0;
-        a.rejectReactions = void 0;
-        a.promiseStatus = "has-resolution";
-        w(b, f);
+      if ("unresolved" === b.promiseStatus) {
+        var e = b.resolveReactions;
+        b.result = f;
+        b.resolveReactions = void 0;
+        b.rejectReactions = void 0;
+        b.promiseStatus = "has-resolution";
+        t(e, f);
       }
     };
   }
-  function l() {
-    function a(f, b) {
-      a.resolve = f;
-      a.reject = b;
+  function s() {
+    function b(f, e) {
+      b.resolve = f;
+      b.reject = e;
     }
-    return a;
+    return b;
   }
-  function t(a, f, b) {
-    return function(h) {
-      if (h === a) {
-        return b(new TypeError("Self resolution"));
-      }
-      var n = a.promiseConstructor;
-      if (e(h) && h.promiseConstructor === n) {
-        return h.then(f, b);
-      }
-      n = g(n);
-      return m(h, n) ? n.promise.then(f, b) : f(h);
+  function v(b, f, e) {
+    return function(d) {
+      if (d === b) {
+        return e(new TypeError("Self resolution"));
+      }
+      var a = b.promiseConstructor;
+      if (g(d) && d.promiseConstructor === a) {
+        return d.then(f, e);
+      }
+      a = l(a);
+      return r(d, a) ? a.promise.then(f, e) : f(d);
     };
   }
-  function r(a, f, b, h) {
-    return function(n) {
-      f[a] = n;
-      h.countdown--;
-      0 === h.countdown && b.resolve(f);
+  function d(b, f, e, d) {
+    return function(a) {
+      f[b] = a;
+      d.countdown--;
+      0 === d.countdown && e.resolve(f);
     };
   }
-  function u(a) {
-    if ("function" !== typeof a) {
+  function e(b) {
+    if ("function" !== typeof b) {
       throw new TypeError("resolver is not a function");
     }
     if ("object" !== typeof this) {
       throw new TypeError("Promise to initialize is not an object");
     }
     this.promiseStatus = "unresolved";
     this.resolveReactions = [];
     this.rejectReactions = [];
     this.result = void 0;
-    var f = v(this), b = y(this);
+    var f = n(this), d = u(this);
     try {
-      a(f, b);
-    } catch (h) {
-      c(this, h);
+      b(f, d);
+    } catch (a) {
+      c(this, a);
     }
-    this.promiseConstructor = u;
+    this.promiseConstructor = e;
     return this;
   }
-  var h = Function("return this")();
-  if (h.Promise) {
-    "function" !== typeof h.Promise.all && (h.Promise.all = function(a) {
-      var f = 0, b = [], s, n, p = new h.Promise(function(a, d) {
-        s = a;
-        n = d;
+  var b = Function("return this")();
+  if (b.Promise) {
+    "function" !== typeof b.Promise.all && (b.Promise.all = function(f) {
+      var e = 0, d = [], a, h, p = new b.Promise(function(b, f) {
+        a = b;
+        h = f;
       });
-      a.forEach(function(a, d) {
-        f++;
-        a.then(function(a) {
-          b[d] = a;
-          f--;
-          0 === f && s(b);
-        }, n);
+      f.forEach(function(b, f) {
+        e++;
+        b.then(function(b) {
+          d[f] = b;
+          e--;
+          0 === e && a(d);
+        }, h);
       });
-      0 === f && s(b);
+      0 === e && a(d);
       return p;
-    }), "function" !== typeof h.Promise.resolve && (h.Promise.resolve = function(a) {
-      return new h.Promise(function(f) {
-        f(a);
+    }), "function" !== typeof b.Promise.resolve && (b.Promise.resolve = function(f) {
+      return new b.Promise(function(b) {
+        b(f);
       });
     });
   } else {
     var f = [];
-    u.all = function(a) {
-      var f = g(this), b = [], h = {countdown:0}, n = 0;
-      a.forEach(function(a) {
-        this.cast(a).then(r(n, b, f, h), f.reject);
-        n++;
-        h.countdown++;
+    e.all = function(b) {
+      var f = l(this), e = [], a = {countdown:0}, h = 0;
+      b.forEach(function(b) {
+        this.cast(b).then(d(h, e, f, a), f.reject);
+        h++;
+        a.countdown++;
       }, this);
-      0 === n && f.resolve(b);
+      0 === h && f.resolve(e);
       return f.promise;
     };
-    u.cast = function(a) {
-      if (e(a)) {
-        return a;
-      }
-      var f = g(this);
-      f.resolve(a);
+    e.cast = function(b) {
+      if (g(b)) {
+        return b;
+      }
+      var f = l(this);
+      f.resolve(b);
       return f.promise;
     };
-    u.reject = function(a) {
-      var f = g(this);
-      f.reject(a);
+    e.reject = function(b) {
+      var f = l(this);
+      f.reject(b);
       return f.promise;
     };
-    u.resolve = function(a) {
-      var f = g(this);
-      f.resolve(a);
+    e.resolve = function(b) {
+      var f = l(this);
+      f.resolve(b);
       return f.promise;
     };
-    u.prototype = {"catch":function(a) {
-      this.then(void 0, a);
-    }, then:function(a, f) {
-      if (!e(this)) {
+    e.prototype = {"catch":function(b) {
+      this.then(void 0, b);
+    }, then:function(b, f) {
+      if (!g(this)) {
         throw new TypeError("this is not a Promises");
       }
-      var b = g(this.promiseConstructor), h = "function" === typeof f ? f : n, c = {deferred:b, handler:t(this, "function" === typeof a ? a : p, h)}, h = {deferred:b, handler:h};
+      var e = l(this.promiseConstructor), d = "function" === typeof f ? f : p, a = {deferred:e, handler:v(this, "function" === typeof b ? b : k, d)}, d = {deferred:e, handler:d};
       switch(this.promiseStatus) {
         case "unresolved":
-          this.resolveReactions.push(c);
-          this.rejectReactions.push(h);
+          this.resolveReactions.push(a);
+          this.rejectReactions.push(d);
           break;
         case "has-resolution":
-          k({reaction:c, argument:this.result});
+          m({reaction:a, argument:this.result});
           break;
         case "has-rejection":
-          k({reaction:h, argument:this.result});
-      }
-      return b.promise;
+          m({reaction:d, argument:this.result});
+      }
+      return e.promise;
     }};
-    h.Promise = u;
+    b.Promise = e;
   }
 })();
 "undefined" !== typeof exports && (exports.Shumway = Shumway);
 (function() {
-  function g(g, e, c) {
-    g[e] || Object.defineProperty(g, e, {value:c, writable:!0, configurable:!0, enumerable:!1});
+  function l(l, g, c) {
+    l[g] || Object.defineProperty(l, g, {value:c, writable:!0, configurable:!0, enumerable:!1});
   }
-  g(String.prototype, "padRight", function(g, e) {
-    var c = this, w = c.replace(/\033\[[0-9]*m/g, "").length;
-    if (!g || w >= e) {
+  l(String.prototype, "padRight", function(l, g) {
+    var c = this, t = c.replace(/\033\[[0-9]*m/g, "").length;
+    if (!l || t >= g) {
       return c;
     }
-    for (var w = (e - w) / g.length, k = 0;k < w;k++) {
-      c += g;
+    for (var t = (g - t) / l.length, m = 0;m < t;m++) {
+      c += l;
     }
     return c;
   });
-  g(String.prototype, "padLeft", function(g, e) {
-    var c = this, w = c.length;
-    if (!g || w >= e) {
+  l(String.prototype, "padLeft", function(l, g) {
+    var c = this, t = c.length;
+    if (!l || t >= g) {
       return c;
     }
-    for (var w = (e - w) / g.length, k = 0;k < w;k++) {
-      c = g + c;
+    for (var t = (g - t) / l.length, m = 0;m < t;m++) {
+      c = l + c;
     }
     return c;
   });
-  g(String.prototype, "trim", function() {
+  l(String.prototype, "trim", function() {
     return this.replace(/^\s+|\s+$/g, "");
   });
-  g(String.prototype, "endsWith", function(g) {
-    return-1 !== this.indexOf(g, this.length - g.length);
+  l(String.prototype, "endsWith", function(l) {
+    return-1 !== this.indexOf(l, this.length - l.length);
   });
-  g(Array.prototype, "replace", function(g, e) {
-    if (g === e) {
+  l(Array.prototype, "replace", function(l, g) {
+    if (l === g) {
       return 0;
     }
-    for (var c = 0, w = 0;w < this.length;w++) {
-      this[w] === g && (this[w] = e, c++);
+    for (var c = 0, t = 0;t < this.length;t++) {
+      this[t] === l && (this[t] = g, c++);
     }
     return c;
   });
 })();
-(function(g) {
-  (function(m) {
-    var e = g.isObject, c = g.Debug.assert, w = function() {
-      function a(b, n, c, k) {
-        this.shortName = b;
-        this.longName = n;
+(function(l) {
+  (function(r) {
+    var g = l.isObject, c = function() {
+      function a(a, p, c, m) {
+        this.shortName = a;
+        this.longName = p;
         this.type = c;
-        k = k || {};
-        this.positional = k.positional;
-        this.parseFn = k.parse;
-        this.value = k.defaultValue;
+        m = m || {};
+        this.positional = m.positional;
+        this.parseFn = m.parse;
+        this.value = m.defaultValue;
       }
       a.prototype.parse = function(a) {
-        "boolean" === this.type ? (c("boolean" === typeof a), this.value = a) : "number" === this.type ? (c(!isNaN(a), a + " is not a number"), this.value = parseInt(a, 10)) : this.value = a;
+        this.value = "boolean" === this.type ? a : "number" === this.type ? parseInt(a, 10) : a;
         this.parseFn && this.parseFn(this.value);
       };
       return a;
     }();
-    m.Argument = w;
-    var k = function() {
-      function n() {
+    r.Argument = c;
+    var t = function() {
+      function a() {
         this.args = [];
       }
-      n.prototype.addArgument = function(a, b, n, c) {
-        a = new w(a, b, n, c);
+      a.prototype.addArgument = function(a, p, k, m) {
+        a = new c(a, p, k, m);
         this.args.push(a);
         return a;
       };
-      n.prototype.addBoundOption = function(a) {
-        this.args.push(new w(a.shortName, a.longName, a.type, {parse:function(b) {
-          a.value = b;
+      a.prototype.addBoundOption = function(a) {
+        this.args.push(new c(a.shortName, a.longName, a.type, {parse:function(p) {
+          a.value = p;
         }}));
       };
-      n.prototype.addBoundOptionSet = function(n) {
-        var k = this;
-        n.options.forEach(function(n) {
-          n instanceof b ? k.addBoundOptionSet(n) : (c(n instanceof a), k.addBoundOption(n));
+      a.prototype.addBoundOptionSet = function(a) {
+        var p = this;
+        a.options.forEach(function(a) {
+          a instanceof m ? p.addBoundOptionSet(a) : p.addBoundOption(a);
         });
       };
-      n.prototype.getUsage = function() {
+      a.prototype.getUsage = function() {
         var a = "";
-        this.args.forEach(function(b) {
-          a = b.positional ? a + b.longName : a + ("[-" + b.shortName + "|--" + b.longName + ("boolean" === b.type ? "" : " " + b.type[0].toUpperCase()) + "]");
+        this.args.forEach(function(p) {
+          a = p.positional ? a + p.longName : a + ("[-" + p.shortName + "|--" + p.longName + ("boolean" === p.type ? "" : " " + p.type[0].toUpperCase()) + "]");
           a += " ";
         });
         return a;
       };
-      n.prototype.parse = function(a) {
-        var b = {}, n = [];
-        this.args.forEach(function(a) {
-          a.positional ? n.push(a) : (b["-" + a.shortName] = a, b["--" + a.longName] = a);
+      a.prototype.parse = function(a) {
+        var p = {}, c = [];
+        this.args.forEach(function(d) {
+          d.positional ? c.push(d) : (p["-" + d.shortName] = d, p["--" + d.longName] = d);
         });
-        for (var k = [];a.length;) {
-          var t = a.shift(), r = null, u = t;
-          if ("--" == t) {
-            k = k.concat(a);
+        for (var m = [];a.length;) {
+          var n = a.shift(), s = null, g = n;
+          if ("--" == n) {
+            m = m.concat(a);
             break;
           } else {
-            if ("-" == t.slice(0, 1) || "--" == t.slice(0, 2)) {
-              r = b[t];
-              if (!r) {
+            if ("-" == n.slice(0, 1) || "--" == n.slice(0, 2)) {
+              s = p[n];
+              if (!s) {
                 continue;
               }
-              "boolean" !== r.type ? (u = a.shift(), c("-" !== u && "--" !== u, "Argument " + t + " must have a value.")) : u = !0;
+              g = "boolean" !== s.type ? a.shift() : !0;
             } else {
-              n.length ? r = n.shift() : k.push(u);
-            }
-          }
-          r && r.parse(u);
-        }
-        c(0 === n.length, "Missing positional arguments.");
-        return k;
-      };
-      return n;
+              c.length ? s = c.shift() : m.push(g);
+            }
+          }
+          s && s.parse(g);
+        }
+        return m;
+      };
+      return a;
     }();
-    m.ArgumentParser = k;
-    var b = function() {
-      function a(b, n) {
-        void 0 === n && (n = null);
+    r.ArgumentParser = t;
+    var m = function() {
+      function a(a, p) {
+        void 0 === p && (p = null);
         this.open = !1;
-        this.name = b;
-        this.settings = n || {};
+        this.name = a;
+        this.settings = p || {};
         this.options = [];
       }
-      a.prototype.register = function(b) {
-        if (b instanceof a) {
-          for (var c = 0;c < this.options.length;c++) {
-            var k = this.options[c];
-            if (k instanceof a && k.name === b.name) {
-              return k;
-            }
-          }
-        }
-        this.options.push(b);
+      a.prototype.register = function(h) {
+        if (h instanceof a) {
+          for (var p = 0;p < this.options.length;p++) {
+            var c = this.options[p];
+            if (c instanceof a && c.name === h.name) {
+              return c;
+            }
+          }
+        }
+        this.options.push(h);
         if (this.settings) {
-          if (b instanceof a) {
-            c = this.settings[b.name], e(c) && (b.settings = c.settings, b.open = c.open);
+          if (h instanceof a) {
+            p = this.settings[h.name], g(p) && (h.settings = p.settings, h.open = p.open);
           } else {
-            if ("undefined" !== typeof this.settings[b.longName]) {
-              switch(b.type) {
+            if ("undefined" !== typeof this.settings[h.longName]) {
+              switch(h.type) {
                 case "boolean":
-                  b.value = !!this.settings[b.longName];
+                  h.value = !!this.settings[h.longName];
                   break;
                 case "number":
-                  b.value = +this.settings[b.longName];
+                  h.value = +this.settings[h.longName];
                   break;
                 default:
-                  b.value = this.settings[b.longName];
+                  h.value = this.settings[h.longName];
               }
             }
           }
         }
-        return b;
+        return h;
       };
       a.prototype.trace = function(a) {
         a.enter(this.name + " {");
-        this.options.forEach(function(b) {
-          b.trace(a);
+        this.options.forEach(function(p) {
+          p.trace(a);
         });
         a.leave("}");
       };
       a.prototype.getSettings = function() {
-        var b = {};
-        this.options.forEach(function(c) {
-          c instanceof a ? b[c.name] = {settings:c.getSettings(), open:c.open} : b[c.longName] = c.value;
+        var h = {};
+        this.options.forEach(function(p) {
+          p instanceof a ? h[p.name] = {settings:p.getSettings(), open:p.open} : h[p.longName] = p.value;
         });
-        return b;
-      };
-      a.prototype.setSettings = function(b) {
-        b && this.options.forEach(function(c) {
-          c instanceof a ? c.name in b && c.setSettings(b[c.name].settings) : c.longName in b && (c.value = b[c.longName]);
+        return h;
+      };
+      a.prototype.setSettings = function(h) {
+        h && this.options.forEach(function(p) {
+          p instanceof a ? p.name in h && p.setSettings(h[p.name].settings) : p.longName in h && (p.value = h[p.longName]);
         });
       };
       return a;
     }();
-    m.OptionSet = b;
-    var a = function() {
-      function a(b, n, c, k, t, r) {
-        void 0 === r && (r = null);
-        this.longName = n;
-        this.shortName = b;
+    r.OptionSet = m;
+    t = function() {
+      function a(a, p, c, m, n, s) {
+        void 0 === s && (s = null);
+        this.longName = p;
+        this.shortName = a;
         this.type = c;
-        this.value = this.defaultValue = k;
-        this.description = t;
-        this.config = r;
+        this.value = this.defaultValue = m;
+        this.description = n;
+        this.config = s;
       }
       a.prototype.parse = function(a) {
         this.value = a;
       };
       a.prototype.trace = function(a) {
         a.writeLn(("-" + this.shortName + "|--" + this.longName).padRight(" ", 30) + " = " + this.type + " " + this.value + " [" + this.defaultValue + "] (" + this.description + ")");
       };
       return a;
     }();
-    m.Option = a;
-  })(g.Options || (g.Options = {}));
+    r.Option = t;
+  })(l.Options || (l.Options = {}));
 })(Shumway || (Shumway = {}));
-(function(g) {
-  (function(m) {
-    function e() {
+(function(l) {
+  (function(r) {
+    function g() {
       try {
         return "undefined" !== typeof window && "localStorage" in window && null !== window.localStorage;
       } catch (c) {
         return!1;
       }
     }
     function c(c) {
-      void 0 === c && (c = m.ROOT);
-      var k = {};
-      if (e() && (c = window.localStorage[c])) {
+      void 0 === c && (c = r.ROOT);
+      var m = {};
+      if (g() && (c = window.localStorage[c])) {
         try {
-          k = JSON.parse(c);
-        } catch (b) {
-        }
-      }
-      return k;
+          m = JSON.parse(c);
+        } catch (a) {
+        }
+      }
+      return m;
     }
-    m.ROOT = "Shumway Options";
-    m.shumwayOptions = new g.Options.OptionSet(m.ROOT, c());
-    m.isStorageSupported = e;
-    m.load = c;
-    m.save = function(c, k) {
+    r.ROOT = "Shumway Options";
+    r.shumwayOptions = new l.Options.OptionSet(r.ROOT, c());
+    r.isStorageSupported = g;
+    r.load = c;
+    r.save = function(c, m) {
       void 0 === c && (c = null);
-      void 0 === k && (k = m.ROOT);
-      if (e()) {
+      void 0 === m && (m = r.ROOT);
+      if (g()) {
         try {
-          window.localStorage[k] = JSON.stringify(c ? c : m.shumwayOptions.getSettings());
-        } catch (b) {
-        }
-      }
-    };
-    m.setSettings = function(c) {
-      m.shumwayOptions.setSettings(c);
-    };
-    m.getSettings = function(c) {
-      return m.shumwayOptions.getSettings();
-    };
-  })(g.Settings || (g.Settings = {}));
+          window.localStorage[m] = JSON.stringify(c ? c : r.shumwayOptions.getSettings());
+        } catch (a) {
+        }
+      }
+    };
+    r.setSettings = function(c) {
+      r.shumwayOptions.setSettings(c);
+    };
+    r.getSettings = function(c) {
+      return r.shumwayOptions.getSettings();
+    };
+  })(l.Settings || (l.Settings = {}));
 })(Shumway || (Shumway = {}));
-(function(g) {
-  (function(m) {
-    var e = function() {
-      function c(c, k) {
+(function(l) {
+  (function(r) {
+    var g = function() {
+      function c(c, m) {
         this._parent = c;
-        this._timers = g.ObjectUtilities.createMap();
-        this._name = k;
+        this._timers = l.ObjectUtilities.createMap();
+        this._name = m;
         this._count = this._total = this._last = this._begin = 0;
       }
-      c.time = function(e, k) {
-        c.start(e);
-        k();
+      c.time = function(g, m) {
+        c.start(g);
+        m();
         c.stop();
       };
-      c.start = function(e) {
-        c._top = c._top._timers[e] || (c._top._timers[e] = new c(c._top, e));
+      c.start = function(g) {
+        c._top = c._top._timers[g] || (c._top._timers[g] = new c(c._top, g));
         c._top.start();
-        e = c._flat._timers[e] || (c._flat._timers[e] = new c(c._flat, e));
-        e.start();
-        c._flatStack.push(e);
+        g = c._flat._timers[g] || (c._flat._timers[g] = new c(c._flat, g));
+        g.start();
+        c._flatStack.push(g);
       };
       c.stop = function() {
         c._top.stop();
         c._top = c._top._parent;
         c._flatStack.pop().stop();
       };
-      c.stopStart = function(e) {
+      c.stopStart = function(g) {
         c.stop();
-        c.start(e);
+        c.start(g);
       };
       c.prototype.start = function() {
-        this._begin = g.getTicks();
+        this._begin = l.getTicks();
       };
       c.prototype.stop = function() {
-        this._last = g.getTicks() - this._begin;
+        this._last = l.getTicks() - this._begin;
         this._total += this._last;
         this._count += 1;
       };
       c.prototype.toJSON = function() {
         return{name:this._name, total:this._total, timers:this._timers};
       };
       c.prototype.trace = function(c) {
         c.enter(this._name + ": " + this._total.toFixed(2) + " ms, count: " + this._count + ", average: " + (this._total / this._count).toFixed(2) + " ms");
-        for (var k in this._timers) {
-          this._timers[k].trace(c);
+        for (var m in this._timers) {
+          this._timers[m].trace(c);
         }
         c.outdent();
       };
-      c.trace = function(e) {
-        c._base.trace(e);
-        c._flat.trace(e);
+      c.trace = function(g) {
+        c._base.trace(g);
+        c._flat.trace(g);
       };
       c._base = new c(null, "Total");
       c._top = c._base;
       c._flat = new c(null, "Flat");
       c._flatStack = [];
       return c;
     }();
-    m.Timer = e;
-    e = function() {
+    r.Timer = g;
+    g = function() {
       function c(c) {
         this._enabled = c;
         this.clear();
       }
       Object.defineProperty(c.prototype, "counts", {get:function() {
         return this._counts;
       }, enumerable:!0, configurable:!0});
       c.prototype.setEnabled = function(c) {
         this._enabled = c;
       };
       c.prototype.clear = function() {
-        this._counts = g.ObjectUtilities.createMap();
-        this._times = g.ObjectUtilities.createMap();
+        this._counts = l.ObjectUtilities.createMap();
+        this._times = l.ObjectUtilities.createMap();
       };
       c.prototype.toJSON = function() {
         return{counts:this._counts, times:this._times};
       };
-      c.prototype.count = function(c, k, b) {
-        void 0 === k && (k = 1);
-        void 0 === b && (b = 0);
+      c.prototype.count = function(c, m, a) {
+        void 0 === m && (m = 1);
+        void 0 === a && (a = 0);
         if (this._enabled) {
-          return void 0 === this._counts[c] && (this._counts[c] = 0, this._times[c] = 0), this._counts[c] += k, this._times[c] += b, this._counts[c];
+          return void 0 === this._counts[c] && (this._counts[c] = 0, this._times[c] = 0), this._counts[c] += m, this._times[c] += a, this._counts[c];
         }
       };
       c.prototype.trace = function(c) {
-        for (var k in this._counts) {
-          c.writeLn(k + ": " + this._counts[k]);
-        }
-      };
-      c.prototype._pairToString = function(c, k) {
-        var b = k[0], a = k[1], n = c[b], b = b + ": " + a;
-        n && (b += ", " + n.toFixed(4), 1 < a && (b += " (" + (n / a).toFixed(4) + ")"));
-        return b;
+        for (var m in this._counts) {
+          c.writeLn(m + ": " + this._counts[m]);
+        }
+      };
+      c.prototype._pairToString = function(c, m) {
+        var a = m[0], h = m[1], p = c[a], a = a + ": " + h;
+        p && (a += ", " + p.toFixed(4), 1 < h && (a += " (" + (p / h).toFixed(4) + ")"));
+        return a;
       };
       c.prototype.toStringSorted = function() {
-        var c = this, k = this._times, b = [], a;
-        for (a in this._counts) {
-          b.push([a, this._counts[a]]);
-        }
-        b.sort(function(a, b) {
-          return b[1] - a[1];
+        var c = this, m = this._times, a = [], h;
+        for (h in this._counts) {
+          a.push([h, this._counts[h]]);
+        }
+        a.sort(function(a, h) {
+          return h[1] - a[1];
         });
-        return b.map(function(a) {
-          return c._pairToString(k, a);
+        return a.map(function(a) {
+          return c._pairToString(m, a);
         }).join(", ");
       };
-      c.prototype.traceSorted = function(c, k) {
-        void 0 === k && (k = !1);
-        var b = this, a = this._times, n = [], p;
-        for (p in this._counts) {
-          n.push([p, this._counts[p]]);
-        }
-        n.sort(function(a, b) {
-          return b[1] - a[1];
+      c.prototype.traceSorted = function(c, m) {
+        void 0 === m && (m = !1);
+        var a = this, h = this._times, p = [], k;
+        for (k in this._counts) {
+          p.push([k, this._counts[k]]);
+        }
+        p.sort(function(a, h) {
+          return h[1] - a[1];
         });
-        k ? c.writeLn(n.map(function(n) {
-          return b._pairToString(a, n);
-        }).join(", ")) : n.forEach(function(n) {
-          c.writeLn(b._pairToString(a, n));
+        m ? c.writeLn(p.map(function(p) {
+          return a._pairToString(h, p);
+        }).join(", ")) : p.forEach(function(p) {
+          c.writeLn(a._pairToString(h, p));
         });
       };
       c.instance = new c(!0);
       return c;
     }();
-    m.Counter = e;
-    e = function() {
+    r.Counter = g;
+    g = function() {
       function c(c) {
         this._samples = new Float64Array(c);
         this._index = this._count = 0;
       }
       c.prototype.push = function(c) {
         this._count < this._samples.length && this._count++;
         this._index++;
         this._samples[this._index % this._samples.length] = c;
       };
       c.prototype.average = function() {
-        for (var c = 0, k = 0;k < this._count;k++) {
-          c += this._samples[k];
+        for (var c = 0, m = 0;m < this._count;m++) {
+          c += this._samples[m];
         }
         return c / this._count;
       };
       return c;
     }();
-    m.Average = e;
-  })(g.Metrics || (g.Metrics = {}));
+    r.Average = g;
+  })(l.Metrics || (l.Metrics = {}));
 })(Shumway || (Shumway = {}));
-var __extends = this.__extends || function(g, m) {
-  function e() {
-    this.constructor = g;
+var __extends = this.__extends || function(l, r) {
+  function g() {
+    this.constructor = l;
   }
-  for (var c in m) {
-    m.hasOwnProperty(c) && (g[c] = m[c]);
+  for (var c in r) {
+    r.hasOwnProperty(c) && (l[c] = r[c]);
   }
-  e.prototype = m.prototype;
-  g.prototype = new e;
+  g.prototype = r.prototype;
+  l.prototype = new g;
 };
-(function(g) {
-  (function(m) {
-    function e(a) {
-      for (var f = Math.max.apply(null, a), d = a.length, q = 1 << f, b = new Uint32Array(q), s = f << 16 | 65535, n = 0;n < q;n++) {
-        b[n] = s;
-      }
-      for (var s = 0, n = 1, c = 2;n <= f;s <<= 1, ++n, c <<= 1) {
-        for (var p = 0;p < d;++p) {
-          if (a[p] === n) {
-            for (var r = 0, k = 0;k < n;++k) {
-              r = 2 * r + (s >> k & 1);
-            }
-            for (k = r;k < q;k += c) {
-              b[k] = n << 16 | p;
-            }
-            ++s;
-          }
-        }
-      }
-      return{codes:b, maxBits:f};
+(function(l) {
+  (function(l) {
+    function g(b) {
+      for (var f = Math.max.apply(null, b), q = b.length, e = 1 << f, d = new Uint32Array(e), a = f << 16 | 65535, h = 0;h < e;h++) {
+        d[h] = a;
+      }
+      for (var a = 0, h = 1, p = 2;h <= f;a <<= 1, ++h, p <<= 1) {
+        for (var c = 0;c < q;++c) {
+          if (b[c] === h) {
+            for (var m = 0, k = 0;k < h;++k) {
+              m = 2 * m + (a >> k & 1);
+            }
+            for (k = m;k < e;k += p) {
+              d[k] = h << 16 | c;
+            }
+            ++a;
+          }
+        }
+      }
+      return{codes:d, maxBits:f};
     }
     var c;
-    (function(a) {
-      a[a.INIT = 0] = "INIT";
-      a[a.BLOCK_0 = 1] = "BLOCK_0";
-      a[a.BLOCK_1 = 2] = "BLOCK_1";
-      a[a.BLOCK_2_PRE = 3] = "BLOCK_2_PRE";
-      a[a.BLOCK_2 = 4] = "BLOCK_2";
-      a[a.DONE = 5] = "DONE";
-      a[a.ERROR = 6] = "ERROR";
-      a[a.VERIFY_HEADER = 7] = "VERIFY_HEADER";
+    (function(b) {
+      b[b.INIT = 0] = "INIT";
+      b[b.BLOCK_0 = 1] = "BLOCK_0";
+      b[b.BLOCK_1 = 2] = "BLOCK_1";
+      b[b.BLOCK_2_PRE = 3] = "BLOCK_2_PRE";
+      b[b.BLOCK_2 = 4] = "BLOCK_2";
+      b[b.DONE = 5] = "DONE";
+      b[b.ERROR = 6] = "ERROR";
+      b[b.VERIFY_HEADER = 7] = "VERIFY_HEADER";
     })(c || (c = {}));
     c = function() {
-      function a(f) {
-        this._error = null;
-      }
-      Object.defineProperty(a.prototype, "error", {get:function() {
-        return this._error;
-      }, enumerable:!0, configurable:!0});
-      a.prototype.push = function(a) {
-        g.Debug.abstractMethod("Inflate.push");
-      };
-      a.prototype.close = function() {
-      };
-      a.create = function(a) {
-        return "undefined" !== typeof SpecialInflate ? new t(a) : new w(a);
-      };
-      a.prototype._processZLibHeader = function(a, d, q) {
-        if (d + 2 > q) {
+      function b(b) {
+      }
+      b.prototype.push = function(b) {
+      };
+      b.prototype.close = function() {
+      };
+      b.create = function(b) {
+        return "undefined" !== typeof SpecialInflate ? new v(b) : new t(b);
+      };
+      b.prototype._processZLibHeader = function(b, q, e) {
+        if (q + 2 > e) {
           return 0;
         }
-        a = a[d] << 8 | a[d + 1];
-        d = null;
-        2048 !== (a & 3840) ? d = "inflate: unknown compression method" : 0 !== a % 31 ? d = "inflate: bad FCHECK" : 0 !== (a & 32) && (d = "inflate: FDICT bit set");
-        return d ? (this._error = d, -1) : 2;
-      };
-      a.inflate = function(f, d, q) {
-        var b = new Uint8Array(d), s = 0;
-        d = a.create(q);
-        d.onData = function(a) {
-          b.set(a, s);
-          s += a.length;
-        };
-        d.push(f);
-        d.close();
-        return b;
-      };
-      return a;
+        b = b[q] << 8 | b[q + 1];
+        q = null;
+        2048 !== (b & 3840) ? q = "inflate: unknown compression method" : 0 !== b % 31 ? q = "inflate: bad FCHECK" : 0 !== (b & 32) && (q = "inflate: FDICT bit set");
+        if (q) {
+          if (this.onError) {
+            this.onError(q);
+          }
+          return-1;
+        }
+        return 2;
+      };
+      b.inflate = function(f, q, e) {
+        var d = new Uint8Array(q), a = 0;
+        q = b.create(e);
+        q.onData = function(b) {
+          d.set(b, a);
+          a += b.length;
+        };
+        q.push(f);
+        q.close();
+        return d;
+      };
+      return b;
     }();
-    m.Inflate = c;
-    var w = function(h) {
-      function f(d) {
-        h.call(this, d);
+    l.Inflate = c;
+    var t = function(b) {
+      function f(f) {
+        b.call(this, f);
         this._buffer = null;
         this._bitLength = this._bitBuffer = this._bufferPosition = this._bufferSize = 0;
         this._window = new Uint8Array(65794);
         this._windowPosition = 0;
-        this._state = d ? 7 : 0;
+        this._state = f ? 7 : 0;
         this._isFinalBlock = !1;
         this._distanceTable = this._literalTable = null;
         this._block0Read = 0;
         this._block2State = null;
         this._copyState = {state:0, len:0, lenBits:0, dist:0, distBits:0};
-        this._error = void 0;
-        if (!l) {
-          k = new Uint8Array([16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]);
-          b = new Uint16Array(30);
-          a = new Uint8Array(30);
-          for (var f = d = 0, x = 1;30 > d;++d) {
-            b[d] = x, x += 1 << (a[d] = ~~((f += 2 < d ? 1 : 0) / 2));
-          }
-          var s = new Uint8Array(288);
-          for (d = 0;32 > d;++d) {
-            s[d] = 5;
-          }
-          n = e(s.subarray(0, 32));
-          p = new Uint16Array(29);
-          y = new Uint8Array(29);
-          f = d = 0;
-          for (x = 3;29 > d;++d) {
-            p[d] = x - (28 == d ? 1 : 0), x += 1 << (y[d] = ~~((f += 4 < d ? 1 : 0) / 4 % 6));
-          }
-          for (d = 0;288 > d;++d) {
-            s[d] = 144 > d || 279 < d ? 8 : 256 > d ? 9 : 7;
-          }
-          v = e(s);
-          l = !0;
-        }
-      }
-      __extends(f, h);
-      Object.defineProperty(f.prototype, "error", {get:function() {
-        return this._error;
-      }, enumerable:!0, configurable:!0});
-      f.prototype.push = function(a) {
-        if (!this._buffer || this._buffer.length < this._bufferSize + a.length) {
-          var f = new Uint8Array(this._bufferSize + a.length);
+        if (!s) {
+          m = new Uint8Array([16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]);
+          a = new Uint16Array(30);
+          h = new Uint8Array(30);
+          for (var e = f = 0, d = 1;30 > f;++f) {
+            a[f] = d, d += 1 << (h[f] = ~~((e += 2 < f ? 1 : 0) / 2));
+          }
+          var c = new Uint8Array(288);
+          for (f = 0;32 > f;++f) {
+            c[f] = 5;
+          }
+          p = g(c.subarray(0, 32));
+          k = new Uint16Array(29);
+          u = new Uint8Array(29);
+          e = f = 0;
+          for (d = 3;29 > f;++f) {
+            k[f] = d - (28 == f ? 1 : 0), d += 1 << (u[f] = ~~((e += 4 < f ? 1 : 0) / 4 % 6));
+          }
+          for (f = 0;288 > f;++f) {
+            c[f] = 144 > f || 279 < f ? 8 : 256 > f ? 9 : 7;
+          }
+          n = g(c);
+          s = !0;
+        }
+      }
+      __extends(f, b);
+      f.prototype.push = function(b) {
+        if (!this._buffer || this._buffer.length < this._bufferSize + b.length) {
+          var f = new Uint8Array(this._bufferSize + b.length);
           this._buffer && f.set(this._buffer);
           this._buffer = f;
         }
-        this._buffer.set(a, this._bufferSize);
-        this._bufferSize += a.length;
+        this._buffer.set(b, this._bufferSize);
+        this._bufferSize += b.length;
         this._bufferPosition = 0;
-        a = !1;
+        b = !1;
         do {
           f = this._windowPosition;
-          if (0 === this._state && (a = this._decodeInitState())) {
+          if (0 === this._state && (b = this._decodeInitState())) {
             break;
           }
           switch(this._state) {
             case 1:
-              a = this._decodeBlock0();
+              b = this._decodeBlock0();
               break;
             case 3:
-              if (a = this._decodeBlock2Pre()) {
+              if (b = this._decodeBlock2Pre()) {
                 break;
               }
             ;
             case 2:
             ;
             case 4:
-              a = this._decodeBlock();
+              b = this._decodeBlock();
               break;
             case 6:
             ;
             case 5:
               this._bufferPosition = this._bufferSize;
               break;
             case 7:
-              var b = this._processZLibHeader(this._buffer, this._bufferPosition, this._bufferSize);
-              0 < b ? (this._bufferPosition += b, this._state = 0) : 0 === b ? a = !0 : this._state = 6;
+              var e = this._processZLibHeader(this._buffer, this._bufferPosition, this._bufferSize);
+              0 < e ? (this._bufferPosition += e, this._state = 0) : 0 === e ? b = !0 : this._state = 6;
           }
           if (0 < this._windowPosition - f) {
             this.onData(this._window.subarray(f, this._windowPosition));
           }
           65536 <= this._windowPosition && ("copyWithin" in this._buffer ? this._window.copyWithin(0, this._windowPosition - 32768, this._windowPosition) : this._window.set(this._window.subarray(this._windowPosition - 32768, this._windowPosition)), this._windowPosition = 32768);
-        } while (!a && this._bufferPosition < this._bufferSize);
+        } while (!b && this._bufferPosition < this._bufferSize);
         this._bufferPosition < this._bufferSize ? ("copyWithin" in this._buffer ? this._buffer.copyWithin(0, this._bufferPosition, this._bufferSize) : this._buffer.set(this._buffer.subarray(this._bufferPosition, this._bufferSize)), this._bufferSize -= this._bufferPosition) : this._bufferSize = 0;
       };
       f.prototype._decodeInitState = function() {
         if (this._isFinalBlock) {
           return this._state = 5, !1;
         }
-        var a = this._buffer, f = this._bufferSize, b = this._bitBuffer, h = this._bitLength, c = this._bufferPosition;
-        if (3 > (f - c << 3) + h) {
+        var b = this._buffer, f = this._bufferSize, e = this._bitBuffer, d = this._bitLength, a = this._bufferPosition;
+        if (3 > (f - a << 3) + d) {
           return!0;
         }
-        3 > h && (b |= a[c++] << h, h += 8);
-        var p = b & 7, b = b >> 3, h = h - 3;
-        switch(p >> 1) {
+        3 > d && (e |= b[a++] << d, d += 8);
+        var h = e & 7, e = e >> 3, d = d - 3;
+        switch(h >> 1) {
           case 0:
-            h = b = 0;
-            if (4 > f - c) {
+            d = e = 0;
+            if (4 > f - a) {
               return!0;
             }
-            var r = a[c] | a[c + 1] << 8, a = a[c + 2] | a[c + 3] << 8, c = c + 4;
-            if (65535 !== (r ^ a)) {
-              this._error = "inflate: invalid block 0 length";
-              a = 6;
+            var c = b[a] | b[a + 1] << 8, b = b[a + 2] | b[a + 3] << 8, a = a + 4;
+            if (65535 !== (c ^ b)) {
+              this._error("inflate: invalid block 0 length");
+              b = 6;
               break;
             }
-            0 === r ? a = 0 : (this._block0Read = r, a = 1);
+            0 === c ? b = 0 : (this._block0Read = c, b = 1);
             break;
           case 1:
-            a = 2;
-            this._literalTable = v;
-            this._distanceTable = n;
+            b = 2;
+            this._literalTable = n;
+            this._distanceTable = p;
             break;
           case 2:
-            if (26 > (f - c << 3) + h) {
+            if (26 > (f - a << 3) + d) {
               return!0;
             }
-            for (;14 > h;) {
-              b |= a[c++] << h, h += 8;
-            }
-            r = (b >> 10 & 15) + 4;
-            if ((f - c << 3) + h < 14 + 3 * r) {
+            for (;14 > d;) {
+              e |= b[a++] << d, d += 8;
+            }
+            c = (e >> 10 & 15) + 4;
+            if ((f - a << 3) + d < 14 + 3 * c) {
               return!0;
             }
-            for (var f = {numLiteralCodes:(b & 31) + 257, numDistanceCodes:(b >> 5 & 31) + 1, codeLengthTable:void 0, bitLengths:void 0, codesRead:0, dupBits:0}, b = b >> 14, h = h - 14, t = new Uint8Array(19), l = 0;l < r;++l) {
-              3 > h && (b |= a[c++] << h, h += 8), t[k[l]] = b & 7, b >>= 3, h -= 3;
-            }
-            for (;19 > l;l++) {
-              t[k[l]] = 0;
+            for (var f = {numLiteralCodes:(e & 31) + 257, numDistanceCodes:(e >> 5 & 31) + 1, codeLengthTable:void 0, bitLengths:void 0, codesRead:0, dupBits:0}, e = e >> 14, d = d - 14, k = new Uint8Array(19), u = 0;u < c;++u) {
+              3 > d && (e |= b[a++] << d, d += 8), k[m[u]] = e & 7, e >>= 3, d -= 3;
+            }
+            for (;19 > u;u++) {
+              k[m[u]] = 0;
             }
             f.bitLengths = new Uint8Array(f.numLiteralCodes + f.numDistanceCodes);
-            f.codeLengthTable = e(t);
+            f.codeLengthTable = g(k);
             this._block2State = f;
-            a = 3;
+            b = 3;
             break;
           default:
-            return this._error = "inflate: unsupported block type", !1;
-        }
-        this._isFinalBlock = !!(p & 1);
-        this._state = a;
-        this._bufferPosition = c;
-        this._bitBuffer = b;
-        this._bitLength = h;
+            return this._error("inflate: unsupported block type"), !1;
+        }
+        this._isFinalBlock = !!(h & 1);
+        this._state = b;
+        this._bufferPosition = a;
+        this._bitBuffer = e;
+        this._bitLength = d;
         return!1;
       };
+      f.prototype._error = function(b) {
+        if (this.onError) {
+          this.onError(b);
+        }
+      };
       f.prototype._decodeBlock0 = function() {
-        var a = this._bufferPosition, f = this._windowPosition, b = this._block0Read, h = 65794 - f, n = this._bufferSize - a, c = n < b, p = Math.min(h, n, b);
-        this._window.set(this._buffer.subarray(a, a + p), f);
+        var b = this._bufferPosition, f = this._windowPosition, e = this._block0Read, d = 65794 - f, a = this._bufferSize - b, h = a < e, p = Math.min(d, a, e);
+        this._window.set(this._buffer.subarray(b, b + p), f);
         this._windowPosition = f + p;
-        this._bufferPosition = a + p;
-        this._block0Read = b - p;
-        return b === p ? (this._state = 0, !1) : c && h < n;
-      };
-      f.prototype._readBits = function(a) {
-        var f = this._bitBuffer, b = this._bitLength;
-        if (a > b) {
-          var h = this._bufferPosition, n = this._bufferSize;
+        this._bufferPosition = b + p;
+        this._block0Read = e - p;
+        return e === p ? (this._state = 0, !1) : h && d < a;
+      };
+      f.prototype._readBits = function(b) {
+        var f = this._bitBuffer, e = this._bitLength;
+        if (b > e) {
+          var d = this._bufferPosition, a = this._bufferSize;
           do {
-            if (h >= n) {
-              return this._bufferPosition = h, this._bitBuffer = f, this._bitLength = b, -1;
-            }
-            f |= this._buffer[h++] << b;
-            b += 8;
-          } while (a > b);
-          this._bufferPosition = h;
-        }
-        this._bitBuffer = f >> a;
-        this._bitLength = b - a;
-        return f & (1 << a) - 1;
-      };
-      f.prototype._readCode = function(a) {
-        var f = this._bitBuffer, b = this._bitLength, h = a.maxBits;
-        if (h > b) {
-          var n = this._bufferPosition, c = this._bufferSize;
+            if (d >= a) {
+              return this._bufferPosition = d, this._bitBuffer = f, this._bitLength = e, -1;
+            }
+            f |= this._buffer[d++] << e;
+            e += 8;
+          } while (b > e);
+          this._bufferPosition = d;
+        }
+        this._bitBuffer = f >> b;
+        this._bitLength = e - b;
+        return f & (1 << b) - 1;
+      };
+      f.prototype._readCode = function(b) {
+        var f = this._bitBuffer, e = this._bitLength, d = b.maxBits;
+        if (d > e) {
+          var a = this._bufferPosition, h = this._bufferSize;
           do {
-            if (n >= c) {
-              return this._bufferPosition = n, this._bitBuffer = f, this._bitLength = b, -1;
-            }
-            f |= this._buffer[n++] << b;
-            b += 8;
-          } while (h > b);
-          this._bufferPosition = n;
-        }
-        a = a.codes[f & (1 << h) - 1];
-        h = a >> 16;
-        if (a & 32768) {
-          return this._error = "inflate: invalid encoding", this._state = 6, -1;
-        }
-        this._bitBuffer = f >> h;
-        this._bitLength = b - h;
-        return a & 65535;
+            if (a >= h) {
+              return this._bufferPosition = a, this._bitBuffer = f, this._bitLength = e, -1;
+            }
+            f |= this._buffer[a++] << e;
+            e += 8;
+          } while (d > e);
+          this._bufferPosition = a;
+        }
+        b = b.codes[f & (1 << d) - 1];
+        d = b >> 16;
+        if (b & 32768) {
+          return this._error("inflate: invalid encoding"), this._state = 6, -1;
+        }
+        this._bitBuffer = f >> d;
+        this._bitLength = e - d;
+        return b & 65535;
       };
       f.prototype._decodeBlock2Pre = function() {
-        var a = this._block2State, f = a.numLiteralCodes + a.numDistanceCodes, b = a.bitLengths, h = a.codesRead, n = 0 < h ? b[h - 1] : 0, c = a.codeLengthTable, p;
-        if (0 < a.dupBits) {
-          p = this._readBits(a.dupBits);
+        var b = this._block2State, f = b.numLiteralCodes + b.numDistanceCodes, e = b.bitLengths, d = b.codesRead, a = 0 < d ? e[d - 1] : 0, h = b.codeLengthTable, p;
+        if (0 < b.dupBits) {
+          p = this._readBits(b.dupBits);
           if (0 > p) {
             return!0;
           }
           for (;p--;) {
-            b[h++] = n;
-          }
-          a.dupBits = 0;
-        }
-        for (;h < f;) {
-          var r = this._readCode(c);
-          if (0 > r) {
-            return a.codesRead = h, !0;
-          }
-          if (16 > r) {
-            b[h++] = n = r;
+            e[d++] = a;
+          }
+          b.dupBits = 0;
+        }
+        for (;d < f;) {
+          var c = this._readCode(h);
+          if (0 > c) {
+            return b.codesRead = d, !0;
+          }
+          if (16 > c) {
+            e[d++] = a = c;
           } else {
-            var k;
-            switch(r) {
+            var m;
+            switch(c) {
               case 16:
-                k = 2;
+                m = 2;
                 p = 3;
-                r = n;
+                c = a;
                 break;
               case 17:
-                p = k = 3;
-                r = 0;
+                p = m = 3;
+                c = 0;
                 break;
               case 18:
-                k = 7, p = 11, r = 0;
+                m = 7, p = 11, c = 0;
             }
             for (;p--;) {
-              b[h++] = r;
-            }
-            p = this._readBits(k);
+              e[d++] = c;
+            }
+            p = this._readBits(m);
             if (0 > p) {
-              return a.codesRead = h, a.dupBits = k, !0;
+              return b.codesRead = d, b.dupBits = m, !0;
             }
             for (;p--;) {
-              b[h++] = r;
-            }
-            n = r;
-          }
-        }
-        this._literalTable = e(b.subarray(0, a.numLiteralCodes));
-        this._distanceTable = e(b.subarray(a.numLiteralCodes));
+              e[d++] = c;
+            }
+            a = c;
+          }
+        }
+        this._literalTable = g(e.subarray(0, b.numLiteralCodes));
+        this._distanceTable = g(e.subarray(b.numLiteralCodes));
         this._state = 4;
         this._block2State = null;
         return!1;
       };
       f.prototype._decodeBlock = function() {
-        var d = this._literalTable, f = this._distanceTable, h = this._window, n = this._windowPosition, c = this._copyState, r, k, t, l;
-        if (0 !== c.state) {
-          switch(c.state) {
+        var b = this._literalTable, f = this._distanceTable, e = this._window, d = this._windowPosition, p = this._copyState, c, m, n, s;
+        if (0 !== p.state) {
+          switch(p.state) {
             case 1:
-              if (0 > (r = this._readBits(c.lenBits))) {
+              if (0 > (c = this._readBits(p.lenBits))) {
                 return!0;
               }
-              c.len += r;
-              c.state = 2;
+              p.len += c;
+              p.state = 2;
             case 2:
-              if (0 > (r = this._readCode(f))) {
+              if (0 > (c = this._readCode(f))) {
                 return!0;
               }
-              c.distBits = a[r];
-              c.dist = b[r];
-              c.state = 3;
+              p.distBits = h[c];
+              p.dist = a[c];
+              p.state = 3;
             case 3:
-              r = 0;
-              if (0 < c.distBits && 0 > (r = this._readBits(c.distBits))) {
+              c = 0;
+              if (0 < p.distBits && 0 > (c = this._readBits(p.distBits))) {
                 return!0;
               }
-              l = c.dist + r;
-              k = c.len;
-              for (r = n - l;k--;) {
-                h[n++] = h[r++];
+              s = p.dist + c;
+              m = p.len;
+              for (c = d - s;m--;) {
+                e[d++] = e[c++];
               }
-              c.state = 0;
-              if (65536 <= n) {
-                return this._windowPosition = n, !1;
+              p.state = 0;
+              if (65536 <= d) {
+                return this._windowPosition = d, !1;
               }
               break;
           }
         }
         do {
-          r = this._readCode(d);
-          if (0 > r) {
-            return this._windowPosition = n, !0;
-          }
-          if (256 > r) {
-            h[n++] = r;
+          c = this._readCode(b);
+          if (0 > c) {
+            return this._windowPosition = d, !0;
+          }
+          if (256 > c) {
+            e[d++] = c;
           } else {
-            if (256 < r) {
-              this._windowPosition = n;
-              r -= 257;
-              t = y[r];
-              k = p[r];
-              r = 0 === t ? 0 : this._readBits(t);
-              if (0 > r) {
-                return c.state = 1, c.len = k, c.lenBits = t, !0;
+            if (256 < c) {
+              this._windowPosition = d;
+              c -= 257;
+              n = u[c];
+              m = k[c];
+              c = 0 === n ? 0 : this._readBits(n);
+              if (0 > c) {
+                return p.state = 1, p.len = m, p.lenBits = n, !0;
               }
-              k += r;
-              r = this._readCode(f);
-              if (0 > r) {
-                return c.state = 2, c.len = k, !0;
+              m += c;
+              c = this._readCode(f);
+              if (0 > c) {
+                return p.state = 2, p.len = m, !0;
               }
-              t = a[r];
-              l = b[r];
-              r = 0 === t ? 0 : this._readBits(t);
-              if (0 > r) {
-                return c.state = 3, c.len = k, c.dist = l, c.distBits = t, !0;
+              n = h[c];
+              s = a[c];
+              c = 0 === n ? 0 : this._readBits(n);
+              if (0 > c) {
+                return p.state = 3, p.len = m, p.dist = s, p.distBits = n, !0;
               }
-              l += r;
-              for (r = n - l;k--;) {
-                h[n++] = h[r++];
+              s += c;
+              for (c = d - s;m--;) {
+                e[d++] = e[c++];
               }
             } else {
               this._state = 0;
               break;
             }
           }
-        } while (65536 > n);
-        this._windowPosition = n;
+        } while (65536 > d);
+        this._windowPosition = d;
         return!1;
       };
       return f;
-    }(c), k, b, a, n, p, y, v, l = !1, t = function(a) {
-      function f(d) {
-        a.call(this, d);
-        this._verifyHeader = d;
+    }(c), m, a, h, p, k, u, n, s = !1, v = function(b) {
+      function f(f) {
+        b.call(this, f);
+        this._verifyHeader = f;
         this._specialInflate = new SpecialInflate;
-        this._specialInflate.onData = function(a) {
-          this.onData(a);
+        this._specialInflate.onData = function(b) {
+          this.onData(b);
         }.bind(this);
       }
-      __extends(f, a);
-      f.prototype.push = function(a) {
+      __extends(f, b);
+      f.prototype.push = function(b) {
         if (this._verifyHeader) {
           var f;
-          this._buffer ? (f = new Uint8Array(this._buffer.length + a.length), f.set(this._buffer), f.set(a, this._buffer.length), this._buffer = null) : f = new Uint8Array(a);
-          var b = this._processZLibHeader(f, 0, f.length);
-          if (0 === b) {
+          this._buffer ? (f = new Uint8Array(this._buffer.length + b.length), f.set(this._buffer), f.set(b, this._buffer.length), this._buffer = null) : f = new Uint8Array(b);
+          var e = this._processZLibHeader(f, 0, f.length);
+          if (0 === e) {
             this._buffer = f;
             return;
           }
           this._verifyHeader = !0;
-          0 < b && (a = f.subarray(b));
-        }
-        this._error || this._specialInflate.push(a);
+          0 < e && (b = f.subarray(e));
+        }
+        this._specialInflate.push(b);
       };
       f.prototype.close = function() {
         this._specialInflate && (this._specialInflate.close(), this._specialInflate = null);
       };
       return f;
-    }(c), r;
-    (function(a) {
-      a[a.WRITE = 0] = "WRITE";
-      a[a.DONE = 1] = "DONE";
-      a[a.ZLIB_HEADER = 2] = "ZLIB_HEADER";
-    })(r || (r = {}));
-    var u = function() {
-      function a() {
+    }(c), d;
+    (function(b) {
+      b[b.WRITE = 0] = "WRITE";
+      b[b.DONE = 1] = "DONE";
+      b[b.ZLIB_HEADER = 2] = "ZLIB_HEADER";
+    })(d || (d = {}));
+    var e = function() {
+      function b() {
         this.a = 1;
         this.b = 0;
       }
-      a.prototype.update = function(a, d, q) {
-        for (var b = this.a, h = this.b;d < q;++d) {
-          b = (b + (a[d] & 255)) % 65521, h = (h + b) % 65521;
-        }
-        this.a = b;
+      b.prototype.update = function(b, e, d) {
+        for (var a = this.a, h = this.b;e < d;++e) {
+          a = (a + (b[e] & 255)) % 65521, h = (h + a) % 65521;
+        }
+        this.a = a;
         this.b = h;
       };
-      a.prototype.getChecksum = function() {
+      b.prototype.getChecksum = function() {
         return this.b << 16 | this.a;
       };
-      return a;
+      return b;
     }();
-    m.Adler32 = u;
-    r = function() {
-      function a(f) {
-        this._state = (this._writeZlibHeader = f) ? 2 : 0;
-        this._adler32 = f ? new u : null;
-      }
-      a.prototype.push = function(a) {
+    l.Adler32 = e;
+    d = function() {
+      function b(b) {
+        this._state = (this._writeZlibHeader = b) ? 2 : 0;
+        this._adler32 = b ? new e : null;
+      }
+      b.prototype.push = function(b) {
         2 === this._state && (this.onData(new Uint8Array([120, 156])), this._state = 0);
-        for (var d = a.length, q = new Uint8Array(d + 5 * Math.ceil(d / 65535)), b = 0, h = 0;65535 < d;) {
-          q.set(new Uint8Array([0, 255, 255, 0, 0]), b), b += 5, q.set(a.subarray(h, h + 65535), b), h += 65535, b += 65535, d -= 65535;
-        }
-        q.set(new Uint8Array([0, d & 255, d >> 8 & 255, ~d & 255, ~d >> 8 & 255]), b);
-        q.set(a.subarray(h, d), b + 5);
-        this.onData(q);
-        this._adler32 && this._adler32.update(a, 0, d);
-      };
-      a.prototype.finish = function() {
+        for (var e = b.length, d = new Uint8Array(e + 5 * Math.ceil(e / 65535)), a = 0, h = 0;65535 < e;) {
+          d.set(new Uint8Array([0, 255, 255, 0, 0]), a), a += 5, d.set(b.subarray(h, h + 65535), a), h += 65535, a += 65535, e -= 65535;
+        }
+        d.set(new Uint8Array([0, e & 255, e >> 8 & 255, ~e & 255, ~e >> 8 & 255]), a);
+        d.set(b.subarray(h, e), a + 5);
+        this.onData(d);
+        this._adler32 && this._adler32.update(b, 0, e);
+      };
+      b.prototype.close = function() {
         this._state = 1;
         this.onData(new Uint8Array([1, 0, 0, 255, 255]));
         if (this._adler32) {
-          var a = this._adler32.getChecksum();
-          this.onData(new Uint8Array([a & 255, a >> 8 & 255, a >> 16 & 255, a >>> 24 & 255]));
-        }
-      };
-      return a;
+          var b = this._adler32.getChecksum();
+          this.onData(new Uint8Array([b & 255, b >> 8 & 255, b >> 16 & 255, b >>> 24 & 255]));
+        }
+      };
+      return b;
     }();
-    m.Deflate = r;
-  })(g.ArrayUtilities || (g.ArrayUtilities = {}));
+    l.Deflate = d;
+  })(l.ArrayUtilities || (l.ArrayUtilities = {}));
 })(Shumway || (Shumway = {}));
-(function(g) {
-  (function(m) {
-    function e(b, n) {
-      b !== a(b, 0, n) && throwError("RangeError", Errors.ParamRangeError);
+(function(l) {
+  (function(l) {
+    function g(b) {
+      for (var e = new Uint16Array(b), d = 0;d < b;d++) {
+        e[d] = 1024;
+      }
+      return e;
+    }
+    function c(b, e, d, a) {
+      for (var h = 1, p = 0, c = 0;c < d;c++) {
+        var m = a.decodeBit(b, h + e), h = (h << 1) + m, p = p | m << c
+      }
+      return p;
+    }
+    function t(b, e) {
+      var d = [];
+      d.length = e;
+      for (var a = 0;a < e;a++) {
+        d[a] = new k(b);
+      }
+      return d;
+    }
+    var m = function() {
+      function b() {
+        this.pos = this.available = 0;
+        this.buffer = new Uint8Array(2E3);
+      }
+      b.prototype.append = function(b) {
+        var f = this.pos + this.available, e = f + b.length;
+        if (e > this.buffer.length) {
+          for (var d = 2 * this.buffer.length;d < e;) {
+            d *= 2;
+          }
+          e = new Uint8Array(d);
+          e.set(this.buffer);
+          this.buffer = e;
+        }
+        this.buffer.set(b, f);
+        this.available += b.length;
+      };
+      b.prototype.compact = function() {
+        0 !== this.available && (this.buffer.set(this.buffer.subarray(this.pos, this.pos + this.available), 0), this.pos = 0);
+      };
+      b.prototype.readByte = function() {
+        if (0 >= this.available) {
+          throw Error("Unexpected end of file");
+        }
+        this.available--;
+        return this.buffer[this.pos++];
+      };
+      return b;
+    }(), a = function() {
+      function b(f) {
+        this.onData = f;
+        this.processed = 0;
+      }
+      b.prototype.writeBytes = function(b) {
+        this.onData.call(null, b);
+        this.processed += b.length;
+      };
+      return b;
+    }(), h = function() {
+      function b(f) {
+        this.outStream = f;
+        this.buf = null;
+        this.size = this.pos = 0;
+        this.isFull = !1;
+        this.totalPos = this.writePos = 0;
+      }
+      b.prototype.create = function(b) {
+        this.buf = new Uint8Array(b);
+        this.pos = 0;
+        this.size = b;
+        this.isFull = !1;
+        this.totalPos = this.writePos = 0;
+      };
+      b.prototype.putByte = function(b) {
+        this.totalPos++;
+        this.buf[this.pos++] = b;
+        this.pos === this.size && (this.flush(), this.pos = 0, this.isFull = !0);
+      };
+      b.prototype.getByte = function(b) {
+        return this.buf[b <= this.pos ? this.pos - b : this.size - b + this.pos];
+      };
+      b.prototype.flush = function() {
+        this.writePos < this.pos && (this.outStream.writeBytes(this.buf.subarray(this.writePos, this.pos)), this.writePos = this.pos === this.size ? 0 : this.pos);
+      };
+      b.prototype.copyMatch = function(b, f) {
+        for (var e = this.pos, d = this.size, a = this.buf, h = b <= e ? e - b : d - b + e, p = f;0 < p;) {
+          for (var c = Math.min(Math.min(p, d - e), d - h), m = 0;m < c;m++) {
+            var k = a[h++];
+            a[e++] = k;
+          }
+          e === d && (this.pos = e, this.flush(), e = 0, this.isFull = !0);
+          h === d && (h = 0);
+          p -= c;
+        }
+        this.pos = e;
+        this.totalPos += f;
+      };
+      b.prototype.checkDistance = function(b) {
+        return b <= this.pos || this.isFull;
+      };
+      b.prototype.isEmpty = function() {
+        return 0 === this.pos && !this.isFull;
+      };
+      return b;
+    }(), p = function() {
+      function b(f) {
+        this.inStream = f;
+        this.code = this.range = 0;
+        this.corrupted = !1;
+      }
+      b.prototype.init = function() {
+        0 !== this.inStream.readByte() && (this.corrupted = !0);
+        this.range = -1;
+        for (var b = 0, f = 0;4 > f;f++) {
+          b = b << 8 | this.inStream.readByte();
+        }
+        b === this.range && (this.corrupted = !0);
+        this.code = b;
+      };
+      b.prototype.isFinishedOK = function() {
+        return 0 === this.code;
+      };
+      b.prototype.decodeDirectBits = function(b) {
+        var f = 0, e = this.range, d = this.code;
+        do {
+          var e = e >>> 1 | 0, d = d - e | 0, a = d >> 31, d = d + (e & a) | 0;
+          d === e && (this.corrupted = !0);
+          0 <= e && 16777216 > e && (e <<= 8, d = d << 8 | this.inStream.readByte());
+          f = (f << 1) + a + 1 | 0;
+        } while (--b);
+        this.range = e;
+        this.code = d;
+        return f;
+      };
+      b.prototype.decodeBit = function(b, f) {
+        var e = this.range, d = this.code, a = b[f], h = (e >>> 11) * a;
+        d >>> 0 < h ? (a = a + (2048 - a >> 5) | 0, e = h | 0, h = 0) : (a = a - (a >> 5) | 0, d = d - h | 0, e = e - h | 0, h = 1);
+        b[f] = a & 65535;
+        0 <= e && 16777216 > e && (e <<= 8, d = d << 8 | this.inStream.readByte());
+        this.range = e;
+        this.code = d;
+        return h;
+      };
+      return b;
+    }(), k = function() {
+      function b(f) {
+        this.numBits = f;
+        this.probs = g(1 << f);
+      }
+      b.prototype.decode = function(b) {
+        for (var f = 1, e = 0;e < this.numBits;e++) {
+          f = (f << 1) + b.decodeBit(this.probs, f);
+        }
+        return f - (1 << this.numBits);
+      };
+      b.prototype.reverseDecode = function(b) {
+        return c(this.probs, 0, this.numBits, b);
+      };
+      return b;
+    }(), u = function() {
+      function b() {
+        this.choice = g(2);
+        this.lowCoder = t(3, 16);
+        this.midCoder = t(3, 16);
+        this.highCoder = new k(8);
+      }
+      b.prototype.decode = function(b, f) {
+        return 0 === b.decodeBit(this.choice, 0) ? this.lowCoder[f].decode(b) : 0 === b.decodeBit(this.choice, 1) ? 8 + this.midCoder[f].decode(b) : 16 + this.highCoder.decode(b);
+      };
+      return b;
+    }(), n = function() {
+      function b(f, e) {
+        this.rangeDec = new p(f);
+        this.outWindow = new h(e);
+        this.markerIsMandatory = !1;
+        this.dictSizeInProperties = this.dictSize = this.lp = this.pb = this.lc = 0;
+        this.leftToUnpack = this.unpackSize = void 0;
+        this.reps = new Int32Array(4);
+        this.state = 0;
+      }
+      b.prototype.decodeProperties = function(b) {
+        var f = b[0];
+        if (225 <= f) {
+          throw Error("Incorrect LZMA properties");
+        }
+        this.lc = f % 9;
+        f = f / 9 | 0;
+        this.pb = f / 5 | 0;
+        this.lp = f % 5;
+        for (f = this.dictSizeInProperties = 0;4 > f;f++) {
+          this.dictSizeInProperties |= b[f + 1] << 8 * f;
+        }
+        this.dictSize = this.dictSizeInProperties;
+        4096 > this.dictSize && (this.dictSize = 4096);
+      };
+      b.prototype.create = function() {
+        this.outWindow.create(this.dictSize);
+        this.init();
+        this.rangeDec.init();
+        this.reps[0] = 0;
+        this.reps[1] = 0;
+        this.reps[2] = 0;
+        this.state = this.reps[3] = 0;
+        this.leftToUnpack = this.unpackSize;
+      };
+      b.prototype.decodeLiteral = function(b, f) {
+        var e = this.outWindow, d = this.rangeDec, a = 0;
+        e.isEmpty() || (a = e.getByte(1));
+        var h = 1, a = 768 * (((e.totalPos & (1 << this.lp) - 1) << this.lc) + (a >> 8 - this.lc));
+        if (7 <= b) {
+          e = e.getByte(f + 1);
+          do {
+            var p = e >> 7 & 1, e = e << 1, c = d.decodeBit(this.litProbs, a + ((1 + p << 8) + h)), h = h << 1 | c;
+            if (p !== c) {
+              break;
+            }
+          } while (256 > h);
+        }
+        for (;256 > h;) {
+          h = h << 1 | d.decodeBit(this.litProbs, a + h);
+        }
+        return h - 256 & 255;
+      };
+      b.prototype.decodeDistance = function(b) {
+        var f = b;
+        3 < f && (f = 3);
+        b = this.rangeDec;
+        f = this.posSlotDecoder[f].decode(b);
+        if (4 > f) {
+          return f;
+        }
+        var e = (f >> 1) - 1, d = (2 | f & 1) << e;
+        14 > f ? d = d + c(this.posDecoders, d - f, e, b) | 0 : (d = d + (b.decodeDirectBits(e - 4) << 4) | 0, d = d + this.alignDecoder.reverseDecode(b) | 0);
+        return d;
+      };
+      b.prototype.init = function() {
+        this.litProbs = g(768 << this.lc + this.lp);
+        this.posSlotDecoder = t(6, 4);
+        this.alignDecoder = new k(4);
+        this.posDecoders = g(115);
+        this.isMatch = g(192);
+        this.isRep = g(12);
+        this.isRepG0 = g(12);
+        this.isRepG1 = g(12);
+        this.isRepG2 = g(12);
+        this.isRep0Long = g(192);
+        this.lenDecoder = new u;
+        this.repLenDecoder = new u;
+      };
+      b.prototype.decode = function(b) {
+        for (var f = this.rangeDec, a = this.outWindow, h = this.pb, p = this.dictSize, c = this.markerIsMandatory, m = this.leftToUnpack, k = this.isMatch, n = this.isRep, u = this.isRepG0, g = this.isRepG1, l = this.isRepG2, r = this.isRep0Long, t = this.lenDecoder, y = this.repLenDecoder, z = this.reps[0], B = this.reps[1], x = this.reps[2], E = this.reps[3], A = this.state;;) {
+          if (b && 48 > f.inStream.available) {
+            this.outWindow.flush();
+            break;
+          }
+          if (0 === m && !c && (this.outWindow.flush(), f.isFinishedOK())) {
+            return d;
+          }
+          var D = a.totalPos & (1 << h) - 1;
+          if (0 === f.decodeBit(k, (A << 4) + D)) {
+            if (0 === m) {
+              return s;
+            }
+            a.putByte(this.decodeLiteral(A, z));
+            A = 4 > A ? 0 : 10 > A ? A - 3 : A - 6;
+            m--;
+          } else {
+            if (0 !== f.decodeBit(n, A)) {
+              if (0 === m || a.isEmpty()) {
+                return s;
+              }
+              if (0 === f.decodeBit(u, A)) {
+                if (0 === f.decodeBit(r, (A << 4) + D)) {
+                  A = 7 > A ? 9 : 11;
+                  a.putByte(a.getByte(z + 1));
+                  m--;
+                  continue;
+                }
+              } else {
+                var F;
+                0 === f.decodeBit(g, A) ? F = B : (0 === f.decodeBit(l, A) ? F = x : (F = E, E = x), x = B);
+                B = z;
+                z = F;
+              }
+              D = y.decode(f, D);
+              A = 7 > A ? 8 : 11;
+            } else {
+              E = x;
+              x = B;
+              B = z;
+              D = t.decode(f, D);
+              A = 7 > A ? 7 : 10;
+              z = this.decodeDistance(D);
+              if (-1 === z) {
+                return this.outWindow.flush(), f.isFinishedOK() ? v : s;
+              }
+              if (0 === m || z >= p || !a.checkDistance(z)) {
+                return s;
+              }
+            }
+            D += 2;
+            F = !1;
+            void 0 !== m && m < D && (D = m, F = !0);
+            a.copyMatch(z + 1, D);
+            m -= D;
+            if (F) {
+              return s;
+            }
+          }
+        }
+        this.state = A;
+        this.reps[0] = z;
+        this.reps[1] = B;
+        this.reps[2] = x;
+        this.reps[3] = E;
+        this.leftToUnpack = m;
+        return e;
+      };
+      return b;
+    }(), s = 0, v = 1, d = 2, e = 3, b;
+    (function(b) {
+      b[b.WAIT_FOR_LZMA_HEADER = 0] = "WAIT_FOR_LZMA_HEADER";
+      b[b.WAIT_FOR_SWF_HEADER = 1] = "WAIT_FOR_SWF_HEADER";
+      b[b.PROCESS_DATA = 2] = "PROCESS_DATA";
+      b[b.CLOSED = 3] = "CLOSED";
+    })(b || (b = {}));
+    b = function() {
+      function b(f) {
+        void 0 === f && (f = !1);
+        this._state = f ? 1 : 0;
+        this.buffer = null;
+      }
+      b.prototype.push = function(b) {
+        if (2 > this._state) {
+          var f = this.buffer ? this.buffer.length : 0, d = (1 === this._state ? 17 : 13) + 5;
+          if (f + b.length < d) {
+            d = new Uint8Array(f + b.length);
+            0 < f && d.set(this.buffer);
+            d.set(b, f);
+            this.buffer = d;
+            return;
+          }
+          var h = new Uint8Array(d);
+          0 < f && h.set(this.buffer);
+          h.set(b.subarray(0, d - f), f);
+          this._inStream = new m;
+          this._inStream.append(h.subarray(d - 5));
+          this._outStream = new a(function(b) {
+            this.onData.call(null, b);
+          }.bind(this));
+          this._decoder = new n(this._inStream, this._outStream);
+          if (1 === this._state) {
+            this._decoder.decodeProperties(h.subarray(12, 17)), this._decoder.markerIsMandatory = !1, this._decoder.unpackSize = ((h[4] | h[5] << 8 | h[6] << 16 | h[7] << 24) >>> 0) - 8;
+          } else {
+            this._decoder.decodeProperties(h.subarray(0, 5));
+            for (var f = 0, p = !1, c = 0;8 > c;c++) {
+              var k = h[5 + c];
+              255 !== k && (p = !0);
+              f |= k << 8 * c;
+            }
+            this._decoder.markerIsMandatory = !p;
+            this._decoder.unpackSize = p ? f : void 0;
+          }
+          this._decoder.create();
+          b = b.subarray(d);
+          this._state = 2;
+        }
+        this._inStream.append(b);
+        b = this._decoder.decode(!0);
+        this._inStream.compact();
+        b !== e && this._checkError(b);
+      };
+      b.prototype.close = function() {
+        this._state = 3;
+        var b = this._decoder.decode(!1);
+        this._checkError(b);
+        this._decoder = null;
+      };
+      b.prototype._checkError = function(b) {
+        var f;
+        b === s ? f = "LZMA decoding error" : b === e ? f = "Decoding is not complete" : b === v ? void 0 !== this._decoder.unpackSize && this._decoder.unpackSize !== this._outStream.processed && (f = "Finished with end marker before than specified size") : f = "Internal LZMA Error";
+        if (f && this.onError) {
+          this.onError(f);
+        }
+      };
+      return b;
+    }();
+    l.LzmaDecoder = b;
+  })(l.ArrayUtilities || (l.ArrayUtilities = {}));
+})(Shumway || (Shumway = {}));
+(function(l) {
+  (function(r) {
+    function g(a, d) {
+      a !== h(a, 0, d) && throwError("RangeError", Errors.ParamRangeError);
     }
     function c(a) {
       return "string" === typeof a ? a : void 0 == a ? null : a + "";
     }
-    var w = g.Debug.notImplemented, k = g.StringUtilities.utf8decode, b = g.StringUtilities.utf8encode, a = g.NumberUtilities.clamp, n = function() {
-      return function(a, b, n) {
+    var t = l.Debug.notImplemented, m = l.StringUtilities.utf8decode, a = l.StringUtilities.utf8encode, h = l.NumberUtilities.clamp, p = function() {
+      return function(a, d, e) {
         this.buffer = a;
-        this.length = b;
-        this.littleEndian = n;
+        this.length = d;
+        this.littleEndian = e;
       };
     }();
-    m.PlainObjectDataBuffer = n;
-    for (var p = new Uint32Array(33), y = 1, v = 0;32 >= y;y++) {
-      p[y] = v = v << 1 | 1;
+    r.PlainObjectDataBuffer = p;
+    for (var k = new Uint32Array(33), u = 1, n = 0;32 >= u;u++) {
+      k[u] = n = n << 1 | 1;
     }
-    var l;
+    var s;
     (function(a) {
       a[a.U8 = 1] = "U8";
       a[a.I32 = 2] = "I32";
       a[a.F32 = 4] = "F32";
-    })(l || (l = {}));
-    y = function() {
-      function l(a) {
-        void 0 === a && (a = l.INITIAL_SIZE);
-        this._buffer || (this._buffer = new ArrayBuffer(a), this._position = this._length = 0, this._resetViews(), this._littleEndian = l._nativeLittleEndian, this._bitLength = this._bitBuffer = 0);
-      }
-      l.FromArrayBuffer = function(a, b) {
-        void 0 === b && (b = -1);
-        var h = Object.create(l.prototype);
-        h._buffer = a;
-        h._length = -1 === b ? a.byteLength : b;
-        h._position = 0;
-        h._resetViews();
-        h._littleEndian = l._nativeLittleEndian;
-        h._bitBuffer = 0;
-        h._bitLength = 0;
-        return h;
-      };
-      l.FromPlainObject = function(a) {
-        var b = l.FromArrayBuffer(a.buffer, a.length);
-        b._littleEndian = a.littleEndian;
+    })(s || (s = {}));
+    u = function() {
+      function n(d) {
+        void 0 === d && (d = n.INITIAL_SIZE);
+        this._buffer || (this._buffer = new ArrayBuffer(d), this._position = this._length = 0, this._resetViews(), this._littleEndian = n._nativeLittleEndian, this._bitLength = this._bitBuffer = 0);
+      }
+      n.FromArrayBuffer = function(d, e) {
+        void 0 === e && (e = -1);
+        var b = Object.create(n.prototype);
+        b._buffer = d;
+        b._length = -1 === e ? d.byteLength : e;
+        b._position = 0;
+        b._resetViews();
+        b._littleEndian = n._nativeLittleEndian;
+        b._bitBuffer = 0;
+        b._bitLength = 0;
         return b;
       };
-      l.prototype.toPlainObject = function() {
-        return new n(this._buffer, this._length, this._littleEndian);
-      };
-      l.prototype._resetViews = function() {
+      n.FromPlainObject = function(d) {
+        var e = n.FromArrayBuffer(d.buffer, d.length);
+        e._littleEndian = d.littleEndian;
+        return e;
+      };
+      n.prototype.toPlainObject = function() {
+        return new p(this._buffer, this._length, this._littleEndian);
+      };
+      n.prototype._resetViews = function() {
         this._u8 = new Uint8Array(this._buffer);
         this._f32 = this._i32 = null;
       };
-      l.prototype._requestViews = function(a) {
-        0 === (this._buffer.byteLength & 3) && (null === this._i32 && a & 2 && (this._i32 = new Int32Array(this._buffer)), null === this._f32 && a & 4 && (this._f32 = new Float32Array(this._buffer)));
-      };
-      l.prototype.getBytes = function() {
+      n.prototype._requestViews = function(d) {
+        0 === (this._buffer.byteLength & 3) && (null === this._i32 && d & 2 && (this._i32 = new Int32Array(this._buffer)), null === this._f32 && d & 4 && (this._f32 = new Float32Array(this._buffer)));
+      };
+      n.prototype.getBytes = function() {
         return new Uint8Array(this._buffer, 0, this._length);
       };
-      l.prototype._ensureCapacity = function(a) {
-        var b = this._buffer;
-        if (b.byteLength < a) {
-          for (var h = Math.max(b.byteLength, 1);h < a;) {
-            h *= 2;
-          }
-          a = l._arrayBufferPool.acquire(h);
-          h = this._u8;
-          this._buffer = a;
+      n.prototype._ensureCapacity = function(d) {
+        var e = this._buffer;
+        if (e.byteLength < d) {
+          for (var b = Math.max(e.byteLength, 1);b < d;) {
+            b *= 2;
+          }
+          d = n._arrayBufferPool.acquire(b);
+          b = this._u8;
+          this._buffer = d;
           this._resetViews();
-          this._u8.set(h);
-          l._arrayBufferPool.release(b);
-        }
-      };
-      l.prototype.clear = function() {
+          this._u8.set(b);
+          n._arrayBufferPool.release(e);
+        }
+      };
+      n.prototype.clear = function() {
         this._position = this._length = 0;
       };
-      l.prototype.readBoolean = function() {
+      n.prototype.readBoolean = function() {
         return 0 !== this.readUnsignedByte();
       };
-      l.prototype.readByte = function() {
+      n.prototype.readByte = function() {
         return this.readUnsignedByte() << 24 >> 24;
       };
-      l.prototype.readUnsignedByte = function() {
+      n.prototype.readUnsignedByte = function() {
         this._position + 1 > this._length && throwError("EOFError", Errors.EOFError);
         return this._u8[this._position++];
       };
-      l.prototype.readBytes = function(a, b) {
-        var h = 0;
-        void 0 === h && (h = 0);
-        void 0 === b && (b = 0);
-        var f = this._position;
-        h || (h = 0);
-        b || (b = this._length - f);
-        f + b > this._length && throwError("EOFError", Errors.EOFError);
-        a.length < h + b && (a._ensureCapacity(h + b), a.length = h + b);
-        a._u8.set(new Uint8Array(this._buffer, f, b), h);
-        this._position += b;
-      };
-      l.prototype.readShort = function() {
-        return this.readUnsignedShort() << 16 >> 16;
-      };
-      l.prototype.readUnsignedShort = function() {
-        var a = this._u8, b = this._position;
-        b + 2 > this._length && throwError("EOFError", Errors.EOFError);
-        var h = a[b + 0], a = a[b + 1];
-        this._position = b + 2;
-        return this._littleEndian ? a << 8 | h : h << 8 | a;
-      };
-      l.prototype.readInt = function() {
-        var a = this._u8, b = this._position;
-        b + 4 > this._length && throwError("EOFError", Errors.EOFError);
-        var h = a[b + 0], f = a[b + 1], d = a[b + 2], a = a[b + 3];
-        this._position = b + 4;
-        return this._littleEndian ? a << 24 | d << 16 | f << 8 | h : h << 24 | f << 16 | d << 8 | a;
-      };
-      l.prototype.readUnsignedInt = function() {
-        return this.readInt() >>> 0;
-      };
-      l.prototype.readFloat = function() {
-        var a = this._position;
-        a + 4 > this._length && throwError("EOFError", Errors.EOFError);
-        this._position = a + 4;
-        this._requestViews(4);
-        if (this._littleEndian && 0 === (a & 3) && this._f32) {
-          return this._f32[a >> 2];
-        }
-        var b = this._u8, h = g.IntegerUtilities.u8;
-        this._littleEndian ? (h[0] = b[a + 0], h[1] = b[a + 1], h[2] = b[a + 2], h[3] = b[a + 3]) : (h[3] = b[a + 0], h[2] = b[a + 1], h[1] = b[a + 2], h[0] = b[a + 3]);
-        return g.IntegerUtilities.f32[0];
-      };
-      l.prototype.readDouble = function() {
-        var a = this._u8, b = this._position;
-        b + 8 > this._length && throwError("EOFError", Errors.EOFError);
-        var h = g.IntegerUtilities.u8;
-        this._littleEndian ? (h[0] = a[b + 0], h[1] = a[b + 1], h[2] = a[b + 2], h[3] = a[b + 3], h[4] = a[b + 4], h[5] = a[b + 5], h[6] = a[b + 6], h[7] = a[b + 7]) : (h[0] = a[b + 7], h[1] = a[b + 6], h[2] = a[b + 5], h[3] = a[b + 4], h[4] = a[b + 3], h[5] = a[b + 2], h[6] = a[b + 1], h[7] = a[b + 0]);
-        this._position = b + 8;
-        return g.IntegerUtilities.f64[0];
-      };
-      l.prototype.writeBoolean = function(a) {
-        this.writeByte(a ? 1 : 0);
-      };
-      l.prototype.writeByte = function(a) {
-        var b = this._position + 1;
-        this._ensureCapacity(b);
-        this._u8[this._position++] = a;
-        b > this._length && (this._length = b);
-      };
-      l.prototype.writeUnsignedByte = function(a) {
-        var b = this._position + 1;
-        this._ensureCapacity(b);
-        this._u8[this._position++] = a;
-        b > this._length && (this._length = b);
-      };
-      l.prototype.writeRawBytes = function(a) {
-        var b = this._position + a.length;
-        this._ensureCapacity(b);
-        this._u8.set(a, this._position);
-        this._position = b;
-        b > this._length && (this._length = b);
-      };
-      l.prototype.writeBytes = function(a, b, h) {
+      n.prototype.readBytes = function(d, e) {
+        var b = 0;
         void 0 === b && (b = 0);
-        void 0 === h && (h = 0);
-        g.isNullOrUndefined(a) && throwError("TypeError", Errors.NullPointerError, "bytes");
-        2 > arguments.length && (b = 0);
-        3 > arguments.length && (h = 0);
-        e(b, a.length);
-        e(b + h, a.length);
-        0 === h && (h = a.length - b);
-        this.writeRawBytes(new Int8Array(a._buffer, b, h));
-      };
-      l.prototype.writeShort = function(a) {
-        this.writeUnsignedShort(a);
-      };
-      l.prototype.writeUnsignedShort = function(a) {
-        var b = this._position;
-        this._ensureCapacity(b + 2);
-        var h = this._u8;
-        this._littleEndian ? (h[b + 0] = a, h[b + 1] = a >> 8) : (h[b + 0] = a >> 8, h[b + 1] = a);
-        this._position = b += 2;
-        b > this._length && (this._length = b);
-      };
-      l.prototype.writeInt = function(a) {
-        this.writeUnsignedInt(a);
-      };
-      l.prototype.write2Ints = function(a, b) {
-        this.write2UnsignedInts(a, b);
-      };
-      l.prototype.write4Ints = function(a, b, h, f) {
-        this.write4UnsignedInts(a, b, h, f);
-      };
-      l.prototype.writeUnsignedInt = function(a) {
-        var b = this._position;
-        this._ensureCapacity(b + 4);
+        void 0 === e && (e = 0);
+        var f = this._position;
+        b || (b = 0);
+        e || (e = this._length - f);
+        f + e > this._length && throwError("EOFError", Errors.EOFError);
+        d.length < b + e && (d._ensureCapacity(b + e), d.length = b + e);
+        d._u8.set(new Uint8Array(this._buffer, f, e), b);
+        this._position += e;
+      };
+      n.prototype.readShort = function() {
+        return this.readUnsignedShort() << 16 >> 16;
+      };
+      n.prototype.readUnsignedShort = function() {
+        var d = this._u8, e = this._position;
+        e + 2 > this._length && throwError("EOFError", Errors.EOFError);
+        var b = d[e + 0], d = d[e + 1];
+        this._position = e + 2;
+        return this._littleEndian ? d << 8 | b : b << 8 | d;
+      };
+      n.prototype.readInt = function() {
+        var d = this._u8, e = this._position;
+        e + 4 > this._length && throwError("EOFError", Errors.EOFError);
+        var b = d[e + 0], f = d[e + 1], a = d[e + 2], d = d[e + 3];
+        this._position = e + 4;
+        return this._littleEndian ? d << 24 | a << 16 | f << 8 | b : b << 24 | f << 16 | a << 8 | d;
+      };
+      n.prototype.readUnsignedInt = function() {
+        return this.readInt() >>> 0;
+      };
+      n.prototype.readFloat = function() {
+        var d = this._position;
+        d + 4 > this._length && throwError("EOFError", Errors.EOFError);
+        this._position = d + 4;
+        this._requestViews(4);
+        if (this._littleEndian && 0 === (d & 3) && this._f32) {
+          return this._f32[d >> 2];
+        }
+        var e = this._u8, b = l.IntegerUtilities.u8;
+        this._littleEndian ? (b[0] = e[d + 0], b[1] = e[d + 1], b[2] = e[d + 2], b[3] = e[d + 3]) : (b[3] = e[d + 0], b[2] = e[d + 1], b[1] = e[d + 2], b[0] = e[d + 3]);
+        return l.IntegerUtilities.f32[0];
+      };
+      n.prototype.readDouble = function() {
+        var d = this._u8, e = this._position;
+        e + 8 > this._length && throwError("EOFError", Errors.EOFError);
+        var b = l.IntegerUtilities.u8;
+        this._littleEndian ? (b[0] = d[e + 0], b[1] = d[e + 1], b[2] = d[e + 2], b[3] = d[e + 3], b[4] = d[e + 4], b[5] = d[e + 5], b[6] = d[e + 6], b[7] = d[e + 7]) : (b[0] = d[e + 7], b[1] = d[e + 6], b[2] = d[e + 5], b[3] = d[e + 4], b[4] = d[e + 3], b[5] = d[e + 2], b[6] = d[e + 1], b[7] = d[e + 0]);
+        this._position = e + 8;
+        return l.IntegerUtilities.f64[0];
+      };
+      n.prototype.writeBoolean = function(d) {
+        this.writeByte(d ? 1 : 0);
+      };
+      n.prototype.writeByte = function(d) {
+        var e = this._position + 1;
+        this._ensureCapacity(e);
+        this._u8[this._position++] = d;
+        e > this._length && (this._length = e);
+      };
+      n.prototype.writeUnsignedByte = function(d) {
+        var e = this._position + 1;
+        this._ensureCapacity(e);
+        this._u8[this._position++] = d;
+        e > this._length && (this._length = e);
+      };
+      n.prototype.writeRawBytes = function(d) {
+        var e = this._position + d.length;
+        this._ensureCapacity(e);
+        this._u8.set(d, this._position);
+        this._position = e;
+        e > this._length && (this._length = e);
+      };
+      n.prototype.writeBytes = function(d, e, b) {
+        void 0 === e && (e = 0);
+        void 0 === b && (b = 0);
+        l.isNullOrUndefined(d) && throwError("TypeError", Errors.NullPointerError, "bytes");
+        2 > arguments.length && (e = 0);
+        3 > arguments.length && (b = 0);
+        g(e, d.length);
+        g(e + b, d.length);
+        0 === b && (b = d.length - e);
+        this.writeRawBytes(new Int8Array(d._buffer, e, b));
+      };
+      n.prototype.writeShort = function(d) {
+        this.writeUnsignedShort(d);
+      };
+      n.prototype.writeUnsignedShort = function(d) {
+        var e = this._position;
+        this._ensureCapacity(e + 2);
+        var b = this._u8;
+        this._littleEndian ? (b[e + 0] = d, b[e + 1] = d >> 8) : (b[e + 0] = d >> 8, b[e + 1] = d);
+        this._position = e += 2;
+        e > this._length && (this._length = e);
+      };
+      n.prototype.writeInt = function(d) {
+        this.writeUnsignedInt(d);
+      };
+      n.prototype.write2Ints = function(d, e) {
+        this.write2UnsignedInts(d, e);
+      };
+      n.prototype.write4Ints = function(d, e, b, f) {
+        this.write4UnsignedInts(d, e, b, f);
+      };
+      n.prototype.writeUnsignedInt = function(d) {
+        var e = this._position;
+        this._ensureCapacity(e + 4);
         this._requestViews(2);
-        if (this._littleEndian === l._nativeLittleEndian && 0 === (b & 3) && this._i32) {
-          this._i32[b >> 2] = a;
+        if (this._littleEndian === n._nativeLittleEndian && 0 === (e & 3) && this._i32) {
+          this._i32[e >> 2] = d;
         } else {
-          var h = this._u8;
-          this._littleEndian ? (h[b + 0] = a, h[b + 1] = a >> 8, h[b + 2] = a >> 16, h[b + 3] = a >> 24) : (h[b + 0] = a >> 24, h[b + 1] = a >> 16, h[b + 2] = a >> 8, h[b + 3] = a);
-        }
-        this._position = b += 4;
-        b > this._length && (this._length = b);
-      };
-      l.prototype.write2UnsignedInts = function(a, b) {
-        var h = this._position;
-        this._ensureCapacity(h + 8);
-        this._requestViews(2);
-        this._littleEndian === l._nativeLittleEndian && 0 === (h & 3) && this._i32 ? (this._i32[(h >> 2) + 0] = a, this._i32[(h >> 2) + 1] = b, this._position = h += 8, h > this._length && (this._length = h)) : (this.writeUnsignedInt(a), this.writeUnsignedInt(b));
-      };
-      l.prototype.write4UnsignedInts = function(a, b, h, f) {
-        var d = this._position;
-        this._ensureCapacity(d + 16);
-        this._requestViews(2);
-        this._littleEndian === l._nativeLittleEndian && 0 === (d & 3) && this._i32 ? (this._i32[(d >> 2) + 0] = a, this._i32[(d >> 2) + 1] = b, this._i32[(d >> 2) + 2] = h, this._i32[(d >> 2) + 3] = f, this._position = d += 16, d > this._length && (this._length = d)) : (this.writeUnsignedInt(a), this.writeUnsignedInt(b), this.writeUnsignedInt(h), this.writeUnsignedInt(f));
-      };
-      l.prototype.writeFloat = function(a) {
-        var b = this._position;
-        this._ensureCapacity(b + 4);
-        this._requestViews(4);
-        if (this._littleEndian === l._nativeLittleEndian && 0 === (b & 3) && this._f32) {
-          this._f32[b >> 2] = a;
-        } else {
-          var h = this._u8;
-          g.IntegerUtilities.f32[0] = a;
-          a = g.IntegerUtilities.u8;
-          this._littleEndian ? (h[b + 0] = a[0], h[b + 1] = a[1], h[b + 2] = a[2], h[b + 3] = a[3]) : (h[b + 0] = a[3], h[b + 1] = a[2], h[b + 2] = a[1], h[b + 3] = a[0]);
-        }
-        this._position = b += 4;
-        b > this._length && (this._length = b);
-      };
-      l.prototype.write6Floats = function(a, b, h, f, d, q) {
-        var n = this._position;
-        this._ensureCapacity(n + 24);
-        this._requestViews(4);
-        this._littleEndian === l._nativeLittleEndian && 0 === (n & 3) && this._f32 ? (this._f32[(n >> 2) + 0] = a, this._f32[(n >> 2) + 1] = b, this._f32[(n >> 2) + 2] = h, this._f32[(n >> 2) + 3] = f, this._f32[(n >> 2) + 4] = d, this._f32[(n >> 2) + 5] = q, this._position = n += 24, n > this._length && (this._length = n)) : (this.writeFloat(a), this.writeFloat(b), this.writeFloat(h), this.writeFloat(f), this.writeFloat(d), this.writeFloat(q));
-      };
-      l.prototype.writeDouble = function(a) {
+          var b = this._u8;
+          this._littleEndian ? (b[e + 0] = d, b[e + 1] = d >> 8, b[e + 2] = d >> 16, b[e + 3] = d >> 24) : (b[e + 0] = d >> 24, b[e + 1] = d >> 16, b[e + 2] = d >> 8, b[e + 3] = d);
+        }
+        this._position = e += 4;
+        e > this._length && (this._length = e);
+      };
+      n.prototype.write2UnsignedInts = function(d, e) {
         var b = this._position;
         this._ensureCapacity(b + 8);
-        var h = this._u8;
-        g.IntegerUtilities.f64[0] = a;
-        a = g.IntegerUtilities.u8;
-        this._littleEndian ? (h[b + 0] = a[0], h[b + 1] = a[1], h[b + 2] = a[2], h[b + 3] = a[3], h[b + 4] = a[4], h[b + 5] = a[5], h[b + 6] = a[6], h[b + 7] = a[7]) : (h[b + 0] = a[7], h[b + 1] = a[6], h[b + 2] = a[5], h[b + 3] = a[4], h[b + 4] = a[3], h[b + 5] = a[2], h[b + 6] = a[1], h[b + 7] = a[0]);
-        this._position = b += 8;
-        b > this._length && (this._length = b);
-      };
-      l.prototype.readRawBytes = function() {
+        this._requestViews(2);
+        this._littleEndian === n._nativeLittleEndian && 0 === (b & 3) && this._i32 ? (this._i32[(b >> 2) + 0] = d, this._i32[(b >> 2) + 1] = e, this._position = b += 8, b > this._length && (this._length = b)) : (this.writeUnsignedInt(d), this.writeUnsignedInt(e));
+      };
+      n.prototype.write4UnsignedInts = function(d, e, b, f) {
+        var a = this._position;
+        this._ensureCapacity(a + 16);
+        this._requestViews(2);
+        this._littleEndian === n._nativeLittleEndian && 0 === (a & 3) && this._i32 ? (this._i32[(a >> 2) + 0] = d, this._i32[(a >> 2) + 1] = e, this._i32[(a >> 2) + 2] = b, this._i32[(a >> 2) + 3] = f, this._position = a += 16, a > this._length && (this._length = a)) : (this.writeUnsignedInt(d), this.writeUnsignedInt(e), this.writeUnsignedInt(b), this.writeUnsignedInt(f));
+      };
+      n.prototype.writeFloat = function(d) {
+        var e = this._position;
+        this._ensureCapacity(e + 4);
+        this._requestViews(4);
+        if (this._littleEndian === n._nativeLittleEndian && 0 === (e & 3) && this._f32) {
+          this._f32[e >> 2] = d;
+        } else {
+          var b = this._u8;
+          l.IntegerUtilities.f32[0] = d;
+          d = l.IntegerUtilities.u8;
+          this._littleEndian ? (b[e + 0] = d[0], b[e + 1] = d[1], b[e + 2] = d[2], b[e + 3] = d[3]) : (b[e + 0] = d[3], b[e + 1] = d[2], b[e + 2] = d[1], b[e + 3] = d[0]);
+        }
+        this._position = e += 4;
+        e > this._length && (this._length = e);
+      };
+      n.prototype.write6Floats = function(d, e, b, f, a, h) {
+        var p = this._position;
+        this._ensureCapacity(p + 24);
+        this._requestViews(4);
+        this._littleEndian === n._nativeLittleEndian && 0 === (p & 3) && this._f32 ? (this._f32[(p >> 2) + 0] = d, this._f32[(p >> 2) + 1] = e, this._f32[(p >> 2) + 2] = b, this._f32[(p >> 2) + 3] = f, this._f32[(p >> 2) + 4] = a, this._f32[(p >> 2) + 5] = h, this._position = p += 24, p > this._length && (this._length = p)) : (this.writeFloat(d), this.writeFloat(e), this.writeFloat(b), this.writeFloat(f), this.writeFloat(a), this.writeFloat(h));
+      };
+      n.prototype.writeDouble = function(d) {
+        var e = this._position;
+        this._ensureCapacity(e + 8);
+        var b = this._u8;
+        l.IntegerUtilities.f64[0] = d;
+        d = l.IntegerUtilities.u8;
+        this._littleEndian ? (b[e + 0] = d[0], b[e + 1] = d[1], b[e + 2] = d[2], b[e + 3] = d[3], b[e + 4] = d[4], b[e + 5] = d[5], b[e + 6] = d[6], b[e + 7] = d[7]) : (b[e + 0] = d[7], b[e + 1] = d[6], b[e + 2] = d[5], b[e + 3] = d[4], b[e + 4] = d[3], b[e + 5] = d[2], b[e + 6] = d[1], b[e + 7] = d[0]);
+        this._position = e += 8;
+        e > this._length && (this._length = e);
+      };
+      n.prototype.readRawBytes = function() {
         return new Int8Array(this._buffer, 0, this._length);
       };
-      l.prototype.writeUTF = function(a) {
-        a = c(a);
-        a = k(a);
-        this.writeShort(a.length);
-        this.writeRawBytes(a);
-      };
-      l.prototype.writeUTFBytes = function(a) {
-        a = c(a);
-        a = k(a);
-        this.writeRawBytes(a);
-      };
-      l.prototype.readUTF = function() {
+      n.prototype.writeUTF = function(d) {
+        d = c(d);
+        d = m(d);
+        this.writeShort(d.length);
+        this.writeRawBytes(d);
+      };
+      n.prototype.writeUTFBytes = function(d) {
+        d = c(d);
+        d = m(d);
+        this.writeRawBytes(d);
+      };
+      n.prototype.readUTF = function() {
         return this.readUTFBytes(this.readShort());
       };
-      l.prototype.readUTFBytes = function(a) {
-        a >>>= 0;
-        var n = this._position;
-        n + a > this._length && throwError("EOFError", Errors.EOFError);
-        this._position += a;
-        return b(new Int8Array(this._buffer, n, a));
-      };
-      Object.defineProperty(l.prototype, "length", {get:function() {
+      n.prototype.readUTFBytes = function(d) {
+        d >>>= 0;
+        var e = this._position;
+        e + d > this._length && throwError("EOFError", Errors.EOFError);
+        this._position += d;
+        return a(new Int8Array(this._buffer, e, d));
+      };
+      Object.defineProperty(n.prototype, "length", {get:function() {
         return this._length;
-      }, set:function(b) {
-        b >>>= 0;
-        b > this._buffer.byteLength && this._ensureCapacity(b);
-        this._length = b;
-        this._position = a(this._position, 0, this._length);
+      }, set:function(d) {
+        d >>>= 0;
+        d > this._buffer.byteLength && this._ensureCapacity(d);
+        this._length = d;
+        this._position = h(this._position, 0, this._length);
       }, enumerable:!0, configurable:!0});
-      Object.defineProperty(l.prototype, "bytesAvailable", {get:function() {
+      Object.defineProperty(n.prototype, "bytesAvailable", {get:function() {
         return this._length - this._position;
       }, enumerable:!0, configurable:!0});
-      Object.defineProperty(l.prototype, "position", {get:function() {
+      Object.defineProperty(n.prototype, "position", {get:function() {
         return this._position;
-      }, set:function(a) {
-        this._position = a >>> 0;
+      }, set:function(d) {
+        this._position = d >>> 0;
       }, enumerable:!0, configurable:!0});
-      Object.defineProperty(l.prototype, "buffer", {get:function() {
+      Object.defineProperty(n.prototype, "buffer", {get:function() {
         return this._buffer;
       }, enumerable:!0, configurable:!0});
-      Object.defineProperty(l.prototype, "bytes", {get:function() {
+      Object.defineProperty(n.prototype, "bytes", {get:function() {
         return this._u8;
       }, enumerable:!0, configurable:!0});
-      Object.defineProperty(l.prototype, "ints", {get:function() {
+      Object.defineProperty(n.prototype, "ints", {get:function() {
         this._requestViews(2);
         return this._i32;
       }, enumerable:!0, configurable:!0});
-      Object.defineProperty(l.prototype, "objectEncoding", {get:function() {
+      Object.defineProperty(n.prototype, "objectEncoding", {get:function() {
         return this._objectEncoding;
-      }, set:function(a) {
-        this._objectEncoding = a >>> 0;
+      }, set:function(d) {
+        this._objectEncoding = d >>> 0;
       }, enumerable:!0, configurable:!0});
-      Object.defineProperty(l.prototype, "endian", {get:function() {
+      Object.defineProperty(n.prototype, "endian", {get:function() {
         return this._littleEndian ? "littleEndian" : "bigEndian";
-      }, set:function(a) {
-        a = c(a);
-        this._littleEndian = "auto" === a ? l._nativeLittleEndian : "littleEndian" === a;
+      }, set:function(d) {
+        d = c(d);
+        this._littleEndian = "auto" === d ? n._nativeLittleEndian : "littleEndian" === d;
       }, enumerable:!0, configurable:!0});
-      l.prototype.toString = function() {
-        return b(new Int8Array(this._buffer, 0, this._length));
-      };
-      l.prototype.toBlob = function(a) {
-        return new Blob([new Int8Array(this._buffer, this._position, this._length)], {type:a});
-      };
-      l.prototype.writeMultiByte = function(a, b) {
-        w("packageInternal flash.utils.ObjectOutput::writeMultiByte");
-      };
-      l.prototype.readMultiByte = function(a, b) {
-        w("packageInternal flash.utils.ObjectInput::readMultiByte");
-      };
-      l.prototype.getValue = function(a) {
-        a |= 0;
-        return a >= this._length ? void 0 : this._u8[a];
-      };
-      l.prototype.setValue = function(a, b) {
-        a |= 0;
-        var h = a + 1;
-        this._ensureCapacity(h);
-        this._u8[a] = b;
-        h > this._length && (this._length = h);
-      };
-      l.prototype.readFixed = function() {
+      n.prototype.toString = function() {
+        return a(new Int8Array(this._buffer, 0, this._length));
+      };
+      n.prototype.toBlob = function(d) {
+        return new Blob([new Int8Array(this._buffer, this._position, this._length)], {type:d});
+      };
+      n.prototype.writeMultiByte = function(d, e) {
+        t("packageInternal flash.utils.ObjectOutput::writeMultiByte");
+      };
+      n.prototype.readMultiByte = function(d, e) {
+        t("packageInternal flash.utils.ObjectInput::readMultiByte");
+      };
+      n.prototype.getValue = function(d) {
+        d |= 0;
+        return d >= this._length ? void 0 : this._u8[d];
+      };
+      n.prototype.setValue = function(d, e) {
+        d |= 0;
+        var b = d + 1;
+        this._ensureCapacity(b);
+        this._u8[d] = e;
+        b > this._length && (this._length = b);
+      };
+      n.prototype.readFixed = function() {
         return this.readInt() / 65536;
       };
-      l.prototype.readFixed8 = function() {
+      n.prototype.readFixed8 = function() {
         return this.readShort() / 256;
       };
-      l.prototype.readFloat16 = function() {
-        var a = this.readUnsignedShort(), b = a >> 15 ? -1 : 1, h = (a & 31744) >> 10, a = a & 1023;
-        return h ? 31 === h ? a ? NaN : Infinity * b : b * Math.pow(2, h - 15) * (1 + a / 1024) : a / 1024 * Math.pow(2, -14) * b;
-      };
-      l.prototype.readEncodedU32 = function() {
-        var a = this.readUnsignedByte();
-        if (!(a & 128)) {
-          return a;
-        }
-        a = a & 127 | this.readUnsignedByte() << 7;
-        if (!(a & 16384)) {
-          return a;
-        }
-        a = a & 16383 | this.readUnsignedByte() << 14;
-        if (!(a & 2097152)) {
-          return a;
-        }
-        a = a & 2097151 | this.readUnsignedByte() << 21;
-        return a & 268435456 ? a & 268435455 | this.readUnsignedByte() << 28 : a;
-      };
-      l.prototype.readBits = function(a) {
-        return this.readUnsignedBits(a) << 32 - a >> 32 - a;
-      };
-      l.prototype.readUnsignedBits = function(a) {
-        for (var b = this._bitBuffer, h = this._bitLength;a > h;) {
-          b = b << 8 | this.readUnsignedByte(), h += 8;
-        }
-        h -= a;
-        a = b >>> h & p[a];
-        this._bitBuffer = b;
-        this._bitLength = h;
-        return a;
-      };
-      l.prototype.readFixedBits = function(a) {
-        return this.readBits(a) / 65536;
-      };
-      l.prototype.readString = function(a) {
-        var n = this._position;
-        if (a) {
-          n + a > this._length && throwError("EOFError", Errors.EOFError), this._position += a;
+      n.prototype.readFloat16 = function() {
+        var d = this.readUnsignedShort(), e = d >> 15 ? -1 : 1, b = (d & 31744) >> 10, d = d & 1023;
+        return b ? 31 === b ? d ? NaN : Infinity * e : e * Math.pow(2, b - 15) * (1 + d / 1024) : d / 1024 * Math.pow(2, -14) * e;
+      };
+      n.prototype.readEncodedU32 = function() {
+        var d = this.readUnsignedByte();
+        if (!(d & 128)) {
+          return d;
+        }
+        d = d & 127 | this.readUnsignedByte() << 7;
+        if (!(d & 16384)) {
+          return d;
+        }
+        d = d & 16383 | this.readUnsignedByte() << 14;
+        if (!(d & 2097152)) {
+          return d;
+        }
+        d = d & 2097151 | this.readUnsignedByte() << 21;
+        return d & 268435456 ? d & 268435455 | this.readUnsignedByte() << 28 : d;
+      };
+      n.prototype.readBits = function(d) {
+        return this.readUnsignedBits(d) << 32 - d >> 32 - d;
+      };
+      n.prototype.readUnsignedBits = function(d) {
+        for (var e = this._bitBuffer, b = this._bitLength;d > b;) {
+          e = e << 8 | this.readUnsignedByte(), b += 8;
+        }
+        b -= d;
+        d = e >>> b & k[d];
+        this._bitBuffer = e;
+        this._bitLength = b;
+        return d;
+      };
+      n.prototype.readFixedBits = function(d) {
+        return this.readBits(d) / 65536;
+      };
+      n.prototype.readString = function(d) {
+        var e = this._position;
+        if (d) {
+          e + d > this._length && throwError("EOFError", Errors.EOFError), this._position += d;
         } else {
-          a = 0;
-          for (var h = n;h < this._length && this._u8[h];h++) {
-            a++;
-          }
-          this._position += a + 1;
-        }
-        return b(new Int8Array(this._buffer, n, a));
-      };
-      l.prototype.align = function() {
+          d = 0;
+          for (var b = e;b < this._length && this._u8[b];b++) {
+            d++;
+          }
+          this._position += d + 1;
+        }
+        return a(new Int8Array(this._buffer, e, d));
+      };
+      n.prototype.align = function() {
         this._bitLength = this._bitBuffer = 0;
       };
-      l.prototype._compress = function(a) {
-        a = c(a);
-        switch(a) {
+      n.prototype._compress = function(d) {
+        d = c(d);
+        switch(d) {
           case "zlib":
-            a = new m.Deflate(!0);
+            d = new r.Deflate(!0);
             break;
           case "deflate":
-            a = new m.Deflate(!1);
+            d = new r.Deflate(!1);
             break;
           default:
             return;
         }
-        var b = new l;
-        a.onData = b.writeRawBytes.bind(b);
-        a.push(this._u8.subarray(0, this._length));
-        a.finish();
-        this._ensureCapacity(b._u8.length);
-        this._u8.set(b._u8);
-        this.length = b.length;
+        var e = new n;
+        d.onData = e.writeRawBytes.bind(e);
+        d.push(this._u8.subarray(0, this._length));
+        d.close();
+        this._ensureCapacity(e._u8.length);
+        this._u8.set(e._u8);
+        this.length = e.length;
         this._position = 0;
       };
-      l.prototype._uncompress = function(a) {
-        a = c(a);
-        switch(a) {
+      n.prototype._uncompress = function(d) {
+        d = c(d);
+        switch(d) {
           case "zlib":
-            a = m.Inflate.create(!0);
+            d = r.Inflate.create(!0);
             break;
           case "deflate":
-            a = m.Inflate.create(!1);
+            d = r.Inflate.create(!1);
+            break;
+          case "lzma":
+            d = new r.LzmaDecoder(!1);
             break;
           default:
             return;
         }
-        var b = new l;
-        a.onData = b.writeRawBytes.bind(b);
-        a.push(this._u8.subarray(0, this._length));
-        a.error && throwError("IOError", Errors.CompressedDataError);
-        a.close();
-        this._ensureCapacity(b._u8.length);
-        this._u8.set(b._u8);
-        this.length = b.length;
+        var e = new n, b;
+        d.onData = e.writeRawBytes.bind(e);
+        d.onError = function(f) {
+          return b = f;
+        };
+        d.push(this._u8.subarray(0, this._length));
+        b && throwError("IOError", Errors.CompressedDataError);
+        d.close();
+        this._ensureCapacity(e._u8.length);
+        this._u8.set(e._u8);
+        this.length = e.length;
         this._position = 0;
       };
-      l._nativeLittleEndian = 1 === (new Int8Array((new Int32Array([1])).buffer))[0];
-      l.INITIAL_SIZE = 128;
-      l._arrayBufferPool = new g.ArrayBufferPool;
-      return l;
+      n._nativeLittleEndian = 1 === (new Int8Array((new Int32Array([1])).buffer))[0];
+      n.INITIAL_SIZE = 128;
+      n._arrayBufferPool = new l.ArrayBufferPool;
+      return n;
     }();
-    m.DataBuffer = y;
-  })(g.ArrayUtilities || (g.ArrayUtilities = {}));
+    r.DataBuffer = u;
+  })(l.ArrayUtilities || (l.ArrayUtilities = {}));
 })(Shumway || (Shumway = {}));
-(function(g) {
-  var m = g.ArrayUtilities.DataBuffer, e = g.ArrayUtilities.ensureTypedArrayCapacity, c = g.Debug.assert;
-  (function(b) {
-    b[b.BeginSolidFill = 1] = "BeginSolidFill";
-    b[b.BeginGradientFill = 2] = "BeginGradientFill";
-    b[b.BeginBitmapFill = 3] = "BeginBitmapFill";
-    b[b.EndFill = 4] = "EndFill";
-    b[b.LineStyleSolid = 5] = "LineStyleSolid";
-    b[b.LineStyleGradient = 6] = "LineStyleGradient";
-    b[b.LineStyleBitmap = 7] = "LineStyleBitmap";
-    b[b.LineEnd = 8] = "LineEnd";
-    b[b.MoveTo = 9] = "MoveTo";
-    b[b.LineTo = 10] = "LineTo";
-    b[b.CurveTo = 11] = "CurveTo";
-    b[b.CubicCurveTo = 12] = "CubicCurveTo";
-  })(g.PathCommand || (g.PathCommand = {}));
-  (function(b) {
-    b[b.Linear = 16] = "Linear";
-    b[b.Radial = 18] = "Radial";
-  })(g.GradientType || (g.GradientType = {}));
-  (function(b) {
-    b[b.Pad = 0] = "Pad";
-    b[b.Reflect = 1] = "Reflect";
-    b[b.Repeat = 2] = "Repeat";
-  })(g.GradientSpreadMethod || (g.GradientSpreadMethod = {}));
-  (function(b) {
-    b[b.RGB = 0] = "RGB";
-    b[b.LinearRGB = 1] = "LinearRGB";
-  })(g.GradientInterpolationMethod || (g.GradientInterpolationMethod = {}));
-  (function(b) {
-    b[b.None = 0] = "None";
-    b[b.Normal = 1] = "Normal";
-    b[b.Vertical = 2] = "Vertical";
-    b[b.Horizontal = 3] = "Horizontal";
-  })(g.LineScaleMode || (g.LineScaleMode = {}));
-  var w = function() {
-    return function(b, a, n, c, k, e, l, g, r, m, h) {
-      this.commands = b;
+(function(l) {
+  var r = l.ArrayUtilities.DataBuffer, g = l.ArrayUtilities.ensureTypedArrayCapacity;
+  (function(c) {
+    c[c.BeginSolidFill = 1] = "BeginSolidFill";
+    c[c.BeginGradientFill = 2] = "BeginGradientFill";
+    c[c.BeginBitmapFill = 3] = "BeginBitmapFill";
+    c[c.EndFill = 4] = "EndFill";
+    c[c.LineStyleSolid = 5] = "LineStyleSolid";
+    c[c.LineStyleGradient = 6] = "LineStyleGradient";
+    c[c.LineStyleBitmap = 7] = "LineStyleBitmap";
+    c[c.LineEnd = 8] = "LineEnd";
+    c[c.MoveTo = 9] = "MoveTo";
+    c[c.LineTo = 10] = "LineTo";
+    c[c.CurveTo = 11] = "CurveTo";
+    c[c.CubicCurveTo = 12] = "CubicCurveTo";
+  })(l.PathCommand || (l.PathCommand = {}));
+  (function(c) {
+    c[c.Linear = 16] = "Linear";
+    c[c.Radial = 18] = "Radial";
+  })(l.GradientType || (l.GradientType = {}));
+  (function(c) {
+    c[c.Pad = 0] = "Pad";
+    c[c.Reflect = 1] = "Reflect";
+    c[c.Repeat = 2] = "Repeat";
+  })(l.GradientSpreadMethod || (l.GradientSpreadMethod = {}));
+  (function(c) {
+    c[c.RGB = 0] = "RGB";
+    c[c.LinearRGB = 1] = "LinearRGB";
+  })(l.GradientInterpolationMethod || (l.GradientInterpolationMethod = {}));
+  (function(c) {
+    c[c.None = 0] = "None";
+    c[c.Normal = 1] = "Normal";
+    c[c.Vertical = 2] = "Vertical";
+    c[c.Horizontal = 3] = "Horizontal";
+  })(l.LineScaleMode || (l.LineScaleMode = {}));
+  var c = function() {
+    return function(c, a, h, p, k, u, n, s, g, d, e) {
+      this.commands = c;
       this.commandsPosition = a;
-      this.coordinates = n;
-      this.morphCoordinates = c;
+      this.coordinates = h;
+      this.morphCoordinates = p;
       this.coordinatesPosition = k;
-      this.styles = e;
-      this.stylesLength = l;
-      this.morphStyles = g;
-      this.morphStylesLength = r;
-      this.hasFills = m;
-      this.hasLines = h;
+      this.styles = u;
+      this.stylesLength = n;
+      this.morphStyles = s;
+      this.morphStylesLength = g;
+      this.hasFills = d;
+      this.hasLines = e;
     };
   }();
-  g.PlainObjectShapeData = w;
-  var k;
-  (function(b) {
-    b[b.Commands = 32] = "Commands";
-    b[b.Coordinates = 128] = "Coordinates";
-    b[b.Styles = 16] = "Styles";
-  })(k || (k = {}));
-  k = function() {
-    function b(a) {
+  l.PlainObjectShapeData = c;
+  var t;
+  (function(c) {
+    c[c.Commands = 32] = "Commands";
+    c[c.Coordinates = 128] = "Coordinates";
+    c[c.Styles = 16] = "Styles";
+  })(t || (t = {}));
+  t = function() {
+    function m(a) {
       void 0 === a && (a = !0);
       a && this.clear();
     }
-    b.FromPlainObject = function(a) {
-      var n = new b(!1);
-      n.commands = a.commands;
-      n.coordinates = a.coordinates;
-      n.morphCoordinates = a.morphCoordinates;
-      n.commandsPosition = a.commandsPosition;
-      n.coordinatesPosition = a.coordinatesPosition;
-      n.styles = m.FromArrayBuffer(a.styles, a.stylesLength);
-      n.styles.endian = "auto";
-      a.morphStyles && (n.morphStyles = m.FromArrayBuffer(a.morphStyles, a.morphStylesLength), n.morphStyles.endian = "auto");
-      n.hasFills = a.hasFills;
-      n.hasLines = a.hasLines;
-      return n;
-    };
-    b.prototype.moveTo = function(a, b) {
+    m.FromPlainObject = function(a) {
+      var h = new m(!1);
+      h.commands = a.commands;
+      h.coordinates = a.coordinates;
+      h.morphCoordinates = a.morphCoordinates;
+      h.commandsPosition = a.commandsPosition;
+      h.coordinatesPosition = a.coordinatesPosition;
+      h.styles = r.FromArrayBuffer(a.styles, a.stylesLength);
+      h.styles.endian = "auto";
+      a.morphStyles && (h.morphStyles = r.FromArrayBuffer(a.morphStyles, a.morphStylesLength), h.morphStyles.endian = "auto");
+      h.hasFills = a.hasFills;
+      h.hasLines = a.hasLines;
+      return h;
+    };
+    m.prototype.moveTo = function(a, h) {
       this.ensurePathCapacities(1, 2);
       this.commands[this.commandsPosition++] = 9;
       this.coordinates[this.coordinatesPosition++] = a;
-      this.coordinates[this.coordinatesPosition++] = b;
-    };
-    b.prototype.lineTo = function(a, b) {
+      this.coordinates[this.coordinatesPosition++] = h;
+    };
+    m.prototype.lineTo = function(a, h) {
       this.ensurePathCapacities(1, 2);
       this.commands[this.commandsPosition++] = 10;
       this.coordinates[this.coordinatesPosition++] = a;
-      this.coordinates[this.coordinatesPosition++] = b;
-    };
-    b.prototype.curveTo = function(a, b, c, k) {
+      this.coordinates[this.coordinatesPosition++] = h;
+    };
+    m.prototype.curveTo = function(a, h, c, k) {
       this.ensurePathCapacities(1, 4);
       this.commands[this.commandsPosition++] = 11;
       this.coordinates[this.coordinatesPosition++] = a;
-      this.coordinates[this.coordinatesPosition++] = b;
+      this.coordinates[this.coordinatesPosition++] = h;
       this.coordinates[this.coordinatesPosition++] = c;
       this.coordinates[this.coordinatesPosition++] = k;
     };
-    b.prototype.cubicCurveTo = function(a, b, c, k, e, l) {
+    m.prototype.cubicCurveTo = function(a, h, c, k, m, n) {
       this.ensurePathCapacities(1, 6);
       this.commands[this.commandsPosition++] = 12;
       this.coordinates[this.coordinatesPosition++] = a;
-      this.coordinates[this.coordinatesPosition++] = b;
+      this.coordinates[this.coordinatesPosition++] = h;
       this.coordinates[this.coordinatesPosition++] = c;
       this.coordinates[this.coordinatesPosition++] = k;
-      this.coordinates[this.coordinatesPosition++] = e;
-      this.coordinates[this.coordinatesPosition++] = l;
-    };
-    b.prototype.beginFill = function(a) {
+      this.coordinates[this.coordinatesPosition++] = m;
+      this.coordinates[this.coordinatesPosition++] = n;
+    };
+    m.prototype.beginFill = function(a) {
       this.ensurePathCapacities(1, 0);
       this.commands[this.commandsPosition++] = 1;
       this.styles.writeUnsignedInt(a);
       this.hasFills = !0;
     };
-    b.prototype.writeMorphFill = function(a) {
+    m.prototype.writeMorphFill = function(a) {
       this.morphStyles.writeUnsignedInt(a);
     };
-    b.prototype.endFill = function() {
+    m.prototype.endFill = function() {
       this.ensurePathCapacities(1, 0);
       this.commands[this.commandsPosition++] = 4;
     };
-    b.prototype.endLine = function() {
+    m.prototype.endLine = function() {
       this.ensurePathCapacities(1, 0);
       this.commands[this.commandsPosition++] = 8;
     };
-    b.prototype.lineStyle = function(a, b, p, k, e, l, g) {
-      c(a === (a | 0), 0 <= a && 5100 >= a);
+    m.prototype.lineStyle = function(a, h, c, k, m, n, s) {
       this.ensurePathCapacities(2, 0);
       this.commands[this.commandsPosition++] = 5;
       this.coordinates[this.coordinatesPosition++] = a;
       a = this.styles;
-      a.writeUnsignedInt(b);
-      a.writeBoolean(p);
+      a.writeUnsignedInt(h);
+      a.writeBoolean(c);
       a.writeUnsignedByte(k);
-      a.writeUnsignedByte(e);
-      a.writeUnsignedByte(l);
-      a.writeUnsignedByte(g);
+      a.writeUnsignedByte(m);
+      a.writeUnsignedByte(n);
+      a.writeUnsignedByte(s);
       this.hasLines = !0;
     };
-    b.prototype.writeMorphLineStyle = function(a, b) {
+    m.prototype.writeMorphLineStyle = function(a, h) {
       this.morphCoordinates[this.coordinatesPosition - 1] = a;
-      this.morphStyles.writeUnsignedInt(b);
-    };
-    b.prototype.beginBitmap = function(a, b, p, k, e) {
-      c(3 === a || 7 === a);
+      this.morphStyles.writeUnsignedInt(h);
+    };
+    m.prototype.beginBitmap = function(a, h, c, k, m) {
       this.ensurePathCapacities(1, 0);
       this.commands[this.commandsPosition++] = a;
       a = this.styles;
-      a.writeUnsignedInt(b);
-      this._writeStyleMatrix(p, !1);
+      a.writeUnsignedInt(h);
+      this._writeStyleMatrix(c, !1);
       a.writeBoolean(k);
-      a.writeBoolean(e);
+      a.writeBoolean(m);
       this.hasFills = !0;
     };
-    b.prototype.writeMorphBitmap = function(a) {
+    m.prototype.writeMorphBitmap = function(a) {
       this._writeStyleMatrix(a, !0);
     };
-    b.prototype.beginGradient = function(a, b, p, k, e, l, g, r) {
-      c(2 === a || 6 === a);
+    m.prototype.beginGradient = function(a, h, c, k, m, n, s, g) {
       this.ensurePathCapacities(1, 0);
       this.commands[this.commandsPosition++] = a;
       a = this.styles;
       a.writeUnsignedByte(k);
-      c(r === (r | 0));
-      a.writeShort(r);
-      this._writeStyleMatrix(e, !1);
-      k = b.length;
+      a.writeShort(g);
+      this._writeStyleMatrix(m, !1);
+      k = h.length;
       a.writeByte(k);
-      for (e = 0;e < k;e++) {
-        a.writeUnsignedByte(p[e]), a.writeUnsignedInt(b[e]);
-      }
-      a.writeUnsignedByte(l);
-      a.writeUnsignedByte(g);
+      for (m = 0;m < k;m++) {
+        a.writeUnsignedByte(c[m]), a.writeUnsignedInt(h[m]);
+      }
+      a.writeUnsignedByte(n);
+      a.writeUnsignedByte(s);
       this.hasFills = !0;
     };
-    b.prototype.writeMorphGradient = function(a, b, c) {
+    m.prototype.writeMorphGradient = function(a, h, c) {
       this._writeStyleMatrix(c, !0);
       c = this.morphStyles;
       for (var k = 0;k < a.length;k++) {
-        c.writeUnsignedByte(b[k]), c.writeUnsignedInt(a[k]);
-      }
-    };
-    b.prototype.writeCommandAndCoordinates = function(a, b, c) {
+        c.writeUnsignedByte(h[k]), c.writeUnsignedInt(a[k]);
+      }
+    };
+    m.prototype.writeCommandAndCoordinates = function(a, h, c) {
       this.ensurePathCapacities(1, 2);
       this.commands[this.commandsPosition++] = a;
-      this.coordinates[this.coordinatesPosition++] = b;
+      this.coordinates[this.coordinatesPosition++] = h;
       this.coordinates[this.coordinatesPosition++] = c;
     };
-    b.prototype.writeCoordinates = function(a, b) {
+    m.prototype.writeCoordinates = function(a, h) {
       this.ensurePathCapacities(0, 2);
       this.coordinates[this.coordinatesPosition++] = a;
-      this.coordinates[this.coordinatesPosition++] = b;
-    };
-    b.prototype.writeMorphCoordinates = function(a, b) {
-      this.morphCoordinates = e(this.morphCoordinates, this.coordinatesPosition);
+      this.coordinates[this.coordinatesPosition++] = h;
+    };
+    m.prototype.writeMorphCoordinates = function(a, h) {
+      this.morphCoordinates = g(this.morphCoordinates, this.coordinatesPosition);
       this.morphCoordinates[this.coordinatesPosition - 2] = a;
-      this.morphCoordinates[this.coordinatesPosition - 1] = b;
-    };
-    b.prototype.clear = function() {
+      this.morphCoordinates[this.coordinatesPosition - 1] = h;
+    };
+    m.prototype.clear = function() {
       this.commandsPosition = this.coordinatesPosition = 0;
       this.commands = new Uint8Array(32);
       this.coordinates = new Int32Array(128);
-      this.styles = new m(16);
+      this.styles = new r(16);
       this.styles.endian = "auto";
       this.hasFills = this.hasLines = !1;
     };
-    b.prototype.isEmpty = function() {
+    m.prototype.isEmpty = function() {
       return 0 === this.commandsPosition;
     };
-    b.prototype.clone = function() {
-      var a = new b(!1);
+    m.prototype.clone = function() {
+      var a = new m(!1);
       a.commands = new Uint8Array(this.commands);
       a.commandsPosition = this.commandsPosition;
       a.coordinates = new Int32Array(this.coordinates);
       a.coordinatesPosition = this.coordinatesPosition;
-      a.styles = new m(this.styles.length);
+      a.styles = new r(this.styles.length);
       a.styles.writeRawBytes(this.styles.bytes);
-      this.morphStyles && (a.morphStyles = new m(this.morphStyles.length), a.morphStyles.writeRawBytes(this.morphStyles.bytes));
+      this.morphStyles && (a.morphStyles = new r(this.morphStyles.length), a.morphStyles.writeRawBytes(this.morphStyles.bytes));
       a.hasFills = this.hasFills;
       a.hasLines = this.hasLines;
       re